diff --git a/.gitignore b/.gitignore
index e854dce..131a03f 100644
--- a/.gitignore
+++ b/.gitignore
@@ -9,21 +9,14 @@ experts.dat
 /Logs
 
 /Include/Experts/
-/Include/Arrays/
-/Include/Canvas/
-/Include/ChartObjects/
-/Include/Charts/
 /Include/Generic/
-/Include/Controls/
 /Include/Expert/
-/Include/Files/
 /Include/Graphics/
 /Include/Indicators/
 /Include/Math/
 /Include/MovingAverages.mqh
 /Include/OpenCL/
 /Include/Strings/
-/Include/Tools/
 /Include/VirtualKeys.mqh
 /Scripts/
 
diff --git a/Include/Arrays/Array.mqh b/Include/Arrays/Array.mqh
new file mode 100644
index 0000000..b78f528
--- /dev/null
+++ b/Include/Arrays/Array.mqh
@@ -0,0 +1,182 @@
+//+------------------------------------------------------------------+
+//|                                                        Array.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Object.mqh>
+//+------------------------------------------------------------------+
+//| Class CArray                                                     |
+//| Purpose: Base class of dynamic arrays.                           |
+//|          Derives from class CObject.                             |
+//+------------------------------------------------------------------+
+class CArray : public CObject
+  {
+protected:
+   int               m_step_resize;      // increment size of the array
+   int               m_data_total;       // number of elements
+   int               m_data_max;         // maximmum size of the array without memory reallocation
+   int               m_sort_mode;        // mode of array sorting
+
+public:
+                     CArray(void);
+                    ~CArray(void);
+   //--- methods of access to protected data
+   int               Step(void) const { return(m_step_resize); }
+   bool              Step(const int step);
+   int               Total(void) const { return(m_data_total); }
+   int               Available(void) const { return(m_data_max-m_data_total); }
+   int               Max(void) const { return(m_data_max); }
+   bool              IsSorted(const int mode=0) const { return(m_sort_mode==mode); }
+   int               SortMode(void) const { return(m_sort_mode); }
+   //--- cleaning method
+   void              Clear(void) { m_data_total=0; }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- sorting method
+   void              Sort(const int mode=0);
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0) { m_sort_mode=-1; }
+   //--- templates for methods of searching for minimum and maximum
+   template<typename T>
+   int               Minimum(const T &data[],const int start,const int count) const;
+   template<typename T>
+   int               Maximum(const T &data[],const int start,const int count) const;
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArray::CArray(void) : m_step_resize(16),
+                       m_data_total(0),
+                       m_data_max(0),
+                       m_sort_mode(-1)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArray::~CArray(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Method Set for variable m_step_resize                            |
+//+------------------------------------------------------------------+
+bool CArray::Step(const int step)
+  {
+//--- check
+   if(step>0)
+     {
+      m_step_resize=step;
+      return(true);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Sorting an array in ascending order                              |
+//+------------------------------------------------------------------+
+void CArray::Sort(const int mode)
+  {
+//--- check
+   if(IsSorted(mode))
+      return;
+   m_sort_mode=mode;
+   if(m_data_total<=1)
+      return;
+//--- sort
+   QuickSort(0,m_data_total-1,mode);
+  }
+//+------------------------------------------------------------------+
+//| Writing header of array to file                                  |
+//+------------------------------------------------------------------+
+bool CArray::Save(const int file_handle)
+  {
+//--- check handle
+   if(file_handle!=INVALID_HANDLE)
+     {
+      //--- write start marker - 0xFFFFFFFFFFFFFFFF
+      if(FileWriteLong(file_handle,-1)==sizeof(long))
+        {
+         //--- write array type
+         if(FileWriteInteger(file_handle,Type(),INT_VALUE)==INT_VALUE)
+            return(true);
+        }
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Reading header of array from file                                |
+//+------------------------------------------------------------------+
+bool CArray::Load(const int file_handle)
+  {
+//--- check handle
+   if(file_handle!=INVALID_HANDLE)
+     {
+      //--- read and check start marker - 0xFFFFFFFFFFFFFFFF
+      if(FileReadLong(file_handle)==-1)
+        {
+         //--- read and check array type
+         if(FileReadInteger(file_handle,INT_VALUE)==Type())
+            return(true);
+        }
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Find minimum of array                                            |
+//+------------------------------------------------------------------+
+template<typename T>
+int CArray::Minimum(const T &data[],const int start,const int count) const
+  {
+   int real_count;
+//--- check for empty array
+   if(m_data_total<1)
+     {
+      SetUserError(ERR_USER_ARRAY_IS_EMPTY);
+      return(-1);
+     }
+   //--- check for start is out of range
+   if(start<0 || start>=m_data_total)
+     {
+      SetUserError(ERR_USER_ITEM_NOT_FOUND);
+      return(-1);
+     }
+//--- compute count of elements
+   real_count=(count==WHOLE_ARRAY || start+count>m_data_total) ? m_data_total-start : count;
+#ifdef __MQL5__
+   return(ArrayMinimum(data,start,real_count));
+#else
+   return(ArrayMinimum(data,real_count,start));
+#endif
+  }
+//+------------------------------------------------------------------+
+//| Find maximum of array                                            |
+//+------------------------------------------------------------------+
+template<typename T>
+int CArray::Maximum(const T &data[],const int start,const int count) const
+  {
+   int real_count;
+//--- check for empty array
+   if(m_data_total<1)
+     {
+      SetUserError(ERR_USER_ARRAY_IS_EMPTY);
+      return(-1);
+     }
+   //--- check for start is out of range
+   if(start<0 || start>=m_data_total)
+     {
+      SetUserError(ERR_USER_ITEM_NOT_FOUND);
+      return(-1);
+     }
+//--- compute count of elements
+   real_count=(count==WHOLE_ARRAY || start+count>m_data_total) ? m_data_total-start : count;
+#ifdef __MQL5__
+   return(ArrayMaximum(data,start,real_count));
+#else
+   return(ArrayMaximum(data,real_count,start));
+#endif
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayChar.mqh b/Include/Arrays/ArrayChar.mqh
new file mode 100644
index 0000000..73bc39e
--- /dev/null
+++ b/Include/Arrays/ArrayChar.mqh
@@ -0,0 +1,771 @@
+//+------------------------------------------------------------------+
+//|                                                    ArrayChar.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayChar.                                                |
+//| Purpose: Class of dynamic array of variables                     |
+//|          of char or uchar type.                                  |
+//|          Derives from class CArray.                              |
+//+------------------------------------------------------------------+
+class CArrayChar : public CArray
+  {
+protected:
+   char              m_data[];           // data array
+
+public:
+                     CArrayChar(void);
+                    ~CArrayChar(void);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_CHAR); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const char element);
+   bool              AddArray(const char &src[]);
+   bool              AddArray(const CArrayChar *src);
+   bool              Insert(const char element,const int pos);
+   bool              InsertArray(const char &src[],const int pos);
+   bool              InsertArray(const CArrayChar *src,const int pos);
+   bool              AssignArray(const char &src[]);
+   bool              AssignArray(const CArrayChar *src);
+   //--- method of access to the array
+   char              At(const int index) const;
+   char operator[](const int index) const { return(At(index)); }
+   //--- methods of searching for minimum and maximum
+   int               Minimum(const int start,const int count) const { return(Minimum(m_data,start,count)); }
+   int               Maximum(const int start,const int count) const { return(Maximum(m_data,start,count)); }
+   //--- methods of changing
+   bool              Update(const int index,const char element);
+   bool              Shift(const int index,const int shift);
+   //--- methods of deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for comparing arrays
+   bool              CompareArray(const char &array[]) const;
+   bool              CompareArray(const CArrayChar *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(const char element);
+   int               Search(const char element) const;
+   int               SearchGreat(const char element) const;
+   int               SearchLess(const char element) const;
+   int               SearchGreatOrEqual(const char element) const;
+   int               SearchLessOrEqual(const char element) const;
+   int               SearchFirst(const char element) const;
+   int               SearchLast(const char element) const;
+   int               SearchLinear(const char element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const char element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayChar::CArrayChar(void)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayChar::~CArrayChar(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayChar::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayChar::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayChar::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayChar::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayChar::Add(const char element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayChar::AddArray(const char &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayChar::AddArray(const CArrayChar *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayChar::Insert(const char element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayChar::InsertArray(const char &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayChar::InsertArray(const CArrayChar *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayChar::AssignArray(const char &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayChar::AssignArray(const CArrayChar *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+char CArrayChar::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(CHAR_MAX);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayChar::Update(const int index,const char element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayChar::Shift(const int index,const int shift)
+  {
+   char tmp_char;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_char=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_char;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayChar::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayChar::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayChar::CompareArray(const char &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayChar::CompareArray(const CArrayChar *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayChar::QuickSort(int beg,int end,const int mode)
+  {
+   int   i,j;
+   char  p_char;
+   char  t_char;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_char=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_char)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_char)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_char=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_char;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayChar::InsertSort(const char element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- find position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchLinear(const char element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]==element)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayChar::QuickSearch(const char element) const
+  {
+   int   i,j,m=-1;
+   char  t_char;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_char=m_data[m];
+      if(t_char==element)
+         break;
+      if(t_char>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayChar::Search(const char element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchGreat(const char element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]<=element)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchLess(const char element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]>=element)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchGreatOrEqual(const char element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchLessOrEqual(const char element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchFirst(const char element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayChar::SearchLast(const char element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayChar::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(FileWriteInteger(file_handle,m_data[i],CHAR_VALUE)!=CHAR_VALUE)
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayChar::Load(const int file_handle)
+  {
+   int i,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         m_data[i]=(char)FileReadInteger(file_handle,CHAR_VALUE);
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayDouble.mqh b/Include/Arrays/ArrayDouble.mqh
new file mode 100644
index 0000000..d9a7340
--- /dev/null
+++ b/Include/Arrays/ArrayDouble.mqh
@@ -0,0 +1,777 @@
+//+------------------------------------------------------------------+
+//|                                                  ArrayDouble.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayDouble.                                              |
+//| Puprpose: Class of dynamic array variables of double type.       |
+//|           Derives from class CArray.                             |
+//+------------------------------------------------------------------+
+class CArrayDouble : public CArray
+  {
+protected:
+   double            m_data[];           // data array
+   double            m_delta;            // search tolerance
+
+public:
+                     CArrayDouble(void);
+                    ~CArrayDouble(void);
+   //--- methods of access to protected data
+   void              Delta(const double delta) { m_delta=MathAbs(delta); }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_DOUBLE); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const double element);
+   bool              AddArray(const double &src[]);
+   bool              AddArray(const CArrayDouble *src);
+   bool              Insert(const double element,const int pos);
+   bool              InsertArray(const double &src[],const int pos);
+   bool              InsertArray(const CArrayDouble *src,const int pos);
+   bool              AssignArray(const double &src[]);
+   bool              AssignArray(const CArrayDouble *src);
+   //--- method of access to the array
+   double            At(const int index) const;
+   double operator[](const int index) const { return(At(index)); }
+   //--- methods of searching for minimum and maximum
+   int               Minimum(const int start,const int count) const { return(Minimum(m_data,start,count)); }
+   int               Maximum(const int start,const int count) const { return(Maximum(m_data,start,count)); }
+   //--- methods of changing
+   bool              Update(const int index,const double element);
+   bool              Shift(const int index,const int shift);
+   //--- methods of deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for comparing arrays
+   bool              CompareArray(const double &array[]) const;
+   bool              CompareArray(const CArrayDouble *array) const;
+   //--- methods for working with a sorted array
+   bool              InsertSort(const double element);
+   int               Search(const double element) const;
+   int               SearchGreat(const double element) const;
+   int               SearchLess(const double element) const;
+   int               SearchGreatOrEqual(const double element) const;
+   int               SearchLessOrEqual(const double element) const;
+   int               SearchFirst(const double element) const;
+   int               SearchLast(const double element) const;
+   int               SearchLinear(const double element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const double element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayDouble::CArrayDouble(void) : m_delta(0.0)
+  {
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayDouble::~CArrayDouble(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayDouble::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Add(const double element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayDouble::AddArray(const double &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayDouble::AddArray(const CArrayDouble *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Insert(const double element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayDouble::InsertArray(const double &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayDouble::InsertArray(const CArrayDouble *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayDouble::AssignArray(const double &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayDouble::AssignArray(const CArrayDouble *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+double CArrayDouble::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(DBL_MAX);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Update(const int index,const double element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Shift(const int index,const int shift)
+  {
+   double tmp_double;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_double=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_double;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayDouble::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayDouble::CompareArray(const double &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayDouble::CompareArray(const CArrayDouble *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayDouble::QuickSort(int beg,int end,const int mode)
+  {
+   int    i,j;
+   double p_double,t_double;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_double=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_double)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_double)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_double=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_double;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayDouble::InsertSort(const double element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- search position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchLinear(const double element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(MathAbs(m_data[i]-element)<=m_delta)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayDouble::QuickSearch(const double element) const
+  {
+   int    i,j,m=-1;
+   double t_double;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_double=m_data[m];
+      //--- compare with delta
+      if(MathAbs(t_double-element)<=m_delta)
+         break;
+      if(t_double>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayDouble::Search(const double element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+//--- compare with delta
+   if(MathAbs(m_data[pos]-element)<=m_delta)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchGreat(const double element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+//--- compare with delta
+   while(m_data[pos]<=element+m_delta)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchLess(const double element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+//--- compare with delta
+   while(m_data[pos]>=element-m_delta)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchGreatOrEqual(const double element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchLessOrEqual(const double element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchFirst(const double element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      //--- compare with delta
+      while(MathAbs(m_data[pos]-element)<=m_delta)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayDouble::SearchLast(const double element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      //--- compare with delta
+      while(MathAbs(m_data[pos]-element)<=m_delta)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(FileWriteDouble(file_handle,m_data[i])!=sizeof(double))
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayDouble::Load(const int file_handle)
+  {
+   int i=0,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         m_data[i]=FileReadDouble(file_handle);
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayFloat.mqh b/Include/Arrays/ArrayFloat.mqh
new file mode 100644
index 0000000..63f1a27
--- /dev/null
+++ b/Include/Arrays/ArrayFloat.mqh
@@ -0,0 +1,778 @@
+//+------------------------------------------------------------------+
+//|                                                   ArrayFloat.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayFloat.                                               |
+//| Purpose: Class of dynamic array of variable                      |
+//|          of float type.                                          |
+//|          Derives from class CArray.                              |
+//+------------------------------------------------------------------+
+class CArrayFloat : public CArray
+  {
+protected:
+   float             m_data[];           // data array
+   float             m_delta;            // search tolerance
+
+public:
+                     CArrayFloat(void);
+                    ~CArrayFloat(void);
+   //--- methods of access to protected data
+   void              Delta(const float delta) { m_delta=(float)MathAbs(delta); }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_FLOAT); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const float element);
+   bool              AddArray(const float &src[]);
+   bool              AddArray(const CArrayFloat *src);
+   bool              Insert(const float element,const int pos);
+   bool              InsertArray(const float &src[],const int pos);
+   bool              InsertArray(const CArrayFloat *src,const int pos);
+   bool              AssignArray(const float &src[]);
+   bool              AssignArray(const CArrayFloat *src);
+   //--- method of access to the array
+   float             At(const int index) const;
+   float operator[](const int index) const { return(At(index)); }
+   //--- methods of searching for minimum and maximum
+   int               Minimum(const int start,const int count) const { return(Minimum(m_data,start,count)); }
+   int               Maximum(const int start,const int count) const { return(Maximum(m_data,start,count)); }
+   //--- methods of changing
+   bool              Update(const int index,const float element);
+   bool              Shift(const int index,const int shift);
+   //--- methods deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for comparing arrays
+   bool              CompareArray(const float &array[]) const;
+   bool              CompareArray(const CArrayFloat *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(const float element);
+   int               Search(const float element) const;
+   int               SearchGreat(const float element) const;
+   int               SearchLess(const float element) const;
+   int               SearchGreatOrEqual(const float element) const;
+   int               SearchLessOrEqual(const float element) const;
+   int               SearchFirst(const float element) const;
+   int               SearchLast(const float element) const;
+   int               SearchLinear(const float element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const float element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayFloat::CArrayFloat(void) : m_delta(0.0)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayFloat::~CArrayFloat(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayFloat::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Add(const float element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayFloat::AddArray(const float &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayFloat::AddArray(const CArrayFloat *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Insert(const float element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayFloat::InsertArray(const float &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayFloat::InsertArray(const CArrayFloat *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayFloat::AssignArray(const float &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayFloat::AssignArray(const CArrayFloat *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+float CArrayFloat::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(FLT_MAX);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Update(const int index,const float element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Shift(const int index,const int shift)
+  {
+   float tmp_float;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_float=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_float;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayFloat::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayFloat::CompareArray(const float &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayFloat::CompareArray(const CArrayFloat *array) const
+  {
+//--- check
+   if(!CheckPointer(array)) return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayFloat::QuickSort(int beg,int end,const int mode)
+  {
+   int   i,j;
+   float p_float,t_float;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_float=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_float)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_float)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_float=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_float;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayFloat::InsertSort(const float element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- search position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchLinear(const float element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(MathAbs(m_data[i]-element)<=m_delta)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayFloat::QuickSearch(const float element) const
+  {
+   int   i,j,m=-1;
+   float t_float;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_float=m_data[m];
+      //--- compare with delta
+      if(MathAbs(t_float-element)<=m_delta)
+         break;
+      if(t_float>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayFloat::Search(const float element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+//--- compare with delta
+   if(MathAbs(m_data[pos]-element)<=m_delta)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchGreat(const float element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+//--- compare with delta
+   while(m_data[pos]<=element+m_delta)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchLess(const float element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+//--- compare with delta
+   while(m_data[pos]>=element-m_delta)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchGreatOrEqual(const float element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchLessOrEqual(const float element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchFirst(const float element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      //--- compare with delta
+      while(MathAbs(m_data[pos]-element)<=m_delta)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayFloat::SearchLast(const float element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      //--- compare with delta
+      while(MathAbs(m_data[pos]-element)<=m_delta)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(FileWriteFloat(file_handle,m_data[i])!=sizeof(float))
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayFloat::Load(const int file_handle)
+  {
+   int i=0,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         m_data[i]=FileReadFloat(file_handle);
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayInt.mqh b/Include/Arrays/ArrayInt.mqh
new file mode 100644
index 0000000..2e32853
--- /dev/null
+++ b/Include/Arrays/ArrayInt.mqh
@@ -0,0 +1,770 @@
+//+------------------------------------------------------------------+
+//|                                                     ArrayInt.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayInt.                                                 |
+//| Puprose: Class of dynamic array of variables                     |
+//|          of int or uint type.                                    |
+//|          Derives from class CArray.                              |
+//+------------------------------------------------------------------+
+class CArrayInt : public CArray
+  {
+protected:
+   int               m_data[];           // data array
+
+public:
+                     CArrayInt(void);
+                    ~CArrayInt(void);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_INT); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const int element);
+   bool              AddArray(const int &src[]);
+   bool              AddArray(const CArrayInt *src);
+   bool              Insert(const int element,const int pos);
+   bool              InsertArray(const int &src[],const int pos);
+   bool              InsertArray(const CArrayInt *src,const int pos);
+   bool              AssignArray(const int &src[]);
+   bool              AssignArray(const CArrayInt *src);
+   //--- method of access to the array
+   int               At(const int index) const;
+   int operator[](const int index) const { return(At(index)); }
+   //--- methods of searching for minimum and maximum
+   int               Minimum(const int start,const int count) const { return(Minimum(m_data,start,count)); }
+   int               Maximum(const int start,const int count) const { return(Maximum(m_data,start,count)); }
+   //--- methods of changing
+   bool              Update(const int index,const int element);
+   bool              Shift(const int index,const int shift);
+   //--- methods of deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for comparing arrays
+   bool              CompareArray(const int &array[]) const;
+   bool              CompareArray(const CArrayInt *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(const int element);
+   int               Search(const int element) const;
+   int               SearchGreat(const int element) const;
+   int               SearchLess(const int element) const;
+   int               SearchGreatOrEqual(const int element) const;
+   int               SearchLessOrEqual(const int element) const;
+   int               SearchFirst(const int element) const;
+   int               SearchLast(const int element) const;
+   int               SearchLinear(const int element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const int element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayInt::CArrayInt(void)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayInt::~CArrayInt(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayInt::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayInt::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayInt::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayInt::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayInt::Add(const int element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayInt::AddArray(const int &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayInt::AddArray(const CArrayInt *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayInt::Insert(const int element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayInt::InsertArray(const int &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayInt::InsertArray(const CArrayInt *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayInt::AssignArray(const int &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayInt::AssignArray(const CArrayInt *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+int CArrayInt::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(INT_MAX);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayInt::Update(const int index,const int element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayInt::Shift(const int index,const int shift)
+  {
+   int tmp_int;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_int=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_int;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayInt::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayInt::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayInt::CompareArray(const int &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayInt::CompareArray(const CArrayInt *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayInt::QuickSort(int beg,int end,const int mode)
+  {
+   int  i,j;
+   int  p_int,t_int;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_int=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_int)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_int)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_int=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_int;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayInt::InsertSort(const int element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- find position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchLinear(const int element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]==element)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayInt::QuickSearch(const int element) const
+  {
+   int  i,j,m=-1;
+   int  t_int;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_int=m_data[m];
+      if(t_int==element)
+         break;
+      if(t_int>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayInt::Search(const int element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchGreat(const int element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]<=element)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchLess(const int element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]>=element)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchGreatOrEqual(const int element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchLessOrEqual(const int element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchFirst(const int element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayInt::SearchLast(const int element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayInt::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(FileWriteInteger(file_handle,m_data[i],INT_VALUE)!=INT_VALUE)
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayInt::Load(const int file_handle)
+  {
+   int i=0,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         m_data[i]=FileReadInteger(file_handle,INT_VALUE);
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayLong.mqh b/Include/Arrays/ArrayLong.mqh
new file mode 100644
index 0000000..3090ad9
--- /dev/null
+++ b/Include/Arrays/ArrayLong.mqh
@@ -0,0 +1,770 @@
+//+------------------------------------------------------------------+
+//|                                                    ArrayLong.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayLong.                                                |
+//| Purpose: Class of dynamic array of variables                     |
+//|          of long or ulong type.                                  |
+//|          Derives from class CArray.                              |
+//+------------------------------------------------------------------+
+class CArrayLong : public CArray
+  {
+protected:
+   long              m_data[];           // data array
+
+public:
+                     CArrayLong(void);
+                    ~CArrayLong(void);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_LONG); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const long element);
+   bool              AddArray(const long &src[]);
+   bool              AddArray(const CArrayLong *src);
+   bool              Insert(const long element,const int pos);
+   bool              InsertArray(const long &src[],const int pos);
+   bool              InsertArray(const CArrayLong *src,const int pos);
+   bool              AssignArray(const long &src[]);
+   bool              AssignArray(const CArrayLong *src);
+   //--- method of access to the array
+   long              At(const int index) const;
+   long operator[](const int index) const { return(At(index)); }
+   //--- methods of searching for minimum and maximum
+   int               Minimum(const int start,const int count) const { return(Minimum(m_data,start,count)); }
+   int               Maximum(const int start,const int count) const { return(Maximum(m_data,start,count)); }
+   //--- methods change
+   bool              Update(const int index,const long element);
+   bool              Shift(const int index,const int shift);
+   //--- methods for deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for compare arrays
+   bool              CompareArray(const long &array[]) const;
+   bool              CompareArray(const CArrayLong *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(const long element);
+   int               Search(const long element) const;
+   int               SearchGreat(const long element) const;
+   int               SearchLess(const long element) const;
+   int               SearchGreatOrEqual(const long element) const;
+   int               SearchLessOrEqual(const long element) const;
+   int               SearchFirst(const long element) const;
+   int               SearchLast(const long element) const;
+   int               SearchLinear(const long element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const long element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayLong::CArrayLong(void)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayLong::~CArrayLong(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayLong::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayLong::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayLong::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayLong::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayLong::Add(const long element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayLong::AddArray(const long &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayLong::AddArray(const CArrayLong *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayLong::Insert(const long element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayLong::InsertArray(const long &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayLong::InsertArray(const CArrayLong *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayLong::AssignArray(const long &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayLong::AssignArray(const CArrayLong *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+long CArrayLong::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(LONG_MAX);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayLong::Update(const int index,const long element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayLong::Shift(const int index,const int shift)
+  {
+   long tmp_long;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_long=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_long;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayLong::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayLong::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayLong::CompareArray(const long &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayLong::CompareArray(const CArrayLong *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayLong::QuickSort(int beg,int end,const int mode)
+  {
+   int i,j;
+   long p_long,t_long;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_long=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_long)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_long)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_long=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_long;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayLong::InsertSort(const long element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- search position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchLinear(const long element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]==element)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayLong::QuickSearch(const long element) const
+  {
+   int  i,j,m=-1;
+   long t_long;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_long=m_data[m];
+      if(t_long==element)
+         break;
+      if(t_long>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayLong::Search(const long element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchGreat(const long element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]<=element)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchLess(const long element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]>=element)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchGreatOrEqual(const long element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchLessOrEqual(const long element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchFirst(const long element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayLong::SearchLast(const long element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayLong::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(FileWriteLong(file_handle,m_data[i])!=sizeof(long))
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayLong::Load(const int file_handle)
+  {
+   int i=0,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         m_data[i]=FileReadLong(file_handle);
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayObj.mqh b/Include/Arrays/ArrayObj.mqh
new file mode 100644
index 0000000..6bb79ce
--- /dev/null
+++ b/Include/Arrays/ArrayObj.mqh
@@ -0,0 +1,759 @@
+//+------------------------------------------------------------------+
+//|                                                     ArrayObj.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayObj.                                                 |
+//| Puprose: Class of dynamic array of pointers to instances         |
+//|          of the CObject class and its derivatives.               |
+//|          Derives from class CArray.                              |
+//+------------------------------------------------------------------+
+class CArrayObj : public CArray
+  {
+protected:
+   CObject          *m_data[];           // data array
+   bool              m_free_mode;        // flag of necessity of "physical" deletion of object
+
+public:
+                     CArrayObj(void);
+                    ~CArrayObj(void);
+   //--- methods of access to protected data
+   bool              FreeMode(void) const { return(m_free_mode); }
+   void              FreeMode(const bool mode) { m_free_mode=mode; }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(0x7778); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- method of creating an element of array
+   virtual bool      CreateElement(const int index) { return(false); }
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(CObject *element);
+   bool              AddArray(const CArrayObj *src);
+   bool              Insert(CObject *element,const int pos);
+   bool              InsertArray(const CArrayObj *src,const int pos);
+   bool              AssignArray(const CArrayObj *src);
+   //--- method of access to thre array
+   CObject          *At(const int index) const;
+   //--- methods of changing
+   bool              Update(const int index,CObject *element);
+   bool              Shift(const int index,const int shift);
+   //--- methods of deleting
+   CObject          *Detach(const int index);
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   void              Clear(void);
+   //--- method for comparing arrays
+   bool              CompareArray(const CArrayObj *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(CObject *element);
+   int               Search(const CObject *element) const;
+   int               SearchGreat(const CObject *element) const;
+   int               SearchLess(const CObject *element) const;
+   int               SearchGreatOrEqual(const CObject *element) const;
+   int               SearchLessOrEqual(const CObject *element) const;
+   int               SearchFirst(const CObject *element) const;
+   int               SearchLast(const CObject *element) const;
+
+protected:
+   void              QuickSort(int beg,int end,const int mode);
+   int               QuickSearch(const CObject *element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayObj::CArrayObj(void) : m_free_mode(true)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayObj::~CArrayObj(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayObj::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+        {
+         //--- "physical" removal of the object (if necessary and possible)
+         if(m_free_mode && CheckPointer(m_data[dest+i])==POINTER_DYNAMIC)
+            delete m_data[dest+i];
+         //---
+         m_data[dest+i]=m_data[src+i];
+         m_data[src+i]=NULL;
+        }
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+        {
+         //--- "physical" removal of the object (if necessary and possible)
+         if(m_free_mode && CheckPointer(m_data[dest+i])==POINTER_DYNAMIC)
+            delete m_data[dest+i];
+         //---
+         m_data[dest+i]=m_data[src+i];
+         m_data[src+i]=NULL;
+        }
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayObj::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+      //--- explicitly zeroize all the loose items in the array
+      for(int i=m_data_total;i<m_data_max;i++)
+         m_data[i]=NULL;
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayObj::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_total>size)
+     {
+      //--- "physical" removal of the object (if necessary and possible)
+      if(m_free_mode)
+         for(int i=size;i<m_data_total;i++)
+            if(CheckPointer(m_data[i])==POINTER_DYNAMIC)
+               delete m_data[i];
+      m_data_total=size;
+     }
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayObj::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   Clear();
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayObj::Add(CObject *element)
+  {
+//--- check
+   if(!CheckPointer(element))
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayObj::AddArray(const CArrayObj *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayObj::Insert(CObject *element,const int pos)
+  {
+//--- check
+   if(pos<0 || !CheckPointer(element))
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayObj::InsertArray(const CArrayObj *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num)) return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayObj::AssignArray(const CArrayObj *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+CObject *CArrayObj::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(NULL);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayObj::Update(const int index,CObject *element)
+  {
+//--- check
+   if(index<0 || !CheckPointer(element) || index>=m_data_total)
+      return(false);
+//--- "physical" removal of the object (if necessary and possible)
+   if(m_free_mode && CheckPointer(m_data[index])==POINTER_DYNAMIC)
+      delete m_data[index];
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayObj::Shift(const int index,const int shift)
+  {
+   CObject *tmp_node;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_node=m_data[index];
+   m_data[index]=NULL;
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_node;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayObj::Delete(const int index)
+  {
+//--- check
+   if(index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1)
+     {
+      if(index>=0 && MemMove(index,index+1,m_data_total-index-1)<0)
+         return(false);
+     }
+   else
+   if(m_free_mode && CheckPointer(m_data[index])==POINTER_DYNAMIC)
+      delete m_data[index];
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Detach element from the specified position                       |
+//+------------------------------------------------------------------+
+CObject *CArrayObj::Detach(const int index)
+  {
+   CObject *result;
+//--- check
+   if(index>=m_data_total)
+      return(NULL);
+//--- detach
+   result=m_data[index];
+//--- reset the array element, so as not remove the method MemMove
+   m_data[index]=NULL;
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(NULL);
+   m_data_total--;
+//--- successful
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayObj::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   for(int i=to-from+1;i>0;i--,m_data_total--)
+      if(m_free_mode && CheckPointer(m_data[m_data_total-1])==POINTER_DYNAMIC)
+         delete m_data[m_data_total-1];
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Clearing of array without the release of memory                  |
+//+------------------------------------------------------------------+
+void CArrayObj::Clear(void)
+  {
+//--- "physical" removal of the object (if necessary and possible)
+   if(m_free_mode)
+     {
+      for(int i=0;i<m_data_total;i++)
+        {
+         if(CheckPointer(m_data[i])==POINTER_DYNAMIC)
+            delete m_data[i];
+         m_data[i]=NULL;
+        }
+     }
+   m_data_total=0;
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayObj::CompareArray(const CArrayObj *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i].Compare(array.m_data[i],0)!=0)
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayObj::QuickSort(int beg,int end,const int mode)
+  {
+   int      i,j;
+   CObject *p_node;
+   CObject *t_node;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_node=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i].Compare(p_node,mode)<0)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j].Compare(p_node,mode)>0)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_node=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_node;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j,mode);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayObj::InsertSort(CObject *element)
+  {
+   int pos;
+//--- check
+   if(!CheckPointer(element) || m_sort_mode==-1)
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- find position and insert
+   int mode=m_sort_mode;
+   pos=QuickSearch(element);
+   if(m_data[pos].Compare(element,m_sort_mode)>0)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=mode;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayObj::QuickSearch(const CObject *element) const
+  {
+   int      i,j,m=-1;
+   CObject *t_node;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m==m_data_total-1)
+         break;
+      t_node=m_data[m];
+      if(t_node.Compare(element,m_sort_mode)==0)
+         break;
+      if(t_node.Compare(element,m_sort_mode)>0)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayObj::Search(const CObject *element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos].Compare(element,m_sort_mode)==0)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayObj::SearchGreat(const CObject *element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos].Compare(element,m_sort_mode)<=0)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayObj::SearchLess(const CObject *element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos].Compare(element,m_sort_mode)>=0)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayObj::SearchGreatOrEqual(const CObject *element) const
+  {
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos].Compare(element,m_sort_mode)>=0)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayObj::SearchLessOrEqual(const CObject *element) const
+  {
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos].Compare(element,m_sort_mode)<=0)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayObj::SearchFirst(const CObject *element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos].Compare(element,m_sort_mode)==0)
+     {
+      while(m_data[pos].Compare(element,m_sort_mode)==0)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayObj::SearchLast(const CObject *element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !CheckPointer(element) || m_sort_mode==-1)
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos].Compare(element,m_sort_mode)==0)
+     {
+      while(m_data[pos].Compare(element,m_sort_mode)==0)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayObj::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(m_data[i].Save(file_handle)!=true)
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayObj::Load(const int file_handle)
+  {
+   int i=0,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         //--- create new element
+         if(!CreateElement(i))
+            break;
+         if(m_data[i].Load(file_handle)!=true)
+            break;
+         m_data_total++;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayShort.mqh b/Include/Arrays/ArrayShort.mqh
new file mode 100644
index 0000000..3079427
--- /dev/null
+++ b/Include/Arrays/ArrayShort.mqh
@@ -0,0 +1,770 @@
+//+------------------------------------------------------------------+
+//|                                                   ArrayShort.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayShort.                                               |
+//| Pupose: Class of dynamic array of variables                      |
+//|         of short or ushort type.                                 |
+//|         Derives from class CArray.                               |
+//+------------------------------------------------------------------+
+class CArrayShort : public CArray
+  {
+protected:
+   short             m_data[];           // data array
+
+public:
+                     CArrayShort(void);
+                    ~CArrayShort(void);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_SHORT); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const short element);
+   bool              AddArray(const short &src[]);
+   bool              AddArray(const CArrayShort *src);
+   bool              Insert(const short element,const int pos);
+   bool              InsertArray(const short &src[],const int pos);
+   bool              InsertArray(const CArrayShort *src,const int pos);
+   bool              AssignArray(const short &src[]);
+   bool              AssignArray(const CArrayShort *src);
+   //--- method of access to the array
+   short             At(const int index) const;
+   short operator[](const int index) const { return(At(index)); }
+   //--- methods of searching for minimum and maximum
+   int               Minimum(const int start,const int count) const { return(Minimum(m_data,start,count)); }
+   int               Maximum(const int start,const int count) const { return(Maximum(m_data,start,count)); }
+   //--- methods of changing
+   bool              Update(const int index,const short element);
+   bool              Shift(const int index,const int shift);
+   //--- methods of deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for comparing arrays
+   bool              CompareArray(const short &array[]) const;
+   bool              CompareArray(const CArrayShort *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(const short element);
+   int               Search(const short element) const;
+   int               SearchGreat(const short element) const;
+   int               SearchLess(const short element) const;
+   int               SearchGreatOrEqual(const short element) const;
+   int               SearchLessOrEqual(const short element) const;
+   int               SearchFirst(const short element) const;
+   int               SearchLast(const short element) const;
+   int               SearchLinear(const short element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const short element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayShort::CArrayShort(void)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayShort::~CArrayShort(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayShort::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayShort::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayShort::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayShort::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayShort::Add(const short element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayShort::AddArray(const short &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayShort::AddArray(const CArrayShort *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayShort::Insert(const short element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayShort::InsertArray(const short &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayShort::InsertArray(const CArrayShort *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayShort::AssignArray(const short &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayShort::AssignArray(const CArrayShort *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+short CArrayShort::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(SHORT_MAX);
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayShort::Update(const int index,const short element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayShort::Shift(const int index,const int shift)
+  {
+   short tmp_short;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_short=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_short;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayShort::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayShort::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayShort::CompareArray(const short &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayShort::CompareArray(const CArrayShort *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayShort::QuickSort(int beg,int end,const int mode)
+  {
+   int   i,j;
+   short p_short,t_short;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_short=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_short)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_short)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_short=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_short;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayShort::InsertSort(const short element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- find position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchLinear(const short element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]==element)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayShort::QuickSearch(const short element) const
+  {
+   int   i,j,m=-1;
+   short t_short;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_short=m_data[m];
+      if(t_short==element)
+         break;
+      if(t_short>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayShort::Search(const short element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchGreat(const short element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]<=element)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchLess(const short element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]>=element)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchGreatOrEqual(const short element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchLessOrEqual(const short element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchFirst(const short element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayShort::SearchLast(const short element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayShort::Save(const int file_handle)
+  {
+   int i=0;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+      if(FileWriteInteger(file_handle,m_data[i],SHORT_VALUE)!=SHORT_VALUE)
+         break;
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayShort::Load(const int file_handle)
+  {
+   int i=0,num;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         m_data[i]=(short)FileReadInteger(file_handle,SHORT_VALUE);
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/ArrayString.mqh b/Include/Arrays/ArrayString.mqh
new file mode 100644
index 0000000..1138101
--- /dev/null
+++ b/Include/Arrays/ArrayString.mqh
@@ -0,0 +1,780 @@
+//+------------------------------------------------------------------+
+//|                                                  ArrayString.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Array.mqh"
+//+------------------------------------------------------------------+
+//| Class CArrayString.                                              |
+//| Purpose: Class of dynamic array of variables of string type.     |
+//|          Derives from class CArray.                              |
+//+------------------------------------------------------------------+
+class CArrayString : public CArray
+  {
+protected:
+   string            m_data[];           // data array
+
+public:
+                     CArrayString(void);
+                    ~CArrayString(void);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(TYPE_STRING); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- methods of managing dynamic memory
+   bool              Reserve(const int size);
+   bool              Resize(const int size);
+   bool              Shutdown(void);
+   //--- methods of filling the array
+   bool              Add(const string element);
+   bool              AddArray(const string &src[]);
+   bool              AddArray(const CArrayString *src);
+   bool              Insert(const string element,const int pos);
+   bool              InsertArray(const string &src[],const int pos);
+   bool              InsertArray(const CArrayString *src,const int pos);
+   bool              AssignArray(const string &src[]);
+   bool              AssignArray(const CArrayString *src);
+   //--- method of access to the array
+   string            At(const int index) const;
+   string operator[](const int index) const { return(At(index)); }
+   //--- methods of changing
+   bool              Update(const int index,const string element);
+   bool              Shift(const int index,const int shift);
+   //--- methods of deleting
+   bool              Delete(const int index);
+   bool              DeleteRange(int from,int to);
+   //--- methods for comparing arrays
+   bool              CompareArray(const string &array[]) const;
+   bool              CompareArray(const CArrayString *array) const;
+   //--- methods for working with the sorted array
+   bool              InsertSort(const string element);
+   int               Search(const string element) const;
+   int               SearchGreat(const string element) const;
+   int               SearchLess(const string element) const;
+   int               SearchGreatOrEqual(const string element) const;
+   int               SearchLessOrEqual(const string element) const;
+   int               SearchFirst(const string element) const;
+   int               SearchLast(const string element) const;
+   int               SearchLinear(const string element) const;
+
+protected:
+   virtual void      QuickSort(int beg,int end,const int mode=0);
+   int               QuickSearch(const string element) const;
+   int               MemMove(const int dest,const int src,int count);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CArrayString::CArrayString(void)
+  {
+//--- initialize protected data
+   m_data_max=ArraySize(m_data);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CArrayString::~CArrayString(void)
+  {
+   if(m_data_max!=0)
+      Shutdown();
+  }
+//+------------------------------------------------------------------+
+//| Moving the memory within a single array                          |
+//+------------------------------------------------------------------+
+int CArrayString::MemMove(const int dest,const int src,int count)
+  {
+   int i;
+//--- check parameters
+   if(dest<0 || src<0 || count<0)
+      return(-1);
+//--- check count
+   if(src+count>m_data_total)
+      count=m_data_total-src;
+   if(count<0)
+      return(-1);
+//--- no need to copy
+   if(dest==src || count==0)
+      return(dest);
+//--- check data total
+   if(dest+count>m_data_total)
+     {
+      if(m_data_max<dest+count)
+         return(-1);
+      m_data_total=dest+count;
+     }
+//--- copy
+   if(dest<src)
+     {
+      //--- copy from left to right
+      for(i=0;i<count;i++)
+         m_data[dest+i]=m_data[src+i];
+     }
+   else
+     {
+      //--- copy from right to left
+      for(i=count-1;i>=0;i--)
+         m_data[dest+i]=m_data[src+i];
+     }
+//--- successful
+   return(dest);
+  }
+//+------------------------------------------------------------------+
+//| Request for more memory in an array. Checks if the requested     |
+//| number of free elements already exists; allocates additional     |
+//| memory with a given step                                         |
+//+------------------------------------------------------------------+
+bool CArrayString::Reserve(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<=0)
+      return(false);
+//--- resize array
+   if(Available()<size)
+     {
+      new_size=m_data_max+m_step_resize*(1+(size-Available())/m_step_resize);
+      if(new_size<0)
+         //--- overflow occurred when calculating new_size
+         return(false);
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+         m_data_max=ArraySize(m_data);
+     }
+//--- result
+   return(Available()>=size);
+  }
+//+------------------------------------------------------------------+
+//| Resizing (with removal of elements on the right)                 |
+//+------------------------------------------------------------------+
+bool CArrayString::Resize(const int size)
+  {
+   int new_size;
+//--- check
+   if(size<0)
+      return(false);
+//--- resize array
+   new_size=m_step_resize*(1+size/m_step_resize);
+   if(m_data_max!=new_size)
+     {
+      if((m_data_max=ArrayResize(m_data,new_size))==-1)
+        {
+         m_data_max=ArraySize(m_data);
+         return(false);
+        }
+     }
+   if(m_data_total>size)
+      m_data_total=size;
+//--- result
+   return(m_data_max==new_size);
+  }
+//+------------------------------------------------------------------+
+//| Complete cleaning of the array with the release of memory        |
+//+------------------------------------------------------------------+
+bool CArrayString::Shutdown(void)
+  {
+//--- check
+   if(m_data_max==0)
+      return(true);
+//--- clean
+   if(ArrayResize(m_data,0)==-1)
+      return(false);
+   m_data_total=0;
+   m_data_max=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array                        |
+//+------------------------------------------------------------------+
+bool CArrayString::Add(const string element)
+  {
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- add
+   m_data[m_data_total++]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayString::AddArray(const string &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adding an element to the end of the array from another array     |
+//+------------------------------------------------------------------+
+bool CArrayString::AddArray(const CArrayString *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- add
+   for(int i=0;i<num;i++)
+      m_data[m_data_total++]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting an element in the specified position                   |
+//+------------------------------------------------------------------+
+bool CArrayString::Insert(const string element,const int pos)
+  {
+//--- check/reserve elements of array
+   if(pos<0 || !Reserve(1))
+      return(false);
+//--- insert
+   m_data_total++;
+   if(pos<m_data_total-1)
+     {
+      if(MemMove(pos+1,pos,m_data_total-pos-1)<0)
+         return(false);
+      m_data[pos]=element;
+     }
+   else
+      m_data[m_data_total-1]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayString::InsertArray(const string &src[],const int pos)
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserting elements in the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayString::InsertArray(const CArrayString *src,const int pos)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.Total();
+   if(!Reserve(num))
+      return(false);
+//--- insert
+   if(MemMove(num+pos,pos,m_data_total-pos)<0)
+      return(false);
+   for(int i=0;i<num;i++)
+      m_data[i+pos]=src.m_data[i];
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayString::AssignArray(const string &src[])
+  {
+   int num=ArraySize(src);
+//--- check/reserve elements of array
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src[i];
+      m_data_total++;
+     }
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Assignment (copying) of another array                            |
+//+------------------------------------------------------------------+
+bool CArrayString::AssignArray(const CArrayString *src)
+  {
+   int num;
+//--- check
+   if(!CheckPointer(src))
+      return(false);
+//--- check/reserve elements of array
+   num=src.m_data_total;
+   Clear();
+   if(m_data_max<num)
+     {
+      if(!Reserve(num))
+         return(false);
+     }
+   else
+      Resize(num);
+//--- copy array
+   for(int i=0;i<num;i++)
+     {
+      m_data[i]=src.m_data[i];
+      m_data_total++;
+     }
+   m_sort_mode=src.SortMode();
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Access to data in the specified position                         |
+//+------------------------------------------------------------------+
+string CArrayString::At(const int index) const
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return("");
+//--- result
+   return(m_data[index]);
+  }
+//+------------------------------------------------------------------+
+//| Updating element in the specified position                       |
+//+------------------------------------------------------------------+
+bool CArrayString::Update(const int index,const string element)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- update
+   m_data[index]=element;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Moving element from the specified position                       |
+//| on the specified shift                                           |
+//+------------------------------------------------------------------+
+bool CArrayString::Shift(const int index,const int shift)
+  {
+   string tmp_string;
+//--- check
+   if(index<0 || index+shift<0 || index+shift>=m_data_total)
+      return(false);
+   if(shift==0)
+      return(true);
+//--- move
+   tmp_string=m_data[index];
+   if(shift>0)
+     {
+      if(MemMove(index,index+1,shift)<0)
+         return(false);
+     }
+   else
+     {
+      if(MemMove(index+shift+1,index+shift,-shift)<0)
+         return(false);
+     }
+   m_data[index+shift]=tmp_string;
+   m_sort_mode=-1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting element from the specified position                     |
+//+------------------------------------------------------------------+
+bool CArrayString::Delete(const int index)
+  {
+//--- check
+   if(index<0 || index>=m_data_total)
+      return(false);
+//--- delete
+   if(index<m_data_total-1 && MemMove(index,index+1,m_data_total-index-1)<0)
+      return(false);
+   m_data_total--;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deleting range of elements                                       |
+//+------------------------------------------------------------------+
+bool CArrayString::DeleteRange(int from,int to)
+  {
+//--- check
+   if(from<0 || to<0)
+      return(false);
+   if(from>to || from>=m_data_total)
+      return(false);
+//--- delete
+   if(to>=m_data_total-1)
+      to=m_data_total-1;
+   if(MemMove(from,to+1,m_data_total-to-1)<0)
+      return(false);
+   m_data_total-=to-from+1;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayString::CompareArray(const string &array[]) const
+  {
+//--- compare
+   if(m_data_total!=ArraySize(array))
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Equality comparison of two arrays                                |
+//+------------------------------------------------------------------+
+bool CArrayString::CompareArray(const CArrayString *array) const
+  {
+//--- check
+   if(!CheckPointer(array))
+      return(false);
+//--- compare
+   if(m_data_total!=array.m_data_total)
+      return(false);
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]!=array.m_data[i])
+         return(false);
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CArrayString::QuickSort(int beg,int end,const int mode)
+  {
+   int    i,j;
+   string p_string;
+   string t_string;
+//--- check
+   if(beg<0 || end<0)
+      return;
+//--- sort
+   i=beg;
+   j=end;
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      p_string=m_data[(beg+end)>>1];
+      while(i<j)
+        {
+         while(m_data[i]<p_string)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+           }
+         while(m_data[j]>p_string)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+         if(i<=j)
+           {
+            t_string=m_data[i];
+            m_data[i++]=m_data[j];
+            m_data[j]=t_string;
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j);
+      beg=i;
+      j=end;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Inserting element in a sorted array                              |
+//+------------------------------------------------------------------+
+bool CArrayString::InsertSort(const string element)
+  {
+   int pos;
+//--- check
+   if(!IsSorted())
+      return(false);
+//--- check/reserve elements of array
+   if(!Reserve(1))
+      return(false);
+//--- if the array is empty, add an element
+   if(m_data_total==0)
+     {
+      m_data[m_data_total++]=element;
+      return(true);
+     }
+//--- find position and insert
+   pos=QuickSearch(element);
+   if(m_data[pos]>element)
+      Insert(element,pos);
+   else
+      Insert(element,pos+1);
+//--- restore the sorting flag after Insert(...)
+   m_sort_mode=0;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a array                         |
+//+------------------------------------------------------------------+
+int CArrayString::SearchLinear(const string element) const
+  {
+//--- check
+   if(m_data_total==0)
+      return(-1);
+//---
+   for(int i=0;i<m_data_total;i++)
+      if(m_data[i]==element)
+         return(i);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Quick search of position of element in a sorted array            |
+//+------------------------------------------------------------------+
+int CArrayString::QuickSearch(const string element) const
+  {
+   int    i,j,m=-1;
+   string t_string;
+//--- search
+   i=0;
+   j=m_data_total-1;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_string=m_data[m];
+      if(t_string==element)
+         break;
+      if(t_string>element)
+         j=m-1;
+      else
+         i=m+1;
+     }
+//--- position
+   return(m);
+  }
+//+------------------------------------------------------------------+
+//| Search of position of element in a sorted array                  |
+//+------------------------------------------------------------------+
+int CArrayString::Search(const string element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+      return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than       |
+//| specified in a sorted array                                      |
+//+------------------------------------------------------------------+
+int CArrayString::SearchGreat(const string element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]<=element)
+      if(++pos==m_data_total)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than          |
+//| specified in the sorted array                                    |
+//+------------------------------------------------------------------+
+int CArrayString::SearchLess(const string element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   while(m_data[pos]>=element)
+      if(pos--==0)
+         return(-1);
+//--- position
+   return(pos);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is greater than or    |
+//| equal to the specified in a sorted array                         |
+//+------------------------------------------------------------------+
+int CArrayString::SearchGreatOrEqual(const string element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos<m_data_total;pos++)
+      if(m_data[pos]>=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Search position of the first element which is less than or equal |
+//| to the specified in a sorted array                               |
+//+------------------------------------------------------------------+
+int CArrayString::SearchLessOrEqual(const string element) const
+  {
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   for(int pos=QuickSearch(element);pos>=0;pos--)
+      if(m_data[pos]<=element)
+         return(pos);
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of first appearance of element in a sorted array   |
+//+------------------------------------------------------------------+
+int CArrayString::SearchFirst(const string element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(pos--==0)
+            break;
+      return(pos+1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Find position of last appearance of element in a sorted array    |
+//+------------------------------------------------------------------+
+int CArrayString::SearchLast(const string element) const
+  {
+   int pos;
+//--- check
+   if(m_data_total==0 || !IsSorted())
+      return(-1);
+//--- search
+   pos=QuickSearch(element);
+   if(m_data[pos]==element)
+     {
+      while(m_data[pos]==element)
+         if(++pos==m_data_total)
+            break;
+      return(pos-1);
+     }
+//--- not found
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Writing array to file                                            |
+//+------------------------------------------------------------------+
+bool CArrayString::Save(const int file_handle)
+  {
+   int i=0,len;
+//--- check
+   if(!CArray::Save(file_handle))
+      return(false);
+//--- write array length
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write array
+   for(i=0;i<m_data_total;i++)
+     {
+      len=StringLen(m_data[i]);
+      //--- write string length
+      if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+         return(false);
+      //--- write string
+      if(len!=0) if(FileWriteString(file_handle,m_data[i],len)!=len)
+         break;
+     }
+//--- result
+   return(i==m_data_total);
+  }
+//+------------------------------------------------------------------+
+//| Reading array from file                                          |
+//+------------------------------------------------------------------+
+bool CArrayString::Load(const int file_handle)
+  {
+   int i=0,num,len;
+//--- check
+   if(!CArray::Load(file_handle))
+      return(false);
+//--- read array length
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read array
+   Clear();
+   if(num!=0)
+     {
+      if(!Reserve(num))
+         return(false);
+      for(i=0;i<num;i++)
+        {
+         //--- read string length
+         len=FileReadInteger(file_handle,INT_VALUE);
+         //--- read string
+         if(len!=0)
+            m_data[i]=FileReadString(file_handle,len);
+         else
+            m_data[i]="";
+         m_data_total++;
+         if(FileIsEnding(file_handle))
+            break;
+        }
+     }
+   m_sort_mode=-1;
+//--- result
+   return(m_data_total==num);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/List.mqh b/Include/Arrays/List.mqh
new file mode 100644
index 0000000..068e5ed
--- /dev/null
+++ b/Include/Arrays/List.mqh
@@ -0,0 +1,657 @@
+//+------------------------------------------------------------------+
+//|                                                         List.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Object.mqh>
+//+------------------------------------------------------------------+
+//| Class CList.                                                     |
+//| Purpose: Provides the possibility of working with the list of    |
+//|          CObject instances and its dervivatives                  |
+//|          Derives from class CObject.                             |
+//+------------------------------------------------------------------+
+class CList : public CObject
+  {
+protected:
+   CObject          *m_first_node;       // pointer to the first element of the list
+   CObject          *m_last_node;        // pointer to the last element of the list
+   CObject          *m_curr_node;        // pointer to the current element of the list
+   int               m_curr_idx;         // index of the current list item
+   int               m_data_total;       // number of elements
+   bool              m_free_mode;        // flag of the necessity of "physical" deletion of object
+   bool              m_data_sort;        // flag if the list is sorted or not
+   int               m_sort_mode;        // mode of sorting of array
+
+public:
+                     CList(void);
+                    ~CList(void);
+   //--- methods of access to protected data
+   bool              FreeMode(void)          const { return(m_free_mode);  }
+   void              FreeMode(bool mode)           { m_free_mode=mode;     }
+   int               Total(void)             const { return(m_data_total); }
+   bool              IsSorted(void)          const { return(m_data_sort);  }
+   int               SortMode(void)          const { return(m_sort_mode);  }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(0x7779); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+   //--- method of creating an element of the list
+   virtual CObject  *CreateElement(void) { return(NULL); }
+   //--- methods of filling the list
+   int               Add(CObject *new_node);
+   int               Insert(CObject *new_node,int index);
+   //--- methods for navigating
+   int               IndexOf(CObject *node);
+   CObject          *GetNodeAtIndex(int index);
+   CObject          *GetFirstNode(void);
+   CObject          *GetPrevNode(void);
+   CObject          *GetCurrentNode(void);
+   CObject          *GetNextNode(void);
+   CObject          *GetLastNode(void);
+   //--- methods for deleting
+   CObject          *DetachCurrent(void);
+   bool              DeleteCurrent(void);
+   bool              Delete(int index);
+   void              Clear(void);
+   //--- method for comparing lists
+   bool              CompareList(CList *List);
+   //--- methods for changing
+   void              Sort(int mode);
+   bool              MoveToIndex(int index);
+   bool              Exchange(CObject *node1,CObject *node2);
+   //--- method for searching
+   CObject          *Search(CObject *element);
+protected:
+   void              QuickSort(int beg,int end,int mode);
+   CObject          *QuickSearch(CObject *element);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CList::CList(void) : m_first_node(NULL),
+                     m_last_node(NULL),
+                     m_curr_node(NULL),
+                     m_curr_idx(-1),
+                     m_data_total(0),
+                     m_free_mode(true),
+                     m_data_sort(false),
+                     m_sort_mode(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CList::~CList(void)
+  {
+   Clear();
+  }
+//+------------------------------------------------------------------+
+//| Method QuickSort                                                 |
+//+------------------------------------------------------------------+
+void CList::QuickSort(int beg,int end,int mode)
+  {
+   int      i,j,k;
+   CObject *i_ptr,*j_ptr,*k_ptr;
+//---
+   i_ptr=GetNodeAtIndex(i=beg);
+   j_ptr=GetNodeAtIndex(j=end);
+   while(i<end)
+     {
+      //--- ">>1" is quick division by 2
+      k_ptr=GetNodeAtIndex(k=(beg+end)>>1);
+      while(i<j)
+        {
+         while(i_ptr.Compare(k_ptr,mode)<0)
+           {
+            //--- control the output of the array bounds
+            if(i==m_data_total-1)
+               break;
+            i++;
+            i_ptr=i_ptr.Next();
+           }
+         while(j_ptr.Compare(k_ptr,mode)>0)
+           {
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            j--;
+            j_ptr=j_ptr.Prev();
+           }
+         if(i<=j)
+           {
+            Exchange(i_ptr,j_ptr);
+            i++;
+            i_ptr=GetNodeAtIndex(i);
+            //--- control the output of the array bounds
+            if(j==0)
+               break;
+            else
+              {
+               j--;
+               j_ptr=GetNodeAtIndex(j);
+              }
+           }
+        }
+      if(beg<j)
+         QuickSort(beg,j,mode);
+      beg=i;
+      i_ptr=GetNodeAtIndex(i=beg);
+      j_ptr=GetNodeAtIndex(j=end);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Index of element specified via the pointer to the list item      |
+//+------------------------------------------------------------------+
+int CList::IndexOf(CObject *node)
+  {
+//--- check
+   if(!CheckPointer(node) || !CheckPointer(m_curr_node))
+      return(-1);
+//--- searching index
+   if(node==m_curr_node)
+      return(m_curr_idx);
+   if(GetFirstNode()==node)
+      return(0);
+   for(int i=1;i<m_data_total;i++)
+      if(GetNextNode()==node)
+         return(i);
+//---
+   return(-1);
+  }
+//+------------------------------------------------------------------+
+//| Adding a new element to the end of the list                      |
+//+------------------------------------------------------------------+
+int CList::Add(CObject *new_node)
+  {
+//--- check
+   if(!CheckPointer(new_node))
+      return(-1);
+//--- add
+   if(m_first_node==NULL)
+      m_first_node=new_node;
+   else
+     {
+      m_last_node.Next(new_node);
+      new_node.Prev(m_last_node);
+     }
+   m_curr_node=new_node;
+   m_curr_idx=m_data_total;
+   m_last_node=new_node;
+   m_data_sort=false;
+//--- result
+   return(m_data_total++);
+  }
+//+------------------------------------------------------------------+
+//| Inserting a new element to the specified position in the list.   |
+//| Inserting element to the current position of the list if index=-1|
+//+------------------------------------------------------------------+
+int CList::Insert(CObject *new_node,int index)
+  {
+   CObject *tmp_node;
+//--- check
+   if(!CheckPointer(new_node))
+      return(-1);
+   if(index>m_data_total || index<0)
+      return(-1);
+//--- adjust
+   if(index==-1)
+     {
+      if(m_curr_node==NULL)
+         return(Add(new_node));
+     }
+   else
+     {
+      if(GetNodeAtIndex(index)==NULL)
+         return(Add(new_node));
+     }
+//--- no need to check m_curr_node
+   tmp_node=m_curr_node.Prev();
+   new_node.Prev(tmp_node);
+   if(tmp_node!=NULL)
+      tmp_node.Next(new_node);
+   else
+      m_first_node=new_node;
+   new_node.Next(m_curr_node);
+   m_curr_node.Prev(new_node);
+   m_data_total++;
+   m_data_sort=false;
+   m_curr_node=new_node;
+//--- result
+   return(index);
+  }
+//+------------------------------------------------------------------+
+//| Get a pointer to the position of element in the list             |
+//+------------------------------------------------------------------+
+CObject *CList::GetNodeAtIndex(int index)
+  {
+   int      i;
+   bool     revers;
+   CObject *result;
+//--- check
+   if(index>=m_data_total)
+      return(NULL);
+   if(index==m_curr_idx)
+      return(m_curr_node);
+//--- optimize bust list
+   if(index<m_curr_idx)
+     {
+      //--- index to the left of the current
+      if(m_curr_idx-index<index)
+        {
+         //--- closer to the current index
+         i=m_curr_idx;
+         revers=true;
+         result=m_curr_node;
+        }
+      else
+        {
+         //--- closer to the top of the list
+         i=0;
+         revers=false;
+         result=m_first_node;
+        }
+     }
+   else
+     {
+      //--- index to the right of the current
+      if(index-m_curr_idx<m_data_total-index-1)
+        {
+         //--- closer to the current index
+         i=m_curr_idx;
+         revers=false;
+         result=m_curr_node;
+        }
+      else
+        {
+         //--- closer to the end of the list
+         i=m_data_total-1;
+         revers=true;
+         result=m_last_node;
+        }
+     }
+   if(!CheckPointer(result))
+      return(NULL);
+//---
+   if(revers)
+     {
+      //--- search from right to left
+      for(;i>index;i--)
+        {
+         result=result.Prev();
+         if(result==NULL)
+            return(NULL);
+        }
+     }
+   else
+     {
+      //--- search from left to right
+      for(;i<index;i++)
+        {
+         result=result.Next();
+         if(result==NULL)
+            return(NULL);
+        }
+     }
+   m_curr_idx=index;
+//--- result
+   return(m_curr_node=result);
+  }
+//+------------------------------------------------------------------+
+//| Get a pointer to the first itme of the list                      |
+//+------------------------------------------------------------------+
+CObject *CList::GetFirstNode(void)
+  {
+//--- check
+   if(!CheckPointer(m_first_node))
+      return(NULL);
+//--- save
+   m_curr_idx=0;
+//--- result
+   return(m_curr_node=m_first_node);
+  }
+//+------------------------------------------------------------------+
+//| Get a pointer to the previous itme of the list                   |
+//+------------------------------------------------------------------+
+CObject *CList::GetPrevNode(void)
+  {
+//--- check
+   if(!CheckPointer(m_curr_node) || m_curr_node.Prev()==NULL)
+      return(NULL);
+//--- decrement
+   m_curr_idx--;
+//--- result
+   return(m_curr_node=m_curr_node.Prev());
+  }
+//+------------------------------------------------------------------+
+//| Get a pointer to the current item of the list                    |
+//+------------------------------------------------------------------+
+CObject *CList::GetCurrentNode(void)
+  {
+   return(m_curr_node);
+  }
+//+------------------------------------------------------------------+
+//| Get a pointer to the next item of the list                       |
+//+------------------------------------------------------------------+
+CObject *CList::GetNextNode(void)
+  {
+//--- check
+   if(!CheckPointer(m_curr_node) || m_curr_node.Next()==NULL)
+      return(NULL);
+//--- increment
+   m_curr_idx++;
+//--- result
+   return(m_curr_node=m_curr_node.Next());
+  }
+//+------------------------------------------------------------------+
+//| Get a pointer to the last itme of the list                       |
+//+------------------------------------------------------------------+
+CObject *CList::GetLastNode(void)
+  {
+//--- check
+   if(!CheckPointer(m_last_node))
+      return(NULL);
+//---
+   m_curr_idx=m_data_total-1;
+//--- result
+   return(m_curr_node=m_last_node);
+  }
+//+------------------------------------------------------------------+
+//| Detach current item in the list                                  |
+//+------------------------------------------------------------------+
+CObject *CList::DetachCurrent(void)
+  {
+   CObject *tmp_node,*result=NULL;
+//--- check
+   if(!CheckPointer(m_curr_node))
+      return(result);
+//--- "explode" list
+   result=m_curr_node;
+   m_curr_node=NULL;
+//--- if the deleted item was not the last one, pull up the "tail" of the list
+   if((tmp_node=result.Next())!=NULL)
+     {
+      tmp_node.Prev(result.Prev());
+      m_curr_node=tmp_node;
+     }
+//--- if the deleted item was not the first one, pull up "head" list
+   if((tmp_node=result.Prev())!=NULL)
+     {
+      tmp_node.Next(result.Next());
+      //--- if "last_node" is removed, move the current pointer to the end of the list
+      if(m_curr_node==NULL)
+        {
+         m_curr_node=tmp_node;
+         m_curr_idx=m_data_total-2;
+        }
+     }
+   m_data_total--;
+//--- if necessary, adjust the settings of the first and last elements
+   if(m_first_node==result)
+      m_first_node=result.Next();
+   if(m_last_node==result)
+      m_last_node=result.Prev();
+//--- complete the processing of element removed from the list
+//--- remove references to the list
+   result.Prev(NULL);
+   result.Next(NULL);
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Delete current item of list item                                 |
+//+------------------------------------------------------------------+
+bool CList::DeleteCurrent(void)
+  {
+   CObject *result=DetachCurrent();
+//--- check
+   if(result==NULL)
+      return(false);
+//--- complete the processing of element removed from the list
+   if(m_free_mode)
+     {
+      //--- delete it "physically"
+      if(CheckPointer(result)==POINTER_DYNAMIC)
+         delete result;
+     }
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Delete an item from a given position in the list                 |
+//+------------------------------------------------------------------+
+bool CList::Delete(int index)
+  {
+   if(GetNodeAtIndex(index)==NULL)
+      return(false);
+//--- result
+   return(DeleteCurrent());
+  }
+//+------------------------------------------------------------------+
+//| Remove all items from the list                                   |
+//+------------------------------------------------------------------+
+void CList::Clear(void)
+  {
+   GetFirstNode();
+   while(m_data_total!=0)
+      if(!DeleteCurrent())
+         break;
+  }
+//+------------------------------------------------------------------+
+//| Equality comparing of two lists                                  |
+//+------------------------------------------------------------------+
+bool CList::CompareList(CList *List)
+  {
+   CObject *node,*lnode;
+//--- check
+   if(!CheckPointer(List))
+      return(false);
+   if((node=GetFirstNode())==NULL)
+      return(false);
+   if((lnode=List.GetFirstNode())==NULL)
+      return(false);
+//--- compare
+   if(node.Compare(lnode)!=0)
+      return(false);
+   while((node=GetNextNode())!=NULL)
+     {
+      if((lnode=List.GetNextNode())==NULL)
+         return(false);
+      if(node.Compare(lnode)!=0)
+         return(false);
+     }
+//--- equal
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Sorting an array in ascending order                              |
+//+------------------------------------------------------------------+
+void CList::Sort(int mode)
+  {
+//--- check
+   if(m_data_total==0)
+      return;
+   if(m_data_sort && m_sort_mode==mode)
+      return;
+//--- sort
+   QuickSort(0,m_data_total-1,mode);
+   m_sort_mode=mode;
+   m_data_sort=true;
+  }
+//+------------------------------------------------------------------+
+//| Move the current item of list to the specified position          |
+//+------------------------------------------------------------------+
+bool CList::MoveToIndex(int index)
+  {
+//--- check
+   if(index>=m_data_total || !CheckPointer(m_curr_node))
+      return(false);
+//--- tune
+   if(m_curr_idx==index)
+      return(true);
+   if(m_curr_idx<index)
+      index--;
+//--- move
+   Insert(DetachCurrent(),index);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Move an item of the list from the specified position to the      |
+//| current one                                                      |
+//+------------------------------------------------------------------+
+bool CList::Exchange(CObject *node1,CObject *node2)
+  {
+   CObject *tmp_node,*node;
+//--- check
+   if(!CheckPointer(node1) || !CheckPointer(node2))
+      return(false);
+//---
+   tmp_node=node1.Prev();
+   node1.Prev(node2.Prev());
+   if(node1.Prev()!=NULL)
+     {
+      node=node1.Prev();
+      node.Next(node1);
+     }
+   else
+      m_first_node=node1;
+   node2.Prev(tmp_node);
+   if(node2.Prev()!=NULL)
+     {
+      node=node2.Prev();
+      node.Next(node2);
+     }
+   else
+      m_first_node=node2;
+   tmp_node=node1.Next();
+   node1.Next(node2.Next());
+   if(node1.Next()!=NULL)
+     {
+      node=node1.Next();
+      node.Prev(node1);
+     }
+   else
+      m_last_node=node1;
+   node2.Next(tmp_node);
+   if(node2.Next()!=NULL)
+     {
+      node=node2.Next();
+      node.Prev(node2);
+     }
+   else
+      m_last_node=node2;
+//---
+   m_curr_idx=0;
+   m_curr_node=m_first_node;
+   m_data_sort=false;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Search position of an element in a sorted list                   |
+//+------------------------------------------------------------------+
+CObject *CList::QuickSearch(CObject *element)
+  {
+   int      i,j,m;
+   CObject *t_node=NULL;
+//--- check
+   if(m_data_total==0)
+      return(NULL);
+//--- check the pointer is not needed
+   i=0;
+   j=m_data_total;
+   while(j>=i)
+     {
+      //--- ">>1" is quick division by 2
+      m=(j+i)>>1;
+      if(m<0 || m>=m_data_total)
+         break;
+      t_node=GetNodeAtIndex(m);
+      if(t_node.Compare(element,m_sort_mode)==0)
+         break;
+      if(t_node.Compare(element,m_sort_mode)>0)
+         j=m-1;
+      else
+         i=m+1;
+      t_node=NULL;
+     }
+//--- result
+   return(t_node);
+  }
+//+------------------------------------------------------------------+
+//| Search position of an element in a sorted list                   |
+//+------------------------------------------------------------------+
+CObject *CList::Search(CObject *element)
+  {
+   CObject *result;
+//--- check
+   if(!CheckPointer(element) || !m_data_sort)
+      return(NULL);
+//--- search
+   result=QuickSearch(element);
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Writing list to file                                             |
+//+------------------------------------------------------------------+
+bool CList::Save(const int file_handle)
+  {
+   CObject *node;
+   bool     result=true;
+//--- check
+   if(!CheckPointer(m_curr_node) || file_handle==INVALID_HANDLE)
+      return(false);
+//--- write start marker - 0xFFFFFFFFFFFFFFFF
+   if(FileWriteLong(file_handle,-1)!=sizeof(long))
+      return(false);
+//--- write type
+   if(FileWriteInteger(file_handle,Type(),INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write list size
+   if(FileWriteInteger(file_handle,m_data_total,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- sequential scannning of elements in the list using the call of method Save()
+   node=m_first_node;
+   while(node!=NULL)
+     {
+      result&=node.Save(file_handle);
+      node=node.Next();
+     }
+//--- successful
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Reading list from file                                           |
+//+------------------------------------------------------------------+
+bool CList::Load(const int file_handle)
+  {
+   uint     i,num;
+   CObject *node;
+   bool     result=true;
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- read and checking begin marker - 0xFFFFFFFFFFFFFFFF
+   if(FileReadLong(file_handle)!=-1)
+      return(false);
+//--- read and checking type
+   if(FileReadInteger(file_handle,INT_VALUE)!=Type())
+      return(false);
+//--- read list size
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- sequential creation of list items using the call of method Load()
+   Clear();
+   for(i=0;i<num;i++)
+     {
+      node=CreateElement();
+      if(node==NULL)
+         return(false);
+      Add(node);
+      result&=node.Load(file_handle);
+     }
+//--- successful
+   return(result);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/Tree.mqh b/Include/Arrays/Tree.mqh
new file mode 100644
index 0000000..dae9965
--- /dev/null
+++ b/Include/Arrays/Tree.mqh
@@ -0,0 +1,415 @@
+//+------------------------------------------------------------------+
+//|                                                         Tree.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include  "TreeNode.mqh"
+//+------------------------------------------------------------------+
+//| Class CTree.                                                     |
+//| Purpose: Building a binary tree of instances of CTreeNode class  |
+//|          and its derviatives.                                    |
+//|          Derives from class CTreeNode.                           |
+//+------------------------------------------------------------------+
+class CTree : public CTreeNode
+  {
+protected:
+   CTreeNode        *m_root_node;        // root node of the tree
+
+public:
+                     CTree(void);
+                    ~CTree(void);
+   //--- methods of access to protected data
+   CTreeNode        *Root(void) const { return(m_root_node); }
+   //--- method of identifying the object
+   virtual int       Type() const { return(0x9999); }
+   //--- method of filling the tree
+   CTreeNode        *Insert(CTreeNode *new_node);
+   //--- methods of removing tree nodes
+   bool              Detach(CTreeNode *node);
+   bool              Delete(CTreeNode *node);
+   void              Clear(void);
+   //--- method of searching data in the tree
+   CTreeNode        *Find(const CTreeNode *node);
+   //--- method to create elements in the tree
+   virtual CTreeNode *CreateElement() { return(NULL); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   void              Balance(CTreeNode *node);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CTree::CTree(void) : m_root_node(NULL)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CTree::~CTree(void)
+  {
+   Clear();
+  }
+//+------------------------------------------------------------------+
+//| Method of adding a node to the tree                              |
+//+------------------------------------------------------------------+
+CTreeNode *CTree::Insert(CTreeNode *new_node)
+  {
+   CTreeNode *p_node;
+   CTreeNode *result=m_root_node;
+//--- check
+   if(!CheckPointer(new_node))
+      return(NULL);
+//--- add
+   if(result!=NULL)
+     {
+      p_node=NULL;
+      result=m_root_node;
+      while(result!=NULL && result.Compare(new_node)!=0)
+        {
+         p_node=result;
+         result=result.GetNext(new_node);
+        }
+      if(result!=NULL)
+         return(result);
+      if(p_node.Compare(new_node)>0)
+         p_node.Left(new_node);
+      else
+         p_node.Right(new_node);
+      new_node.Parent(p_node);
+      Balance(p_node);
+     }
+   else
+      m_root_node=new_node;
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Method of removing a node from the tree                          |
+//+------------------------------------------------------------------+
+bool CTree::Delete(CTreeNode *node)
+  {
+//--- check
+   if(!CheckPointer(node))
+      return(false);
+//--- delete
+   if(Detach(node) && CheckPointer(node)==POINTER_DYNAMIC)
+      delete node;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method of detaching node from the tree                           |
+//+------------------------------------------------------------------+
+bool CTree::Detach(CTreeNode *node)
+  {
+   CTreeNode *curr_node,*tmp_node;
+   CTreeNode *nodeA,*nodeB;
+//--- check
+   curr_node=node;
+   if(!CheckPointer(curr_node))
+      return(false);
+//--- detach
+   if(curr_node.BalanceL()>curr_node.BalanceR())
+     {
+      nodeA=curr_node.Left();
+      while(nodeA.Right()!=NULL)
+         nodeA=nodeA.Right();
+      nodeB=nodeA.Parent();
+      if(nodeB!=curr_node)
+        {
+         nodeB.Right(nodeA.Left());
+         tmp_node=nodeB.Right();
+         if(tmp_node!=NULL)
+            tmp_node.Parent(nodeB);
+         tmp_node=curr_node.Left();
+         nodeA.Left(tmp_node);
+         tmp_node.Parent(nodeA);
+        }
+      //--- left link of curr_node is already installed as it should be
+      curr_node.Left(NULL);
+      //--- transferring the right link of curr_node to nodeA
+      nodeA.Right(curr_node.Right());
+      tmp_node=curr_node.Right();
+      if(tmp_node!=NULL)
+         tmp_node.Parent(nodeA);
+      curr_node.Right(NULL);
+      //--- transferring the root link of curr_node to nodeA
+      tmp_node=curr_node.Parent();
+      nodeA.Parent(tmp_node);
+      if(tmp_node!=NULL)
+        {
+         if(tmp_node.Left()==curr_node)
+            tmp_node.Left(nodeA);
+         else
+            tmp_node.Right(nodeA);
+        }
+      else
+        {
+         curr_node.Parent(NULL);
+         m_root_node=nodeA;
+         tmp_node=nodeA;
+        }
+      Balance(tmp_node);
+     }
+   else
+     {
+      if(curr_node.BalanceR()>0)
+        {
+         nodeA=curr_node.Right();
+         while(nodeA.Left()!=NULL)
+            nodeA=nodeA.Left();
+         nodeB=nodeA.Parent();
+         if(nodeB!=curr_node)
+           {
+            nodeB.Left(nodeA.Right());
+            tmp_node=nodeB.Left();
+            if(tmp_node!=NULL)
+               tmp_node.Parent(nodeB);
+            tmp_node=curr_node.Right();
+            nodeA.Right(tmp_node);
+            tmp_node.Parent(nodeA);
+           }
+         //--- right link of curr_node is already installed as it should be
+         curr_node.Right(NULL);
+         //--- transferring the left link of curr_node to nodeA
+         nodeA.Left(curr_node.Left());
+         tmp_node=curr_node.Left();
+         if(tmp_node!=NULL)
+            tmp_node.Parent(nodeA);
+         curr_node.Left(NULL);
+         //--- transferring the root link of curr_node to nodeA
+         tmp_node=curr_node.Parent();
+         nodeA.Parent(tmp_node);
+         if(tmp_node!=NULL)
+           {
+            if(tmp_node.Left()==curr_node)
+               tmp_node.Left(nodeA);
+            else
+               tmp_node.Right(nodeA);
+           }
+         else
+           {
+            curr_node.Parent(NULL);
+            m_root_node=nodeA;
+            tmp_node=nodeA;
+           }
+         Balance(tmp_node);
+        }
+      else
+        {
+         //--- node list
+         if(curr_node.Parent()==NULL)
+            m_root_node=NULL;
+         else
+           {
+            tmp_node=curr_node.Parent();
+            if(tmp_node.Left()==curr_node)
+               tmp_node.Left(NULL);
+            else
+               tmp_node.Right(NULL);
+            curr_node.Parent(NULL);
+           }
+         Balance(curr_node.Parent());
+        }
+     }
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Method of cleaning the tree                                      |
+//+------------------------------------------------------------------+
+void CTree::Clear(void)
+  {
+   if(CheckPointer(m_root_node)==POINTER_DYNAMIC)
+      delete m_root_node;
+   m_root_node=NULL;
+  }
+//+------------------------------------------------------------------+
+//| Method of searching for a node in the tree                       |
+//+------------------------------------------------------------------+
+CTreeNode *CTree::Find(const CTreeNode *node)
+  {
+   CTreeNode *result=m_root_node;
+//--- find
+   while(result!=NULL && result.Compare(node)!=0)
+      result=result.GetNext(node);
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Method of balancing the tree                                     |
+//+------------------------------------------------------------------+
+void CTree::Balance(CTreeNode *node)
+  {
+   CTreeNode *nodeA,*nodeB,*nodeC,*curr_node,*tmp_node;
+//---
+   curr_node=node;
+   while(curr_node!=NULL)
+     {
+      curr_node.RefreshBalance();
+      if(MathAbs(curr_node.BalanceL()-curr_node.BalanceR())<=1)
+         curr_node=curr_node.Parent();
+      else
+        {
+         if(curr_node.BalanceR()>curr_node.BalanceL())
+           {
+            //--- rotation to the right
+            tmp_node=curr_node.Right();
+            if(tmp_node.BalanceL()>tmp_node.BalanceR())
+              {
+               //--- great rotation to the right
+               nodeA=curr_node;
+               nodeB=nodeA.Right();
+               nodeC=nodeB.Left();
+               nodeC.Parent(nodeA.Parent());
+               tmp_node=nodeC.Parent();
+               if(tmp_node!=NULL)
+                 {
+                  if(tmp_node.Right()==nodeA)
+                     tmp_node.Right(nodeC);
+                  else
+                     tmp_node.Left(nodeC);
+                 }
+               else
+                  m_root_node=nodeC;
+               nodeA.Parent(nodeC);
+               nodeB.Parent(nodeC);
+               nodeA.Right(nodeC.Left());
+               tmp_node=nodeA.Right();
+               if(tmp_node!=NULL)
+                  tmp_node.Parent(nodeA);
+               nodeC.Left(nodeA);
+               nodeB.Left(nodeC.Right());
+               tmp_node=nodeB.Left();
+               if(tmp_node!=NULL)
+                  tmp_node.Parent(nodeB);
+               nodeC.Right(nodeB);
+               if(m_root_node==nodeA)
+                  m_root_node=nodeC;
+               curr_node=nodeC.Parent();
+              }
+            else
+              {
+               //--- slight rotation to the right
+               nodeA=curr_node;
+               nodeB=nodeA.Right();
+               nodeB.Parent(nodeA.Parent());
+               tmp_node=nodeB.Parent();
+               if(tmp_node!=NULL)
+                 {
+                  if(tmp_node.Right()==nodeA)
+                     tmp_node.Right(nodeB);
+                  else
+                     tmp_node.Left(nodeB);
+                 }
+               else
+                  m_root_node=nodeB;
+               nodeA.Parent(nodeB);
+               nodeA.Right(nodeB.Left());
+               tmp_node=nodeA.Right();
+               if(tmp_node!=NULL)
+                  tmp_node.Parent(nodeA);
+               nodeB.Left(nodeA);
+               if(m_root_node==nodeA)
+                  m_root_node=nodeB;
+               curr_node=nodeB.Parent();
+              }
+           }
+         else
+           {
+            //--- rotation to the left
+            tmp_node=curr_node.Left();
+            if(tmp_node.BalanceR()>tmp_node.BalanceL())
+              {
+               //--- great rotation to the left
+               nodeA=curr_node;
+               nodeB=nodeA.Left();
+               nodeC=nodeB.Right();
+               nodeC.Parent(nodeA.Parent());
+               tmp_node=nodeC.Parent();
+               if(tmp_node!=NULL)
+                 {
+                  if(tmp_node.Right()==nodeA)
+                     tmp_node.Right(nodeC);
+                  else
+                     tmp_node.Left(nodeC);
+                 }
+               else
+                  m_root_node=nodeC;
+               nodeA.Parent(nodeC);
+               nodeB.Parent(nodeC);
+               nodeA.Left(nodeC.Right());
+               tmp_node=nodeA.Left();
+               if(tmp_node!=NULL)
+                  tmp_node.Parent(nodeA);
+               nodeC.Right(nodeA);
+               nodeB.Right(nodeC.Left());
+               tmp_node=nodeB.Right();
+               if(tmp_node!=NULL)
+                  tmp_node.Parent(nodeB);
+               nodeC.Left(nodeB);
+               if(m_root_node==nodeA)
+                  m_root_node=nodeC;
+               curr_node=nodeC.Parent();
+              }
+            else
+              {
+               //--- small rotation to the left
+               nodeA=curr_node;
+               nodeB=nodeA.Left();
+               nodeB.Parent(nodeA.Parent());
+               tmp_node=nodeB.Parent();
+               if(tmp_node!=NULL)
+                 {
+                  if(tmp_node.Right()==nodeA)
+                     tmp_node.Right(nodeB);
+                  else
+                     tmp_node.Left(nodeB);
+                 }
+               else
+                  m_root_node=nodeB;
+               nodeA.Parent(nodeB);
+               nodeA.Left(nodeB.Right());
+               tmp_node=nodeA.Left();
+               if(tmp_node!=NULL)
+                  tmp_node.Parent(nodeA);
+               nodeB.Right(nodeA);
+               if(m_root_node==nodeA)
+                  m_root_node=nodeB;
+               curr_node=nodeB.Parent();
+              }
+           }
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Writing tree to file                                             |
+//+------------------------------------------------------------------+
+bool CTree::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+   if(m_root_node==NULL)
+      return(true);
+//--- result
+   return(m_root_node.SaveNode(file_handle));
+  }
+//+------------------------------------------------------------------+
+//| Reading tree from file                                           |
+//+------------------------------------------------------------------+
+bool CTree::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- create root node only
+   Clear();
+   Insert(CreateElement());
+//--- result
+   return(m_root_node.LoadNode(file_handle,m_root_node));
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Arrays/TreeNode.mqh b/Include/Arrays/TreeNode.mqh
new file mode 100644
index 0000000..fde1633
--- /dev/null
+++ b/Include/Arrays/TreeNode.mqh
@@ -0,0 +1,174 @@
+//+------------------------------------------------------------------+
+//|                                                     TreeNode.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Object.mqh>
+//+------------------------------------------------------------------+
+//| Class CTreeNode.                                                 |
+//| Purpose: Base class of node of binary tree CTree.                |
+//|          Derives from class CObject.                             |
+//+------------------------------------------------------------------+
+class CTreeNode : public CObject
+  {
+private:
+   CTreeNode        *m_p_node;             // link to node up
+   CTreeNode        *m_l_node;             // link to node left
+   CTreeNode        *m_r_node;             // link to node right
+   //--- variables
+   int               m_balance;            // balance of node
+   int               m_l_balance;          // balance of the left branch
+   int               m_r_balance;          // balance of the right branch
+
+public:
+                     CTreeNode(void);
+                    ~CTreeNode(void);
+   //--- methods of access to protected data
+   CTreeNode*        Parent(void)           const { return(m_p_node);    }
+   void              Parent(CTreeNode *node)      { m_p_node=node;       }
+   CTreeNode*        Left(void)             const { return(m_l_node);    }
+   void              Left(CTreeNode *node)        { m_l_node=node;       }
+   CTreeNode*        Right(void)            const { return(m_r_node);    }
+   void              Right(CTreeNode *node)       { m_r_node=node;       }
+   int               Balance(void)          const { return(m_balance);   }
+   int               BalanceL(void)         const { return(m_l_balance); }
+   int               BalanceR(void)         const { return(m_r_balance); }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(0x8888); }
+   //--- methods for controlling
+   int               RefreshBalance(void);
+   CTreeNode        *GetNext(const CTreeNode *node);
+   //--- methods for working with files
+   bool              SaveNode(const int file_handle);
+   bool              LoadNode(const int file_handle,CTreeNode *main);
+
+protected:
+   //--- method for creating an instance of class
+   virtual CTreeNode *CreateSample(void) { return(NULL); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CTreeNode::CTreeNode(void) : m_p_node(NULL),
+                             m_l_node(NULL),
+                             m_r_node(NULL),
+                             m_balance(0),
+                             m_l_balance(0),
+                             m_r_balance(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CTreeNode::~CTreeNode(void)
+  {
+//--- delete nodes of the next level
+   if(m_l_node!=NULL)
+      delete m_l_node;
+   if(m_r_node!=NULL)
+      delete m_r_node;
+  }
+//+------------------------------------------------------------------+
+//| Calculating the balance of the node                              |
+//+------------------------------------------------------------------+
+int CTreeNode::RefreshBalance(void)
+  {
+//--- calculate the balance of the left branch
+   if(m_l_node==NULL)
+      m_l_balance=0;
+   else
+      m_l_balance=m_l_node.RefreshBalance();
+//--- calculate the balance of the right branch
+   if(m_r_node==NULL)
+      m_r_balance=0;
+   else
+      m_r_balance=m_r_node.RefreshBalance();
+//--- calculate the balance of the node
+   if(m_r_balance>m_l_balance)
+      m_balance=m_r_balance+1;
+   else
+      m_balance=m_l_balance+1;
+//--- result
+   return(m_balance);
+  }
+//+------------------------------------------------------------------+
+//| Selecting next node                                              |
+//+------------------------------------------------------------------+
+CTreeNode *CTreeNode::GetNext(const CTreeNode *node)
+  {
+   if(Compare(node)>0)
+      return(m_l_node);
+//--- result
+   return(m_r_node);
+  }
+//+------------------------------------------------------------------+
+//| Writing node data to file                                        |
+//+------------------------------------------------------------------+
+bool CTreeNode::SaveNode(const int file_handle)
+  {
+   bool result=true;
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- write left node (if it is available)
+   if(m_l_node!=NULL)
+     {
+      FileWriteInteger(file_handle,'L',SHORT_VALUE);
+      result&=m_l_node.SaveNode(file_handle);
+     }
+   else
+      FileWriteInteger(file_handle,'X',SHORT_VALUE);
+//--- write data of current node
+   result&=Save(file_handle);
+//--- write right node (if it is available)
+   if(m_r_node!=NULL)
+     {
+      FileWriteInteger(file_handle,'R',SHORT_VALUE);
+      result&=m_r_node.SaveNode(file_handle);
+     }
+   else
+      FileWriteInteger(file_handle,'X',SHORT_VALUE);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading node data from file                                      |
+//+------------------------------------------------------------------+
+bool CTreeNode::LoadNode(const int file_handle,CTreeNode *main)
+  {
+   bool       result=true;
+   short      s_val;
+   CTreeNode *node;
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- read directions
+   s_val=(short)FileReadInteger(file_handle,SHORT_VALUE);
+   if(s_val=='L')
+     {
+      //--- read left node (if there is data)
+      node=CreateSample();
+      if(node==NULL)
+         return(false);
+      m_l_node=node;
+      node.Parent(main);
+      result&=node.LoadNode(file_handle,node);
+     }
+//--- read data of current node
+   result&=Load(file_handle);
+//--- read directions
+   s_val=(short)FileReadInteger(file_handle,SHORT_VALUE);
+   if(s_val=='R')
+     {
+      //--- read right node (if there is data)
+      node=CreateSample();
+      if(node==NULL)
+         return(false);
+      m_r_node=node;
+      node.Parent(main);
+      result&=node.LoadNode(file_handle,node);
+     }
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Canvas/Canvas.mqh b/Include/Canvas/Canvas.mqh
new file mode 100644
index 0000000..3d9c92a
--- /dev/null
+++ b/Include/Canvas/Canvas.mqh
@@ -0,0 +1,4804 @@
+//+------------------------------------------------------------------+
+//|                                                       Canvas.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Files\FileBin.mqh>
+#include <Controls\Rect.mqh>
+//+------------------------------------------------------------------+
+#define SIGN(i) ((i<0) ? -1 : 1)
+//+------------------------------------------------------------------+
+//| Macro to generate color                                          |
+//+------------------------------------------------------------------+
+#define XRGB(r,g,b)    (0xFF000000|(uchar(r)<<16)|(uchar(g)<<8)|uchar(b))
+#define ARGB(a,r,g,b)  ((uchar(a)<<24)|(uchar(r)<<16)|(uchar(g)<<8)|uchar(b))
+#define TRGB(a,rgb)    ((uchar(a)<<24)|(rgb))
+#define GETRGB(clr)    ((clr)&0xFFFFFF)
+#define GETRGBA(clr)   uchar((clr)>>24)
+#define GETRGBR(clr)   uchar((clr)>>16)
+#define GETRGBG(clr)   uchar((clr)>>8)
+#define GETRGBB(clr)   uchar(clr)
+#define COLOR2RGB(clr) (0xFF000000|(uchar(clr)<<16)|(uchar((clr)>>8)<<8)|uchar((clr)>>16))
+#define RGB2COLOR(rgb) ((uchar(rgb)<<16)|(uchar((rgb)>>8)<<8)|uchar((rgb)>>16))
+//+------------------------------------------------------------------+
+//| Line end style (round, butt, square)                             |
+//+------------------------------------------------------------------+
+enum ENUM_LINE_END
+  {
+   LINE_END_ROUND,
+   LINE_END_BUTT,
+   LINE_END_SQUARE,
+  };
+//+------------------------------------------------------------------+
+//| Class CCanvas                                                    |
+//| Usage: class for working with a dynamic resource                 |
+//+------------------------------------------------------------------+
+class CCanvas
+  {
+private:
+   uint              m_style;                  // line style template
+   uint              m_style_idx;              // variable - current index of bit in line style template
+   static uint       m_default_colors[9];      // default colors
+
+protected:
+   long              m_chart_id;               // chart ID
+   string            m_objname;                // object name
+   ENUM_OBJECT       m_objtype;                // object type
+   string            m_rcname;                 // resource name
+   int               m_width;                  // canvas width
+   int               m_height;                 // canvas height
+   ENUM_COLOR_FORMAT m_format;                 // method of color processing
+   //--- for text
+   string            m_fontname;               // font name
+   int               m_fontsize;               // font size
+   uint              m_fontflags;              // font flags
+   uint              m_fontangle;              // angle of text tilt to the X axis in 0.1 degrees
+   //--- data
+   uint              m_pixels[];               // array of pixels
+
+public:
+                     CCanvas(void);
+                    ~CCanvas(void);
+   //--- create/attach/destroy
+   virtual bool      Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   bool              CreateBitmap(const string name,const datetime time,const double price,
+                                  const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   bool              CreateBitmap(const long chart_id,const int subwin,const string name,
+                                  const datetime time,const double price,const int width,const int height,
+                                  ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   bool              CreateBitmapLabel(const string name,const int x,const int y,
+                                       const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   bool              CreateBitmapLabel(const long chart_id,const int subwin,const string name,
+                                       const int x,const int y,const int width,const int height,
+                                       ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   bool              Attach(const long chart_id,const string objname,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   bool              Attach(const long chart_id,const string objname,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   void              Destroy(void);
+   //--- properties
+   string            ChartObjectName(void)          const { return(m_objname); }
+   string            ResourceName(void)             const { return(m_rcname);  }
+   int               Width(void)                    const { return(m_width);   }
+   int               Height(void)                   const { return(m_height);  }
+   //--- update object on screen
+   void              Update(const bool redraw=true);
+   bool              Resize(const int width,const int height);
+   //--- clear/fill color
+   void              Erase(const uint clr=0);
+   //--- data access
+   uint              PixelGet(const int x,const int y) const;
+   void              PixelSet(const int x,const int y,const uint clr);
+   //--- draw primitives
+   void              LineVertical(int x,int y1,int y2,const uint clr);
+   void              LineHorizontal(int x1,int x2,int y,const uint clr);
+   void              Line(int x1,int y1,int x2,int y2,const uint clr);
+   void              Polyline(int &x[],int &y[],const uint clr);
+   void              Polygon(int &x[],int &y[],const uint clr);
+   void              Rectangle(int x1,int y1,int x2,int y2,const uint clr);
+   void              Triangle(int x1,int y1,int x2,int y2,int x3,int y3,const uint clr);
+   void              Circle(int x,int y,int r,const uint clr);
+   void              Ellipse(int x1,int y1,int x2,int y2,const uint clr);
+   void              Arc(int x1,int y1,int x2,int y2,int x3,int y3,int x4,int y4,const uint clr);
+   void              Arc(int x,int y,int rx,int ry,double fi3,double fi4,const uint clr);
+   void              Arc(int x,int y,int rx,int ry,double fi3,double fi4,int &x3,int &y3,int &x4,int &y4,const uint clr);
+   void              Pie(int x1,int y1,int x2,int y2,int x3,int y3,int x4,int y4,const uint clr,const uint fill_clr);
+   void              Pie(int x,int y,int rx,int ry,double fi3,double fi4,const uint clr,const uint fill_clr);
+   //--- draw filled primitives
+   void              FillRectangle(int x1,int y1,int x2,int y2,const uint clr);
+   void              FillTriangle(int x1,int y1,int x2,int y2,int x3,int y3,const uint clr);
+   void              FillPolygon(int &x[],int &y[],const uint clr);
+   void              FillCircle(int x,int y,int r,const uint clr);
+   void              FillEllipse(int x1,int y1,int x2,int y2,const uint clr);
+   void              Fill(int x,int y,const uint clr);
+   void              Fill(int x,int y,const uint clr,const uint threshould);
+   //--- draw primitives with antialiasing
+   void              PixelSetAA(const double x,const double y,const uint clr);
+   void              LineAA(const int x1,const int y1,const int x2,const int y2,const uint clr,const uint style=UINT_MAX);
+   void              PolylineAA(int &x[],int &y[],const uint clr,const uint style=UINT_MAX);
+   void              PolygonAA(int &x[],int &y[],const uint clr,const uint style=UINT_MAX);
+   void              TriangleAA(const int x1,const int y1,const int x2,const int y2,const int x3,const int y3,
+                                const uint clr,const uint style=UINT_MAX);
+   void              CircleAA(const int x,const int y,const double r,const uint clr,const uint style=UINT_MAX);
+   void              EllipseAA(const double x1,const double y1,const double x2,const double y2,const uint clr,const uint style=UINT_MAX);
+   //--- draw primitives with antialiasing by Wu's algorithm                              
+   void              LineWu(int x1,int y1,int x2,int y2,const uint clr,const uint style=UINT_MAX);
+   void              PolylineWu(const int &x[],const int &y[],const uint clr,const uint style=UINT_MAX);
+   void              PolygonWu(const int &x[],const int &y[],const uint clr,const uint style=UINT_MAX);
+   void              TriangleWu(const int x1,const int y1,const int x2,const int y2,const int x3,const int y3,const uint clr,const uint style=UINT_MAX);
+   void              CircleWu(const int x,const int y,const double r,const uint clr,const uint style=UINT_MAX);
+   void              EllipseWu(const int x1,const int y1,const int x2,const int y2,const uint clr,const uint style=UINT_MAX);
+   //--- draw primitives with prefiltered antialiasing
+   void              LineThickVertical(const int x,const int y1,const int y2,const uint clr,const int size,const uint style,ENUM_LINE_END end_style);
+   void              LineThickHorizontal(const int x1,const int x2,const int y,const uint clr,const int size,const uint style,ENUM_LINE_END end_style);
+   void              LineThick(const int x1,const int y1,const int x2,const int y2,const uint clr,const int size,const uint style,ENUM_LINE_END end_style);
+   void              PolylineThick(const int &x[],const int &y[],const uint clr,const int size,const uint style,ENUM_LINE_END end_style);
+   void              PolygonThick(const int &x[],const int &y[],const uint clr,const int size,const uint style,ENUM_LINE_END end_style);
+   //--- draw primitives smoothing polyline and polygon
+   void              PolylineSmooth(const int &x[],const int &y[],const uint clr,const int size,
+                                    ENUM_LINE_STYLE style=STYLE_SOLID,ENUM_LINE_END end_style=LINE_END_ROUND,
+                                    double tension=0.5,double step=10);
+   void              PolygonSmooth(int &x[],int &y[],const uint clr,const int size,
+                                   ENUM_LINE_STYLE style=STYLE_SOLID,ENUM_LINE_END end_style=LINE_END_ROUND,
+                                   double tension=0.5,double step=10);
+   //--- for text
+   bool              FontSet(const string name,const int size,const uint flags=0,const uint angle=0);
+   bool              FontNameSet(string name);
+   bool              FontSizeSet(int size);
+   bool              FontFlagsSet(uint flags);
+   bool              FontAngleSet(uint angle);
+   void              FontGet(string &name,int &size,uint &flags,uint &angle);
+   string            FontNameGet(void)                 const { return(m_fontname);  }
+   int               FontSizeGet(void)                 const { return(m_fontsize);  }
+   uint              FontFlagsGet(void)                const { return(m_fontflags); }
+   uint              FontAngleGet(void)                const { return(m_fontangle); }
+   void              TextOut(int x,int y,string text,const uint clr,uint alignment=0);
+   int               TextWidth(const string text);
+   int               TextHeight(const string text);
+   void              TextSize(const string text,int &width,int &height);
+   //--- services
+   static uint       GetDefaultColor(const int i);
+   void              TransparentLevelSet(const uchar value);
+   //--- load bitmap from file
+   bool              LoadFromFile(const string filename);
+   //--- line style property
+   uint              LineStyleGet(void) const;
+   void              LineStyleSet(const uint style);
+
+private:
+   bool              FontSet(void);
+   void              TextOutFast(int x,int y,string text,const uint clr,uint alignment=0);
+   bool              PixelsSimilar(const uint clr0,const uint clr1,const uint threshould);
+   //--- for Wu's algorithm
+   void              PixelTransform(const int x,const int y,const uint clr,const double alpha);
+   //--- for circle and ellipse
+   void              PixelTransform4(const int x,const int y,const int dx,const int dy,const uint clr,const double alpha);
+   void              PixelSet4AA(const double x,const double y,const double dx,const double dy,const uint clr);
+   //--- for thick line
+   void              SegmentVertical(const int x,const int y1,const int y2,const int ysign,const double r,const uint clr,ENUM_LINE_END end_style);
+   void              SegmentHorizontal(const int x1,const int x2,const int y,const int xsign,const double r,const uint clr,ENUM_LINE_END end_style);
+   void              Segment(const int x1,const int y1,const int x2,const int y2,const double kp0,const double kp1,const int xsign,const int ysign,
+                             const double rcos_k,const double rsin_k,const double r,const uint clr,ENUM_LINE_END end_style);
+   double            DistancePointSegment(const double px,const double py,const double x1,const double y1,const double x2,const double y2);
+   //--- for pie
+   double            AngleCalc(int x1,int y1,int x2,int y2);
+   //--- for polygon
+   int               PointClassify(const CPoint &p0,const CPoint &p1,const CPoint &p2);
+   int               PolygonClassify(const CPoint &p[]);
+   bool              IsPolygonConvex(CPoint &p[]);
+   void              PolygonNormalize(CPoint &p[]);
+   void              PolygonIntersect(CPoint &p[],CPoint &add[]);
+   void              PolygonFill(CPoint &p[],const uint clr);
+   //--- for smoothing polyline and polygon
+   void              CalcCurveBezierEndp(const double xend,const double yend,const double xadj,const double yadj,const double tension,double &x,double &y);
+   void              CalcCurveBezier(const int &x[],const int &y[],const int i,const double tension,double &x1,double &y1,double &x2,double &y2);
+   double            CalcBezierX(const double t,const double x0,const double x1,const double x2,const double x3);
+   double            CalcBezierY(const double t,const double y0,const double y1,const double y2,const double y3);
+
+protected:
+   //--- method for prefiltered antialiasing
+   virtual double    FilterFunction(const double x);
+  };
+//+------------------------------------------------------------------+
+//| Initialize static array                                          |
+//+------------------------------------------------------------------+
+uint CCanvas::m_default_colors[9]=
+  {
+   XRGB(0,0,255),     // blue
+   XRGB(255,0,0),     // red
+   XRGB(0,128,0),     // green
+   XRGB(255,242,0),   // yellow
+   XRGB(255,0,128),   // pink
+   XRGB(0,255,0),     // lime
+   XRGB(185,0,61),    // crimson
+   XRGB(0,183,239),   // sky blue
+   XRGB(255,128,0)    // orange
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CCanvas::CCanvas(void) : m_chart_id(0),
+                         m_objname(NULL),
+                         m_objtype(WRONG_VALUE),
+                         m_rcname(NULL),
+                         m_width(0),
+                         m_height(0),
+                         m_format(COLOR_FORMAT_XRGB_NOALPHA),
+                         m_fontname("arial"),
+                         m_fontsize(-120),
+                         m_fontflags(0),
+                         m_fontangle(0),
+                         m_style(UINT_MAX),
+                         m_style_idx(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CCanvas::~CCanvas(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create dynamic resource                                          |
+//+------------------------------------------------------------------+
+bool CCanvas::Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+   Destroy();
+//--- prepare data array
+   if(width>0 && height>0 && ArrayResize(m_pixels,width*height)>0)
+     {
+      //--- generate resource name
+      m_rcname="::"+name+(string)(GetTickCount()+MathRand());
+      //--- initialize data with zeros
+      ArrayInitialize(m_pixels,0);
+      //--- create dynamic resource
+      if(ResourceCreate(m_rcname,m_pixels,width,height,0,0,0,clrfmt))
+        {
+         //--- successfully created
+         //--- complete initialization
+         m_width =width;
+         m_height=height;
+         m_format=clrfmt;
+         //--- succeed
+         return(true);
+        }
+     }
+//--- error - destroy object
+   Destroy();
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart with attached dynamic resource            |
+//+------------------------------------------------------------------+
+bool CCanvas::CreateBitmap(const string name,const datetime time,const double price,
+                           const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+   return(CreateBitmap(0,0,name,time,price,width,height,clrfmt));
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart with attached dynamic resource            |
+//+------------------------------------------------------------------+
+bool CCanvas::CreateBitmap(const long chart_id,const int subwin,const string name,
+                           const datetime time,const double price,const int width,const int height,
+                           ENUM_COLOR_FORMAT clrfmt)
+  {
+//--- create canvas
+   if(Create(name,width,height,clrfmt))
+     {
+      //--- create attached object
+      if(ObjectCreate(chart_id,name,OBJ_BITMAP,subwin,time,price))
+        {
+         //--- bind object with resource
+         if(ObjectSetString(chart_id,name,OBJPROP_BMPFILE,m_rcname))
+           {
+            //--- successfully created
+            //--- complete initialization
+            m_chart_id=chart_id;
+            m_objname =name;
+            m_objtype =OBJ_BITMAP;
+            //--- succeed
+            return(true);
+           }
+        }
+     }
+//--- error
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart with attached dynamic resource            |
+//+------------------------------------------------------------------+
+bool CCanvas::CreateBitmapLabel(const string name,const int x,const int y,
+                                const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+   return(CreateBitmapLabel(0,0,name,x,y,width,height,clrfmt));
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart with attached dynamic resource            |
+//+------------------------------------------------------------------+
+bool CCanvas::CreateBitmapLabel(const long chart_id,const int subwin,const string name,
+                                const int x,const int y,const int width,const int height,
+                                ENUM_COLOR_FORMAT clrfmt)
+  {
+//--- create canvas
+   if(Create(name,width,height,clrfmt))
+     {
+      //--- create attached object
+      if(ObjectCreate(chart_id,name,OBJ_BITMAP_LABEL,subwin,0,0))
+        {
+         //--- set x,y and bind object with resource
+         if(ObjectSetInteger(chart_id,name,OBJPROP_XDISTANCE,x) && 
+            ObjectSetInteger(chart_id,name,OBJPROP_YDISTANCE,y) && 
+            ObjectSetString(chart_id,name,OBJPROP_BMPFILE,m_rcname))
+           {
+            //--- successfully created
+            //--- complete initialization
+            m_chart_id=chart_id;
+            m_objname =name;
+            m_objtype =OBJ_BITMAP_LABEL;
+            //--- succeed
+            return(true);
+           }
+        }
+     }
+//--- error
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Attach new object with bitmap resource                           |
+//+------------------------------------------------------------------+
+bool CCanvas::Attach(const long chart_id,const string objname,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA)
+  {
+   if(OBJ_BITMAP_LABEL==ObjectGetInteger(chart_id,objname,OBJPROP_TYPE))
+     {
+      string rcname=ObjectGetString(chart_id,objname,OBJPROP_BMPFILE);
+      rcname=StringSubstr(rcname,StringFind(rcname,"::"));
+      if(ResourceReadImage(rcname,m_pixels,m_width,m_height))
+        {
+         m_objname=objname;
+         m_rcname=rcname;
+         m_format=clrfmt;
+         m_objtype=OBJ_BITMAP_LABEL;
+         //--- success
+         return(true);
+        }
+     }
+//--- failed
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Attach new object without bitmap resource                        |
+//+------------------------------------------------------------------+
+bool CCanvas::Attach(const long chart_id,const string objname,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA)
+  {
+   if(OBJ_BITMAP_LABEL==ObjectGetInteger(chart_id,objname,OBJPROP_TYPE))
+     {
+      string rcname=ObjectGetString(chart_id,objname,OBJPROP_BMPFILE);
+      if(StringLen(rcname)==0 && width>0 && height>0 && ArrayResize(m_pixels,width*height)>0)
+        {
+         ZeroMemory(m_pixels);
+         if(ResourceCreate("::"+objname,m_pixels,width,height,0,0,0,clrfmt) && 
+            ObjectSetString(chart_id,objname,OBJPROP_BMPFILE,"::"+objname))
+           {
+            m_width=width;
+            m_height=height;
+            m_objname=objname;
+            m_rcname="::"+objname;
+            m_format=clrfmt;
+            m_objtype=OBJ_BITMAP_LABEL;
+            //--- success
+            return(true);
+           }
+        }
+     }
+//--- failed
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Remove object from chart and deallocate data array               |
+//+------------------------------------------------------------------+
+void CCanvas::Destroy(void)
+  {
+//--- delete object
+   if(m_objname!=NULL)
+     {
+      ObjectDelete(m_chart_id,m_objname);
+      m_chart_id=0;
+      m_objname =NULL;
+      m_objtype =WRONG_VALUE;
+     }
+//--- deallocate array
+   ArrayFree(m_pixels);
+//--- free resource
+   if(m_rcname!=NULL)
+     {
+      ResourceFree(m_rcname);
+      m_rcname=NULL;
+     }
+//--- zeroize data
+   m_width =0;
+   m_height=0;
+  }
+//+------------------------------------------------------------------+
+//| Update object on screen (redraw)                                 |
+//+------------------------------------------------------------------+
+void CCanvas::Update(const bool redraw)
+  {
+//--- check
+   if(m_rcname==NULL)
+      return;
+//--- update resource and redraw
+   if(ResourceCreate(m_rcname,m_pixels,m_width,m_height,0,0,0,m_format) && redraw)
+      ChartRedraw(this.m_chart_id);
+  }
+//+------------------------------------------------------------------+
+//| Resize                                                           |
+//+------------------------------------------------------------------+
+bool CCanvas::Resize(const int width,const int height)
+  {
+//--- check
+   if(m_rcname!=NULL && width>0 && height>0)
+      if(ArrayResize(m_pixels,width*height)>0)
+        {
+         m_width =width;
+         m_height=height;
+         //--- initialize data with zeros
+         ArrayInitialize(m_pixels,0);
+         //--- create dynamic resource
+         if(ResourceCreate(m_rcname,m_pixels,m_width,m_height,0,0,0,m_format))
+           {
+            //--- bind object with resource
+            if(m_objname!=NULL && ObjectSetString(m_chart_id,m_objname,OBJPROP_BMPFILE,m_rcname))
+               return(true);
+           }
+        }
+//--- error
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Clear/Fill color                                                 |
+//+------------------------------------------------------------------+
+void CCanvas::Erase(const uint clr)
+  {
+   ArrayInitialize(m_pixels,clr);
+  }
+//+------------------------------------------------------------------+
+//| Get pixel color                                                  |
+//+------------------------------------------------------------------+
+uint CCanvas::PixelGet(const int x,const int y) const
+  {
+//--- check coordinates
+   if(x>=0 && x<m_width && y>=0 && y<m_height)
+      return(m_pixels[y*m_width+x]);
+//--- error
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Set pixel                                                        |
+//+------------------------------------------------------------------+
+void CCanvas::PixelSet(const int x,const int y,const uint clr)
+  {
+//--- check coordinates
+   if(x>=0 && x<m_width && y>=0 && y<m_height)
+      m_pixels[y*m_width+x]=clr;
+  }
+//+------------------------------------------------------------------+
+//| Fill closed region with color                                    |
+//+------------------------------------------------------------------+
+void CCanvas::Fill(int x,int y,const uint clr)
+  {
+//--- check
+   if(x<0 || x>=m_width || y<0 || y>=m_height)
+      return;
+//---
+   int  index=y*m_width+x;
+   uint old_clr=m_pixels[index];
+//--- check if replacement is necessary
+   if(old_clr==clr)
+      return;
+//--- use pseudo stack to emulate deeply-nested recursive calls
+   int  stack[];
+   uint count=1;
+   int  idx;
+   int  total=ArraySize(m_pixels);
+//--- allocate memory for stack
+   if(ArrayResize(stack,total)==-1)
+      return;
+   stack[0]=index;
+   m_pixels[index]=clr;
+   for(uint i=0;i<count;i++)
+     {
+      index=stack[i];
+      x=index%m_width;
+      //--- left adjacent point
+      idx=index-1;
+      if(x>0 && m_pixels[idx]==old_clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+      //--- top adjacent point
+      idx=index-m_width;
+      if(idx>=0 && m_pixels[idx]==old_clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+      //--- right adjacent point
+      idx=index+1;
+      if(x<m_width-1 && m_pixels[idx]==old_clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+      //--- bottom adjacent point
+      idx=index+m_width;
+      if(idx<total && m_pixels[idx]==old_clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+     }
+//--- deallocate memory
+   ArrayFree(stack);
+  }
+//+------------------------------------------------------------------+
+//| Fill closed region with color                                    |
+//+------------------------------------------------------------------+
+void CCanvas::Fill(int x,int y,const uint clr,const uint threshould)
+  {
+//--- check
+   if(threshould==0.0)
+     {
+      Fill(x,y,clr);
+      return;
+     }
+   if(x<0 || x>=m_width || y<0 || y>=m_height || threshould>255)
+      return;
+//---
+   int  index=y*m_width+x;
+   uint old_clr=m_pixels[index];
+//--- check if replacement is necessary
+   if(old_clr==clr)
+      return;
+//--- use pseudo stack to emulate deeply-nested recursive calls
+   int  stack[];
+   uint count=1;
+   int  idx;
+   int  total=ArraySize(m_pixels);
+//--- allocate memory for stack
+   if(ArrayResize(stack,total)==-1)
+      return;
+   stack[0]=index;
+   m_pixels[index]=clr;
+   for(uint i=0;i<count;i++)
+     {
+      index=stack[i];
+      x=index%m_width;
+      //--- left adjacent point
+      idx=index-1;
+      if(x>0 && PixelsSimilar(m_pixels[idx],old_clr,threshould) && m_pixels[idx]!=clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+      //--- top adjacent point
+      idx=index-m_width;
+      if(idx>=0 && PixelsSimilar(m_pixels[idx],old_clr,threshould) && m_pixels[idx]!=clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+      //--- right adjacent point
+      idx=index+1;
+      if(x<m_width-1 && PixelsSimilar(m_pixels[idx],old_clr,threshould) && m_pixels[idx]!=clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+      //--- bottom adjacent point
+      idx=index+m_width;
+      if(idx<total && PixelsSimilar(m_pixels[idx],old_clr,threshould) && m_pixels[idx]!=clr)
+        {
+         m_pixels[idx]=clr;
+         stack[count++]=idx;
+        }
+     }
+//--- deallocate memory
+   ArrayFree(stack);
+  }
+//+------------------------------------------------------------------+
+//| Draw vertical line                                               |
+//+------------------------------------------------------------------+
+void CCanvas::LineVertical(int x,int y1,int y2,const uint clr)
+  {
+   int tmp;
+//--- sort by Y
+   if(y1>y2)
+     {
+      tmp=y1;
+      y1 =y2;
+      y2 =tmp;
+     }
+//--- line is out of image boundaries
+   if(y2<0 || y1>=m_height || x<0 || x>=m_width)
+      return;
+//--- stay withing image boundaries
+   if(y1<0)
+      y1=0;
+   if(y2>=m_height)
+      y2=m_height-1;
+//--- draw line
+   int index=y1*m_width+x;
+   for(int i=y1;i<=y2;i++,index+=m_width)
+      m_pixels[index]=clr;
+  }
+//+------------------------------------------------------------------+
+//| Draw horizontal line                                             |
+//+------------------------------------------------------------------+
+void CCanvas::LineHorizontal(int x1,int x2,int y,const uint clr)
+  {
+   int tmp;
+//--- sort by X
+   if(x1>x2)
+     {
+      tmp=x1;
+      x1 =x2;
+      x2 =tmp;
+     }
+//--- line is out of image boundaries
+   if(x2<0 || x1>=m_width || y<0 || y>=m_height)
+      return;
+//--- stay withing image boundaries
+   if(x1<0)
+      x1=0;
+   if(x2>=m_width)
+      x2=m_width-1;
+//--- draw line
+   ArrayFill(m_pixels,y*m_width+x1,(x2-x1)+1,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw line according to Bresenham's algorithm                     |
+//+------------------------------------------------------------------+
+void CCanvas::Line(int x1,int y1,int x2,int y2,const uint clr)
+  {
+//--- line is out of image boundaries
+   if((x1<0 && x2<0) || (y1<0 && y2<0))
+      return;
+   if(x1>=m_width && x2>=m_width)
+      return;
+   if(y1>=m_height && y2>=m_height)
+      return;
+//--- get length by X and Y
+   int dx=(x2>x1)? x2-x1 : x1-x2;
+   int dy=(y2>y1)? y2-y1 : y1-y2;
+   if(dx==0)
+     {
+      //--- vertical line
+      LineVertical(x1,y1,y2,clr);
+      return;
+     }
+   if(dy==0)
+     {
+      //--- horizontal line
+      LineHorizontal(x1,x2,y1,clr);
+      return;
+     }
+//--- get direction by X and Y
+   int  sx=(x1<x2)? 1 : -1;
+   int  sy=(y1<y2)? 1 : -1;
+   int  er=dx-dy;
+   bool draw=false;
+//--- continue to draw line
+   while(x1!=x2 || y1!=y2)
+     {
+      if(x1<0 || x1>=m_width ||
+         y1<0 || y1>=m_height)
+        {
+         if(draw)
+            return;
+        }
+      else
+        {
+         //--- draw pixel
+         m_pixels[y1*m_width+x1]=clr;
+         draw=true;
+        }
+      //--- get coordinates of next pixel
+      int er2=er<<1;
+      if(er2>-dy)
+        {
+         er-=dy;
+         x1+=sx;
+        }
+      if(er2<dx)
+        {
+         er+=dx;
+         y1+=sy;
+        }
+     }
+//--- set pixel at the end
+   PixelSet(x2,y2,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw polyline                                                    |
+//+------------------------------------------------------------------+
+void CCanvas::Polyline(int &x[],int &y[],const uint clr)
+  {
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+   total--;
+//--- draw
+   for(int i=0;i<total;i++)
+      Line(x[i],y[i],x[i+1],y[i+1],clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw polygon                                                     |
+//+------------------------------------------------------------------+
+void CCanvas::Polygon(int &x[],int &y[],const uint clr)
+  {
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+   total--;
+//--- draw
+   for(int i=0;i<total;i++)
+      Line(x[i],y[i],x[i+1],y[i+1],clr);
+//--- close the outline
+   Line(x[total],y[total],x[0],y[0],clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw rectangle                                                   |
+//+------------------------------------------------------------------+
+void CCanvas::Rectangle(int x1,int y1,int x2,int y2,const uint clr)
+  {
+   LineHorizontal(x1,x2,y1,clr);
+   LineVertical(x2,y1,y2,clr);
+   LineHorizontal(x2,x1,y2,clr);
+   LineVertical(x1,y2,y1,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw triangle                                                    |
+//+------------------------------------------------------------------+
+void CCanvas::Triangle(int x1,int y1,int x2,int y2,int x3,int y3,const uint clr)
+  {
+   Line(x1,y1,x2,y2,clr);
+   Line(x2,y2,x3,y3,clr);
+   Line(x3,y3,x1,y1,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw circle according to Bresenham's algorithm                   |
+//+------------------------------------------------------------------+
+void CCanvas::Circle(int x,int y,int r,const uint clr)
+  {
+   int f   =1-r;
+   int dd_x=1;
+   int dd_y=-2*r;
+   int dx  =0;
+   int dy  =r;
+   int xx,yy;
+//--- draw
+   while(dy>=dx)
+     {
+      xx=x+dx;
+      if(xx>=0 && xx<m_width)
+        {
+         yy=y+dy;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+         yy=y-dy;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+        }
+      xx=x-dx;
+      if(xx>=0 && xx<m_width)
+        {
+         yy=y+dy;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+         yy=y-dy;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+        }
+      xx=x+dy;
+      if(xx>=0 && xx<m_width)
+        {
+         yy=y+dx;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+         yy=y-dx;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+        }
+      xx=x-dy;
+      if(xx>=0 && xx<m_width)
+        {
+         yy=y+dx;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+         yy=y-dx;
+         if(yy>=0 && yy<m_height)
+            m_pixels[yy*m_width+xx]=clr;
+        }
+      //---
+      if(f>=0)
+        {
+         dy--;
+         dd_y+=2;
+         f+=dd_y;
+        }
+      dx++;
+      dd_x+=2;
+      f+=dd_x;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw ellipse according to Bresenham's algorithm                  |
+//+------------------------------------------------------------------+
+void CCanvas::Ellipse(int x1,int y1,int x2,int y2,const uint clr)
+  {
+   int x,y;
+   int rx,ry;
+   int dx,dy;
+   int xx,yy;
+   int rx_sq,ry_sq;
+   int f;
+   int tmp;
+//--- handle extreme conditions
+   if(x1==x2)
+     {
+      if(y1==y2)
+         PixelSet(x1,y1,clr);
+      else
+         LineVertical(x1,y1,y2,clr);
+      return;
+     }
+   if(y1==y2)
+     {
+      LineHorizontal(x1,x2,y1,clr);
+      return;
+     }
+//--- sort by X
+   if(x1>x2)
+     {
+      tmp=x1;
+      x1 =x2;
+      x2 =tmp;
+     }
+//--- sort by Y
+   if(y1>y2)
+     {
+      tmp=y1;
+      y1 =y2;
+      y2 =tmp;
+     }
+   x =(x2+x1)>>1;
+   y =(y2+y1)>>1;
+   rx=(x2-x1)>>1;
+   ry=(y2-y1)>>1;
+   dx=0;
+   dy=ry;
+   rx_sq=rx*rx;
+   ry_sq=ry*ry;
+   f=(rx_sq<<1)*((dy-1)*dy)+rx_sq+(ry_sq<<1)*(1-rx_sq);
+   while(rx_sq*dy>ry_sq*dx)
+     {
+      yy=y+dy;
+      if(yy>=0 && yy<m_height)
+        {
+         yy*=m_width;
+         xx=x+dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+         xx=x-dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+        }
+      yy=y-dy;
+      if(yy>=0 && yy<m_height)
+        {
+         yy*=m_width;
+         xx=x+dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+         xx=x-dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+        }
+      if(f>=0)
+        {
+         dy--;
+         f-=(rx_sq<<2)*dy;
+        }
+      f+=(ry_sq<<1)*(3+(dx<<1));
+      dx++;
+     }
+   f=(ry_sq<<1)*(dx+1)*dx+(rx_sq<<1)*(dy*(dy-2)+1)+(1-(rx_sq<<1))*ry_sq;
+   while(dy>=0)
+     {
+      yy=y+dy;
+      if(yy>=0 && yy<m_height)
+        {
+         yy*=m_width;
+         xx=x+dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+         xx=x-dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+        }
+      yy=y-dy;
+      if(yy>=0 && yy<m_height)
+        {
+         yy*=m_width;
+         xx=x+dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+         xx=x-dx;
+         if(xx>=0 && xx<m_width)
+            m_pixels[yy+xx]=clr;
+        }
+      if(f<=0)
+        {
+         dx++;
+         f+=(ry_sq<<2)*dx;
+        }
+      dy--;
+      f+=(rx_sq<<1)*(3-(dy<<1));
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draws ellipse arc                                                |
+//+------------------------------------------------------------------+
+void CCanvas::Arc(int x1,int y1,int x2,int y2,int x3,int y3,int x4,int y4,const uint clr)
+  {
+   int    tmp;
+   int    x,y;
+   double fi3;
+   double fi4;
+//--- check
+   if(x1==x2 || y1==y2)
+      return;
+//--- sort by X
+   if(x1>x2)
+     {
+      tmp=x1;
+      x1 =x2;
+      x2 =tmp;
+     }
+//--- sort by Y
+   if(y1>y2)
+     {
+      tmp=y1;
+      y1 =y2;
+      y2 =tmp;
+     }
+   x =(x2+x1)>>1;
+   y =(y2+y1)>>1;
+//--- check rays
+   if(x3==x && y3==y)
+      return;
+   if(x4==x && y4==y)
+      return;
+//--- calculate parameters of ray x3,y3
+   fi3=AngleCalc(x,y,x3,y3);
+//--- calculate parameters of ray x4,y4
+   fi4=AngleCalc(x,y,x4,y4);
+//--- draw arc
+   Arc(x,y,x2-x,y2-y,fi3,fi4,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draws ellipse arc                                                |
+//+------------------------------------------------------------------+
+void CCanvas::Arc(int x,int y,int rx,int ry,double fi3,double fi4,const uint clr)
+  {
+   int x3,y3,x4,y4;
+//--- check
+   if(rx<10 || ry<10)
+      return;
+   if(rx<0)
+      rx=-rx;
+   if(ry<0)
+      ry=-ry;
+//--- check rays
+   if(fi3==fi4)
+      return;
+//--- adjustment for passing through 0
+   if(fi4<fi3)
+      fi4+=2*M_PI;
+//--- draw arc
+   Arc(x,y,rx,ry,fi3,fi4,x3,y3,x4,y4,clr);
+  }
+//+------------------------------------------------------------------+
+//| Calculates angle between ray (x1,y1),(x1+1,y1) and               |
+//|                          ray (x1,y1),(x2,y2)                     |
+//| Note that y coordinates are inversed 				                  |
+//+------------------------------------------------------------------+
+double CCanvas::AngleCalc(int x1,int y1,int x2,int y2)
+  {
+   double fi;
+//--- check
+   if(x1==x2)
+     {
+      if(y1==y2)
+         return(EMPTY_VALUE);
+      fi=(y2<y1) ? M_PI_2 : 3*M_PI_2;
+     }
+   else
+     {
+      //--- calc
+      fi=atan((double)(y1-y2)/(x2-x1));
+      //--- adjust to the 0-2Pi range
+      if(x2<x1)
+         fi+=M_PI;
+      else
+        {
+         if(fi<0)
+            fi+=2*M_PI;
+        }
+     }
+//--- result
+   return(fi);
+  }
+//+------------------------------------------------------------------+
+//| Draws ellipse arc and finds points of intersection with rays     |
+//+------------------------------------------------------------------+
+void CCanvas::Arc(int x,int y,int rx,int ry,double fi3,double fi4,int &x3,int &y3,int &x4,int &y4,const uint clr)
+  {
+//--- check
+   if(rx<10 || ry<10)
+      return;
+//--- variables
+   int dx,dy;
+   int xx,yy;
+   int rx_sq,ry_sq;
+   int f;
+   double fi;
+//--- to find intersections
+   bool   ray3=false;
+   bool   ray4=false;
+   bool   ckw=false;
+   int    xx_c=0,yy_c=0;
+   double fi_c=0.0;
+   bool   ackw=false;
+   int    xx_a=0,yy_a=0;
+   double fi_a=0.0;
+//---
+   rx_sq=rx*rx;
+   ry_sq=ry*ry;
+//--- cannot avoid check if each intersection point is between rays
+//--- this will significantly decrease drawing speed, but there is no other way
+//--- split ellipse into four arcs
+//---
+//--- 1 top
+//---
+//--- if arc is obviously not within the rays range, don't draw
+   fi=MathMod(fi4,2*M_PI);
+   if((fi3<M_PI && fi3>0) ||  // ray 3 is in the 1st or 2nd quadrant
+      (fi<M_PI && fi>0)   ||  // ray 4 is in the 1st or 2nd quadrant
+      (fi4-fi3>=M_PI))        // arc will pass through the top of the ellipse
+     {
+      dx=0;
+      dy=ry;
+      f=(rx_sq<<1)*((dy-1)*dy)+rx_sq+(ry_sq<<1)*(1-rx_sq);
+      while(rx_sq*dy>=ry_sq*dx)
+        {
+         yy=y-dy;
+         if(dx==0)
+           {
+            //--- central point
+            fi=AngleCalc(0,0,0,-dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(x,yy,clr);
+               ckw=ackw=true;
+              }
+            else
+               ckw=ackw=false;
+            xx_c=x;
+            yy_c=yy;
+            fi_c=fi;
+            xx_a=x;
+            yy_a=yy;
+            fi_a=fi;
+           }
+         else
+           {
+            //--- iterate clockwise
+            xx=x+dx;
+            fi=AngleCalc(0,0,dx,-dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 4 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(!ckw)
+                 {
+                  ckw=true;
+                  if(!ray4)
+                    {
+                     if(MathAbs(fi_c-MathMod(fi4,2*M_PI))<MathAbs(fi-MathMod(fi4,2*M_PI)))
+                        PixelSet(x4=xx_c,y4=yy_c,clr);
+                     else
+                       {
+                        x4=xx;
+                        y4=yy;
+                       }
+                     ray4=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(ckw && !ray3)
+                 {
+                  if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+                     PixelSet(x3=xx,y3=yy,clr);
+                  else
+                    {
+                     x3=xx_c;
+                     y3=yy_c;
+                    }
+                  ray3=true;
+                 }
+               ckw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_c=xx;
+            yy_c=yy;
+            fi_c=fi;
+            //--- iterate counterclockwise
+            xx=x-dx;
+            fi=AngleCalc(0,0,-dx,-dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(!ackw)
+                 {
+                  ackw=true;
+                  if(!ray3)
+                    {
+                     if(MathAbs(fi_a-fi3)<MathAbs(fi-fi3))
+                        PixelSet(x3=xx_a,y3=yy_a,clr);
+                     else
+                       {
+                        x3=xx;
+                        y3=yy;
+                       }
+                     ray3=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(ackw && !ray4)
+                 {
+                  if(MathAbs(fi_a-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+                     PixelSet(x4=xx,y4=yy,clr);
+                  else
+                    {
+                     x4=xx_a;
+                     y4=yy_a;
+                    }
+                  ray4=true;
+                 }
+               ackw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_a=xx;
+            yy_a=yy;
+            fi_a=fi;
+           }
+         //--- calculate coordinates of the next point
+         if(f>=0)
+           {
+            dy--;
+            f-=(rx_sq<<2)*dy;
+           }
+         f+=(ry_sq<<1)*(3+(dx<<1));
+         dx++;
+        }
+      //--- if arc has been drawn clockwise "to the end" and ray 3 had not been found
+      if(ckw && !ray3)
+        {
+         fi=AngleCalc(0,0,dx,-dy);
+         if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+            PixelSet(x3=x+dx,y3=y-dy,clr);
+         else
+           {
+            x3=xx_c;
+            y3=yy_c;
+           }
+        }
+      //--- if arc has been drawn counterclockwise "to the end" and ray 4 had not been found
+      if(ackw && !ray4)
+        {
+         fi=AngleCalc(0,0,-dx,-dy);
+         if(MathAbs(fi_a-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+            PixelSet(x4=x-dx,y4=y-dy,clr);
+         else
+           {
+            x4=xx_a;
+            y4=yy_a;
+           }
+        }
+     }
+//--- 2 left
+//---
+//--- if arc is obviously not within the rays range, don't draw
+   fi=MathMod(fi4,2*M_PI);
+   if((fi3>M_PI_2 && fi3<3*M_PI_2) ||  // ray 3 is in the 2nd or 3rd quadrant
+      (fi>M_PI_2 && fi<3*M_PI_2)   ||  // ray 4 is in the 2nd or 3rd quadrant
+      (fi4-fi3>=M_PI))                 // arc will pass through the left part of the ellipse
+     {
+      dx=rx;
+      dy=0;
+      f=(ry_sq<<1)*((dx-1)*dx)+ry_sq+(rx_sq<<1)*(1-ry_sq);
+      while(ry_sq*dx>=rx_sq*dy)
+        {
+         xx=x-dx;
+         if(dy==0)
+           {
+            //--- central point
+            fi=AngleCalc(0,0,-dx,0);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,y,clr);
+               ckw=ackw=true;
+              }
+            else
+               ckw=ackw=false;
+            xx_c=xx;
+            yy_c=y;
+            fi_c=fi;
+            xx_a=xx;
+            yy_a=y;
+            fi_a=fi;
+           }
+         else
+           {
+            //--- iterate clockwise
+            yy=y-dy;
+            fi=AngleCalc(0,0,-dx,-dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 4 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(!ckw)
+                 {
+                  ckw=true;
+                  if(!ray4)
+                    {
+                     if(MathAbs(fi_c-MathMod(fi4,2*M_PI))<MathAbs(fi-MathMod(fi4,2*M_PI)))
+                        PixelSet(x4=xx_c,y4=yy_c,clr);
+                     else
+                       {
+                        x4=xx;
+                        y4=yy;
+                       }
+                     ray4=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(ckw && !ray3)
+                 {
+                  if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+                     PixelSet(x3=xx,y3=yy,clr);
+                  else
+                    {
+                     x3=xx_c;
+                     y3=yy_c;
+                    }
+                  ray3=true;
+                 }
+               ckw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_c=xx;
+            yy_c=yy;
+            fi_c=fi;
+            //--- iterate counterclockwise
+            yy=y+dy;
+            fi=AngleCalc(0,0,-dx,dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(!ackw)
+                 {
+                  ackw=true;
+                  if(!ray3)
+                    {
+                     if(MathAbs(fi_a-fi3)<MathAbs(fi-fi3))
+                        PixelSet(x3=xx_a,y3=yy_a,clr);
+                     else
+                       {
+                        x3=xx;
+                        y3=yy;
+                       }
+                     ray3=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(ackw && !ray4)
+                 {
+                  if(MathAbs(fi_a-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+                     PixelSet(x4=xx,y4=yy,clr);
+                  else
+                    {
+                     x4=xx_a;
+                     y4=yy_a;
+                    }
+                  ray4=true;
+                 }
+               ackw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_a=xx;
+            yy_a=yy;
+            fi_a=fi;
+           }
+         //--- calculate coordinates of the next point
+         if(f>=0)
+           {
+            dx--;
+            f-=(ry_sq<<2)*dx;
+           }
+         f+=(rx_sq<<1)*(3+(dy<<1));
+         dy++;
+        }
+      //--- if arc has been drawn clockwise "to the end" and ray 3 had not been found
+      if(ckw && !ray3)
+        {
+         fi=AngleCalc(0,0,-dx,-dy);
+         if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+            PixelSet(x3=x-dx,y3=y-dy,clr);
+         else
+           {
+            x3=xx_c;
+            y3=yy_c;
+           }
+        }
+      //--- if arc has been drawn counterclockwise "to the end" and ray 4 had not been found
+      if(ackw && !ray4)
+        {
+         fi=AngleCalc(0,0,-dx,dy);
+         if(MathAbs(fi_a-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+            PixelSet(x4=x-dx,y4=y+dy,clr);
+         else
+           {
+            x4=xx_a;
+            y4=yy_a;
+           }
+        }
+     }
+//--- 3 bottom
+//---
+//--- if arc is obviously not within the rays range, don't draw
+   fi=MathMod(fi4,2*M_PI);
+   if((fi3>M_PI && fi3<2*M_PI) ||  // ray 3 is in the 3rd or 4th quadrant
+      (fi>M_PI && fi<2*M_PI)   ||  // ray 4 is in the 3rd or 4th quadrant
+      (fi4-fi3>=M_PI))             // arc will pass through the bottom of the ellipse
+     {
+      dx=0;
+      dy=ry;
+      f=(rx_sq<<1)*((dy-1)*dy)+rx_sq+(ry_sq<<1)*(1-rx_sq);
+      while(rx_sq*dy>=ry_sq*dx)
+        {
+         yy=y+dy;
+         if(dx==0)
+           {
+            //--- central point
+            fi=AngleCalc(0,0,0,dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(x,yy,clr);
+               ckw=ackw=true;
+              }
+            else
+               ckw=ackw=false;
+            xx_c=x;
+            yy_c=yy;
+            fi_c=fi;
+            xx_a=x;
+            yy_a=yy;
+            fi_a=fi;
+           }
+         else
+           {
+            //--- iterate clockwise
+            xx=x-dx;
+            fi=AngleCalc(0,0,-dx,dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 4 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(!ckw)
+                 {
+                  ckw=true;
+                  if(!ray4)
+                    {
+                     if(MathAbs(fi_c-MathMod(fi4,2*M_PI))<MathAbs(fi-MathMod(fi4,2*M_PI)))
+                        PixelSet(x4=xx_c,y4=yy_c,clr);
+                     else
+                       {
+                        x4=xx;
+                        y4=yy;
+                       }
+                     ray4=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(ckw && !ray3)
+                 {
+                  if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+                     PixelSet(x3=xx,y3=yy,clr);
+                  else
+                    {
+                     x3=xx_c;
+                     y3=yy_c;
+                    }
+                  ray3=true;
+                 }
+               ckw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_c=xx;
+            yy_c=yy;
+            fi_c=fi;
+            //--- iterate counterclockwise
+            xx=x+dx;
+            fi=AngleCalc(0,0,dx,dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(!ackw)
+                 {
+                  ackw=true;
+                  if(!ray3)
+                    {
+                     if(MathAbs(fi_a-fi3)<MathAbs(fi-fi3))
+                        PixelSet(x3=xx_a,y3=yy_a,clr);
+                     else
+                       {
+                        x3=xx;
+                        y3=yy;
+                       }
+                     ray3=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(ackw && !ray4)
+                 {
+                  if(MathAbs(fi_a-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+                     PixelSet(x4=xx,y4=yy,clr);
+                  else
+                    {
+                     x4=xx_a;
+                     y4=yy_a;
+                    }
+                  ray4=true;
+                 }
+               ackw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_a=xx;
+            yy_a=yy;
+            fi_a=fi;
+           }
+         //--- calculate coordinates of the next point
+         if(f>=0)
+           {
+            dy--;
+            f-=(rx_sq<<2)*dy;
+           }
+         f+=(ry_sq<<1)*(3+(dx<<1));
+         dx++;
+        }
+      //--- if arc has been drawn clockwise "to the end" and ray 3 had not been found
+      if(ckw && !ray3)
+        {
+         fi=AngleCalc(0,0,-dx,dy);
+         if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+            PixelSet(x3=x-dx,y3=y+dy,clr);
+         else
+           {
+            x3=xx_c;
+            y3=yy_c;
+           }
+        }
+      //--- if arc has been drawn counterclockwise "to the end" and ray 4 had not been found
+      if(ackw && !ray4)
+        {
+         fi=AngleCalc(0,0,dx,dy);
+         if(MathAbs(fi_a-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+            PixelSet(x4=x+dx,y4=y+dy,clr);
+         else
+           {
+            x4=xx_a;
+            y4=yy_a;
+           }
+        }
+     }
+//--- 4 right
+//---
+//--- if arc is obviously not within the rays range, don't draw
+   fi=MathMod(fi4,2*M_PI);
+   if((fi3<M_PI_2 || fi3>3*M_PI_2) ||  // ray 3 is 1 or 4 quadrant
+      (fi<M_PI_2 || fi>3*M_PI_2)   ||  // ray 4 is 1 or 4 quadrant
+      (fi4-fi3>=M_PI))                 // arc will pass through the right side of the ellipse
+     {
+      dx=rx;
+      dy=0;
+      f=(ry_sq<<1)*((dx-1)*dx)+ry_sq+(rx_sq<<1)*(1-ry_sq);
+      while(ry_sq*dx>=rx_sq*dy)
+        {
+         xx=x+dx;
+         if(dy==0)
+           {
+            //--- central point
+            fi=AngleCalc(0,0,dx,0);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,y,clr);
+               ckw=ackw=true;
+              }
+            else
+               ckw=ackw=false;
+            xx_c=xx;
+            yy_c=y;
+            fi_c=fi;
+            xx_a=xx;
+            yy_a=y;
+            fi_a=fi;
+           }
+         else
+           {
+            //--- iterate clockwise
+            yy=y+dy;
+            fi=AngleCalc(0,0,dx,dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 4 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(!ckw)
+                 {
+                  ckw=true;
+                  if(!ray4)
+                    {
+                     if(MathAbs(fi_c-MathMod(fi4,2*M_PI))<MathAbs(fi-MathMod(fi4,2*M_PI)))
+                        PixelSet(x4=xx_c,y4=yy_c,clr);
+                     else
+                       {
+                        x4=xx;
+                        y4=yy;
+                       }
+                     ray4=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(ckw && !ray3)
+                 {
+                  if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+                     PixelSet(x3=xx,y3=yy,clr);
+                  else
+                    {
+                     x3=xx_c;
+                     y3=yy_c;
+                    }
+                  ray3=true;
+                 }
+               ckw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_c=xx;
+            yy_c=yy;
+            fi_c=fi;
+            //--- iterate counterclockwise
+            yy=y-dy;
+            fi=AngleCalc(0,0,dx,-dy);
+            if((fi<=fi4 && fi3<=fi) || (fi4>=2*M_PI && fi<=fi4-2*M_PI))
+              {
+               PixelSet(xx,yy,clr);
+               //--- if arc haven't been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 3
+               if(!ackw)
+                 {
+                  ackw=true;
+                  if(!ray3)
+                    {
+                     if(MathAbs(MathMod(fi_a,2*M_PI)-fi3)<MathAbs(fi-fi3))
+                        PixelSet(x3=xx_a,y3=yy_a,clr);
+                     else
+                       {
+                        x3=xx;
+                        y3=yy;
+                       }
+                     ray3=true;
+                    }
+                 }
+              }
+            else
+              {
+               //--- if arc has been drawn before and intersection point of ray 3 and arc is not defined
+               //--- this means that we (while iterating over points of the ellipse) had just crossed ray 4
+               if(ackw && !ray4)
+                 {
+                  if(MathAbs(MathMod(fi_a,2*M_PI)-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+                     PixelSet(x4=xx,y4=yy,clr);
+                  else
+                    {
+                     x4=xx_a;
+                     y4=yy_a;
+                    }
+                  ray4=true;
+                 }
+               ackw=false;
+              }
+            //--- save parameters of the last iteration
+            xx_a=xx;
+            yy_a=yy;
+            fi_a=fi;
+           }
+         //--- calculate coordinates of the next point
+         if(f>=0)
+           {
+            dx--;
+            f-=(ry_sq<<2)*dx;
+           }
+         f+=(rx_sq<<1)*(3+(dy<<1));
+         dy++;
+        }
+      //--- if arc has been drawn clockwise "to the end" and ray 3 had not been found
+      if(ckw && !ray3)
+        {
+         fi=AngleCalc(0,0,dx,dy);
+         if(MathAbs(fi_c-fi3)>MathAbs(fi-fi3))
+            PixelSet(x3=x+dx,y3=y+dy,clr);
+         else
+           {
+            x3=xx_c;
+            y3=yy_c;
+           }
+        }
+      //--- if arc has been drawn counterclockwise "to the end" and ray 4 had not been found
+      if(ackw && !ray4)
+        {
+         fi=AngleCalc(0,0,dx,-dy);
+         if(MathAbs(MathMod(fi_a,2*M_PI)-MathMod(fi4,2*M_PI))>MathAbs(fi-MathMod(fi4,2*M_PI)))
+            PixelSet(x4=x+dx,y4=y-dy,clr);
+         else
+           {
+            x4=xx_a;
+            y4=yy_a;
+           }
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draws ellipse pie                                                |
+//+------------------------------------------------------------------+
+void CCanvas::Pie(int x1,int y1,int x2,int y2,int x3,int y3,int x4,int y4,const uint clr,const uint fill_clr)
+  {
+   int tmp;
+   int x,y;
+//---
+   double fi3;
+   double fi4;
+//--- check
+   if(x1==x2 || y1==y2)
+      return;
+//--- sort by X
+   if(x1>x2)
+     {
+      tmp=x1;
+      x1 =x2;
+      x2 =tmp;
+     }
+//--- sort by Y
+   if(y1>y2)
+     {
+      tmp=y1;
+      y1 =y2;
+      y2 =tmp;
+     }
+   x =(x2+x1)>>1;
+   y =(y2+y1)>>1;
+//--- check rays
+   if(x3==x && y3==y)
+      return;
+   if(x4==x && y4==y)
+      return;
+//--- calculate parameters of ray x3,y3
+   fi3=AngleCalc(x,y,x3,y3);
+//--- calculate parameters of ray x4,y4
+   fi4=AngleCalc(x,y,x4,y4);
+//--- draw pie
+   Pie(x,y,x2-x,y2-y,fi3,fi4,clr,fill_clr);
+  }
+//+------------------------------------------------------------------+
+//| Draws ellipse pie                                                |
+//+------------------------------------------------------------------+
+void CCanvas::Pie(int x,int y,int rx,int ry,double fi3,double fi4,const uint clr,const uint fill_clr)
+  {
+   int x3=x;
+   int y3=y;
+   int x4=x;
+   int y4=y;
+//--- check
+   if(rx==0 || ry==0)
+      return;
+   if(rx<0)
+      rx=-rx;
+   if(ry<0)
+      ry=-ry;
+//--- check rays
+   if(fi3==fi4)
+      return;
+//--- adjustment for passing through 0
+   if(fi4<fi3)
+      fi4+=2*M_PI;
+//--- draw arc and radii
+   Arc(x,y,rx,ry,fi3,fi4,x3,y3,x4,y4,clr);
+   if((x==x3 && y==y3) || (x==x4 && y==y4))
+      return;
+   Line(x,y,x3,y3,clr);
+   Line(x,y,x4,y4,clr);
+//--- fill
+   if(rx>ry)
+      rx=ry;
+   double fi=(fi3+fi4)/2;
+   int xf=x+(int)(0.9*rx*cos(fi));
+   int yf=y-(int)(0.9*rx*sin(fi));
+   Fill(xf,yf,fill_clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw filled circle                                               |
+//+------------------------------------------------------------------+
+void CCanvas::FillCircle(int x,int y,int r,const uint clr)
+  {
+   int f   =1-r;
+   int dd_x=1;
+   int dd_y=-2*r;
+   int dx  =0;
+   int dy  =r;
+//--- draw
+   while(dy>=dx)
+     {
+      LineHorizontal(x-dy,x+dy,y-dx,clr);
+      LineHorizontal(x-dy,x+dy,y+dx,clr);
+      //---
+      if(f>=0)
+        {
+         LineHorizontal(x-dx,x+dx,y-dy,clr);
+         LineHorizontal(x-dx,x+dx,y+dy,clr);
+         dy--;
+         dd_y+=2;
+         f+=dd_y;
+        }
+      dx++;
+      dd_x+=2;
+      f+=dd_x;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw filled ellipse                                              |
+//+------------------------------------------------------------------+
+void CCanvas::FillEllipse(int x1,int y1,int x2,int y2,const uint clr)
+  {
+   int x,y;
+   int rx,ry;
+   int dx,dy;
+   int rx_sq,ry_sq;
+   int f;
+   int tmp;
+//--- handle extreme conditions
+   if(x1==x2)
+     {
+      if(y1==y2)
+         PixelSet(x1,y1,clr);
+      else
+         LineVertical(x1,y1,y2,clr);
+      return;
+     }
+   if(y1==y2)
+     {
+      LineHorizontal(x1,x2,y1,clr);
+      return;
+     }
+//--- sort by X
+   if(x1>x2)
+     {
+      tmp=x1;
+      x1 =x2;
+      x2 =tmp;
+     }
+//--- sort by Y
+   if(y1>y2)
+     {
+      tmp=y1;
+      y1 =y2;
+      y2 =tmp;
+     }
+   x =(x2+x1)>>1;
+   y =(y2+y1)>>1;
+   rx=(x2-x1)>>1;
+   ry=(y2-y1)>>1;
+   dx=0;
+   dy=ry;
+   rx_sq=rx*rx;
+   ry_sq=ry*ry;
+   f=(rx_sq<<1)*((dy-1)*dy)+rx_sq+(ry_sq<<1)*(1-rx_sq);
+   while(rx_sq*dy>ry_sq*(dx))
+     {
+      LineHorizontal(x-dx,x+dx,y+dy,clr);
+      LineHorizontal(x-dx,x+dx,y-dy,clr);
+      if(f>=0)
+        {
+         dy--;
+         f-=(rx_sq<<2)*dy;
+        }
+      f+=(ry_sq<<1)*(3+(dx<<1));
+      dx++;
+     }
+   f=(ry_sq<<1)*(dx+1)*dx+(rx_sq<<1)*(dy*(dy-2)+1)+(1-(rx_sq<<1))*ry_sq;
+   while(dy>=0)
+     {
+      LineHorizontal(x-dx,x+dx,y+dy,clr);
+      LineHorizontal(x-dx,x+dx,y-dy,clr);
+      if(f<=0)
+        {
+         dx++;
+         f+=(ry_sq<<2)*dx;
+        }
+      dy--;
+      f+=(rx_sq<<1)*(3-(dy<<1));
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw filled rectangle                                            |
+//+------------------------------------------------------------------+
+void CCanvas::FillRectangle(int x1,int y1,int x2,int y2,const uint clr)
+  {
+   int tmp;
+//--- sort vertexes
+   if(x2<x1)
+     {
+      tmp=x1;
+      x1 =x2;
+      x2 =tmp;
+     }
+   if(y2<y1)
+     {
+      tmp=y1;
+      y1 =y2;
+      y2 =tmp;
+     }
+//--- out of screen boundaries
+   if(x2<0 || y2<0 || x1>=m_width || y1>=m_height)
+      return;
+//--- stay withing screen boundaries
+   if(x1<0)
+      x1=0;
+   if(y1<0)
+      y1=0;
+   if(x2>=m_width)
+      x2=m_width -1;
+   if(y2>=m_height)
+      y2=m_height-1;
+   int len=(x2-x1)+1;
+//--- set pixels
+   for(;y1<=y2;y1++)
+      ArrayFill(m_pixels,y1*m_width+x1,len,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw filled triangle                                             |
+//+------------------------------------------------------------------+
+void CCanvas::FillTriangle(int x1,int y1,int x2,int y2,int x3,int y3,const uint clr)
+  {
+   int    xx1,xx2,tmp;
+   double k1=0,k2=0,xd1,xd2;
+//--- sort vertexes from lesser to greater
+   if(y1>y2)
+     {
+      tmp=y2;
+      y2 =y1;
+      y1 =tmp;
+      tmp=x2;
+      x2 =x1;
+      x1=tmp;
+     }
+   if(y1>y3)
+     {
+      tmp=y1;
+      y1 =y3;
+      y3 =tmp;
+      tmp=x1;
+      x1 =x3;
+      x3 =tmp;
+     }
+   if(y2>y3)
+     {
+      tmp=y2;
+      y2 =y3;
+      y3 =tmp;
+      tmp=x2;
+      x2 =x3;
+      x3 =tmp;
+     }
+//--- all vertexes are out of image boundaries
+   if(y3<0 || y1>m_height)
+      return;
+   if(x1<0 && x2<0 && x3<0)
+      return;
+   if(x1>m_width && x2>m_width && x3>m_width)
+      return;
+//--- find coefficients of lines
+   if((tmp=y1-y2)!=0)
+      k1=(x1-x2)/(double)tmp;
+   if((tmp=y1-y3)!=0)
+      k2=(x1-x3)/(double)tmp;
+//---
+   xd1=x1;
+   xd2=x1;
+//---
+   for(int i=y1;i<=y3;i++)
+     {
+      if(i==y2)
+        {
+         if((tmp=y2-y3)!=0)
+            k1=(x2-x3)/(double)tmp;
+         xd1=x2;
+        }
+      //--- calculate new boundaries of triangle line
+      xx1 =(int)xd1;
+      xd1+=k1;
+      xx2 =(int)xd2;
+      xd2+=k2;
+      //--- triangle line is out of screen boundaries
+      if(i<0 || i>=m_height)
+         continue;
+      //--- sort
+      if(xx1>xx2)
+        {
+         tmp=xx1;
+         xx1=xx2;
+         xx2=tmp;
+        }
+      //--- line is out of screen boundaries
+      if(xx2<0 || xx1>=m_width)
+         continue;
+      //--- draw only what is within screen boundaries
+      if(xx1<0)
+         xx1=0;
+      if(xx2>=m_width)
+         xx2=m_width-1;
+      //--- draw horizontal line of triangle
+      ArrayFill(m_pixels,i*m_width+xx1,xx2-xx1,clr);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw filled poligon                                              |
+//+------------------------------------------------------------------+
+void CCanvas::FillPolygon(int &x[],int &y[],const uint clr)
+  {
+   static CPoint p[];
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<3)
+      return;
+//--- resize array of points
+   ArrayResize(p,total);
+//--- find top-left point
+   int imin=0;
+   int xmin=x[0];
+   int ymin=y[0];
+   for(int i=1;i<total;i++)
+     {
+      if(y[i]>ymin)
+         continue;
+      if(y[i]==ymin)
+        {
+         if(x[i]<xmin)
+           {
+            xmin=x[i];
+            imin=i;
+           }
+         continue;
+        }
+      xmin=x[i];
+      ymin=y[i];
+      imin=i;
+     }
+//--- copy coordinates arrays to array of pixels (starting from top-left)
+   for(int i=0;i<total;i++,imin++)
+     {
+      p[i].x=x[imin%total];
+      p[i].y=y[imin%total];
+     }
+   PolygonFill(p,clr);
+   ArrayFree(p);
+  }
+//+------------------------------------------------------------------+
+//| Draw pixel with antialiasing                                     |
+//+------------------------------------------------------------------+
+void CCanvas::PixelSetAA(const double x,const double y,const uint clr)
+  {
+   static double rr[4];
+   static int    xx[4];
+   static int    yy[4];
+//--- preliminary calculations
+   int    ix=(int)MathRound(x);
+   int    iy=(int)MathRound(y);
+   double rrr=0;
+   double k;
+   double dx=x-ix;
+   double dy=y-iy;
+   uchar  a,r,g,b;
+   uint   c;
+//--- no need for anti-aliasing
+   if(dx==0.0 && dy==0.0)
+     {
+      PixelSet(ix,iy,clr);
+      return;
+     }
+//--- prepare array of pixels
+   xx[0]=xx[2]=ix;
+   yy[0]=yy[1]=iy;
+   if(dx<0.0)
+      xx[1]=xx[3]=ix-1;
+   if(dx==0.0)
+      xx[1]=xx[3]=ix;
+   if(dx>0.0)
+      xx[1]=xx[3]=ix+1;
+   if(dy<0.0)
+      yy[2]=yy[2]=iy-1;
+   if(dy==0.0)
+      yy[2]=yy[2]=iy;
+   if(dy>0.0)
+      yy[2]=yy[2]=iy+1;
+//--- calculate radii and sum of their squares
+   for(int i=0;i<4;i++)
+     {
+      dx=xx[i]-x;
+      dy=yy[i]-y;
+      rr[i]=1/(dx*dx+dy*dy);
+      rrr+=rr[i];
+     }
+//--- draw pixels
+   for(int i=0;i<4;i++)
+     {
+      k=rr[i]/rrr;
+      c=PixelGet(xx[i],yy[i]);
+      a=(uchar)(k*GETRGBA(clr)+(1-k)*GETRGBA(c));
+      r=(uchar)(k*GETRGBR(clr)+(1-k)*GETRGBR(c));
+      g=(uchar)(k*GETRGBG(clr)+(1-k)*GETRGBG(c));
+      b=(uchar)(k*GETRGBB(clr)+(1-k)*GETRGBB(c));
+      PixelSet(xx[i],yy[i],ARGB(a,r,g,b));
+     }
+  }
+//+------------------------------------------------------------------+
+//| Get line style                                                   |
+//+------------------------------------------------------------------+
+uint CCanvas::LineStyleGet(void) const
+  {
+   switch(m_style)
+     {
+      case 0xFFFFFF:
+         return(STYLE_SOLID);
+         break;
+      case 0x3FFFF:
+         return(STYLE_DASH);
+         break;
+      case 0x1C71C7:
+         return(STYLE_DOT);
+         break;
+      case 0x381FF:
+         return(STYLE_DASHDOT);
+         break;
+      case 0x1C71FF:
+         return(STYLE_DASHDOTDOT);
+         break;
+      default:
+         return (m_style);
+         break;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Set line style                                                   |
+//+------------------------------------------------------------------+
+void CCanvas::LineStyleSet(const uint style)
+  {
+   switch(style)
+     {
+      case STYLE_SOLID:
+         m_style=0xFFFFFF;
+         break;
+      case STYLE_DASH:
+         m_style=0x3FFFF;
+         break;
+      case STYLE_DOT:
+         m_style=0x1C71C7;
+         break;
+      case STYLE_DASHDOT:
+         m_style=0x381FF;
+         break;
+      case STYLE_DASHDOTDOT:
+         m_style=0x1C71FF;
+         break;
+      default:
+         //--- high-order bit must be set then custom style
+         if((style&0x80000000)!=0)
+           {
+            m_style=style;
+           }
+         break;
+     }
+   m_style_idx=0;
+  }
+//+------------------------------------------------------------------+
+//| Draw line with antialiasing (with style)                         |
+//+------------------------------------------------------------------+
+void CCanvas::LineAA(const int x1,const int y1,const int x2,const int y2,const uint clr,const uint style)
+  {
+//--- line is out of image boundaries
+   if((x1<0 && x2<0) || (y1<0 && y2<0))
+      return;
+   if(x1>=m_width && x2>=m_width)
+      return;
+   if(y1>=m_height && y2>=m_height)
+      return;
+//--- check
+   if(x1==x2 && y1==y2)
+     {
+      PixelSet(x1,y1,clr);
+      return;
+     }
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+//--- preliminary calculations
+   double dx=x2-x1;
+   double dy=y2-y1;
+   double xy=sqrt(dx*dx+dy*dy);
+   double xx=x1;
+   double yy=y1;
+   uint   mask=1<<m_style_idx;
+//--- set pixels
+   dx/=xy;
+   dy/=xy;
+   do
+     {
+      if((m_style&mask)==mask)
+        {
+         PixelSetAA(xx,yy,clr);
+        }
+      xx+=dx;
+      yy+=dy;
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+   while(fabs(x2-xx)>=fabs(dx) && fabs(y2-yy)>=fabs(dy));
+//--- set last pixel
+   if((m_style&mask)==mask)
+     {
+      PixelSetAA(x2,y2,clr);
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw polyline with antialiasing (with style)                     |
+//+------------------------------------------------------------------+
+void CCanvas::PolylineAA(int &x[],int &y[],const uint clr,const uint style)
+  {
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+   total--;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw
+   for(int i=0;i<total;i++)
+     {
+      int x1=x[i];
+      int y1=y[i];
+      int x2=x[i+1];
+      int y2=y[i+1];
+      //--- line is out of image boundaries
+      if((x1<0 && x2<0) || (y1<0 && y2<0))
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      if(x1>=m_width && x2>=m_width)
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      if(y1>=m_height && y2>=m_height)
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      //--- check
+      if(x1==x2 && y1==y2)
+        {
+         PixelSet(x1,y1,clr);
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      //--- preliminary calculations
+      double dx=x2-x1;
+      double dy=y2-y1;
+      double xy=sqrt(dx*dx+dy*dy);
+      double xx=x1;
+      double yy=y1;
+      //--- set pixels
+      dx/=xy;
+      dy/=xy;
+      do
+        {
+         if((m_style&mask)==mask)
+           {
+            PixelSetAA(xx,yy,clr);
+           }
+         xx+=dx;
+         yy+=dy;
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      while(fabs(x2-xx)>=fabs(dx) && fabs(y2-yy)>=fabs(dy));
+      //--- set last pixel
+      if((m_style&mask)==mask)
+        {
+         PixelSetAA(x2,y2,clr);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw polygon with antialiasing (with style)                      |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonAA(int &x[],int &y[],const uint clr,const uint style)
+  {
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw
+   for(int i=0;i<total;i++)
+     {
+      int x1=x[i];
+      int y1=y[i];
+      int x2=(i+1!=total) ? x[i+1] : x[0];
+      int y2=(i+1!=total) ? y[i+1] : y[0];
+      //--- line is out of image boundaries
+      if((x1<0 && x2<0) || (y1<0 && y2<0))
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      if(x1>=m_width && x2>=m_width)
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      if(y1>=m_height && y2>=m_height)
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      //--- check
+      if(x1==x2 && y1==y2)
+        {
+         PixelSet(x1,y1,clr);
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      //--- preliminary calculations
+      double dx=x2-x1;
+      double dy=y2-y1;
+      double xy=sqrt(dx*dx+dy*dy);
+      double xx=x1;
+      double yy=y1;
+      //--- set pixels
+      dx/=xy;
+      dy/=xy;
+      do
+        {
+         if((m_style&mask)==mask)
+           {
+            PixelSetAA(xx,yy,clr);
+           }
+         xx+=dx;
+         yy+=dy;
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      while(fabs(x2-xx)>=fabs(dx) && fabs(y2-yy)>=fabs(dy));
+      //--- set last pixel
+      if((m_style&mask)==mask)
+        {
+         PixelSetAA(x2,y2,clr);
+        }
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw triangle with antialiasing                                  |
+//+------------------------------------------------------------------+
+void CCanvas::TriangleAA(const int x1,const int y1,const int x2,const int y2,const int x3,const int y3,const uint clr,const uint style)
+  {
+//--- draw
+   int x[3];
+   int y[3];
+   x[0] = x1;
+   x[1] = x2;
+   x[2] = x3;
+   y[0] = y1;
+   y[1] = y2;
+   y[2] = y3;
+   PolygonAA(x,y,clr,style);
+  }
+//+------------------------------------------------------------------+
+//| Draw circle with antialiasing                                    |
+//+------------------------------------------------------------------+
+void CCanvas::CircleAA(const int x,const int y,const double r,const uint clr,const uint style=UINT_MAX)
+  {
+   if(r<=0)
+      return;
+//--- preliminary calculations
+   double xx=x+r;
+   double yy=y;
+   double fi=0;
+   double df=M_PI_2/MathCeil(r);
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw
+   if(r>M_PI)
+      df/=2;
+   do
+     {
+      xx=x+r*cos(fi);
+      yy=y-r*sin(fi);
+      if((m_style&mask)==mask)
+         PixelSetAA(xx,yy,clr);
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+      fi+=df;
+     }
+   while(fabs(2*M_PI-fi)>=df/2);
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw ellipse with antialiasing                                   |
+//+------------------------------------------------------------------+
+void CCanvas::EllipseAA(const double x1,const double y1,const double x2,const double y2,const uint clr,const uint style=UINT_MAX)
+  {
+   double rx = (x2-x1)/2;
+   double ry = (y2-y1)/2;
+//--- preliminary calculations
+   double x=(x2>x1) ? x1+rx : x2+rx;
+   double y=(y2>y1) ? y1+ry : y2+ry;
+   double rx2=rx*rx;
+   double ry2=ry*ry;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw   
+   double quarter=round(rx2/sqrt(rx2+ry2));
+   for(double dx=0; dx<=quarter; dx++)
+     {
+      double dy=ry*sqrt(1-dx*dx/rx2);
+      if((m_style&mask)==mask)
+         PixelSet4AA(x,y,dx,dy,clr);
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+   quarter=round(ry2/sqrt(rx2+ry2));
+   for(double dy=0; dy<=quarter; dy++)
+     {
+      double dx=rx*sqrt(1-dy*dy/ry2);
+      if((m_style&mask)==mask)
+         PixelSet4AA(x,y,dx,dy,clr);
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Gets default color                                               |
+//+------------------------------------------------------------------+
+static uint CCanvas::GetDefaultColor(const int i)
+  {
+   if(i<0)
+      return(0);
+   if(i<ArraySize(m_default_colors))
+      return(m_default_colors[i]);
+//---
+   return(XRGB((i%3)*60+i*50,((i+1)%3)*60+i*60,((i+2)%3)*60+i*50));
+  }
+//+------------------------------------------------------------------+
+//| Set level of transparency                                        |
+//+------------------------------------------------------------------+
+void CCanvas::TransparentLevelSet(const uchar value)
+  {
+   int total=ArraySize(m_pixels);
+   uint value24=(uint)value<<24;
+   for(int i=0;i<total;i++)
+      m_pixels[i]=value24|(m_pixels[i]&0xFFFFFF);
+  }
+//+------------------------------------------------------------------+
+//| Set font                                                         |
+//+------------------------------------------------------------------+
+bool CCanvas::FontSet(const string name,const int size,const uint flags,const uint angle)
+  {
+   if(!TextSetFont(name,size,flags,angle))
+      return(false);
+//--- save parameters of generated font
+   m_fontname =name;
+   m_fontsize =size;
+   m_fontflags=flags;
+   m_fontangle=angle;
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set fontname                                                     |
+//+------------------------------------------------------------------+
+bool CCanvas::FontNameSet(string name)
+  {
+   if(!TextSetFont(name,m_fontsize,m_fontflags,m_fontangle))
+      return(false);
+//--- save parameter of generated font
+   m_fontname=name;
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set fontsize                                                     |
+//+------------------------------------------------------------------+
+bool CCanvas::FontSizeSet(int size)
+  {
+   if(!TextSetFont(m_fontname,size,m_fontflags,m_fontangle))
+      return(false);
+//--- save parameter of generated font
+   m_fontsize=size;
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set fontflags                                                    |
+//+------------------------------------------------------------------+
+bool CCanvas::FontFlagsSet(uint flags)
+  {
+   if(!TextSetFont(m_fontname,m_fontsize,flags,m_fontangle))
+      return(false);
+//--- save parameter of generated font
+   m_fontflags=flags;
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set fontangle                                                    |
+//+------------------------------------------------------------------+
+bool CCanvas::FontAngleSet(uint angle)
+  {
+   if(!TextSetFont(m_fontname,m_fontsize,m_fontflags,angle))
+      return(false);
+//--- save parameter of generated font
+   m_fontangle=angle;
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set font                                                         |
+//+------------------------------------------------------------------+
+bool CCanvas::FontSet(void)
+  {
+   return(TextSetFont(m_fontname,m_fontsize,m_fontflags,m_fontangle));
+  }
+//+------------------------------------------------------------------+
+//| Get font params                                                  |
+//+------------------------------------------------------------------+
+void CCanvas::FontGet(string &name,int &size,uint &flags,uint &angle)
+  {
+   name =m_fontname;
+   size =m_fontsize;
+   flags=m_fontflags;
+   angle=m_fontangle;
+  }
+//+------------------------------------------------------------------+
+//| Out text                                                         |
+//+------------------------------------------------------------------+
+void CCanvas::TextOut(int x,int y,string text,const uint clr,uint alignment)
+  {
+   if(FontSet())
+      TextOut(text,x,y,alignment,m_pixels,m_width,m_height,clr,m_format);
+  }
+//+------------------------------------------------------------------+
+//| Out text                                                         |
+//+------------------------------------------------------------------+
+void CCanvas::TextOutFast(int x,int y,string text,const uint clr,uint alignment)
+  {
+   TextOut(text,x,y,alignment,m_pixels,m_width,m_height,clr,m_format);
+  }
+//+------------------------------------------------------------------+
+//| Text width                                                       |
+//+------------------------------------------------------------------+
+int CCanvas::TextWidth(const string text)
+  {
+   if(!FontSet())
+      return(0);
+//---
+   int w,h;
+   TextGetSize(text,w,h);
+//--- result
+   return(w);
+  }
+//+------------------------------------------------------------------+
+//| Text height                                                      |
+//+------------------------------------------------------------------+
+int CCanvas::TextHeight(const string text)
+  {
+   if(!FontSet())
+      return(0);
+//---
+   int w,h;
+   TextGetSize(text,w,h);
+//--- result
+   return(h);
+  }
+//+------------------------------------------------------------------+
+//| Text rectangle                                                   |
+//+------------------------------------------------------------------+
+void CCanvas::TextSize(const string text,int &width,int &height)
+  {
+   if(FontSet())
+      TextGetSize(text,width,height);
+  }
+//+------------------------------------------------------------------+
+//| Load data from file                                              |
+//+------------------------------------------------------------------+
+bool CCanvas::LoadFromFile(const string filename)
+  {
+   struct BitmapHeader
+     {
+      ushort            type;
+      uint              size;
+      uint              reserv;
+      uint              offbits;
+      uint              imgSSize;
+      uint              imgWidth;
+      uint              imgHeight;
+      ushort            imgPlanes;
+      ushort            imgBitCount;
+      uint              imgCompression;
+      uint              imgSizeImage;
+      uint              imgXPelsPerMeter;
+      uint              imgYPelsPerMeter;
+      uint              imgClrUsed;
+      uint              imgClrImportant;
+     };
+   BitmapHeader header;
+   bool     result=true;
+   CFileBin file;
+   uchar    a,r,g,b;
+   uint     img_size;
+   bool     no_alpha,no_flip=false;
+//--- open file
+   if(file.Open(filename,FILE_READ)==INVALID_HANDLE)
+     {
+      Print("File not found");
+      return(false);
+     }
+//--- read header
+   if(file.ReadStruct(header)!=sizeof(header))
+     {
+      Print("Failed to read file header");
+      file.Close();
+      return(false);
+     }
+   m_width =(int)header.imgWidth;
+   m_height=(int)header.imgHeight;
+   if(m_height<0)
+     {
+      m_height=-m_height;
+      no_flip=true;
+     }
+//--- process depending on color depth
+   if(header.imgBitCount==32)
+     {
+      no_alpha=true;
+      img_size=file.ReadArray(m_pixels);
+      //--- flip image
+      if(!no_flip)
+         for(int i=0;i<m_height/2;i++)
+           {
+            uint tmp[];
+            ArrayCopy(tmp,m_pixels,0,m_width*i,m_width);
+            ArrayCopy(m_pixels,m_pixels,m_width*i,m_width*(m_height-i-1),m_width);
+            ArrayCopy(m_pixels,tmp,m_width*(m_height-i-1),0,m_width);
+           }
+      //--- check if at least one pixel has alpha channel
+      //--- then leave image as is (consider it as premultiplied ARGB)
+      for(uint i=0;i<img_size;i++)
+        {
+         //--- there is alpha channel
+         if(GETRGBA(m_pixels[i])!=0)
+           {
+            no_alpha=false;
+            break;
+           }
+        }
+      //--- no alpha channel
+      if(no_alpha)
+        {
+         //--- consider image as nontransparent, add alpha channel as 0xFF
+         for(uint i=0;i<img_size;i++)
+            m_pixels[i]|=0xFF000000;
+        }
+      else
+        {
+         if(m_format==COLOR_FORMAT_ARGB_RAW)
+           {
+            //--- color components are not processed by terminal (they should be correctly specified by user) 
+            //--- convert image to premultiplied ARGB
+            for(uint i=0;i<img_size;i++)
+              {
+               switch(a=GETRGBA(m_pixels[i]))
+                 {
+                  case 0xFF:
+                     break;
+                  case 0x00:
+                     m_pixels[i]=0;
+                     break;
+                  default:
+                     r=GETRGBR(m_pixels[i])*a/255;
+                     g=GETRGBG(m_pixels[i])*a/255;
+                     b=GETRGBB(m_pixels[i])*a/255;
+                     m_pixels[i]=ARGB(a,r,g,b);
+                     break;
+                 }
+              }
+           }
+        }
+     }
+   else
+     {
+      //--- 24 bits - change image color depth to 32 bits
+      int byte_width;
+      //--- allocate memory for pixels
+      if(ArrayResize(m_pixels,m_width*m_height)!=-1)
+        {
+         //--- the number of bytes that define a line of pixels must be multiple of 4
+         byte_width=m_width*3;             // number of bytes in line of pixels
+         byte_width=(byte_width+3)&~3;     // align line to the 4 byte boundary
+         uchar tmp[];
+         for(int i=0;i<m_height;i++)
+           {
+            if(file.ReadArray(tmp,0,byte_width)!=byte_width)
+              {
+               result=false;
+               break;
+              }
+            for(int j=0,k=0,p=m_width*(m_height-i-1);j<m_width;j++,p++,k+=3)
+              {
+               r=tmp[k+2];
+               g=tmp[k+1];
+               b=tmp[k];
+               m_pixels[p]=XRGB(r,g,b);
+              }
+           }
+        }
+      else
+         result=false;
+     }
+//--- succeed
+   file.Close();
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Determines direction of points iteration (<0 - clockwise)        |
+//+------------------------------------------------------------------+
+int CCanvas::PointClassify(const CPoint &p0,const CPoint &p1,const CPoint &p2)
+  {
+   return((p1.x-p0.x)*(p2.y-p0.y)-(p2.x-p0.x)*(p1.y-p0.y));
+  }
+//+------------------------------------------------------------------+
+//| Determines direction of polygon iteration                        |
+//+------------------------------------------------------------------+
+int CCanvas::PolygonClassify(const CPoint &p[])
+  {
+   int total=ArraySize(p);
+   int im= 0;
+   int xm=p[0].x;
+   int ym=p[0].y;
+//--- find the most top-left vertex 
+   for(int i=1;i<total;i++)
+     {
+      if(p[i].y>ym)
+         continue;
+      if((p[i].y==ym) && (p[i].x>xm))
+         continue;
+      im=i;
+      xm=p[i].x;
+      ym=p[i].y;
+     }
+//--- check the orientation of triangle
+   return PointClassify(p[(im-1+total)%total],p[im],p[(im+1)%total]);
+  }
+//+------------------------------------------------------------------+
+//| Checks convexity of polygon                                      |
+//+------------------------------------------------------------------+
+bool CCanvas::IsPolygonConvex(CPoint &p[])
+  {
+   int total=ArraySize(p);
+//--- triangle - always convex
+   if(total==3)
+      return(true);
+   int res=SIGN(PointClassify(p[0],p[1],p[2]));
+   for(int i=1;i<total;i++)
+     {
+      int res1=SIGN(PointClassify(p[i],p[(i+1)%total],p[(i+2)%total]));
+      if(res!=res1)
+         return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Normalizes polygon for drawing                                   |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonNormalize(CPoint &p[])
+  {
+   int total=ArraySize(p);
+//--- find top-left point
+   int imin=0;
+   int xmin=p[0].x;
+   int ymin=p[0].y;
+   for(int i=1;i<total;i++)
+     {
+      if(p[i].y>ymin)
+         continue;
+      if(p[i].y==ymin)
+        {
+         if(p[i].x<xmin)
+           {
+            xmin=p[i].x;
+            imin=i;
+           }
+         continue;
+        }
+      xmin=p[i].x;
+      ymin=p[i].y;
+      imin=i;
+     }
+   if(imin==0)
+      return;
+   for(int i=0;i<imin;i++)
+     {
+      CPoint tmp=p[0];
+      ArrayCopy(p,p,0,1);
+      p[total-1]=tmp;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Dissects non-convex polygon into two                             |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonIntersect(CPoint &p[],CPoint &add[])
+  {
+   int total=ArraySize(p);
+   int res=SIGN(PolygonClassify(p));
+//--- scan vertices clockwise and counterclockwise to find a non-convex one
+   for(int i=0;i<total;i++)
+     {
+      int rr=SIGN(PointClassify(p[i],p[(i+1)%total],p[(i+2)%total]));
+      int rl=SIGN(PointClassify(p[(total-i-2)%total],p[(total-i-1)%total],p[(total-i)%total]));
+      if(rl!=res || rr!=res)
+        {
+         //--- find non-convex vertex, dissect
+         res=(total-i-1)-(i+1);
+         if(res<0)
+            return;
+         if(res<2)
+           {
+            ArrayResize(add,total-i);
+            add[0]=p[0];
+            ArrayCopy(add,p,1,i+1,total-i-1);
+            ArrayResize(p,i+2);
+           }
+         else
+           {
+            ArrayResize(add,res+1);
+            ArrayCopy(add,p,0,i+1,res+1);
+            ArrayCopy(p,p,i+2,i+res+1,total-res-i-1);
+            ArrayResize(p,total-res+1);
+           }
+         break;
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draws filled convex polygon (point 0 is top-left)                |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonFill(CPoint &p[],const uint clr)
+  {
+   int    il,ir;
+   double xl,xr;
+   int    yy;
+   double dl=0.0,dr=0.0;
+   int    total=ArraySize(p);
+//--- check
+   if(total<3)
+      return;
+//--- check polygon for convexity
+   while(!IsPolygonConvex(p))
+     {
+      CPoint add[];
+      PolygonIntersect(p,add);
+      PolygonNormalize(add);
+      PolygonFill(add,clr);
+      ArrayFree(add);
+     }
+   total=ArraySize(p);
+//--- initial settings
+   il=ir=0;
+   xl=xr=p[0].x;
+   yy=p[0].y;
+//--- in case of top horizontal line
+   if(yy==p[1].y)
+      xr=p[ir=1].x;
+//--- draw the top
+   LineHorizontal((int)MathCeil(xl),(int)MathFloor(xr),yy,clr);
+//--- loop by Y
+   do
+     {
+      while(yy==p[il].y)
+        {
+         il=(il-1+total)%total;
+         if(yy>p[il].y)
+            return;
+         if(yy!=p[il].y)
+           {
+            dl=(p[il].x-xl)/(p[il].y-yy);
+            //--- make adjustment for half of left increment dl/2
+            LineHorizontal((int)MathCeil(xl+dl/2),(int)MathFloor(xl),yy,clr);
+            xl+=dl/2;
+           }
+         else
+            LineHorizontal((int)MathCeil(xl),(int)MathFloor(p[il].x),yy,clr);
+        }
+      while(yy==p[ir].y)
+        {
+         ir=(ir+1)%total;
+         if(yy>p[ir].y)
+            return;
+         if(yy!=p[ir].y)
+           {
+            dr=(p[ir].x-xr)/(p[ir].y-yy);
+            //--- make adjustment for half of right increment dr/2
+            LineHorizontal((int)MathCeil(xr),(int)MathFloor(xr+dr/2),yy,clr);
+            xr+=dr/2;
+           }
+         else
+            LineHorizontal((int)MathCeil(p[ir].x),(int)MathFloor(xr),yy,clr);
+        }
+      yy++;
+      if(yy==p[il].y)
+         xl=p[il].x;
+      else
+         xl+=dl;
+      if(yy==p[ir].y)
+         xr=p[ir].x;
+      else
+         xr+=dr;
+      LineHorizontal((int)MathCeil(xl),(int)MathFloor(xr),yy,clr);
+     }
+   while(il>=ir && ir!=0);
+  }
+//+------------------------------------------------------------------+
+//| Draw line according to Wu's algorithm                            |
+//+------------------------------------------------------------------+
+void CCanvas::LineWu(int x1,int y1,int x2,int y2,const uint clr,const uint style=UINT_MAX)
+  {
+//--- calculating the variation of the coordinates
+   int dx = (x2 > x1) ? (x2 - x1) : (x1 - x2);
+   int dy = (y2 > y1) ? (y2 - y1) : (y1 - y2);
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+   int tmp;
+//--- check if dx==0 then draw vertical line
+   if(dx==0)
+     {
+      //--- sort by Y
+      if(y1>y2)
+        {
+         tmp=y1;
+         y1 =y2;
+         y2 =tmp;
+        }
+      //--- line is out of image boundaries
+      if(y2<0 || y1>=m_height || x1<0 || x1>=m_width)
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      //--- stay withing image boundaries
+      if(y1<0)
+         y1=0;
+      if(y2>=m_height-1)
+         y2=m_height-1;
+      //--- draw line
+      int index=y1*m_width+x1;
+      for(int i=y1;i<=y2;i++,index+=m_width)
+        {
+         if((m_style&mask)==mask)
+            m_pixels[index]=clr;
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- set the previous line style
+      if(style!=UINT_MAX)
+         m_style=prev_style;
+      //--- success
+      return;
+     }
+//--- check if dy==0 then draw horizontal line
+   if(dy==0)
+     {
+      //--- sort by X
+      if(x1>x2)
+        {
+         tmp=x1;
+         x1 =x2;
+         x2 =tmp;
+        }
+      //--- line is out of image boundaries
+      if(x2<0 || x1>=m_width || y1<0 || y1>=m_height)
+        {
+         //--- set the previous line style
+         if(style!=UINT_MAX)
+            m_style=prev_style;
+         return;
+        }
+      //--- stay withing image boundaries
+      if(x1<0)
+         x1=0;
+      if(x2>=m_width)
+         x2=m_width-1;
+      //--- draw line
+      for(int i=0,index=y1*m_width+x1; i<x2-x1; i++,index++)
+        {
+         if((m_style&mask)==mask)
+            m_pixels[index]=clr;
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- set the previous line style
+      if(style!=UINT_MAX)
+         m_style=prev_style;
+      //--- success
+      return;
+     }
+//--- check if dx==0 and dy==0 then draw point
+   if(dx==0 && dy==0)
+     {
+      PixelSet(x1,y1,clr);
+      //--- set the previous line style
+      if(style!=UINT_MAX)
+         m_style=prev_style;
+      //--- success
+      return;
+     }
+//--- for the X-line (slope < 1)
+   if(dy<dx)
+     {
+      //--- first point has to have a smaller X coordinate
+      if(x2<x1)
+        {
+         x2 += x1; x1 = x2 - x1; x2 -= x1;
+         y2 += y1; y1 = y2 - y1; y2 -= y1;
+        }
+      if(y2<y1)
+        {
+         dy*=-1;
+        }
+      //--- relative change of the Y
+      float grad=(float)dy/dx;
+      //--- intermediate variable for Y
+      float intery=y1+grad;
+      //--- first point
+      if((m_style&mask)==mask)
+         PixelSet(x1,y1,clr);
+
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+      for(int x=x1+1; x<x2; x++)
+        {
+         double alpha1=1-(intery-(int)intery);
+         double alpha2=(intery-(int)intery);
+         if((m_style&mask)==mask)
+           {
+            //--- high point
+            PixelTransform(x,(int)(intery),clr,alpha1);
+            //--- low point
+            PixelTransform(x,(int)(intery)+1,clr,alpha2);
+           }
+         //--- change the Y coordinate
+         intery+=grad;
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- last point
+      if((m_style&mask)==mask)
+         PixelSet(x2,y2,clr);
+     }
+//--- for the Y-line (slope > 1)
+   else
+     {
+      //--- first point has to have a smaller Y coordinate
+      if(y2<y1)
+        {
+         x2 += x1; x1 = x2 - x1; x2 -= x1;
+         y2 += y1; y1 = y2 - y1; y2 -= y1;
+        }
+      if(x2<x1)
+        {
+         dx*=-1;
+        }
+      //--- relative change of the X
+      float grad=(float)dx/dy;
+      //--- intermediate variable for X
+      float interx=x1+grad;
+      //--- first point
+      if((m_style&mask)==mask)
+         PixelSet(x1,y1,clr);
+
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+      for(int y=y1+1; y<y2; y++)
+        {
+         double alpha1=1-(interx-(int)interx);
+         double alpha2=(interx-(int)interx);
+         if((m_style&mask)==mask)
+           {
+            //--- high point
+            PixelTransform((int)(interx),y,clr,alpha1);
+            //--- low point
+            PixelTransform((int)(interx)+1,y,clr,alpha2);
+           }
+         //--- change the X coordinate
+         interx+=grad;
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- last point
+      if((m_style&mask)==mask)
+         PixelSet(x2,y2,clr);
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw Wu's polyline                                               |
+//+------------------------------------------------------------------+
+void CCanvas::PolylineWu(const int &x[],const int &y[],const uint clr,const uint style=UINT_MAX)
+  {
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+   total--;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw
+   for(int i=0;i<total;i++)
+     {
+      int x1=x[i];
+      int x2=x[i+1];
+      int y1=y[i];
+      int y2=y[i+1];
+      //--- calculating the variation of the coordinates
+      int dx = (x2 > x1) ? (x2 - x1) : (x1 - x2);
+      int dy = (y2 > y1) ? (y2 - y1) : (y1 - y2);
+      int tmp;
+      //--- check if dx==0 then draw vertical line
+      if(dx==0)
+        {
+         //--- sort by Y
+         if(y1>y2)
+           {
+            tmp=y1;
+            y1 =y2;
+            y2 =tmp;
+           }
+         //--- line is out of image boundaries
+         if(y2<0 || y1>=m_height || x1<0 || x1>=m_width)
+            continue;
+         //--- stay withing image boundaries
+         if(y1<0)
+            y1=0;
+         if(y2>=m_height-1)
+            y2=m_height-1;
+         //--- draw line
+         int index=y1*m_width+x1;
+         for(int j=y1;j<=y2;j++,index+=m_width)
+           {
+            if((m_style&mask)==mask)
+               m_pixels[index]=clr;
+
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         continue;
+        }
+      //--- check if dy==0 then draw horizontal line
+      if(dy==0)
+        {
+         //--- sort by X
+         if(x1>x2)
+           {
+            tmp=x1;
+            x1 =x2;
+            x2 =tmp;
+           }
+         //--- line is out of image boundaries
+         if(x2<0 || x1>=m_width || y1<0 || y1>=m_height)
+            continue;
+         //--- stay withing image boundaries
+         if(x1<0)
+            x1=0;
+         if(x2>=m_width)
+            x2=m_width-1;
+         //--- draw line
+         for(int j=0,index=y1*m_width+x1; j<x2-x1; j++,index++)
+           {
+            if((m_style&mask)==mask)
+               m_pixels[index]=clr;
+
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         continue;
+        }
+      //--- check if dx==0 and dy==0 then draw point
+      if(dx==0 && dy==0)
+        {
+         PixelSet(x1,y1,clr);
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+         continue;
+        }
+      //--- for the X-line (slope < 1)
+      if(dy<dx)
+        {
+         //--- first point has to have a smaller X coordinate
+         if(x2<x1)
+           {
+            x2 += x1; x1 = x2 - x1; x2 -= x1;
+            y2 += y1; y1 = y2 - y1; y2 -= y1;
+           }
+         if(y2<y1)
+           {
+            dy*=-1;
+           }
+         //--- relative change of the Y
+         float grad=(float)dy/dx;
+         //--- intermediate variable for Y
+         float intery=y1+grad;
+         //--- first point
+         if((m_style&mask)==mask)
+            PixelSet(x1,y1,clr);
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+         for(int xc=x1+1; xc<x2; xc++)
+           {
+            double alpha1=1-(intery-(int)intery);
+            double alpha2=(intery-(int)intery);
+            if((m_style&mask)==mask)
+              {
+               //--- high point
+               PixelTransform(xc,(int)(intery),clr,alpha1);
+               //--- low point
+               PixelTransform(xc,(int)(intery)+1,clr,alpha2);
+              }
+            //--- change the Y coordinate
+            intery+=grad;
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         //--- last point
+         if((m_style&mask)==mask)
+            PixelSet(x2,y2,clr);
+        }
+      //--- for the Y-line (slope > 1)
+      else
+        {
+         //--- first point has to have a smaller Y coordinate
+         if(y2<y1)
+           {
+            x2 += x1; x1 = x2 - x1; x2 -= x1;
+            y2 += y1; y1 = y2 - y1; y2 -= y1;
+           }
+         if(x2<x1)
+           {
+            dx*=-1;
+           }
+         //--- relative change of the X
+         float grad=(float)dx/dy;
+         //--- intermediate variable for X
+         float interx=x1+grad;
+         //--- first point
+         if((m_style&mask)==mask)
+            PixelSet(x1,y1,clr);
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+         for(int yc=y1+1; yc<y2; yc++)
+           {
+            double alpha1=1-(interx-(int)interx);
+            double alpha2=(interx-(int)interx);
+            if((m_style&mask)==mask)
+              {
+               //--- high point
+               PixelTransform((int)(interx),yc,clr,alpha1);
+               //--- low point
+               PixelTransform((int)(interx)+1,yc,clr,alpha2);
+              }
+            //--- change the X coordinate
+            interx+=grad;
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         //--- last point
+         if((m_style&mask)==mask)
+            PixelSet(x2,y2,clr);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw Wu's polygon                                                |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonWu(const int &x[],const int &y[],const uint clr,const uint style=UINT_MAX)
+  {
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw
+   for(int i=0;i<total;i++)
+     {
+      int x1=x[i];
+      int y1=y[i];
+      int x2=(i+1!=total) ? x[i+1] : x[0];
+      int y2=(i+1!=total) ? y[i+1] : y[0];
+      //--- calculating the variation of the coordinates
+      int dx = (x2 > x1) ? (x2 - x1) : (x1 - x2);
+      int dy = (y2 > y1) ? (y2 - y1) : (y1 - y2);
+      int tmp;
+      //--- check if dx==0 then draw vertical line
+      if(dx==0)
+        {
+         //--- sort by Y
+         if(y1>y2)
+           {
+            tmp=y1;
+            y1 =y2;
+            y2 =tmp;
+           }
+         //--- line is out of image boundaries
+         if(y2<0 || y1>=m_height || x1<0 || x1>=m_width)
+            continue;
+         //--- stay withing image boundaries
+         if(y1<0)
+            y1=0;
+         if(y2>=m_height-1)
+            y2=m_height-1;
+         //--- draw line
+         int index=y1*m_width+x1;
+         for(int j=y1;j<=y2;j++,index+=m_width)
+           {
+            if((m_style&mask)==mask)
+               m_pixels[index]=clr;
+
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         continue;
+        }
+      //--- check if dy==0 then draw horizontal line
+      if(dy==0)
+        {
+         //--- sort by X
+         if(x1>x2)
+           {
+            tmp=x1;
+            x1 =x2;
+            x2 =tmp;
+           }
+         //--- line is out of image boundaries
+         if(x2<0 || x1>=m_width || y1<0 || y1>=m_height)
+            continue;
+         //--- stay withing image boundaries
+         if(x1<0)
+            x1=0;
+         if(x2>=m_width)
+            x2=m_width-1;
+         //--- draw line
+         for(int j=0,index=y1*m_width+x1; j<x2-x1; j++,index++)
+           {
+            if((m_style&mask)==mask)
+               m_pixels[index]=clr;
+
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         continue;
+        }
+      //--- check if dx==0 and dy==0 then draw point
+      if(dx==0 && dy==0)
+        {
+         PixelSet(x1,y1,clr);
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+         continue;
+        }
+      //--- for the X-line (slope < 1)
+      if(dy<dx)
+        {
+         //--- first point has to have a smaller X coordinate
+         if(x2<x1)
+           {
+            x2 += x1; x1 = x2 - x1; x2 -= x1;
+            y2 += y1; y1 = y2 - y1; y2 -= y1;
+           }
+         if(y2<y1)
+           {
+            dy*=-1;
+           }
+         //--- relative change of the Y
+         float grad=(float)dy/dx;
+         //--- intermediate variable for Y
+         float intery=y1+grad;
+         //--- first point
+         if((m_style&mask)==mask)
+            PixelSet(x1,y1,clr);
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+         for(int xc=x1+1; xc<x2; xc++)
+           {
+            double alpha1=1-(intery-(int)intery);
+            double alpha2=(intery-(int)intery);
+            if((m_style&mask)==mask)
+              {
+               //--- high point
+               PixelTransform(xc,(int)(intery),clr,alpha1);
+               //--- low point
+               PixelTransform(xc,(int)(intery)+1,clr,alpha2);
+              }
+            //--- change the Y coordinate
+            intery+=grad;
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         //--- last point
+         if((m_style&mask)==mask)
+            PixelSet(x2,y2,clr);
+        }
+      //--- for the Y-line (slope > 1)
+      else
+        {
+         //--- first point has to have a smaller Y coordinate
+         if(y2<y1)
+           {
+            x2 += x1; x1 = x2 - x1; x2 -= x1;
+            y2 += y1; y1 = y2 - y1; y2 -= y1;
+           }
+         if(x2<x1)
+           {
+            dx*=-1;
+           }
+         //--- relative change of the X
+         float grad=(float)dx/dy;
+         //--- intermediate variable for X
+         float interx=x1+grad;
+         //--- first point
+         if((m_style&mask)==mask)
+            PixelSet(x1,y1,clr);
+
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+         for(int yc=y1+1; yc<y2; yc++)
+           {
+            double alpha1=1-(interx-(int)interx);
+            double alpha2=(interx-(int)interx);
+            if((m_style&mask)==mask)
+              {
+               //--- high point
+               PixelTransform((int)(interx),yc,clr,alpha1);
+               //--- low point
+               PixelTransform((int)(interx)+1,yc,clr,alpha2);
+              }
+            //--- change the X coordinate
+            interx+=grad;
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         //--- last point
+         if((m_style&mask)==mask)
+            PixelSet(x2,y2,clr);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw triangle with Wu's lines                                    |
+//+------------------------------------------------------------------+
+void CCanvas::TriangleWu(const int x1,const int y1,const int x2,const int y2,const int x3,const int y3,const uint clr,const uint style=UINT_MAX)
+  {
+//--- draw
+   int x[3];
+   int y[3];
+   x[0] = x1;
+   x[1] = x2;
+   x[2] = x3;
+   y[0] = y1;
+   y[1] = y2;
+   y[2] = y3;
+   PolygonWu(x,y,clr,style);
+  }
+//+------------------------------------------------------------------+
+//| Draw circle according to Wu's algorithm                          |
+//+------------------------------------------------------------------+
+void CCanvas::CircleWu(const int x,const int y,const double r,const uint clr,const uint style=UINT_MAX)
+  {
+   if(r<=0)
+      return;
+//--- preliminary calculations
+   double r2=r*r;
+   double quarter=round(r/sqrt(2.0));
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- draw
+   for(int d1=0; d1<=quarter; d1++)
+     {
+      double d2=sqrt(r2-d1*d1);
+      double alpha1=d2-floor(d2);
+      double alpha2=1-alpha1;
+      if((m_style&mask)==mask)
+        {
+         PixelTransform4(x,y,(int)d2+1,d1,clr,alpha1);
+         PixelTransform4(x,y,d1,(int)(d2)+1,clr,alpha1);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+      if((m_style&mask)==mask)
+        {
+         PixelTransform4(x,y,d1,(int)(d2),clr,alpha2);
+         PixelTransform4(x,y,(int)d2,d1,clr,alpha2);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw ellipse according to Wu's algorithm                         |
+//+------------------------------------------------------------------+ 
+void CCanvas::EllipseWu(const int x1,const int y1,const int x2,const int y2,const uint clr,const uint style=UINT_MAX)
+  {
+   int rx=(int)(x2-x1)/2;
+   int ry=(int)(y2-y1)/2;
+   int x=(x2>x1) ? x1+rx : x2+rx;
+   int y=(y2>y1) ? y1+ry : y2+ry;
+   if(rx<=0 || ry<=0)
+      return;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint mask=1<<m_style_idx;
+//--- preliminary calculations
+   double rx2=rx*rx;
+   double ry2=ry*ry;
+   double quarter=round(rx2/sqrt(rx2+ry2));
+//--- draw
+   for(int dx=0; dx<=quarter; dx++)
+     {
+      double dy=ry*sqrt(1-dx*dx/rx2);
+      double alpha1=dy-floor(dy);
+      double alpha2=1-alpha1;
+      if((m_style&mask)==mask)
+        {
+         PixelTransform4(x,y,dx,(int)(dy)+1,clr,alpha1);
+         PixelTransform4(x,y,dx,(int)(dy),clr,alpha2);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+   quarter=round(ry2/sqrt(rx2+ry2));
+   for(int dy=0; dy<=quarter; dy++)
+     {
+      double dx=rx*sqrt(1-dy*dy/ry2);
+      double alpha1=dx-floor(dx);
+      double alpha2=1-alpha1;
+      if((m_style&mask)==mask)
+        {
+         PixelTransform4(x,y,(int)(dx)+1,dy,clr,alpha1);
+         PixelTransform4(x,y,(int)(dx),dy,clr,alpha2);
+        }
+      mask<<=1;
+      if(mask==0x1000000)
+         mask=1;
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw vertical thick line with prefiltered antialiasing           |
+//+------------------------------------------------------------------+
+void CCanvas::LineThickVertical(const int x,const int y1,const int y2,const uint clr,const int size,const uint style,ENUM_LINE_END end_style)
+  {
+   if(size<=2)
+     {
+      if(size>0)
+         LineWu(x,y1,x,y2,clr,style);
+      return;
+     }
+//--- r be the filter radius (and also the half-width of the wide line)
+   double r=(size/2.0);
+//--- primary calculate   
+   int dy=MathAbs(y2-y1);
+   int sign=(y1<y2) ? 1 : -1;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint   mask=1<<m_style_idx;
+//--- draw vertical thick line by segment
+   if(style==STYLE_SOLID)
+     {
+      SegmentVertical(x,y1,y2,sign,r,clr,end_style);
+     }
+   else
+     {
+      int ys=0;
+      int ye=0;
+      int steps=(int)MathRound(dy/r);
+      bool segment=false;
+      for(int i=0; i<=steps; i++)
+        {
+         if((m_style&mask)==mask && !segment)
+           {
+            ys=y1+(sign)*(int)(i*r);
+            segment=true;
+           }
+         else
+         if((m_style&mask)!=mask && segment)
+           {
+            ye=y1+(sign)*(int)(i*r);
+            SegmentVertical(x,ys,ye,sign,r,clr,end_style);
+            segment=false;
+           }
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- last segment
+      if(segment)
+         SegmentVertical(x,ys,y2,sign,r,clr,end_style);
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw horizontal thick line with prefiltered antialiasing         |
+//+------------------------------------------------------------------+
+void CCanvas::LineThickHorizontal(const int x1,const int x2,const int y,const uint clr,const int size,const uint style,ENUM_LINE_END end_style)
+  {
+   if(size<=2)
+     {
+      if(size>0)
+         LineWu(x1,y,x2,y,clr,style);
+      return;
+     }
+//--- r be the filter radius (and also the half-width of the wide line)
+   double r=(size/2.0);
+//--- primary calculate  
+   int dx=MathAbs(x2-x1);
+   int sign=(x1<x2) ? 1 : -1;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint   mask=1<<m_style_idx;
+//--- draw horizontal thick line by segment
+   if(style==STYLE_SOLID)
+     {
+      SegmentHorizontal(x1,x2,y,sign,r,clr,end_style);
+     }
+   else
+     {
+      int xs=0;
+      int xe=0;
+      int steps=(int)MathRound(dx/r);
+      bool segment=false;
+      for(int i=0; i<=steps; i++)
+        {
+         if((m_style&mask)==mask && !segment)
+           {
+            xs=x1+(sign)*(int)(i*r);
+            segment=true;
+           }
+         else
+         if((m_style&mask)!=mask && segment)
+           {
+            xe=x1+(sign)*(int)(i*r);
+            SegmentHorizontal(xs,xe,y,sign,r,clr,end_style);
+            segment=false;
+           }
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- last segment
+      if(segment)
+         SegmentHorizontal(xs,x2,y,sign,r,clr,end_style);
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw thick line with prefiltered antialiasing                    |
+//+------------------------------------------------------------------+
+void CCanvas::LineThick(const int x1,const int y1,const int x2,const int y2,const uint clr,const int size,const uint style,ENUM_LINE_END end_style)
+  {
+   if(size<=2)
+     {
+      if(size>0)
+         LineWu(x1,y1,x2,y2,clr,style);
+      return;
+     }
+//--- r be the filter radius (and also the half-width of the wide line)
+   double r=(size/2.0);
+//--- compute x and y deltas
+   double dx=MathAbs(x2-x1);
+   double dy=MathAbs(y2-y1);
+   if(dx==0)
+     {
+      LineThickVertical(x1,y1,y2,size,clr,style,end_style);
+      return;
+     }
+   if(dy==0)
+     {
+      LineThickHorizontal(x1,x2,y1,size,clr,style,end_style);
+      return;
+     }
+//--- compute the linear coefficients of the two (scaled) edge functions
+   double k=MathArctan(dx/dy);
+   double rcos_k=r*cos(k);
+   double rsin_k=r*sin(k);
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint   mask=1<<m_style_idx;
+//--- primary calculate
+   int xsign = (x1<x2) ? 1 : -1;
+   int ysign = (y1<y2) ? 1 : -1;
+   double kp0=(-xsign*ysign)*(dx/dy);
+   double kp1=-1/kp0;
+//--- draw thick line by segment
+   if(style==STYLE_SOLID)
+     {
+      Segment(x1,y1,x2,y2,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+     }
+   else
+     {
+      int xs=0;
+      int ys=0;
+      int xe=0;
+      int ye=0;
+      double length=MathSqrt(dx*dx+dy*dy);
+      int steps=(int)MathRound(length/r);
+      bool segment=false;
+      for(int i=0; i<=steps; i++)
+        {
+         if((m_style&mask)==mask && !segment)
+           {
+            xs=x1+(xsign)*(int)(i*rsin_k);
+            ys=y1+(ysign)*(int)(i*rcos_k);
+            segment=true;
+           }
+         else
+         if((m_style&mask)!=mask && segment)
+           {
+            xe=x1+(xsign)*(int)(i*rsin_k);
+            ye=y1+(ysign)*(int)(i*rcos_k);
+            Segment(xs,ys,xe,ye,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+            segment=false;
+           }
+         mask<<=1;
+         if(mask==0x1000000)
+            mask=1;
+        }
+      //--- last segment
+      if(segment)
+         Segment(xs,ys,x2,y2,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw thick polyline                                              |
+//+------------------------------------------------------------------+
+void CCanvas::PolylineThick(const int &x[],const int &y[],const uint clr,const int size,const uint style,ENUM_LINE_END end_style)
+  {
+   if(size<=2)
+     {
+      if(size>0)
+         PolylineWu(x,y,clr,style);
+      return;
+     }
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+   total--;
+//--- r be the filter radius (and also the half-width of the wide line)
+   double r=(size/2.0);
+//---
+   double gap=1.0;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint   mask=1<<m_style_idx;
+//--- draw
+   for(int index=0; index<total; index++)
+     {
+      int x1=x[index];
+      int y1=y[index];
+      int x2=x[index+1];
+      int y2=y[index+1];
+      //--- compute x and y deltas
+      double dx=MathAbs(x2-x1);
+      double dy=MathAbs(y2-y1);
+      if(dx==0)
+        {
+         int sign=(y1<y2) ? 1 : -1;
+         //--- draw vertical thick line by segment
+         if(style==STYLE_SOLID)
+           {
+            SegmentVertical(x1,y1,y2,sign,r,clr,end_style);
+           }
+         else
+           {
+            int ys=y1;
+            int ye=0;
+            double steps=dy/r;
+            int    isteps=(int)steps;
+            bool segment=false;
+            for(int i=0; i<isteps; i++)
+              {
+               if((m_style&mask)==mask && !segment)
+                 {
+                  ys=y1+(sign)*(int)(i*r);
+                  segment=true;
+                 }
+               else
+               if((m_style&mask)!=mask && segment)
+                 {
+                  ye=y1+(sign)*(int)(i*r);
+                  SegmentVertical(x1,ys,ye,sign,r,clr,end_style);
+                  segment=false;
+                 }
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+            //--- last segment
+            if(segment || (steps<1 && (m_style&mask)==mask))
+               SegmentVertical(x1,ys,y2,sign,r,clr,end_style);
+            gap-=steps-isteps;
+            if(gap<0)
+              {
+               gap++;
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+           }
+         continue;
+        }
+      if(dy==0)
+        {
+         int sign=(x1<x2) ? 1 : -1;
+         //--- draw horizontal thick line by segment
+         if(style==STYLE_SOLID)
+           {
+            SegmentHorizontal(x1,x2,y1,sign,r,clr,end_style);
+           }
+         else
+           {
+            int xs=x1;
+            int xe=0;
+            double steps=dx/r;
+            int    isteps=(int)steps;
+            bool segment=false;
+            for(int i=0; i<isteps; i++)
+              {
+               if((m_style&mask)==mask && !segment)
+                 {
+                  xs=x1+(sign)*(int)(i*r);
+                  segment=true;
+                 }
+               else
+               if((m_style&mask)!=mask && segment)
+                 {
+                  xe=x1+(sign)*(int)(i*r);
+                  SegmentHorizontal(xs,xe,y1,sign,r,clr,end_style);
+                  segment=false;
+                 }
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+            //--- last segment
+            if(segment || (steps<1 && (m_style&mask)==mask))
+               SegmentHorizontal(xs,x2,y1,sign,r,clr,end_style);
+            gap-=steps-isteps;
+            if(gap<0)
+              {
+               gap++;
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+           }
+         continue;
+        }
+      //--- compute the linear coefficients of the two (scaled) edge functions
+      double k=MathArctan(dx/dy);
+      double rcos_k=r*cos(k);
+      double rsin_k=r*sin(k);
+      //--- primary calculate
+      int xsign=(x1<x2) ? 1 : -1;
+      int ysign=(y1<y2) ? 1 : -1;
+      double kp0=(-xsign*ysign)*(dx/dy);
+      double kp1=-1/kp0;
+      //--- draw thick line by segment 
+      if(style==STYLE_SOLID)
+        {
+         Segment(x1,y1,x2,y2,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+        }
+      else
+        {
+         int xs=x1;
+         int ys=y1;
+         int xe=0;
+         int ye=0;
+         double length=MathSqrt(dx*dx+dy*dy);
+         double steps=length/r;
+         int    isteps=(int)steps;
+         bool segment=false;
+         for(int i=0; i<isteps; i++)
+           {
+            if((m_style&mask)==mask && !segment)
+              {
+               xs=x1+(xsign)*(int)(i*rsin_k);
+               ys=y1+(ysign)*(int)(i*rcos_k);
+               segment=true;
+              }
+            else
+            if((m_style&mask)!=mask && segment)
+              {
+               xe=x1+(xsign)*(int)(i*rsin_k);
+               ye=y1+(ysign)*(int)(i*rcos_k);
+               Segment(xs,ys,xe,ye,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+               segment=false;
+              }
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         //--- last segment
+         if(segment || (steps<1 && (m_style&mask)==mask))
+            Segment(xs,ys,x2,y2,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+         gap-=steps-isteps;
+         if(gap<0)
+           {
+            gap++;
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+        }
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Draw thick polygon                                               |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonThick(const int &x[],const int &y[],const uint clr,const int size,const uint style,ENUM_LINE_END end_style)
+  {
+   if(size<=2)
+     {
+      if(size>0)
+         PolylineWu(x,y,clr,style);
+      return;
+     }
+//--- check arrays
+   int total=ArraySize(x);
+   if(total>ArraySize(y))
+      total=ArraySize(y);
+//--- check
+   if(total<2)
+      return;
+//--- r be the filter radius (and also the half-width of the wide line)
+   double r=(size/2.0);
+//---
+   double gap=1.0;
+//--- set the line style
+   uint prev_style=m_style;
+   if(style!=UINT_MAX)
+      LineStyleSet(style);
+   uint   mask=1<<m_style_idx;
+//--- draw
+   for(int index=0; index<total; index++)
+     {
+      int x1=x[index];
+      int y1=y[index];
+      int x2=(index!=total-1) ? x[index+1] : x[0];
+      int y2=(index!=total-1) ? y[index+1] : y[0];
+      //--- compute x and y deltas
+      double dx=MathAbs(x2-x1);
+      double dy=MathAbs(y2-y1);
+      if(dx==0)
+        {
+         int sign=(y1<y2) ? 1 : -1;
+         //--- draw vertical thick line by segment
+         if(style==STYLE_SOLID)
+           {
+            SegmentVertical(x1,y1,y2,sign,r,clr,end_style);
+           }
+         else
+           {
+            int ys=y1;
+            int ye=0;
+            double steps=dy/r;
+            int    isteps=(int)steps;
+            bool segment=false;
+            for(int i=0; i<isteps; i++)
+              {
+               if((m_style&mask)==mask && !segment)
+                 {
+                  ys=y1+(sign)*(int)(i*r);
+                  segment=true;
+                 }
+               else
+               if((m_style&mask)!=mask && segment)
+                 {
+                  ye=y1+(sign)*(int)(i*r);
+                  SegmentVertical(x1,ys,ye,sign,r,clr,end_style);
+                  segment=false;
+                 }
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+            //--- last segment
+            if(segment || (steps<1 && (m_style&mask)==mask))
+               SegmentVertical(x1,ys,y2,sign,r,clr,end_style);
+            gap-=steps-isteps;
+            if(gap<0)
+              {
+               gap++;
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+           }
+         continue;
+        }
+      if(dy==0)
+        {
+         int sign=(x1<x2) ? 1 : -1;
+         //--- draw horizontal thick line by segment   
+         if(style==STYLE_SOLID)
+           {
+            SegmentHorizontal(x1,x2,y1,sign,r,clr,end_style);
+           }
+         else
+           {
+            int xs=x1;
+            int xe=0;
+            double steps=dx/r;
+            int    isteps=(int)steps;
+            bool segment=false;
+            for(int i=0; i<isteps; i++)
+              {
+               if((m_style&mask)==mask && !segment)
+                 {
+                  xs=x1+(sign)*(int)(i*r);
+                  segment=true;
+                 }
+               else
+               if((m_style&mask)!=mask && segment)
+                 {
+                  xe=x1+(sign)*(int)(i*r);
+                  SegmentHorizontal(xs,xe,y1,sign,r,clr,end_style);
+                  segment=false;
+                 }
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+            //--- last segment
+            if(segment || (steps<1 && (m_style&mask)==mask))
+               SegmentHorizontal(xs,x2,y1,sign,r,clr,end_style);
+            gap-=steps-isteps;
+            if(gap<0)
+              {
+               gap++;
+               mask<<=1;
+               if(mask==0x1000000)
+                  mask=1;
+              }
+           }
+         continue;
+        }
+      //--- compute the linear coefficients of the two (scaled) edge functions
+      double k=MathArctan(dx/dy);
+      double rcos_k=r*cos(k);
+      double rsin_k=r*sin(k);
+      //--- primary calculate
+      int xsign=(x1<x2) ? 1 : -1;
+      int ysign=(y1<y2) ? 1 : -1;
+      double kp0=(-xsign*ysign)*(dx/dy);
+      double kp1=-1/kp0;
+      //--- draw thick line by segment 
+      if(style==STYLE_SOLID)
+        {
+         Segment(x1,y1,x2,y2,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+        }
+      else
+        {
+         int xs=x1;
+         int ys=y1;
+         int xe=0;
+         int ye=0;
+         double length=MathSqrt(dx*dx+dy*dy);
+         double steps=length/r;
+         int    isteps=(int)steps;
+         bool segment=false;
+         for(int i=0; i<isteps; i++)
+           {
+            if((m_style&mask)==mask && !segment)
+              {
+               xs=x1+(xsign)*(int)(i*rsin_k);
+               ys=y1+(ysign)*(int)(i*rcos_k);
+               segment=true;
+              }
+            else
+            if((m_style&mask)!=mask && segment)
+              {
+               xe=x1+(xsign)*(int)(i*rsin_k);
+               ye=y1+(ysign)*(int)(i*rcos_k);
+               Segment(xs,ys,xe,ye,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+               segment=false;
+              }
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+         //--- last segment
+         if(segment || (steps<1 && (m_style&mask)==mask))
+            Segment(xs,ys,x2,y2,kp0,kp1,xsign,ysign,rcos_k,rsin_k,r,clr,end_style);
+         gap-=steps-isteps;
+         if(gap<0)
+           {
+            gap++;
+            mask<<=1;
+            if(mask==0x1000000)
+               mask=1;
+           }
+        }
+     }
+//--- set the previous line style
+   if(style!=UINT_MAX)
+      m_style=prev_style;
+  }
+//+------------------------------------------------------------------+
+//| Parametric method of color comparison                            |
+//+------------------------------------------------------------------+
+bool CCanvas::PixelsSimilar(const uint clr0,const uint clr1,const uint threshould)
+  {
+   uint dr=MathAbs(uint((clr0>>16) &0xff) -
+                   uint((clr1>>16) &0xff));
+   uint dg=MathAbs(uint((clr0>>8) &0xff) -
+                   uint((clr1>>8) &0xff));
+   uint db=MathAbs(uint((clr0>>0) &0xff) -
+                   uint((clr1>>0) &0xff));
+//--- return 
+   return (dr<=threshould || dg<=threshould || db<=threshould);
+  }
+//+------------------------------------------------------------------+
+//| Calculate and set new color                                      |
+//+------------------------------------------------------------------+
+void CCanvas::PixelTransform(const int x,const int y,const uint clr,const double alpha)
+  {
+   int index=y*m_width+x;
+//--- check
+   if(x<0 || y<0 || x>m_width || y>m_height || index>=ArraySize(m_pixels))
+      return;
+//--- check alpha
+   if(alpha==1)
+     {
+      m_pixels[index]=clr;
+      return;
+     }
+//--- get pixel color         
+   uint clr0=m_pixels[index];
+//--- transform  of color component for the background
+   double r0 = ((clr0>>16) & 0xFF) * (1.0-alpha);
+   double g0 = ((clr0>>8) & 0xFF) * (1.0-alpha);
+   double b0 = ((clr0>>0) & 0xFF) * (1.0-alpha);
+//--- transform  of color component 
+   double r1 = ((clr>>16) & 0xFF) * (alpha);
+   double g1 = ((clr>>8) & 0xFF) * (alpha);
+   double b1 = ((clr>>0) & 0xFF) * (alpha);
+//--- components of the new color
+   int r = (int)(r0+r1);
+   int g = (int)(g0+g1);
+   int b = (int)(b0+b1);
+//--- set new color
+   m_pixels[y*m_width+x]=(r<<16|g<<8|b<<0|255<<24) &0xffffffff;
+  }
+//+------------------------------------------------------------------+
+//| Draw 4 pixel with PixelTransform method                          |
+//+------------------------------------------------------------------+
+void CCanvas::PixelTransform4(const int x,const int y,const int dx,const int dy,const uint clr,const double alpha)
+  {
+   PixelTransform(x+dx,y+dy,clr,alpha);
+   PixelTransform(x-dx,y+dy,clr,alpha);
+   PixelTransform(x+dx,y-dy,clr,alpha);
+   PixelTransform(x-dx,y-dy,clr,alpha);
+  }
+//+------------------------------------------------------------------+
+//| Draw 4 pixel with antialiasing                                   |
+//+------------------------------------------------------------------+
+void CCanvas::PixelSet4AA(const double x,const double y,const double dx,const double dy,const uint clr)
+  {
+   PixelSetAA(x+dx,y+dy,clr);
+   PixelSetAA(x-dx,y+dy,clr);
+   PixelSetAA(x+dx,y-dy,clr);
+   PixelSetAA(x-dx,y-dy,clr);
+  }
+//+------------------------------------------------------------------+
+//| Draw solid segment for vertical thick line                       |
+//+------------------------------------------------------------------+
+void CCanvas::SegmentVertical(const int x,const int y1,const int y2,const int ysign,const double r,const uint clr,ENUM_LINE_END end_style)
+  {
+//--- compute the constol points of the solid segment
+   int ye1,ye2;
+   int ys1,ys2;
+   switch(end_style)
+     {
+      case LINE_END_ROUND:
+        {
+         ye1=y1;
+         ye2=y2;
+         ys1=y1-(int)(ysign*r);
+         ys2=y2+(int)(ysign*r);
+         break;
+        }
+      case LINE_END_BUTT:
+        {
+         ye1=y1;
+         ye2=y2;
+         ys1=y1;
+         ys2=y2;
+         break;
+        }
+      case LINE_END_SQUARE:
+        {
+         ye1=y1-(int)(ysign*r);
+         ye2=y2+(int)(ysign*r);
+         ys1=ye1;
+         ys2=ye2;
+         break;
+        }
+      default:
+         return;
+     };
+//--- darw solid segment
+   for(int i=0; i<=MathAbs(ys2-ys1); i++)
+     {
+      double yi=ys1+(ysign*i);
+      for(int j=0; j<2*r; j++)
+        {
+         double xi=x-r+j;
+         double dist=DistancePointSegment(xi,yi,x,ye1,x,ye2);
+         double val=MathAbs(dist/r);
+         PixelTransform((int)xi,(int)yi,clr,FilterFunction(val));
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw solid segment for horizontal thick line                     |
+//+------------------------------------------------------------------+
+void CCanvas::SegmentHorizontal(const int x1,const int x2,const int y,const int xsign,const double r,const uint clr,ENUM_LINE_END end_style)
+  {
+//--- compute the constol points of the solid segment
+   int xe1,xe2;
+   int xs1,xs2;
+   switch(end_style)
+     {
+      case LINE_END_ROUND:
+        {
+         xe1=x1;
+         xe2=x2;
+         xs1=x1-(int)(xsign*r);
+         xs2=x2+(int)(xsign*r);
+         break;
+        }
+      case LINE_END_BUTT:
+        {
+         xe1=x1;
+         xe2=x2;
+         xs1=x1;
+         xs2=x2;
+         break;
+        }
+      case LINE_END_SQUARE:
+        {
+         xe1=x1-(int)(xsign*r);
+         xe2=x2+(int)(xsign*r);
+         xs1=xe1;
+         xs2=xe2;
+         break;
+        }
+      default:
+         return;
+     };
+//--- draw solid segment
+   for(int i=0; i<=MathAbs(xs2-xs1); i++)
+     {
+      double xi=xs1+(xsign*i);
+      for(int j=0; j<2*r; j++)
+        {
+         double yi=y-r+j;
+         double dist=DistancePointSegment(xi,yi,xe1,y,xe2,y);
+         double val=MathAbs(dist/r);
+         PixelTransform((int)xi,(int)yi,clr,FilterFunction(val));
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw solid segment for thick line                                |
+//+------------------------------------------------------------------+
+void CCanvas::Segment(const int x1,const int y1,const int x2,const int y2,const double kp0,const double kp1,const int xsign,const int ysign,
+                      const double rcos_k,const double rsin_k,const double r,const uint clr,ENUM_LINE_END end_style)
+  {
+   if(x1==x2 && y1==y2)
+      return;
+   if(x1==x2)
+     {
+      SegmentVertical(x1,y1,y2,ysign,r,clr,end_style);
+      return;
+     }
+   if(y1==y2)
+     {
+      SegmentHorizontal(x1,x2,y1,xsign,r,clr,end_style);
+      return;
+     }
+//--- compute the constol points of the solid segment
+   int xe1,ye1,xe2,ye2;
+   int xs1,ys1,xs2,ys2;
+   switch(end_style)
+     {
+      case LINE_END_ROUND:
+        {
+         xe1=x1;
+         ye1=y1;
+         xe2=x2;
+         ye2=y2;
+         xs1=x1-(xsign)*(int)(rsin_k);
+         ys1=y1-(ysign)*(int)(rcos_k);
+         xs2=x2+(xsign)*(int)(rsin_k);
+         ys2=y2+(ysign)*(int)(rcos_k);
+         break;
+        }
+      case LINE_END_BUTT:
+        {
+         xe1=x1;
+         ye1=y1;
+         xe2=x2;
+         ye2=y2;
+         xs1=x1;
+         ys1=y1;
+         xs2=x2;
+         ys2=y2;
+         break;
+        }
+      case LINE_END_SQUARE:
+        {
+         xe1=x1-(xsign)*(int)(rsin_k);
+         ye1=y1-(ysign)*(int)(rcos_k);
+         xe2=x2+(xsign)*(int)(rsin_k);
+         ye2=y2+(ysign)*(int)(rcos_k);
+         xs1=xe1;
+         ys1=ye1;
+         xs2=xe2;
+         ys2=ye2;
+         break;
+        }
+      default:
+         return;
+     };
+//--- compute the four corners of the wide line
+   double p0x=xs1+(xsign)*(rcos_k);
+   double p0y=ys1-(ysign)*(rsin_k);
+   double p1x=xs1-(xsign)*(rcos_k);
+   double p1y=ys1+(ysign)*(rsin_k);
+   double p2x=xs2+(xsign)*(rcos_k);
+   double p2y=ys2-(ysign)*(rsin_k);
+   double p3x=xs2-(xsign)*(rcos_k);
+   double p3y=ys2+(ysign)*(rsin_k);
+//--- draw solid segment
+   if(MathAbs(kp0)>=1)
+     {
+      double xi0,xi1;
+      double height=MathAbs(p3y-p0y);
+      for(int i=0; i<=height; i++)
+        {
+         double y=p0y+(ysign*i);
+         double xi00 = MathRound(p0x + (y-p0y)/kp0);
+         double xi01 = MathRound(p1x + (y-p1y)/kp1);
+         double xi02 = MathRound(p2x + (y-p2y)/kp1);
+         double xi03 = MathRound(p3x + (y-p3y)/kp0);
+         if(xsign==1)
+           {
+            xi0 = MathMax(xi00,xi01);
+            xi1 = MathMin(xi02,xi03);
+           }
+         else
+           {
+            xi0 = MathMin(xi00,xi01);
+            xi1 = MathMax(xi02,xi03);
+           }
+         double width=MathAbs(MathRound(xi1-xi0));
+         for(int j=0; j<=width; j++)
+           {
+            double xi=xi0+(xsign*j);
+            double dist=DistancePointSegment(xi,y,xe1,ye1,xe2,ye2);
+            double val = MathAbs(dist/r);
+            PixelTransform((int)xi,(int)y,clr,FilterFunction(val));
+           }
+        }
+     }
+   else
+     {
+      double yi0,yi1;
+      double width=MathAbs(p2x-p1x);
+      for(int i=0; i<=width; i++)
+        {
+         double x=p1x+(xsign*i);
+         double yi00 = MathRound(p0y + (x-p0x)*kp0);
+         double yi01 = MathRound(p1y + (x-p1x)*kp1);
+         double yi02 = MathRound(p2y + (x-p2x)*kp1);
+         double yi03 = MathRound(p3y + (x-p3x)*kp0);
+         if(ysign==1)
+           {
+            yi0 = MathMax(yi00,yi02);
+            yi1 = MathMin(yi01,yi03);
+           }
+         else
+           {
+            yi0 = MathMin(yi00,yi02);
+            yi1 = MathMax(yi01,yi03);
+           }
+         double height=MathAbs(yi1-yi0);
+         for(int j=0; j<=height; j++)
+           {
+            double yi=yi0+(ysign*j);
+            double dist=DistancePointSegment(x,yi,xe1,ye1,xe2,ye2);
+            double val=MathAbs(dist/r);
+            PixelTransform((int)x,(int)yi,clr,FilterFunction(val));
+           }
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Filter function for calculating alpha channel                    |
+//+------------------------------------------------------------------+
+double CCanvas::FilterFunction(const double x)
+  {
+   if(x<=0.8)
+      return(1.0);
+   else
+      return MathExp(-(x-0.8)*(x-0.8)*50);
+  }
+//+------------------------------------------------------------------+
+//| Calculate distance between point and segment                     |
+//+------------------------------------------------------------------+
+double CCanvas::DistancePointSegment(const double px,const double py,const double x1,const double y1,const double x2,const double y2)
+  {
+//--- primary calculate
+   double a=(px-x1)*(px-x1)+(py-y1)*(py-y1);
+   double b=(px-x2)*(px-x2)+(py-y2)*(py-y2);
+   double c=(x2-x1)*(x2-x1)+(y2-y1)*(y2-y1);
+//--- check
+   if(a>=b+c)
+      return (MathSqrt(b));
+   if(b>=a+c)
+      return (MathSqrt(a));
+//--- calculate distance
+   a=MathSqrt(a);
+   b=MathSqrt(b);
+   c=MathSqrt(c);
+   double p=(a+b+c)/2;
+   double s=MathSqrt((p-a)*(p-b)*(p-c)*p);
+//--- check distance
+   if(MathIsValidNumber(s))
+      return(s*2.0/c);
+   else
+      return(0);
+  }
+//+------------------------------------------------------------------+
+//| Draw smothing polyline                                           |
+//+------------------------------------------------------------------+
+void CCanvas::PolylineSmooth(const int &x[],const int &y[],const uint clr,const int size,ENUM_LINE_STYLE style=STYLE_SOLID,
+                             ENUM_LINE_END end_style=LINE_END_ROUND,double tension=0.5,double step=10)
+  {
+//---
+   int arr_size= ArraySize(x);
+   if(arr_size!=ArraySize(y))
+      return;
+//---
+   double x1,x2,y1,y2;
+   tension*=0.3;
+//--- coordinates of Bezier curve
+   int xc[];
+   int yc[];
+//--- initialize control points
+   double ptX[];
+   double ptY[];
+   int    size_pt=arr_size*3-2;
+
+   ArrayResize(ptX,size_pt);
+   ArrayResize(ptY,size_pt);
+//--- calculation of control points
+   CalcCurveBezierEndp(x[0],y[0],x[1],y[1],tension,x1,y1);
+
+   ptX[0] = x[0];
+   ptY[0] = y[0];
+   ptX[1] = x1;
+   ptY[1] = y1;
+
+   for(int i=0; i<arr_size-2; i++)
+     {
+      CalcCurveBezier(x,y,i,tension,x1,y1,x2,y2);
+      ptX[3*i+2] = x1;
+      ptY[3*i+2] = y1;
+      ptX[3*i+3] = x[i+1];
+      ptY[3*i+3] = y[i+1];
+      ptX[3*i+4] = x2;
+      ptY[3*i+4] = y2;
+     }
+   CalcCurveBezierEndp(x[arr_size-1],y[arr_size-1],x[arr_size-2],y[arr_size-2],tension,x1,y1);
+
+   ptX[size_pt-2] = x1;
+   ptY[size_pt-2] = y1;
+   ptX[size_pt-1] = x[arr_size-1];
+   ptY[size_pt-1] = y[arr_size-1];
+//--- calculation of the coordinates of Bezier curves   
+   int index=0;
+   for(int i=0; i<arr_size-1; i++)
+     {
+      //--- Euclidean distance between two neighboring points     
+      double distance=MathSqrt((x[i+1]-x[i])*(x[i+1]-x[i])+(y[i+1]-y[i])*(y[i+1]-y[i]));
+      int size_i=(step>0.0) ?(int)(distance/step) : 1;
+      if(size_i<1)
+         size_i=2;
+      ArrayResize(xc,ArraySize(xc)+size_i,1024);
+      ArrayResize(yc,ArraySize(yc)+size_i,1024);
+      for(int t=0; t<size_i; t++,index++)
+        {
+         xc[index]=(int)MathRound(CalcBezierX((double)t/size_i,ptX[3*i],ptX[3*i+1],ptX[3*i+2],ptX[3*i+3]));
+         yc[index]=(int)MathRound(CalcBezierY((double)t/size_i,ptY[3*i],ptY[3*i+1],ptY[3*i+2],ptY[3*i+3]));
+        }
+     }
+   PolylineThick(xc,yc,clr,size,style,LINE_END_ROUND);
+  }
+//+------------------------------------------------------------------+
+//| Draw smothing polygone                                           |
+//+------------------------------------------------------------------+
+void CCanvas::PolygonSmooth(int &x[],int &y[],const uint clr,const int size,ENUM_LINE_STYLE style=STYLE_SOLID,
+                            ENUM_LINE_END end_style=LINE_END_ROUND,double tension=0.5,double step=10)
+  {
+//---
+   int size_arr= ArraySize(x);
+   if(size_arr!=ArraySize(y))
+      return;
+//---
+   double x1,x2,y1,y2;
+   tension*=0.3;
+//--- coordinates of Bezier curve
+   int xc[];
+   int yc[];
+//--- initialize control points
+   double ptX[];
+   double ptY[];
+   int    size_pt=(size_arr+1)*3-3;
+
+   ArrayResize(ptX,size_pt);
+   ArrayResize(ptY,size_pt);
+//--- calculation of control points
+   int xe[];
+   int ye[];
+   ArrayResize(xe,size_arr+2);
+   ArrayResize(ye,size_arr+2);
+   xe[0]=x[size_arr-1];
+   ye[0]=y[size_arr-1];
+   xe[size_arr+1] = x[0];
+   ye[size_arr+1] = y[0];
+   ArrayCopy(xe,x,1,0,size_arr);
+   ArrayCopy(ye,y,1,0,size_arr);
+//---
+   for(int i=0; i<size_arr; i++)
+     {
+      CalcCurveBezier(xe,ye,i,tension,x1,y1,x2,y2);
+      ptX[3*i+0] = x1;
+      ptY[3*i+0] = y1;
+      ptX[3*i+1] = xe[i+1];
+      ptY[3*i+1] = ye[i+1];
+      ptX[3*i+2] = x2;
+      ptY[3*i+2] = y2;
+     }
+//--- Euclidean distance between two neighboring points     
+   int index=0;
+   for(int i=0; i<size_arr-1; i++)
+     {
+      double distance=MathSqrt((x[i]-x[i+1])*(x[i]-x[i+1])+(y[i]-y[i+1])*(y[i]-y[i+1]));
+      int size_i=(step>0.0) ?(int)(distance/step) : 1;
+      if(size_i<1)
+         size_i=2;
+      ArrayResize(xc,ArraySize(xc)+size_i,1024);
+      ArrayResize(yc,ArraySize(yc)+size_i,1024);
+      for(int t=0; t<size_i; t++,index++)
+        {
+         xc[index]=(int)MathRound(CalcBezierX((double)t/size_i,ptX[1+i*3],ptX[2+i*3],ptX[3+i*3],ptX[4+i*3]));
+         yc[index]=(int)MathRound(CalcBezierY((double)t/size_i,ptY[1+i*3],ptY[2+i*3],ptY[3+i*3],ptY[4+i*3]));
+        }
+     }
+//---
+   double distance=MathSqrt((x[size_arr-1]-x[0])*(x[size_arr-1]-x[0])+(y[size_arr-1]-y[0])*(y[size_arr-1]-y[0]));
+   int size_i=(step>0.0) ?(int)(distance/step) : 1;
+   if(size_i<1)
+      size_i=2;
+   ArrayResize(xc,ArraySize(xc)+size_i,1024);
+   ArrayResize(yc,ArraySize(yc)+size_i,1024);
+   for(int t=0; t<size_i; t++,index++)
+     {
+      xc[index]=(int)MathRound(CalcBezierX((double)t/size_i,ptX[size_pt-2],ptX[size_pt-1],ptX[0],ptX[1]));
+      yc[index]=(int)MathRound(CalcBezierY((double)t/size_i,ptY[size_pt-2],ptY[size_pt-1],ptY[0],ptY[1]));
+     }
+   PolygonThick(xc,yc,clr,size,style,LINE_END_ROUND);
+  }
+//+------------------------------------------------------------------+
+//| Calculates Bezier points from cardinal spline endpoints.         |
+//+------------------------------------------------------------------+
+void CCanvas::CalcCurveBezierEndp(const double xend,const double yend,const double xadj,const double yadj,const double tension,double &x,double &y)
+  {
+   x = (tension * (xadj - xend) + xend);
+   y = (tension * (yadj - yend) + yend);
+  }
+//+------------------------------------------------------------------+
+//| Calculates Bezier points from cardinal spline points             |
+//+------------------------------------------------------------------+
+void CCanvas::CalcCurveBezier(const int &x[],const int &y[],const int i,const double tension,double &x1,double &y1,double &x2,double &y2)
+  {
+   double xdiff,ydiff;
+//--- calculate tangent 
+   xdiff = x[i+2] - x[i];
+   ydiff = y[i+2] - y[i];
+//--- apply tangent to get control points 
+   x1 = x[i+1] - tension * xdiff;
+   y1 = y[i+1] - tension * ydiff;
+   x2 = x[i+1] + tension * xdiff;
+   y2 = y[i+1] + tension * ydiff;
+//---
+  }
+//+------------------------------------------------------------------+
+//| Calculate x coordinate of Bezier curve                           |
+//+------------------------------------------------------------------+
+double CCanvas::CalcBezierX(const double t,const double x0,const double x1,const double x2,const double x3)
+  {
+   return(x0*((1-t)*(1-t)*(1-t))+
+          x1*3*t*((1-t)*(1-t))+
+          x2*3*(t*t)*(1-t)+
+          x3*(t*t*t));
+  }
+//+------------------------------------------------------------------+
+//| Calculate y coordinate of Bezier curve                           |
+//+------------------------------------------------------------------+
+double CCanvas::CalcBezierY(const double t,const double y0,const double y1,const double y2,const double y3)
+  {
+   return(y0*((1-t)*(1-t)*(1-t))+
+          y1*3*t*((1-t)*(1-t))+
+          y2*3*(t*t)*(1-t)+
+          y3*(t*t*t));
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Canvas/Charts/ChartCanvas.mqh b/Include/Canvas/Charts/ChartCanvas.mqh
new file mode 100644
index 0000000..3ac3f49
--- /dev/null
+++ b/Include/Canvas/Charts/ChartCanvas.mqh
@@ -0,0 +1,1041 @@
+//+------------------------------------------------------------------+
+//|                                                  ChartCanvas.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "..\Canvas.mqh"
+#include <Arrays\ArrayInt.mqh>
+#include <Arrays\ArrayDouble.mqh>
+#include <Arrays\ArrayString.mqh>
+//--- enumerations
+enum ENUM_SHOW_FLAGS
+  {
+   FLAG_SHOW_NONE        =0,
+   FLAG_SHOW_LEGEND      =1,
+   FLAG_SHOW_SCALE_LEFT  =2,
+   FLAG_SHOW_SCALE_RIGHT =4,
+   FLAG_SHOW_SCALE_TOP   =8,
+   FLAG_SHOW_SCALE_BOTTOM=16,
+   FLAG_SHOW_GRID        =32,
+   FLAG_SHOW_DESCRIPTORS =64,
+   FLAG_SHOW_VALUE       =128,
+   FLAG_SHOW_PERCENT     =256,
+   FLAGS_SHOW_SCALES     =(FLAG_SHOW_SCALE_LEFT+FLAG_SHOW_SCALE_RIGHT+
+                           FLAG_SHOW_SCALE_TOP+FLAG_SHOW_SCALE_BOTTOM),
+   FLAGS_SHOW_ALL        =(FLAG_SHOW_LEGEND+FLAGS_SHOW_SCALES+FLAG_SHOW_GRID+
+                           FLAG_SHOW_DESCRIPTORS+FLAG_SHOW_VALUE+FLAG_SHOW_PERCENT)
+  };
+enum ENUM_ALIGNMENT
+  {
+   ALIGNMENT_LEFT        = 1,   // align by left border
+   ALIGNMENT_TOP         = 2,   // align by top border
+   ALIGNMENT_RIGHT       = 4,   // align by right border
+   ALIGNMENT_BOTTOM      = 8    // align by bottom border
+  };
+//--- macro
+#define IS_SHOW_LEGEND          ((m_show_flags&FLAG_SHOW_LEGEND)      !=0)
+#define IS_SHOW_SCALES          ((m_show_flags&FLAGS_SHOW_SCALES)     !=0)
+#define IS_SHOW_SCALE_LEFT      ((m_show_flags&FLAG_SHOW_SCALE_LEFT)  !=0)
+#define IS_SHOW_SCALE_RIGHT     ((m_show_flags&FLAG_SHOW_SCALE_RIGHT) !=0)
+#define IS_SHOW_SCALE_TOP       ((m_show_flags&FLAG_SHOW_SCALE_TOP)   !=0)
+#define IS_SHOW_SCALE_BOTTOM    ((m_show_flags&FLAG_SHOW_SCALE_BOTTOM)!=0)
+#define IS_SHOW_GRID            ((m_show_flags&FLAG_SHOW_GRID)        !=0)
+#define IS_SHOW_DESCRIPTORS     ((m_show_flags&FLAG_SHOW_DESCRIPTORS) !=0)
+#define IS_SHOW_VALUE           ((m_show_flags&FLAG_SHOW_VALUE)       !=0)
+#define IS_SHOW_PERCENT         ((m_show_flags&FLAG_SHOW_PERCENT)     !=0)
+//+------------------------------------------------------------------+
+//| Class CChartCanvas                                               |
+//| Usage: base class for graphical charts                           |
+//+------------------------------------------------------------------+
+class CChartCanvas : public CCanvas
+  {
+protected:
+   //--- colors
+   uint              m_color_background;
+   uint              m_color_border;
+   uint              m_color_text;
+   uint              m_color_grid;
+   //--- adjusted parameters
+   uint              m_max_data;
+   uint              m_max_descr_len;
+   uint              m_allowed_show_flags;
+   uint              m_show_flags;
+   ENUM_ALIGNMENT    m_legend_alignment;
+   uint              m_threshold_drawing;
+   bool              m_accumulative;
+   //--- parameters for scales and grid
+   double            m_v_scale_min;
+   double            m_v_scale_max;
+   uint              m_num_grid;
+   int               m_scale_digits;
+   //--- data
+   int               m_data_offset;
+   uint              m_data_total;
+   CArray           *m_data;
+   CArrayInt         m_colors;
+   CArrayString      m_descriptors;
+   //---
+   CArrayInt         m_index;
+   uint              m_index_size;
+   double            m_sum;
+   double            m_others;
+   uint              m_max_descr_width;
+   uint              m_max_value_width;
+   //--- variables
+   CRect             m_data_area;
+   //--- variables for scaling and scales
+   double            m_scale_x;
+   int               m_x_min;
+   int               m_x_0;
+   int               m_x_max;
+   int               m_dx_grid;
+   double            m_scale_y;
+   int               m_y_min;
+   int               m_y_0;
+   int               m_y_max;
+   int               m_dy_grid;
+   string            m_scale_text[];
+
+public:
+                     CChartCanvas(void);
+                    ~CChartCanvas(void);
+   //--- create
+   virtual bool      Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   //--- colors
+   uint              ColorBackground(void) const { return(m_color_background); }
+   void              ColorBackground(const uint value);
+   uint              ColorBorder(void) const { return(m_color_border); }
+   void              ColorBorder(const uint value);
+   uint              ColorText(void) const { return(m_color_text); }
+   void              ColorText(const uint value);
+   uint              ColorGrid(void) const { return(m_color_grid); }
+   void              ColorGrid(const uint value) { m_color_grid=value; }
+   //--- adjusted parameters
+   uint              MaxData(void) const { return(m_max_data); }
+   void              MaxData(const uint value);
+   uint              MaxDescrLen(void) const { return(m_max_descr_len); }
+   void              MaxDescrLen(const uint value);
+   //--- show flags
+   void              AllowedShowFlags(const uint flags);
+   bool              ShowFlags(void) const { return(m_show_flags); }
+   void              ShowFlags(const uint flags);
+   bool              IsShowLegend(void)          const { return(IS_SHOW_LEGEND);       }
+   bool              IsShowScaleLeft(void)       const { return(IS_SHOW_SCALE_LEFT);   }
+   bool              IsShowScaleRight(void)      const { return(IS_SHOW_SCALE_RIGHT);  }
+   bool              IsShowScaleTop(void)        const { return(IS_SHOW_SCALE_TOP);    }
+   bool              IsShowScaleBottom(void)     const { return(IS_SHOW_SCALE_BOTTOM); }
+   bool              IsShowGrid(void)            const { return(IS_SHOW_GRID);         }
+   bool              IsShowDescriptors(void)     const { return(IS_SHOW_DESCRIPTORS);  }
+   bool              IsShowPercent(void)         const { return(IS_SHOW_PERCENT);      }
+   void              ShowLegend(const bool flag=true);
+   void              ShowScaleLeft(const bool flag=true);
+   void              ShowScaleRight(const bool flag=true);
+   void              ShowScaleTop(const bool flag=true);
+   void              ShowScaleBottom(const bool flag=true);
+   void              ShowGrid(const bool flag=true);
+   void              ShowDescriptors(const bool flag=true);
+   void              ShowValue(const bool flag=true);
+   void              ShowPercent(const bool flag=true);
+   void              LegendAlignment(const ENUM_ALIGNMENT value);
+   void              Accumulative(const bool flag=true);
+   //--- for scales and grid
+   double            VScaleMin(void) const { return(m_v_scale_min); }
+   void              VScaleMin(const double value);
+   double            VScaleMax(void) const { return(m_v_scale_max); }
+   void              VScaleMax(const double value);
+   uint              NumGrid(void) const { return(m_num_grid); }
+   void              NumGrid(const uint value);
+   void              VScaleParams(const double max,const double min,const uint grid);
+   //--- state
+   int               DataOffset(void) const { return(m_data_offset); }
+   void              DataOffset(const int value);
+   //--- data
+   uint              DataTotal(void) const { return(m_data_total); }
+   bool              DescriptorUpdate(const uint pos,const string descr);
+   bool              ColorUpdate(const uint pos,const uint clr);
+
+protected:
+   virtual void      ValuesCheck(void);
+   virtual void      Redraw(void);
+   virtual void      DrawBackground(void);
+   virtual void      DrawLegend(void);
+   int               DrawLegendVertical(const int w,const int h);
+   int               DrawLegendHorizontal(const int w,const int h);
+   virtual void      CalcScales(void);
+   virtual void      DrawScales(void);
+   virtual int       DrawScaleLeft(const bool draw=true);
+   virtual int       DrawScaleRight(const bool draw=true);
+   virtual int       DrawScaleTop(const bool draw=true);
+   virtual int       DrawScaleBottom(const bool draw=true);
+   virtual void      DrawGrid(void);
+   virtual void      DrawDescriptors(void)       {}
+   virtual void      DrawChart(void);
+   virtual void      DrawData(const uint idx=0)  {}
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartCanvas::CChartCanvas(void) : m_color_background(XRGB(0xFF,0xFF,0xFF)),
+                                   m_color_border(XRGB(0x9F,0x9F,0x9F)),
+                                   m_color_text(XRGB(0x3F,0x3F,0x3F)),
+                                   m_color_grid(XRGB(0xCF,0xCF,0xCF)),
+                                   m_max_data(10),
+                                   m_max_descr_len(10),
+                                   m_allowed_show_flags(FLAGS_SHOW_ALL),
+                                   m_show_flags(FLAG_SHOW_NONE),
+                                   m_legend_alignment(ALIGNMENT_BOTTOM),
+                                   m_threshold_drawing(2),
+                                   m_accumulative(false),
+                                   m_data_offset(0),
+                                   m_data_total(0),
+                                   m_data(NULL),
+                                   m_v_scale_min(0.0),
+                                   m_v_scale_max(10.0),
+                                   m_num_grid(5),
+                                   m_scale_digits(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartCanvas::~CChartCanvas(void)
+  {
+   if(m_data!=NULL)
+      delete m_data;
+  }
+//+------------------------------------------------------------------+
+//| Create dynamic resource                                          |
+//+------------------------------------------------------------------+
+bool CChartCanvas::Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+//--- call method of parent class
+   if(!CCanvas::Create(name,width,height,clrfmt))
+      return(false);
+//--- set font
+   FontSet("Tahoma",-100);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Sets background color                                            |
+//+------------------------------------------------------------------+
+void CChartCanvas::ColorBackground(const uint value)
+  {
+   m_color_background=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets border color                                                |
+//+------------------------------------------------------------------+
+void CChartCanvas::ColorBorder(const uint value)
+  {
+   m_color_border=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets text color                                                  |
+//+------------------------------------------------------------------+
+void CChartCanvas::ColorText(const uint value)
+  {
+   m_color_text=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets maximum amount of data                                      |
+//+------------------------------------------------------------------+
+void CChartCanvas::MaxData(const uint value)
+  {
+//--- check
+   if((value==0) || (m_data_total==value))
+    return;
+//--- save
+   m_max_data=value;
+   if(m_data_total>m_max_data)
+     {
+      m_data_total=value;
+      m_colors.Resize(value);
+      m_descriptors.Resize(value);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets maximum length of descriptor                                |
+//+------------------------------------------------------------------+
+void CChartCanvas::MaxDescrLen(const uint value)
+  {
+   m_max_descr_len=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets allowed visibility flags                                    |
+//+------------------------------------------------------------------+
+void CChartCanvas::AllowedShowFlags(const uint flags)
+  {
+   m_allowed_show_flags=flags;
+   m_show_flags&=m_allowed_show_flags;
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flags                                            |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowFlags(const uint flags)
+  {
+   m_show_flags=flags&m_allowed_show_flags;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for "legend"                                |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowLegend(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_LEGEND)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_LEGEND;
+      else
+         m_show_flags&=~FLAG_SHOW_LEGEND;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for left scale                              |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowScaleLeft(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_SCALE_LEFT)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_SCALE_LEFT;
+      else
+         m_show_flags&=~FLAG_SHOW_SCALE_LEFT;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for right scale                             |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowScaleRight(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_SCALE_RIGHT)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_SCALE_RIGHT;
+      else
+         m_show_flags&=~FLAG_SHOW_SCALE_RIGHT;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for top scale                               |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowScaleTop(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_SCALE_TOP)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_SCALE_TOP;
+      else
+         m_show_flags&=~FLAG_SHOW_SCALE_TOP;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for bottom scale                            |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowScaleBottom(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_SCALE_BOTTOM)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_SCALE_BOTTOM;
+      else
+         m_show_flags&=~FLAG_SHOW_SCALE_BOTTOM;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for grid                                    |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowGrid(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_GRID)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_GRID;
+      else
+         m_show_flags&=~FLAG_SHOW_GRID;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for descriptors                             |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowDescriptors(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_DESCRIPTORS)!=0)
+     {
+      if(flag)
+         m_show_flags|=FLAG_SHOW_DESCRIPTORS;
+      else
+         m_show_flags&=~FLAG_SHOW_DESCRIPTORS;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for value                                   |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowValue(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_VALUE)!=0)
+     {
+      if(flag)
+        {
+         m_show_flags|=FLAG_SHOW_VALUE;
+         m_show_flags&=~FLAG_SHOW_PERCENT;
+        }
+      else
+         m_show_flags&=~FLAG_SHOW_VALUE;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets visibility flag for percentage                              |
+//+------------------------------------------------------------------+
+void CChartCanvas::ShowPercent(const bool flag)
+  {
+   if((m_allowed_show_flags&FLAG_SHOW_PERCENT)!=0)
+     {
+      if(flag)
+        {
+         m_show_flags|=FLAG_SHOW_PERCENT;
+         m_show_flags&=~FLAG_SHOW_VALUE;
+        }
+      else
+         m_show_flags&=~FLAG_SHOW_PERCENT;
+      //--- redraw
+      if(m_data_total>0)
+         Redraw();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets legend alignment                                            |
+//+------------------------------------------------------------------+
+void CChartCanvas::LegendAlignment(const ENUM_ALIGNMENT value)
+  {
+   m_legend_alignment=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets accumulative flag                                           |
+//+------------------------------------------------------------------+
+void CChartCanvas::Accumulative(const bool flag=true)
+  {
+   m_accumulative=flag;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets lower limit for vertical scale                              |
+//+------------------------------------------------------------------+
+void CChartCanvas::VScaleMin(const double value)
+  {
+//--- check
+   if(value==m_v_scale_max)
+      return;
+//--- save
+   m_v_scale_min=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets upper limit for vertical scale                              |
+//+------------------------------------------------------------------+
+void CChartCanvas::VScaleMax(const double value)
+  {
+   if(value==m_v_scale_min)
+      return;
+//--- save
+   m_v_scale_max=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets number of vertical scale divisions                          |
+//+------------------------------------------------------------------+
+void CChartCanvas::NumGrid(const uint value)
+  {
+//--- check
+   if(value==0)
+    return;
+//--- save
+   m_num_grid=value;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets parameters for vertical scale                               |
+//+------------------------------------------------------------------+
+void CChartCanvas::VScaleParams(const double max,const double min,const uint grid)
+  {
+//--- check
+   if(grid==0)
+      return;
+   if(max<=min)
+      return;
+//--- save
+   m_v_scale_max=max;
+   m_v_scale_min=min;
+   m_num_grid   =grid;
+//--- redraw
+   if(m_data_total>0)
+      Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Sets data offset                                                 |
+//+------------------------------------------------------------------+
+void CChartCanvas::DataOffset(const int value)
+  {
+   m_data_offset=value;
+//--- redraw
+   Redraw();
+  }
+//+------------------------------------------------------------------+
+//| Updates parameter descriptor only (in specified position)        |
+//+------------------------------------------------------------------+
+bool CChartCanvas::DescriptorUpdate(const uint pos,const string descr)
+  {
+//--- update
+   if(descr!=NULL && !m_descriptors.Update(pos,descr))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Updates parameter color only (in specified position)             |
+//+------------------------------------------------------------------+
+bool CChartCanvas::ColorUpdate(const uint pos,const uint clr)
+  {
+//--- update
+   if(clr!=0 && !m_colors.Update(pos,clr))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Checks values for insignificance                                 |
+//+------------------------------------------------------------------+
+void CChartCanvas::ValuesCheck(void)
+  {
+   string text;
+   uint   w,h;
+//--- clear
+   m_max_value_width=0;
+   m_sum            =0;
+   m_others         =0;
+   m_index_size     =0;
+   m_index.Clear();
+//--- check
+   if(m_data==NULL)
+      return;
+   if(m_data.Type()==TYPE_DOUBLE)
+     {
+      //--- single-series chart
+      //--- calculate sum of all values
+      for(uint i=0;i<m_data_total;i++)
+         m_sum+=((CArrayDouble*)m_data)[i];
+      //--- find insignificant values
+      for(uint i=0;i<m_data_total;i++)
+        {
+         double value=((CArrayDouble*)m_data)[i];
+         //--- insignificant value is less than drawing threshold value
+         if(value/m_sum<0.01*m_threshold_drawing)
+           {
+            //--- move insignificant value to 'others' group
+            m_others+=value;
+           }
+         else
+           {
+            //--- populate index for all significant values
+            m_index.Add(i);
+            text=DoubleToString(value,2);
+            TextSize(text,w,h);
+            if(m_max_value_width<w)
+               m_max_value_width=w;
+           }
+        }
+      text=DoubleToString(m_others,2);
+      TextSize(text,w,h);
+      if(m_max_value_width<w)
+         m_max_value_width=w;
+      m_index_size=m_index.Total();
+     }
+   else
+     {
+      //--- multi-series chart
+      //--- populate index for uniformity
+      for(uint i=0;i<m_data_total;i++)
+         m_index.Add(i);
+      m_index_size=m_data_total;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Redraws chart                                                    |
+//+------------------------------------------------------------------+
+void CChartCanvas::Redraw(void)
+  {
+   int gap=m_fontsize/(-10);
+   m_data_area.SetBound(gap,gap,m_width-gap,m_height-gap);
+//--- values check
+   ValuesCheck();
+//--- draw background
+   DrawBackground();
+//--- draw auxiliary elements
+   if(IS_SHOW_LEGEND)
+      DrawLegend();
+   if(IS_SHOW_SCALES)
+      DrawScales();
+   if(IS_SHOW_GRID)
+      DrawGrid();
+   if(IS_SHOW_DESCRIPTORS)
+      DrawDescriptors();
+//--- draw data
+   DrawChart();
+//--- fix changes
+   Update();
+  }
+//+------------------------------------------------------------------+
+//| Redraws background                                               |
+//+------------------------------------------------------------------+
+void CChartCanvas::DrawBackground(void)
+  {
+   Erase(m_color_background);
+   Rectangle(0,0,m_width-1,m_height-1,m_color_border);
+  }
+//+------------------------------------------------------------------+
+//| Redraws "legend"                                                 |
+//+------------------------------------------------------------------+
+void CChartCanvas::DrawLegend(void)
+  {
+//--- check
+   if(m_data_total==0)
+      return;
+//--- variables
+   string text="A";
+   int    max_len=0;
+   int    w,h;
+//--- set font
+   FontAngleSet(0);
+//--- calculate
+   if(m_data_total==m_index_size)
+     {
+      for(uint i=0;i<m_data_total;i++)
+        {
+         w=StringLen(m_descriptors[i]);
+         if(max_len<w)
+           {
+            max_len=w;
+            text=m_descriptors[i];
+           }
+        }
+     }
+   else
+     {
+      for(uint i=0;i<m_index_size;i++)
+        {
+         int index=m_index[i];
+         w=StringLen(m_descriptors[index]);
+         if(max_len<w)
+           {
+            max_len=w;
+            text=m_descriptors[index];
+           }
+        }
+      w=StringLen("Others");
+      if(max_len<w)
+        {
+         max_len=w;
+         text="Others";
+        }
+     }
+   if(max_len==0)
+    return;
+   TextSize(" - "+text,m_max_descr_width,h);
+   w=(int)m_max_descr_width+3*h;
+//--- check flag
+   if(!IS_SHOW_LEGEND)
+      return;
+//--- draw
+   switch(m_legend_alignment)
+     {
+      case ALIGNMENT_LEFT:
+         m_data_area.left+=DrawLegendVertical(w,h);
+         break;
+      case ALIGNMENT_RIGHT:
+         m_data_area.right-=DrawLegendVertical(w,h);
+         break;
+      case ALIGNMENT_TOP:
+         m_data_area.top+=DrawLegendHorizontal(w,h);
+         break;
+      case ALIGNMENT_BOTTOM:
+         m_data_area.bottom-=DrawLegendHorizontal(w,h);
+         break;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draw vertical "legend"                                           |
+//+------------------------------------------------------------------+
+int CChartCanvas::DrawLegendVertical(const int w,const int h)
+  {
+   int width =m_data_area.Width();
+   int height=m_data_area.Height();
+   int rows  =(int)m_index_size;
+   int cols  =1;
+   int dy    =(int)(1.5*h);
+//--- calculate
+   while(dy*rows>m_height)
+     {
+      cols++;
+      rows=(int)m_index_size/cols;
+      if((int)m_index_size%cols!=0)
+         rows++;
+     }
+//--- draw
+   int x0=(m_legend_alignment==ALIGNMENT_RIGHT) ? width-w*cols+h : h;
+   int x=0;
+   int y =-h/2;
+   int i;
+   if(m_data_total==m_index_size)
+     {
+      for(i=0;i<(int)m_data_total;i++,x+=w)
+        {
+         if(i%cols==0)
+           {
+            x=x0;
+            y+=dy;
+           }
+         FillRectangle(x,y,x+h,y+h,(uint)m_colors[i]);
+         TextOut(x+h,y," - "+m_descriptors[i],m_color_text);
+        }
+     }
+   else
+     {
+      for(i=0;i<(int)m_index_size;i++,x+=w)
+        {
+         int index=m_index[i];
+         if(i%cols==0)
+           {
+            x=x0;
+            y+=dy;
+           }
+         FillRectangle(x,y,x+h,y+h,(uint)m_colors[index]);
+         TextOut(x+h,y," - "+m_descriptors[index],m_color_text);
+        }
+      if(i%cols==0)
+        {
+         x=x0;
+         y+=dy;
+        }
+      FillRectangle(x,y,x+h,y+h,COLOR2RGB(clrBlack));
+      TextOut(x+h,y," - Others",m_color_text);
+     }
+//--- width
+   return(w*cols);
+  }
+//+------------------------------------------------------------------+
+//| Draw horizontal "legend"                                         |
+//+------------------------------------------------------------------+
+int CChartCanvas::DrawLegendHorizontal(const int w,const int h)
+  {
+   int width =m_data_area.Width();
+   int height=m_data_area.Height();
+   int rows  =1;
+   int cols  =(int)m_index_size;
+//--- calculate
+   while(w*cols>m_width)
+     {
+      rows++;
+      cols=(int)m_index_size/rows;
+      if((int)m_index_size%rows!=0)
+         cols++;
+     }
+//--- draw
+   int dx=width/(cols+1);
+   int x =dx-w/2+h;
+   int dy=(int)(1.5*h);
+   int y =(m_legend_alignment==ALIGNMENT_BOTTOM) ? height-dy*(rows+1) : -h/2;
+   int i;
+   if(m_data_total==m_index_size)
+     {
+      for(i=0;i<(int)m_data_total;i++,x+=dx)
+        {
+         if(i%cols==0)
+           {
+            x=dx-w/2+h;
+            y+=dy;
+           }
+         FillRectangle(x,y,x+h,y+h,(uint)m_colors[i]);
+         TextOut(x+h,y," - "+m_descriptors[i],m_color_text);
+        }
+      }
+    else
+      {
+      for(i=0;i<(int)m_index_size;i++,x+=dx)
+        {
+         int index=m_index[i];
+         if(i%cols==0)
+           {
+            x=dx-w/2+h;
+            y+=dy;
+           }
+         FillRectangle(x,y,x+h,y+h,(uint)m_colors[index]);
+         TextOut(x+h,y," - "+m_descriptors[index],m_color_text);
+        }
+      if(i%cols==0)
+        {
+         x=dx-w/2+h;
+         y+=dy;
+        }
+      FillRectangle(x,y,x+h,y+h,COLOR2RGB(clrBlack));
+      TextOut(x+h,y," - Others",m_color_text);
+      }
+//--- height
+   return(dy*(rows+1));
+  }
+//+------------------------------------------------------------------+
+//| Calculates coordinates of scales                                 |
+//+------------------------------------------------------------------+
+void CChartCanvas::CalcScales(void)
+  {
+   int width =m_data_area.Width();
+   int height=m_data_area.Height();
+//--- limits
+   m_y_max=m_data_area.top+DrawScaleTop(false);
+   m_y_min=m_data_area.bottom-DrawScaleBottom(false);
+//--- additional
+   m_dy_grid=(int)((m_y_min-m_y_max)/m_num_grid);
+   m_y_max+=(int)(((m_y_min-m_y_max)-m_dy_grid*m_num_grid)/2);
+   m_y_min=(int)(m_y_max+m_dy_grid*m_num_grid);
+//--- normalize
+   if(m_v_scale_min>=0.0)
+      m_y_0=m_y_min;
+   else
+     {
+      if(m_v_scale_max<=0.0)
+         m_y_0=m_y_max;
+      else
+         m_y_0=(int)(m_y_max+(m_y_min-m_y_max)*m_v_scale_max/(m_v_scale_max-m_v_scale_min));
+     }
+//--- scale
+   m_scale_y=(m_v_scale_max!=m_v_scale_min) ? (m_y_min-m_y_max)/(m_v_scale_max-m_v_scale_min) : 1;
+//--- labels on scale
+   if(ArraySize(m_scale_text)!=m_num_grid+1 && ArrayResize(m_scale_text,m_num_grid+1)==-1)
+      return;
+   double val=m_v_scale_min;
+   double dval=(m_v_scale_max-m_v_scale_min)/m_num_grid;
+   for(uint i=0;i<=m_num_grid;i++,val+=dval)
+      m_scale_text[i]=DoubleToString(val,m_scale_digits);
+  }
+//+------------------------------------------------------------------+
+//| Redraws scales                                                   |
+//+------------------------------------------------------------------+
+void CChartCanvas::DrawScales(void)
+  {
+//--- recalculate
+   CalcScales();
+//--- redraw scales
+   if(IS_SHOW_SCALE_LEFT)
+      DrawScaleLeft();
+   if(IS_SHOW_SCALE_RIGHT)
+      DrawScaleRight();
+   if(IS_SHOW_SCALE_TOP)
+      DrawScaleTop();
+   if(IS_SHOW_SCALE_BOTTOM)
+      DrawScaleBottom();
+  }
+//+------------------------------------------------------------------+
+//| Redraws left scale                                               |
+//+------------------------------------------------------------------+
+int CChartCanvas::DrawScaleLeft(const bool draw)
+  {
+//--- check flag
+   if(!IS_SHOW_SCALE_LEFT)
+      return(0);
+//--- variables
+   int x1=m_data_area.left;
+   int x2;
+   int y=m_y_min;
+//--- calculate scale width
+   int size=0;
+   for(uint i=0;i<=m_num_grid;i++)
+     {
+      if(size<TextWidth(m_scale_text[i]))
+         size=TextWidth(m_scale_text[i]);
+     }
+//--- add indent and graduation mark (for now 5 pixels)
+   size+=5+5;
+//--- draw
+   if(draw)
+     {
+      x2=x1+size;
+      x1=x2-5;
+      //--- draw line
+      Line(x2,y,x2,m_y_max,m_color_text);
+      //--- set font
+      FontAngleSet(0);
+      //--- draw text
+      for(uint i=0;i<=m_num_grid;i++,y-=m_dy_grid)
+        {
+         Line(x1,y,x2,y,m_color_text);
+         if((int)i<ArraySize(m_scale_text))
+            TextOut(x1-5,y,m_scale_text[i],m_color_text,TA_RIGHT|TA_VCENTER);
+        }
+      //--- adjust data area
+      m_data_area.left+=size;
+     }
+//--- return width
+   return(size);
+  }
+//+------------------------------------------------------------------+
+//| Redraws right scale                                              |
+//+------------------------------------------------------------------+
+int CChartCanvas::DrawScaleRight(const bool draw)
+  {
+//--- check flag
+   if(!IS_SHOW_SCALE_RIGHT)
+      return(0);
+//--- variables
+   int x1;
+   int x2=m_data_area.right;
+   int y =m_y_min;
+//--- calculate scale width
+   int size=0;
+   for(uint i=0;i<=m_num_grid;i++)
+     {
+      if(size<TextWidth(m_scale_text[i]))
+         size=TextWidth(m_scale_text[i]);
+     }
+//--- add indent and graduation mark (for now 5 pixels)
+   size+=5+5;
+//--- draw
+   if(draw)
+     {
+      x1=x2-size;
+      x2=x1+5;
+      //--- draw line
+      Line(x1,y,x1,m_y_max,m_color_text);
+      //--- set font
+      FontAngleSet(0);
+      //--- draw text
+      for(uint i=0;i<=m_num_grid;i++,y-=m_dy_grid)
+        {
+         Line(x1,y,x2,y,m_color_text);
+         if((int)i<ArraySize(m_scale_text))
+            TextOut(x2+5,y,m_scale_text[i],m_color_text,TA_LEFT|TA_VCENTER);
+        }
+      //--- adjust data area
+      m_data_area.right-=size;
+     }
+//--- return widht
+   return(size);
+  }
+//+------------------------------------------------------------------+
+//| Redraws top scale                                                |
+//+------------------------------------------------------------------+
+int CChartCanvas::DrawScaleTop(const bool draw)
+  {
+   int size=0;
+//--- check flag
+   if(!IS_SHOW_SCALE_TOP)
+      return(0);
+//--- draw
+   if(draw)
+     {
+      //--- draw line
+      Line(m_data_area.left,m_y_max,m_data_area.right,m_y_max,m_color_text);
+     }
+//--- return height
+   return(size);
+  }
+//+------------------------------------------------------------------+
+//| Redraws bottom scale                                             |
+//+------------------------------------------------------------------+
+int CChartCanvas::DrawScaleBottom(const bool draw)
+  {
+   int size=0;
+//--- check flag
+   if(!IS_SHOW_SCALE_BOTTOM)
+      return(0);
+//--- draw
+   if(draw)
+     {
+      //--- draw line
+      Line(m_data_area.left,m_y_min,m_data_area.right,m_y_min,m_color_text);
+     }
+//--- return height
+   return(size);
+  }
+//+------------------------------------------------------------------+
+//| Redraws grid                                                     |
+//+------------------------------------------------------------------+
+void CChartCanvas::DrawGrid(void)
+  {
+//--- check flag
+   if(!IS_SHOW_GRID)
+      return;
+//--- variables
+   int x1=m_data_area.left;
+   int x2=m_data_area.right;
+   int y =m_y_min;
+//--- draw
+   uint j=m_num_grid-((IS_SHOW_SCALE_TOP) ? 1 : 0);
+   if(IS_SHOW_SCALE_BOTTOM)
+     {
+      y-=m_dy_grid;
+      j--;
+     }
+   for(uint i=0;i<=j;i++,y-=m_dy_grid)
+      LineAA(x1,y,x2,y,m_color_grid,STYLE_DASH);
+  }
+//+------------------------------------------------------------------+
+//| Redraws data                                                     |
+//+------------------------------------------------------------------+
+void CChartCanvas::DrawChart(void)
+  {
+   for(uint i=0;i<m_data_total;i++)
+      DrawData(i);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Canvas/Charts/HistogramChart.mqh b/Include/Canvas/Charts/HistogramChart.mqh
new file mode 100644
index 0000000..e8a9e09
--- /dev/null
+++ b/Include/Canvas/Charts/HistogramChart.mqh
@@ -0,0 +1,347 @@
+//+------------------------------------------------------------------+
+//|                                               HistogramChart.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "ChartCanvas.mqh"
+#include <Arrays\ArrayObj.mqh>
+//+------------------------------------------------------------------+
+//| Class CHistogramChart                                            |
+//| Usage: generates histogram chart                                 |
+//+------------------------------------------------------------------+
+class CHistogramChart : public CChartCanvas
+  {
+private:
+   //--- colors
+   uint              m_fill_brush[];
+   //--- adjusted parameters
+   bool              m_gradient;
+   uint              m_bar_gap;
+   uint              m_bar_min_size;
+   uint              m_bar_border;
+   //--- data
+   CArrayObj        *m_values;
+
+public:
+                     CHistogramChart(void);
+                    ~CHistogramChart(void);
+   //--- create
+   virtual bool      Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_ARGB_NORMALIZE);
+   //--- adjusted parameters
+   void              Gradient(const bool flag=true) { m_gradient=flag;      }
+   void              BarGap(const uint value)       { m_bar_gap=value;      }
+   void              BarMinSize(const uint value)   { m_bar_min_size=value; }
+   void              BarBorder(const uint value)    { m_bar_border=value;   }
+   //--- data
+   bool              SeriesAdd(const double &value[],const string descr="",const uint clr=0);
+   bool              SeriesInsert(const uint pos,const double &value[],const string descr="",const uint clr=0);
+   bool              SeriesUpdate(const uint pos,const double &value[],const string descr=NULL,const uint clr=0);
+   bool              SeriesDelete(const uint pos);
+   bool              ValueUpdate(const uint series,const uint pos,double value);
+
+protected:
+   virtual void      DrawData(const uint idx);
+   void              DrawBar(const int x,const int y,const int w,const int h,const uint clr);
+   void              GradientBrush(const int size,const uint fill_clr);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CHistogramChart::CHistogramChart(void) : m_gradient(true),
+                                           m_bar_gap(3),
+                                           m_bar_min_size(5),
+                                           m_bar_border(0)
+  {
+   ShowFlags(FLAG_SHOW_LEGEND|FLAGS_SHOW_SCALES|FLAG_SHOW_GRID);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CHistogramChart::~CHistogramChart(void)
+  {
+   if(ArraySize(m_fill_brush)!=0)
+      ArrayFree(m_fill_brush);
+  }
+//+------------------------------------------------------------------+
+//| Create dynamic resource                                          |
+//+------------------------------------------------------------------+
+bool CHistogramChart::Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+//--- create object to store data
+   if((m_values=new CArrayObj)==NULL)
+      return(false);
+//--- pass responsibility for its destruction to the parent class
+   m_data=m_values;
+//--- call method of parent class
+   if(!CChartCanvas::Create(name,width,height,clrfmt))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adds data series                                                 |
+//+------------------------------------------------------------------+
+bool CHistogramChart::SeriesAdd(const double &value[],const string descr,const uint clr)
+  {
+//--- check
+   if(m_data_total==m_max_data)
+      return(false);
+//--- add
+   CArrayDouble *arr=new CArrayDouble;
+   if(!m_values.Add(arr))
+      return(false);
+   if(!arr.AssignArray(value))
+      return(false);
+   if(!m_colors.Add((clr==0) ? GetDefaultColor(m_data_total) : clr))
+      return(false);
+   if(!m_descriptors.Add(descr))
+      return(false);
+   m_data_total++;
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserts data series                                              |
+//+------------------------------------------------------------------+
+bool CHistogramChart::SeriesInsert(const uint pos,const double &value[],const string descr,const uint clr)
+  {
+//--- check
+   if(m_data_total==m_max_data)
+      return(false);
+   if(pos>=m_data_total)
+      return(false);
+//--- insert
+   CArrayDouble *arr=new CArrayDouble;
+   if(!m_values.Insert(arr,pos))
+      return(false);
+   if(!arr.AssignArray(value))
+      return(false);
+   if(!m_colors.Insert((clr==0) ? GetDefaultColor(m_data_total) : clr,pos))
+      return(false);
+   if(!m_descriptors.Insert(descr,pos))
+      return(false);
+   m_data_total++;
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Updates data series                                              |
+//+------------------------------------------------------------------+
+bool CHistogramChart::SeriesUpdate(const uint pos,const double &value[],const string descr,const uint clr)
+  {
+//--- check
+   if(pos>=m_data_total)
+      return(false);
+   CArrayDouble *data=m_values.At(pos);
+   if(data==NULL)
+      return(false);
+//--- update
+   if(!data.AssignArray(value))
+      return(false);
+   if(clr!=0 && !m_colors.Update(pos,clr))
+      return(false);
+   if(descr!=NULL && !m_descriptors.Update(pos,descr))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deletes data series                                              |
+//+------------------------------------------------------------------+
+bool CHistogramChart::SeriesDelete(const uint pos)
+  {
+//--- check
+   if(pos>=m_data_total && m_data_total!=0)
+      return(false);
+//--- delete
+   if(!m_values.Delete(pos))
+      return(false);
+   m_data_total--;
+   if(!m_colors.Delete(pos))
+      return(false);
+   if(!m_descriptors.Delete(pos))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Updates element in data series                                   |
+//+------------------------------------------------------------------+
+bool CHistogramChart::ValueUpdate(const uint series,const uint pos,double value)
+  {
+   CArrayDouble *data=m_values.At(series);
+//--- check
+   if(data==NULL)
+      return(false);
+//--- update
+   if(!data.Update(pos,value))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Draws histogram                                                  |
+//+------------------------------------------------------------------+
+void CHistogramChart::DrawData(const uint idx)
+  {
+   double value=0.0;
+//--- check
+   CArrayDouble *data=m_values.At(idx);
+   if(data==NULL)
+      return;
+   int total=data.Total();
+   if(total==0 || (int)idx>=total)
+      return;
+//--- calculate
+   int  x1=m_data_area.left;
+   int  x2=m_data_area.right;
+   int  dx=(x2-x1)/total;
+   uint clr=m_colors[idx];
+   uint w=dx/m_data_total;
+   if(w<m_bar_min_size)
+      w=m_bar_min_size;
+   int x=x1+(int)(m_bar_gap+w*idx);
+//--- set font
+   string fontname;
+   int    fontsize=0;
+   uint   fontflags=0;
+   uint   fontangle=0;
+   if(IS_SHOW_VALUE)
+     {
+      FontGet(fontname,fontsize,fontflags,fontangle);
+      FontSet(fontname,-10*(w-3),fontflags,900);
+     }
+//--- prepare gradient fill
+   GradientBrush(w,clr);
+//--- draw
+   for(int i=0;i<total;i++,x+=dx)
+     {
+      int y,h;
+      double val=data[i];
+      if(val==EMPTY_VALUE)
+         continue;
+      if(m_accumulative)
+         value+=val;
+      else
+         value=val;
+//      int val=(int)(value*m_scale_y);
+      if(value>0)
+        {
+         y=(m_y_0-(int)(value*m_scale_y));
+         h=m_y_0-y;
+        }
+      else
+        {
+         y=m_y_0;
+         h=-(int)(value*m_scale_y);
+        }
+      DrawBar(x,y,w,h,clr);
+      //--- draw text of value
+      if(IS_SHOW_VALUE)
+        {
+         string text =DoubleToString(value,2);
+         int    width=(int)(TextWidth(text)+w);
+         if(value>0)
+           {
+            if(width>y-m_y_max)
+               TextOut(x+w/2,y+w,text,m_color_text,TA_RIGHT|TA_VCENTER);
+            else
+               TextOut(x+w/2,y-w,text,m_color_text,TA_LEFT|TA_VCENTER);
+           }
+         else
+           {
+            if(width>m_y_min-y-h)
+               TextOut(x+w/2,y+h-w,text,m_color_text,TA_LEFT|TA_VCENTER);
+            else
+               TextOut(x+w/2,y+h+w,text,m_color_text,TA_RIGHT|TA_VCENTER);
+           }
+        }
+     }
+   if(IS_SHOW_VALUE)
+      FontSet(fontname,fontsize,fontflags,fontangle);
+  }
+//+------------------------------------------------------------------+
+//| Draws bar                                                        |
+//+------------------------------------------------------------------+
+void CHistogramChart::DrawBar(const int x,const int y,const int w,const int h,const uint clr)
+  {
+//--- draw bar
+   if(!m_gradient || ArraySize(m_fill_brush)<w)
+      FillRectangle(x+1,y+1,w-x-2,h-y-2,clr);
+   else
+     {
+      for(int i=1;i<h;i++)
+         ArrayCopy(m_pixels,m_fill_brush,(y+i)*m_width+x+1,0,w);
+     }
+//--- draw bar border
+   if(m_bar_border!=0)
+      Rectangle(x,y,x+w-1,y+h-1,m_color_border);
+  }
+//+------------------------------------------------------------------+
+//| Creates brush for gradient fill                                  |
+//+------------------------------------------------------------------+
+void CHistogramChart::GradientBrush(const int size,const uint fill_clr)
+  {
+//--- to prepare gradient fill, we will use Bresenham's circle algorithm
+//--- X coordinate - size of the fill,
+//--- Y coordinate - color brightness
+   if(m_gradient)
+     {
+      //--- adjust gradient radius if necessary
+      int r=size;
+      //--- check
+      if(r<1)
+         return;
+      if(r!=ArrayResize(m_fill_brush,r))
+         return;
+      //--- initialize brush
+      ArrayInitialize(m_fill_brush,m_color_background);
+      //--- variables
+      int  f   =1-r;
+      int  dd_x=1;
+      int  dd_y=-2*r;
+      int  dx  =0;
+      int  dy  =r;
+      int  i1,i2;
+      uint clr,dclr;
+      //---
+      i1=i2=r>>1;
+      if((r&1)==0)
+         i1--;
+      //--- calculate
+      while(dy>=dx)
+        {
+         clr=fill_clr;
+         dclr=GETRGB(XRGB((r-dy)*GETRGBR(clr)/r,(r-dy)*GETRGBG(clr)/r,(r-dy)*GETRGBB(clr)/r));
+         clr-=dclr;
+         m_fill_brush[i1]=clr;
+         m_fill_brush[i2]=clr;
+         //---
+         if(f>=0)
+           {
+            dy--;
+            dd_y+=2;
+            f+=dd_y;
+           }
+         dx++;
+         if(--i1<0)
+            break;
+         i2++;
+         dd_x+=2;
+         f+=dd_x;
+        }
+     }
+   else
+      ArrayFree(m_fill_brush);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Canvas/Charts/LineChart.mqh b/Include/Canvas/Charts/LineChart.mqh
new file mode 100644
index 0000000..c81e9e3
--- /dev/null
+++ b/Include/Canvas/Charts/LineChart.mqh
@@ -0,0 +1,383 @@
+//+------------------------------------------------------------------+
+//|                                                    LineChart.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "ChartCanvas.mqh"
+#include <Arrays\ArrayObj.mqh>
+//+------------------------------------------------------------------+
+//| Class CLineChart                                                 |
+//| Usage: generates line chart                                      |
+//+------------------------------------------------------------------+
+class CLineChart : public CChartCanvas
+  {
+private:
+   //--- data
+   CArrayObj        *m_values;
+   //--- adjusted parameters
+   bool              m_filled;
+
+public:
+                     CLineChart(void);
+                    ~CLineChart(void);
+   //--- create
+   virtual bool      Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_ARGB_NORMALIZE);
+   //--- adjusted parameters
+   void              Filled(const bool flag=true) { m_filled=flag; }
+   //--- set up
+   bool              SeriesAdd(const double &value[],const string descr="",const uint clr=0);
+   bool              SeriesInsert(const uint pos,const double &value[],const string descr="",const uint clr=0);
+   bool              SeriesUpdate(const uint pos,const double &value[],const string descr=NULL,const uint clr=0);
+   bool              SeriesDelete(const uint pos);
+   bool              ValueUpdate(const uint series,const uint pos,double value);
+
+protected:
+   virtual void      DrawChart(void);
+   virtual void      DrawData(const uint index=0);
+
+private:
+   double            CalcArea(const uint index);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CLineChart::CLineChart(void) : m_filled(false)
+  {
+   ShowFlags(FLAG_SHOW_LEGEND|FLAGS_SHOW_SCALES|FLAG_SHOW_GRID);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CLineChart::~CLineChart(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create dynamic resource                                          |
+//+------------------------------------------------------------------+
+bool CLineChart::Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+//--- create object to store data
+   if((m_values=new CArrayObj)==NULL)
+      return(false);
+//--- pass responsibility for its destruction to the parent class
+   m_data=m_values;
+//--- call method of parent class
+   if(!CChartCanvas::Create(name,width,height,clrfmt))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adds data series                                                 |
+//+------------------------------------------------------------------+
+bool CLineChart::SeriesAdd(const double &value[],const string descr,const uint clr)
+  {
+//--- check
+   if(m_data_total==m_max_data)
+      return(false);
+//--- add
+   CArrayDouble *arr=new CArrayDouble;
+   if(!m_values.Add(arr))
+      return(false);
+   if(!arr.AssignArray(value))
+      return(false);
+   if(!m_colors.Add((clr==0) ? GetDefaultColor(m_data_total) : clr))
+      return(false);
+   if(!m_descriptors.Add(descr))
+      return(false);
+   m_data_total++;
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserts data series                                              |
+//+------------------------------------------------------------------+
+bool CLineChart::SeriesInsert(const uint pos,const double &value[],const string descr,const uint clr)
+  {
+//--- check
+   if(m_data_total==m_max_data)
+      return(false);
+   if(pos>=m_data_total)
+      return(false);
+//--- insert
+   CArrayDouble *arr=new CArrayDouble;
+   if(!m_values.Insert(arr,pos))
+      return(false);
+   if(!arr.AssignArray(value))
+      return(false);
+   if(!m_colors.Insert((clr==0) ? GetDefaultColor(m_data_total) : clr,pos))
+      return(false);
+   if(!m_descriptors.Insert(descr,pos))
+      return(false);
+   m_data_total++;
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Updates data series                                              |
+//+------------------------------------------------------------------+
+bool CLineChart::SeriesUpdate(const uint pos,const double &value[],const string descr,const uint clr)
+  {
+//--- check
+   if(pos>=m_data_total)
+      return(false);
+   CArrayDouble *data=m_values.At(pos);
+   if(data==NULL)
+      return(false);
+//--- update
+   if(!data.AssignArray(value))
+      return(false);
+   if(clr!=0 && !m_colors.Update(pos,clr))
+      return(false);
+   if(descr!=NULL && !m_descriptors.Update(pos,descr))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deletes data series                                              |
+//+------------------------------------------------------------------+
+bool CLineChart::SeriesDelete(const uint pos)
+  {
+//--- check
+   if(pos>=m_data_total && m_data_total!=0)
+      return(false);
+//--- delete
+   if(!m_values.Delete(pos))
+      return(false);
+   m_data_total--;
+   if(!m_colors.Delete(pos))
+      return(false);
+   if(!m_descriptors.Delete(pos))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Updates element in data series                                   |
+//+------------------------------------------------------------------+
+bool CLineChart::ValueUpdate(const uint series,const uint pos,double value)
+  {
+   CArrayDouble *data=m_values.At(series);
+//--- check
+   if(data==NULL)
+      return(false);
+//--- update
+   if(!data.Update(pos,value))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Redraws data                                                     |
+//+------------------------------------------------------------------+
+void CLineChart::DrawChart(void)
+  {
+   if(m_filled)
+     {
+      //--- calculate areas of filling
+      double s[];
+      ArrayResize(s,m_data_total);
+      ArrayInitialize(s,0);
+      for(uint i=0;i<m_data_total;i++)
+        {
+         CArrayDouble *data=m_values.At(i);
+         if(data==NULL)
+            continue;
+         int total=data.Total();
+         if(total<=1)
+            continue;
+         s[i]=CalcArea(i);
+        }
+      int index=ArrayMaximum(s);
+      while(index!=-1 && s[index]!=0.0)
+        {
+         //--- draw in area descending order
+         DrawData(index);
+         s[index]=0.0;
+         index=ArrayMaximum(s);
+        }
+     }
+   else
+      for(uint i=0;i<m_data_total;i++)
+         DrawData(i);
+  }
+//+------------------------------------------------------------------+
+//| Draws lines                                                      |
+//+------------------------------------------------------------------+
+void CLineChart::DrawData(const uint index)
+  {
+   double value=0.0;
+//--- check
+   CArrayDouble *data=m_values.At(index);
+   if(data==NULL)
+      return;
+   int total=data.Total();
+   if(total<=1)
+      return;
+//--- calculate
+   int dx=m_data_area.Width()/(total-1);
+   int x=m_data_area.left+1;
+   int y1=0;
+   int y2=(int)(m_y_0-data[0]*m_scale_y);
+//--- draw
+   for(int i=1;i<total;i++,x+=dx)
+     {
+      y1=y2;
+      double val=data[i];
+      if(val==EMPTY_VALUE)
+         continue;
+      if(m_accumulative)
+         value+=val;
+      else
+         value=val;
+      y2=(int)(m_y_0-value*m_scale_y);
+      if(m_filled)
+        {
+         if((y1>m_y_0 && y2<m_y_0) || (y1<m_y_0 && y2>m_y_0))
+           {
+            //--- draw two triangles
+            int x3;
+            if(y1>y2)
+              {
+               x3=x+dx*(y1-m_y_0)/(y1-y2);
+               FillTriangle(x,y1,x3,m_y_0,x,m_y_0,(uint)m_colors[index]);
+               FillTriangle(x+dx,y2,x3,m_y_0,x+dx,m_y_0,(uint)m_colors[index]);
+              }
+            else
+              {
+               x3=x+dx*(m_y_0-y1)/(y2-y1);
+               FillTriangle(x,y1,x3,m_y_0,x,m_y_0,(uint)m_colors[index]);
+               FillTriangle(x+dx,y2,x3,m_y_0,x+dx,m_y_0,(uint)m_colors[index]);
+              }
+            continue;
+           }
+         if(y1<m_y_0 || y2<m_y_0)
+           {
+            if(y1>y2)
+               FillTriangle(x,y1,x+dx,y2,x+dx,y1,(uint)m_colors[index]);
+            if(y1<y2)
+              {
+               FillTriangle(x,y1,x+dx,y2,x,y2,(uint)m_colors[index]);
+               y1=y2;
+              }
+           }
+         if(y1>m_y_0 || y2>m_y_0)
+           {
+            if(y1<y2)
+               FillTriangle(x,y1,x+dx,y2,x+dx,y1,(uint)m_colors[index]);
+            if(y1>y2)
+              {
+               FillTriangle(x,y1,x+dx,y2,x,y2,(uint)m_colors[index]);
+               y1=y2;
+              }
+           }
+         FillRectangle(x,m_y_0,x+dx,y1,(uint)m_colors[index]);
+        }
+      else
+         LineAA(x,y1,x+dx,y2,(uint)m_colors[index],STYLE_SOLID);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Area of filling                                                  |
+//+------------------------------------------------------------------+
+double CLineChart::CalcArea(const uint index)
+  {
+   double area =0;
+   double value=0;
+   int    dx   =100;
+//---
+   CArrayDouble *data=m_values.At(index);
+   if(data==NULL)
+      return(0);
+   int total=data.Total();
+   if(total<=1)
+      return(0);
+   int y1=0;
+   int y2=(int)(m_y_0-data[0]*m_scale_y);
+   for(int i=0;i<total;i++)
+     {
+      y1=y2;
+      double val=data[i];
+      if(val==EMPTY_VALUE)
+         continue;
+      if(m_accumulative)
+         value+=val;
+      else
+         value=val;
+      y2=(int)(m_y_0-value*m_scale_y);
+      if((y1>m_y_0 && y2<m_y_0) || (y1<m_y_0 && y2>m_y_0))
+        {
+         //--- line of values crosses the Y axis
+         int x;
+         if(y1>y2)
+           {
+            //--- from the bottom up
+            x=dx*(y1-m_y_0)/(y1-y2);
+            //--- add area of lower triangle
+            area+=x*(y1-m_y_0)/2;
+            //--- add area of upper triangle
+            area+=(dx-x)*(m_y_0-y2)/2;
+           }
+         else
+           {
+            //--- from top down
+            x=dx*(m_y_0-y1)/(y2-y1);
+            //--- add area of upper triangle
+            area+=x*(m_y_0-y1)/2;
+            //--- add area of lower triangle
+            area+=(dx-x)*(y2-m_y_0)/2;
+           }
+         continue;
+        }
+      if(y1<m_y_0 || y2<m_y_0)
+        {
+         //--- both values are greater than zero
+         if(y1>y2)
+           {
+            //--- add area of triangle
+            area+=dx*(y1-y2)/2;
+            //--- add area of rectangle
+            area+=dx*(m_y_0-y2);
+           }
+         if(y1<y2)
+           {
+            //--- add area of triangle
+            area+=dx*(y2-y1)/2;
+            //--- add area of rectangle
+            area+=dx*(m_y_0-y1);
+           }
+        }
+      if(y1>m_y_0 || y2>m_y_0)
+        {
+         //--- both values are less than zero
+         if(y1<y2)
+           {
+            //--- add area of triangle
+            area+=dx*(y2-y1)/2;
+            //--- add area of rectangle
+            area+=dx*(y1-m_y_0);
+           }
+         if(y1>y2)
+           {
+            //--- add area of triangle
+            area+=dx*(y1-y2)/2;
+            //--- add area of rectangle
+            area+=dx*(y2-m_y_0);
+           }
+        }
+     }
+//---
+   return(area);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Canvas/Charts/PieChart.mqh b/Include/Canvas/Charts/PieChart.mqh
new file mode 100644
index 0000000..79be4d1
--- /dev/null
+++ b/Include/Canvas/Charts/PieChart.mqh
@@ -0,0 +1,414 @@
+//+------------------------------------------------------------------+
+//|                                                     PieChart.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "ChartCanvas.mqh"
+//+------------------------------------------------------------------+
+//| Class CPieChart                                                  |
+//| Usage: generates pie chart                                       |
+//+------------------------------------------------------------------+
+class CPieChart : public CChartCanvas
+  {
+private:
+   //--- data
+   CArrayDouble     *m_values;
+   //--- for draw
+   int               m_x0;
+   int               m_y0;
+   int               m_r;
+
+public:
+                     CPieChart(void);
+                    ~CPieChart(void);
+   //--- create
+   virtual bool      Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt=COLOR_FORMAT_XRGB_NOALPHA);
+   //--- data
+   bool              SeriesSet(const double &value[],const string &text[],const uint &clr[]);
+   bool              ValueAdd(const double value,const string descr="",const uint clr=0);
+   bool              ValueInsert(const uint pos,const double value,const string descr="",const uint clr=0);
+   bool              ValueUpdate(const uint pos,const double value,const string descr=NULL,const uint clr=0);
+   bool              ValueDelete(const uint pos);
+
+protected:
+   virtual void      DrawChart(void);
+   void              DrawPie(double fi3,double fi4,int idx,CPoint &p[],const uint clr);
+   string            LabelMake(const string text,const double value,const bool to_left);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CPieChart::CPieChart(void)
+  {
+   uint flags=FLAG_SHOW_LEGEND|FLAG_SHOW_DESCRIPTORS|FLAG_SHOW_VALUE|FLAG_SHOW_PERCENT;
+   AllowedShowFlags(flags);
+   ShowFlags(flags);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CPieChart::~CPieChart(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create dynamic resource                                          |
+//+------------------------------------------------------------------+
+bool CPieChart::Create(const string name,const int width,const int height,ENUM_COLOR_FORMAT clrfmt)
+  {
+//--- create object to store data
+   if((m_values=new CArrayDouble)==NULL)
+      return(false);
+//--- pass responsibility for its destruction to the parent class
+   m_data=m_values;
+//--- call method of parent class
+   if(!CChartCanvas::Create(name,width,height,clrfmt))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Sets displayed parameters                                        |
+//+------------------------------------------------------------------+
+bool CPieChart::SeriesSet(const double &value[],const string &text[],const uint &clr[])
+  {
+//--- !!! user is responsible for correct filling of arrays !!!
+//--- check
+   if(m_values==NULL)
+      return(false);
+//--- set
+   if(!m_values.AssignArray(value))
+      return(false);
+   if(!m_descriptors.AssignArray(text))
+      return(false);
+   if(!m_colors.AssignArray(clr))
+      return(false);
+   m_data_total=m_values.Total();
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Adds displayed parameter (to the end)                            |
+//+------------------------------------------------------------------+
+bool CPieChart::ValueAdd(const double value,const string descr,const uint clr)
+  {
+//--- check
+   if((value<=0))
+      return(false);
+//--- add
+   if(!m_values.Add(value))
+      return(false);
+   if(!m_descriptors.Add(descr))
+      return(false);
+   if(!m_colors.Add((clr==0) ? GetDefaultColor(m_data_total) : clr))
+      return(false);
+   m_data_total++;
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Inserts displayed parameter (to specified position)              |
+//+------------------------------------------------------------------+
+bool CPieChart::ValueInsert(const uint pos,const double value,const string descr,const uint clr)
+  {
+//--- check
+   if((value<=0))
+      return(false);
+//--- insert
+   if(!m_values.Insert(value,pos))
+      return(false);
+   if(!m_descriptors.Insert(descr,pos))
+      return(false);
+   if(!m_colors.Insert((clr==0) ? GetDefaultColor(m_data_total) : clr,pos))
+      return(false);
+   m_data_total++;
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Updates displayed parameter (in specified position)              |
+//+------------------------------------------------------------------+
+bool CPieChart::ValueUpdate(const uint pos,const double value,const string descr,const uint clr)
+  {
+//--- check
+   if((value<=0))
+      return(false);
+//--- update
+   if(!m_values.Update(pos,value))
+      return(false);
+   if(descr!=NULL && !m_descriptors.Update(pos,descr))
+      return(false);
+   if(clr!=0 && !m_colors.Update(pos,clr))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Deletes displayed parameter (from specified position)            |
+//+------------------------------------------------------------------+
+bool CPieChart::ValueDelete(const uint pos)
+  {
+//--- delete
+   if(!m_values.Delete(pos))
+      return(false);
+   m_data_total--;
+   if(!m_descriptors.Delete(pos))
+      return(false);
+   if(!m_colors.Delete(pos))
+      return(false);
+//--- redraw
+   Redraw();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Draws                                                            |
+//+------------------------------------------------------------------+
+void CPieChart::DrawChart(void)
+  {
+//--- check
+   if(m_data_total==0)
+      return;
+//--- variables
+   string text="";
+   double angle=M_PI*(m_data_offset%360)/180;
+   int    width,height;
+   int    dw=0;
+   int    dh=0;
+   int    index;
+   CPoint p0[];
+   CPoint p1[];
+//--- calculate geometry
+   width =(m_data_area.Width()<<3)/10;
+   height=(m_data_area.Height()<<3)/10;
+   if(IS_SHOW_LEGEND || !IS_SHOW_DESCRIPTORS)
+     {
+      if(IS_SHOW_VALUE)
+         dw=(int)m_max_value_width;
+      else
+        {
+         if(IS_SHOW_PERCENT)
+            dw=TextWidth("100.00%");
+        }
+     }
+   else
+     {
+      if(IS_SHOW_DESCRIPTORS)
+        {
+         if(IS_SHOW_VALUE)
+            dw=(int)m_max_value_width+TextWidth(" ()");
+         else
+           {
+            if(IS_SHOW_PERCENT)
+               dw=TextWidth(" (100.00%)");
+           }
+         dw+=(int)m_max_descr_width;
+        }
+     }
+//--- pie chart will always be round
+   width -=2*dw+10;
+   height-=20;
+   m_x0=m_data_area.left+(m_data_area.Width()>>1);
+   m_y0=m_data_area.top+(m_data_area.Height()>>1);
+   m_r =(((width>height) ? height : width)>>1);
+//--- draw pie chart
+   if(ArrayResize(p0,m_data_total+1)==-1)
+      return;
+   if(m_data_total==1)
+     {
+      FillCircle(m_x0,m_y0,m_r,m_colors[0]);
+      Circle(m_x0,m_y0,m_r,m_color_border);
+     }
+   else
+     {
+      Circle(m_x0,m_y0,m_r,m_color_border);
+      for(uint i=0;i<m_index_size;i++)
+        {
+         index=m_index[i];
+         double val=m_values[index];
+         double d_a=2*M_PI*val/m_sum;
+         DrawPie(angle,angle+d_a,i,p0,m_colors[index]);
+         angle+=d_a;
+         angle=MathMod(angle,2*M_PI);
+        }
+      if(m_data_total!=m_index_size)
+         DrawPie(angle,angle+2*M_PI*m_others/m_sum,m_index_size,p0,COLOR2RGB(clrBlack));
+      for(uint i=0;i<=m_index_size;i++)
+         Line(m_x0,m_y0,p0[i].x,p0[i].y,m_color_border);
+      Circle(m_x0,m_y0,m_r,m_color_border);
+     }
+//--- draw descriptors
+   angle=M_PI*(m_data_offset%360)/180;
+   int r1=(int)round(1.1*m_r);
+   if(ArrayResize(p1,m_data_total)==-1)
+      return;
+   //--- calculations
+   for(uint i=0;i<m_index_size;i++)
+     {
+      index=m_index[i];
+      angle+=M_PI*m_values[index]/m_sum;
+      //--- lines
+      p0[i].x=m_x0+(int)round(m_r*cos(angle));
+      p0[i].y=m_y0-(int)round(m_r*sin(angle));
+      p1[i].x=m_x0+(int)round(r1*cos(angle));
+      p1[i].y=m_y0-(int)round(r1*sin(angle));
+      angle+=M_PI*m_values[index]/m_sum;
+     }
+   if(m_data_total!=m_index_size)
+     {
+      index=(int)m_data_total-1;
+      angle+=M_PI*m_others/m_sum;
+      p0[index].x=m_x0+(int)round(m_r*cos(angle));
+      p0[index].y=m_y0-(int)round(m_r*sin(angle));
+      p1[index].x=m_x0+(int)round(r1*cos(angle));
+      p1[index].y=m_y0-(int)round(r1*sin(angle));
+     }
+   int x,y;
+   //--- draw descriptors to the left
+   for(uint i=0;i<m_index_size;i++)
+      if(p0[i].x<m_x0)
+        {
+         x=p1[i].x-10;
+         y=p1[i].y;
+         index=m_index[i];
+         text=LabelMake(m_descriptors[index],m_values[index],true);
+         if(text!="")
+           {
+            Line(p0[i].x,p0[i].y,p1[i].x,p1[i].y,m_color_border);
+            Line(p1[i].x,p1[i].y,x,y,m_color_border);
+            TextOut(x-5,y,text,m_color_text,TA_RIGHT|TA_VCENTER);
+           }
+        }
+   //--- draw descriptors to the right
+   for(uint i=0;i<m_index_size;i++)
+      if(p0[i].x>=m_x0)
+        {
+         x=p1[i].x+10;
+         y=p1[i].y;
+         index=m_index[i];
+         text=LabelMake(m_descriptors[index],m_values[index],false);
+         if(text!="")
+           {
+            Line(p0[i].x,p0[i].y,p1[i].x,p1[i].y,m_color_border);
+            Line(p1[i].x,p1[i].y,x,y,m_color_border);
+            TextOut(x+5,y,text,m_color_text,TA_LEFT|TA_VCENTER);
+           }
+        }
+   if(m_data_total!=m_index_size)
+     {
+      index=(int)m_data_total-1;
+      if(p0[index].x>=m_x0)
+        {
+         x=p1[index].x+10;
+         y=p1[index].y;
+         text=LabelMake("Others",m_others,true);
+         TextOut(x+5,y,text,m_color_text,TA_LEFT|TA_VCENTER);
+        }
+      else
+        {
+         x=p1[index].x-10;
+         y=p1[index].y;
+         text=LabelMake("Others",m_others,false);
+         TextOut(x-5,y,text,m_color_text,TA_RIGHT|TA_VCENTER);
+        }
+      if(text!="")
+        {
+         Line(p0[index].x,p0[index].y,p1[index].x,p1[index].y,m_color_border);
+         Line(p1[index].x,p1[index].y,x,y,m_color_border);
+        }
+     }
+   ArrayFree(p1);
+   ArrayFree(p0);
+  }
+//+------------------------------------------------------------------+
+//| Draw pie                                                         |
+//+------------------------------------------------------------------+
+void CPieChart::DrawPie(double fi3,double fi4,int idx,CPoint &p[],const uint clr)
+  {
+//--- draw arc
+   Arc(m_x0,m_y0,m_r,m_r,fi3,fi4,p[idx].x,p[idx].y,p[idx+1].x,p[idx+1].y,clr);
+//--- variables
+   int x3=p[idx].x;
+   int y3=p[idx].y;
+   int x4=p[idx+1].x;
+   int y4=p[idx+1].y;
+//--- draw radii
+   if(idx==0)
+      Line(m_x0,m_y0,x3,y3,clr);
+   if(idx!=m_data_total-1)
+      Line(m_x0,m_y0,x4,y4,clr);
+//--- fill
+   double fi=(fi3+fi4)/2;
+   int xf=m_x0+(int)(0.99*m_r*cos(fi));
+   int yf=m_y0-(int)(0.99*m_r*sin(fi));
+   Fill(xf,yf,clr);
+//--- for small pie
+   if(fi4-fi3<=M_PI_4)
+      Line(m_x0,m_y0,xf,yf,clr);
+  }
+//+------------------------------------------------------------------+
+//| Make label for pie                                               |
+//+------------------------------------------------------------------+
+string CPieChart::LabelMake(const string text,const double value,const bool to_left)
+  {
+   string label="";
+//---
+   if(to_left)
+     {
+      if(IS_SHOW_LEGEND || !IS_SHOW_DESCRIPTORS)
+        {
+         if(IS_SHOW_VALUE)
+            label=DoubleToString(value,2);
+         else
+           {
+            if(IS_SHOW_PERCENT)
+               label=DoubleToString(100*value/m_sum,2)+"%";
+           }
+        }
+      else
+        {
+         label=text;
+         if(IS_SHOW_VALUE)
+            label+=" ("+DoubleToString(value,2)+")";
+         else
+           {
+            if(IS_SHOW_PERCENT)
+               label+=" ("+DoubleToString(100*value/m_sum,2)+"%)";
+           }
+        }
+     }
+   else
+     {
+      if(IS_SHOW_LEGEND || !IS_SHOW_DESCRIPTORS)
+        {
+         if(IS_SHOW_VALUE)
+            label=DoubleToString(value,2);
+         else
+           {
+            if(IS_SHOW_PERCENT)
+               label=DoubleToString(100*value/m_sum,2)+"%";
+           }
+        }
+      else
+        {
+         if(IS_SHOW_VALUE)
+            label="("+DoubleToString(value,2)+") ";
+         else
+           {
+            if(IS_SHOW_PERCENT)
+               label="("+DoubleToString(100*value/m_sum,2)+"%) ";
+           }
+         label+=text;
+        }
+     }
+//---
+   return(label);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Canvas/FlameCanvas.mqh b/Include/Canvas/FlameCanvas.mqh
new file mode 100644
index 0000000..3705caa
--- /dev/null
+++ b/Include/Canvas/FlameCanvas.mqh
@@ -0,0 +1,751 @@
+//+------------------------------------------------------------------+
+//|                                                  FlameCanvas.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Canvas.mqh"
+#include <Controls\Defines.mqh>
+//+------------------------------------------------------------------+
+//| Gradient descriptors                                             |
+//+------------------------------------------------------------------+
+struct GRADIENT_COLOR
+  {
+   uint              clr;      // color in ARGB format
+   uint              pos;      // position of color in percentage of gradient range
+  };
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+struct GRADIENT_SIZE
+  {
+   uint              size;     // width of gradient fill in percentage of base fill
+   uint              pos;      // position of color in percentage of gradient length
+  };
+//+------------------------------------------------------------------+
+//| Class CFlameCanvas                                               |
+//| Usage: generates flame                                           |
+//+------------------------------------------------------------------+
+class CFlameCanvas : public CCanvas
+  {
+private:
+   //--- parameters
+   uint              m_bar_gap;
+   uint              m_bar_width;
+   uint              m_chart_scale;
+   double            m_chart_price_min;
+   double            m_chart_price_max;
+   ENUM_TIMEFRAMES   m_timeframe;
+   string            m_symbol;
+   int               m_future_bars;
+   int               m_back_bars;
+   int               m_rates_total;
+   uint              m_palette[256];            // flame palette
+   uchar             m_flame[];                 // buffer for calculation of flame
+   uint              m_time_redraw;
+   uint              m_delay;
+   //   bool              m_resize_flag;
+   //   int               m_tick_cnt;
+   //--- flame parameters
+   datetime          m_tb1;
+   double            m_pb1;
+   datetime          m_te1;
+   double            m_pe1;
+   datetime          m_tb2;
+   double            m_pb2;
+   datetime          m_te2;
+   double            m_pe2;
+   //--- equation parameters for flame
+   int               m_cloud_axis[100];
+   double            m_a1;
+   double            m_b1;
+   double            m_a2;
+   double            m_b2;
+   int               m_xb1;
+   int               m_yb1;
+   int               m_xe1;
+   int               m_ye1;
+   int               m_xb2;
+   int               m_yb2;
+   int               m_xe2;
+   int               m_ye2;
+
+public:
+                     CFlameCanvas(void);
+                    ~CFlameCanvas(void);
+   //--- create
+   bool              FlameCreate(const string name,const datetime time,const int future_bars,const int back_bars=0);
+   void              RatesTotal(const int value);
+   //--- setting
+   void              PaletteSet(uint clr=0xFF0000);
+   //--- draw
+   void              FlameDraw(const double &prices[],const int width,const int lenght);
+   void              FlameSet(datetime xb1,double yb1,datetime xe1,double ye1,datetime xb2,double yb2,datetime xe2,double ye2);
+   //--- event handler
+   void              ChartEventHandler(const int id,const long &lparam,const double &dparam,const string &sparam);
+
+protected:
+   bool              Resize(void);
+   void              ChartScale(void);
+   void              FlameSet(void);
+   void              CloudDraw(const double &prices[],const int width,const int lenght,GRADIENT_SIZE &size[],GRADIENT_COLOR &gradient[],const uchar t_level=255,const bool custom_gradient=true);
+   void              FlameDraw(const int width,const int lenght,GRADIENT_SIZE &size[],GRADIENT_COLOR &gradient[]);
+   void              GradientVertical(const int xb,const int xe,const int yb1,const int ye1,const int yb2,const int ye2,const GRADIENT_COLOR &gradient[]);
+   void              GradientVerticalLine(int x,int y1,int y2,const GRADIENT_COLOR &gradient[]);
+   void              GradientVerticalLineMonochrome(int x,int y1,int y2,uint clr1,uint clr2);
+   void              FlameCreate(void);
+   void              FlameCalculate(void);
+   void              Delay(const uint value);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CFlameCanvas::CFlameCanvas(void) : m_bar_gap(16),
+                                   m_bar_width(8),
+                                   m_chart_scale(1),
+                                   m_chart_price_min(0.0),
+                                   m_chart_price_max(0.0),
+                                   m_timeframe(PERIOD_CURRENT),
+                                   m_symbol(NULL),
+                                   m_future_bars(0),
+                                   m_back_bars(0),
+                                   m_rates_total(0),
+                                   m_time_redraw(0),
+                                   m_delay(50),
+                                   m_tb1(0),
+                                   m_pb1(0),
+                                   m_te1(0),
+                                   m_pe1(0),
+                                   m_tb2(0),
+                                   m_pb2(0),
+                                   m_te2(0),
+                                   m_pe2(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CFlameCanvas::~CFlameCanvas(void)
+  {
+   Destroy();
+  }
+//+------------------------------------------------------------------+
+//| Creates dynamic resource with object                             |
+//+------------------------------------------------------------------+
+bool CFlameCanvas::FlameCreate(const string name,const datetime time,const int future_bars,const int back_bars)
+  {
+//--- get chart parameters
+   ChartScale();
+//--- create
+   int width =(int)m_bar_gap*(future_bars+back_bars);
+   int height=(int)ChartGetInteger(0,CHART_HEIGHT_IN_PIXELS);
+   if(!CreateBitmap(0,0,name,time-back_bars*PeriodSeconds(),m_chart_price_max,width,height,COLOR_FORMAT_ARGB_NORMALIZE))
+      return(false);
+   ArrayResize(m_flame,width*height);
+//--- save parameters
+   m_future_bars=future_bars;
+   m_back_bars  =back_bars;
+//--- settings
+   PaletteSet();
+   m_timeframe  =Period();
+   m_symbol     =Symbol();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Resize                                                           |
+//+------------------------------------------------------------------+
+bool CFlameCanvas::Resize(void)
+  {
+   int x,y;
+//--- get limits
+   double min=ChartGetDouble(0,CHART_PRICE_MIN);
+   double max=ChartGetDouble(0,CHART_PRICE_MAX);
+   if(m_chart_price_max!=max)
+     {
+      //--- move object
+      ObjectSetDouble(0,m_objname,OBJPROP_PRICE,0,max);
+     }
+//--- check
+   if(m_chart_price_min==min && m_chart_price_max==max)
+      return(false);
+   m_chart_price_min=min;
+   m_chart_price_max=max;
+//--- grt size
+   ChartTimePriceToXY(0,0,m_tb1,min,x,y);
+   int width =(int)ChartGetInteger(0,CHART_WIDTH_IN_PIXELS)-x;
+   int height=(int)ChartGetInteger(0,CHART_HEIGHT_IN_PIXELS);
+//--- resize
+   if(width<m_width)
+      width=m_width;
+   if(width<=0)
+      return(false);
+   Resize(width,height);
+//--- resize flame buffer
+   ArrayResize(m_flame,width*height);
+   ArrayInitialize(m_flame,0);
+   ArrayInitialize(m_pixels,0);
+//--- restore parameters
+   if(m_pb1!=0.0)
+      FlameSet(m_tb1,m_pb1,m_te1,m_pe1,m_tb2,m_pb2,m_te2,m_pe2);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+void CFlameCanvas::RatesTotal(const int value)
+  {
+   if(value==0)
+      return;
+   if(m_rates_total==0)
+      m_rates_total=value;
+   else
+     {
+      if(m_rates_total!=value)
+        {
+         //--- move object
+         ObjectSetInteger(0,m_objname,OBJPROP_TIME,0,
+                          ObjectGetInteger(0,m_objname,OBJPROP_TIME)+(value-m_rates_total)*PeriodSeconds());
+         m_rates_total=value;
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Adjusts to the chart scale                                       |
+//+------------------------------------------------------------------+
+void CFlameCanvas::ChartScale(void)
+  {
+   m_chart_scale=(uint)ChartGetInteger(0,CHART_SCALE);
+//--- set params
+   switch(m_chart_scale)
+     {
+      case 0:
+         m_bar_gap  =1;
+         m_bar_width=1;
+         break;
+      case 1:
+         m_bar_gap  =2;
+         m_bar_width=1;
+         break;
+      case 2:
+         m_bar_gap  =4;
+         m_bar_width=2;
+         break;
+      case 3:
+         m_bar_gap  =8;
+         m_bar_width=4;
+         break;
+      case 4:
+         m_bar_gap  =16;
+         m_bar_width=10;
+         break;
+      case 5:
+         m_bar_gap  =32;
+         m_bar_width=22;
+         break;
+      default:
+         return;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets palette                                                     |
+//+------------------------------------------------------------------+
+void CFlameCanvas::PaletteSet(uint clr)
+  {
+//--- create palette
+   double g=0,b=0,dg=1.45,db=0.63;
+//---
+   for(uint a,i=0;i<256;i++)
+     {
+      //--- the first 32 values ??of flame are completely transparent
+      a=uchar(i<32?0:i-32);
+      //--- generate color for the i value of flame
+      m_palette[i]=(a<<24)|(uint(255)<<16)|(uint(g+0.5)<<8)|uint(b+0.5);
+      //--- increment the color components
+      //--- the red color gets gradient due to transparency
+      if(i>80)  g+=dg;
+      if(i>160) b+=db;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draws the flame                                                  |
+//+------------------------------------------------------------------+
+void CFlameCanvas::FlameDraw(const double &prices[],const int width,const int lenght)
+  {
+   static GRADIENT_SIZE  sword[]={{100,0},{150,70},{0,100}};
+   static GRADIENT_COLOR flame[]={{0x00,0},{0x7F7F7F,12},{0xCCCCCC,30},{0xFFFFFF,45},{0xFFFFFF,55},{0xCCCCCC,70},{0x7F7F7F,88},{0x00,100}};
+//--- draw
+   CloudDraw(prices,width,lenght,sword,flame);
+//--- copy flame buffer
+   FlameCalculate();
+//--- start timer
+   EventChartCustom(CONTROLS_SELF_MESSAGE,1302,0,0,NULL);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+void CFlameCanvas::FlameDraw(const int width,const int lenght,GRADIENT_SIZE &size[],GRADIENT_COLOR &gradient[])
+  {
+//--- check
+   int total=ArraySize(m_cloud_axis);
+   if(total<2)
+      return;
+   if(total>lenght)
+      total=lenght;
+//--- draw
+   int xb,xe;     // coordinates of the segment
+   int ybm,yem;   // coordinates of the center line
+   int yb1,ye1;   // coordinates of the first line
+   int yb2,ye2;   // coordinates of the second line
+//--- for implementation of variable width
+   int w_total=ArraySize(size);
+   if(w_total<2)
+      return;
+   int    w_i =0;
+   int    w_is=(int)size[w_i].pos*total/100;
+   int    w_ie=(int)size[w_i+1].pos*total/100;
+   double w   =size[w_i].size*width/100;
+   double dw  =(size[w_i+1].size*width/100-w)/(w_ie-w_is);
+//--- draw from left to right
+   xb=0;
+   ybm=m_cloud_axis[0];
+   yb1=ybm-(int)(w/2);
+   yb2=ybm+(int)(w/2);
+//--- draw
+   for(int i=1;i<total;i++)
+     {
+      xe=(int)(i*m_bar_gap);
+      if(m_cloud_axis[i]==DBL_MAX)
+         continue;
+      yem=m_cloud_axis[i];
+      w+=dw;
+      ye1=yem-(int)(w/2);
+      ye2=yem+(int)(w/2);
+      //--- draw the segment of 'cloud'
+      GradientVertical(xb,xe,yb1,ye1,yb2,ye2,gradient);
+      xb=xe;
+      if(xb>=m_width)
+         break;
+      yb1=ye1;
+      yb2=ye2;
+      while(i>=w_ie-1 && i!=total-1)
+        {
+         w_i++;
+         w_is=(int)size[w_i].pos*total/100;
+         w_ie=(int)size[w_i+1].pos*total/100;
+         w   =size[w_i].size*width/100;
+         if(w_ie==w_is)
+           {
+            //--- for "instant" resize
+            dw=size[w_i+1].size*width/100-w;
+            w+=dw;
+            ye1=yem-(int)(w/2);
+            ye2=yem+(int)(w/2);
+            //--- draw the segment of 'cloud'
+            GradientVertical(xb,xe,yb1,ye1,yb2,ye2,gradient);
+            yb1=ye1;
+            yb2=ye2;
+           }
+         else
+           {
+            dw=(size[w_i+1].size*width/100-w)/(w_ie-w_is);
+            break;
+           }
+        }
+     }
+//--- copy flame buffer
+   FlameCalculate();
+  }
+//+------------------------------------------------------------------+
+//| Sets parameters of the flame and starts to draw                  |
+//+------------------------------------------------------------------+
+void CFlameCanvas::FlameSet(void)
+  {
+   m_a1=m_bar_gap*((m_ye1-m_yb1)/((double)m_xe1-m_xb1));
+   m_a2=m_bar_gap*((m_ye2-m_yb2)/((double)m_xe2-m_xb2));
+  }
+//+------------------------------------------------------------------+
+//| Sets parameters of the flame and starts to draw                  |
+//+------------------------------------------------------------------+
+void CFlameCanvas::FlameSet(datetime tb1,double pb1,
+                            datetime te1,double pe1,
+                            datetime tb2,double pb2,
+                            datetime te2,double pe2)
+  {
+   datetime obj_time =(datetime)ObjectGetInteger(0,m_objname,OBJPROP_TIME);
+   double   obj_price=ObjectGetDouble(0,m_objname,OBJPROP_PRICE);
+   int      dx,dy;
+//--- save parameters
+   m_tb1=tb1;
+   m_pb1=pb1;
+   m_te1=te1;
+   m_pe1=pe1;
+   m_tb2=tb2;
+   m_pb2=pb2;
+   m_te2=te2;
+   m_pe2=pe2;
+//--- resize
+   Resize();
+//--- convert
+   if(ChartTimePriceToXY(0,0,obj_time,obj_price,dx,dy))
+     {
+      dy=m_yb1;
+      if(ChartTimePriceToXY(0,0,tb1,pb1,m_xb1,m_yb1))
+         if(ChartTimePriceToXY(0,0,te1,pe1,m_xe1,m_ye1))
+            if(ChartTimePriceToXY(0,0,tb2,pb2,m_xb2,m_yb2))
+               if(ChartTimePriceToXY(0,0,te2,pe2,m_xe2,m_ye2))
+                 {
+                  //--- convert to canvas coordinates
+                  m_xb1-=dx;
+                  m_xe1-=dx;
+                  m_xb2-=dx;
+                  m_xe2-=dx;
+                  //--- 
+                  FlameSet();
+                 }
+     }
+//--- start timer
+   EventChartCustom(CONTROLS_SELF_MESSAGE,1302,0,0,NULL);
+  }
+//+------------------------------------------------------------------+
+//| Generate array that describes the body of flame                  |
+//+------------------------------------------------------------------+
+void CFlameCanvas::FlameCreate(void)
+  {
+   static GRADIENT_SIZE  sword[]={{100,0},{150,70},{0,100}};
+   static GRADIENT_COLOR flame[]={{0x00,0},{0x7F7F7F,12},{0xCCCCCC,30},{0xFFFFFF,45},{0xFFFFFF,55},{0xCCCCCC,70},{0x7F7F7F,88},{0x00,100}};
+//--- 
+   double a=rand();   // parameter of line a*x+b
+   double b=rand();   // parameter of line a*x+b
+   double c=rand();   // parameter of sine c*Sin(d*x)
+   double d=rand();   // parameter of sine c*Sin(d*x)
+   int    w=rand();   // width at the base
+   int    l=rand();   // length
+//--- normalize
+   a=fmod(a,(m_a2-m_a1))+m_a1;
+   b=(m_yb1+m_yb2)/2;
+   c=fmod(c,20);
+   d=fmod(d,3*M_PI)+M_PI;
+//--- shape
+   w%=150;
+   if(w<10)
+      w=10;                                    // but no less than 10
+   sword[1].size=w;
+   w=rand();
+   l%=50;
+   sword[1].pos=l+30;
+   l=rand();
+//--- sizes
+   w=(m_yb2-m_yb1!=0) ? w%(m_yb2-m_yb1) : 10;  // proportional to the starting width
+   if(w<10)
+      w=10;                                    // but no less than 10
+   l=l%((m_xe1-m_xb1)/(int)m_bar_gap-20)+20;   // proportional to length
+//--- create
+   int total=ArraySize(m_cloud_axis);
+   for(int i=0;i<total;i++)
+      m_cloud_axis[i]=int(a*i+b+c*sin(i/d));
+//--- draw
+   FlameDraw(w,l,sword,flame);
+  }
+//+------------------------------------------------------------------+
+//| Calculates and renders frame                                     |
+//+------------------------------------------------------------------+
+void CFlameCanvas::FlameCalculate(void)
+  {
+//--- calculate new frame
+   int c;
+   int idx;
+//--- draw body of flame to the right
+   for(int x=0,x_tot=m_width-1;x<x_tot;x++)
+     {
+      //--- separately for y==0
+      c=m_flame[x]+m_flame[x+m_width];
+      c+=+m_flame[x]+m_flame[x+m_width];
+      m_flame[x]=uchar(c/4);
+      //---
+      for(int y=1,y_tot=m_height-1;y<y_tot;y++)
+        {
+         idx=y*m_width+x;
+         c=m_flame[idx-m_width]+m_flame[idx]+m_flame[idx+m_width];
+         idx++;
+         c+=m_flame[idx-m_width]+m_flame[idx]+m_flame[idx+m_width];
+         m_flame[idx]=uchar(c/6);
+        }
+      //--- separately for y==m_height-1
+      idx=(m_height-1)*m_width+x;
+      c=m_flame[idx-m_width]+m_flame[idx];
+      idx++;
+      c+=m_flame[idx-m_width]+m_flame[idx];
+      m_flame[idx]=uchar(c/4);
+     }
+//--- move flame to the resource buffer
+   for(int y=0;y<m_height;y++)
+     {
+      for(int x=0;x<m_width;x++)
+        {
+         idx=y*m_width+x;
+         m_pixels[idx]=m_palette[m_flame[idx]];
+        }
+     }
+//---
+  }
+//+------------------------------------------------------------------+
+//| Draws "cloud"                                                    |
+//+------------------------------------------------------------------+
+void CFlameCanvas::CloudDraw(const double &prices[],const int width,const int lenght,GRADIENT_SIZE &size[],GRADIENT_COLOR &gradient[],const uchar t_level,const bool custom_gradient)
+  {
+//--- check
+   int total=ArraySize(prices);
+   if(total<2)
+      return;
+   if(total>lenght)
+      total=lenght;
+//--- draw
+   int xb,xe;     // coordinates of the segment
+   int ybm,yem;   // coordinates of the center line
+   int yb1,ye1;   // coordinates of the first line
+   int yb2,ye2;   // coordinates of the second line
+   int xx;
+//--- for implementation of variable width
+   int w_total=ArraySize(size);
+   if(w_total<2)
+      return;
+   int    w_i =0;
+   int    w_is=(int)size[w_i].pos*total/100;
+   int    w_ie=(int)size[w_i+1].pos*total/100;
+   double w   =size[w_i].size*width/100;
+   double dw  =(size[w_i+1].size*width/100-w)/(w_ie-w_is);
+//--- draw from left to right
+   xb=0;
+   ChartTimePriceToXY(0,0,0,prices[0],xx,ybm);
+   yb1=ybm-(int)(w/2);
+   yb2=ybm+(int)(w/2);
+//--- draw
+   for(int i=1;i<total;i++)
+     {
+      xe=(int)(i*m_bar_gap);
+      if(prices[i]==DBL_MAX)
+         continue;
+      ChartTimePriceToXY(0,0,0,prices[i],xx,yem);
+      w+=dw;
+      ye1=yem-(int)(w/2);
+      ye2=yem+(int)(w/2);
+      //--- draw the segment of 'cloud'
+      GradientVertical(xb,xe,yb1,ye1,yb2,ye2,gradient);
+      xb=xe;
+      if(xb>=m_width)
+         break;
+      yb1=ye1;
+      yb2=ye2;
+      while(i>=w_ie-1 && i!=total-1)
+        {
+         w_i++;
+         w_is=(int)size[w_i].pos*total/100;
+         w_ie=(int)size[w_i+1].pos*total/100;
+         w   =size[w_i].size*width/100;
+         if(w_ie==w_is)
+           {
+            //--- for "instant" resize
+            dw=size[w_i+1].size*width/100-w;
+            w+=dw;
+            ye1=yem-(int)(w/2);
+            ye2=yem+(int)(w/2);
+            //--- draw the segment of 'cloud'
+            GradientVertical(xb,xe,yb1,ye1,yb2,ye2,gradient);
+            yb1=ye1;
+            yb2=ye2;
+           }
+         else
+           {
+            dw=(size[w_i+1].size*width/100-w)/(w_ie-w_is);
+            break;
+           }
+        }
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draws area with vertical fill using specified gradient           |
+//+------------------------------------------------------------------+
+void CFlameCanvas::GradientVertical(const int xb,const int xe,const int yb1,const int ye1,const int yb2,const int ye2,const GRADIENT_COLOR &gradient[])
+  {
+//--- it is assumed that the colors array has sufficient size and positions are already sorted in ascending order
+//--- get length by X and Y
+   int x1 =xb;
+   int y1 =yb1;
+   int x2 =xb;
+   int y2 =yb2;
+   int dx =(xe>xb)? xe-xb : xb-xe;
+   int dy1=(ye1>yb1)? ye1-yb1 : yb1-ye1;
+   int dy2=(ye2>yb2)? ye2-yb2 : yb2-ye2;
+//--- get direction by X and Y
+   int sx =(xb<xe)? 1 : -1;
+   int sy1=(yb1<ye1)? 1 : -1;
+   int sy2=(yb2<ye2)? 1 : -1;
+   int er1=dx-dy1;
+   int er2=dx-dy2;
+//--- extreme colors
+   uint clr_first=gradient[0].clr;
+   uint clr_last =gradient[ArraySize(gradient)-1].clr;
+//--- draw the first line
+   while(x1!=xe || y1!=ye1)
+     {
+      //--- calculate coordinates of next pixel of the first line
+      if((er1<<1)>-dy1)
+        {
+         //--- try to change X coordinate of the first line
+         //--- draw the second line
+         while(x2!=xe || y2!=ye2)
+           {
+            //--- calculate coordinates of next pixel of the second line
+            if((er2<<1)>-dy2)
+              {
+               //--- try to change X coordinate of the second line
+               //--- gradient fill
+               GradientVerticalLine(x1,y1,y2,gradient);
+               er2-=dy2;
+               if(x2!=xe)
+                  x2+=sx;
+              }
+            if((er2<<1)<dx)
+              {
+               er2+=dx;
+               if(y2!=ye2)
+                  y2+=sy2;
+              }
+            //--- draw the first line
+            if(x1!=x2)
+               break;
+           }
+         er1-=dy1;
+         if(x1!=xe)
+            x1+=sx;
+        }
+      if((er1<<1)<dx)
+        {
+         er1+=dx;
+         if(y1!=ye1)
+            y1+=sy1;
+        }
+     }
+//--- gradient fill
+   GradientVerticalLine(x1,ye1,ye2,gradient);
+  }
+//+------------------------------------------------------------------+
+//| Draws gradient vertical line                                     |
+//+------------------------------------------------------------------+
+void CFlameCanvas::GradientVerticalLineMonochrome(int x,int y1,int y2,uint clr1,uint clr2)
+  {
+//---
+   double dc;
+   int    dd,dy=y2-y1;
+//--- check
+   if(dy==0)
+      return;
+//--- extract components from the first color
+   uchar clr=(uchar)clr1;
+//--- parameters of pixels iteration
+   if(dy>0)
+     {
+      dd=dy;
+      dy=1;
+     }
+   else
+     {
+      dd=-dy;
+      dy=-1;
+     }
+//--- increments for the color components
+   dc=(double)((uchar)clr2-clr)/dd;
+//--- draw
+   for(int i=0;y1!=y2;i++,y1+=dy)
+     {
+      int idx=y1*m_width+x;
+      //--- check range
+      if(idx<0 || idx>=ArraySize(m_flame))
+         continue;
+      if(x>=0 && x<m_width && y1>=0 && y1<m_height)
+         if(m_flame[idx]<(uchar)(clr+dc*i))
+            m_flame[idx]=(uchar)(clr+dc*i);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Draws vertical line with specified gradient                      |
+//+------------------------------------------------------------------+
+void CFlameCanvas::GradientVerticalLine(int x,int y1,int y2,const GRADIENT_COLOR &gradient[])
+  {
+//--- it is assumed that the colors array has sufficient size and positions are already sorted in ascending order
+   int total=ArraySize(gradient);
+   int dy=y2-y1;
+//--- draw segments
+   for(int i=0;i<total-1;i++)
+      GradientVerticalLineMonochrome(x,y1+dy*gradient[i].pos/100,y1+dy*gradient[i+1].pos/100,gradient[i].clr,gradient[i+1].clr);
+  }
+//+------------------------------------------------------------------+
+//| Event handler                                                    |
+//+------------------------------------------------------------------+
+void CFlameCanvas::ChartEventHandler(const int id,const long &lparam,const double &dparam,const string &sparam)
+  {
+//--- events filter
+   switch(id)
+     {
+      case CHARTEVENT_CHART_CHANGE:
+         //--- handle only chart modification events
+         if(m_chart_scale!=(uint)ChartGetInteger(0,CHART_SCALE))
+           {
+            Delay(20);
+            //--- changed horizontal scale
+            ChartScale();
+            if(m_pb1!=0.0)
+               FlameSet(m_tb1,m_pb1,m_te1,m_pe1,m_tb2,m_pb2,m_te2,m_pe2);
+            return;
+           }
+         if(m_height!=(int)ChartGetInteger(0,CHART_HEIGHT_IN_PIXELS))
+           {
+            //--- changed vertical size
+            Delay(20);
+            if(m_pb1!=0.0)
+               FlameSet(m_tb1,m_pb1,m_te1,m_pe1,m_tb2,m_pb2,m_te2,m_pe2);
+            return;
+           }
+         if(m_chart_price_min!=ChartGetDouble(0,CHART_PRICE_MIN) ||
+            m_chart_price_max!=ChartGetDouble(0,CHART_PRICE_MAX))
+           {
+            //--- changed vertical scale
+            Delay(20);
+            if(m_pb1!=0.0)
+               FlameSet(m_tb1,m_pb1,m_te1,m_pe1,m_tb2,m_pb2,m_te2,m_pe2);
+            return;
+           }
+         break;
+         //--- organize custom timer
+      case CHARTEVENT_CUSTOM+1302:
+         //--- time to draw the new frame?
+         if(GetTickCount()>m_time_redraw)
+           {
+            //--- add the body of flame
+            FlameCreate();
+            //--- draw frame
+            FlameCalculate();
+            Update();
+            //--- calculate time for the next frame
+            m_time_redraw=GetTickCount()+m_delay;
+           }
+         //--- generate next event for custom timer
+         EventChartCustom(CONTROLS_SELF_MESSAGE,1302,0,0,NULL);
+         break;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Delay                                                            |
+//+------------------------------------------------------------------+
+void CFlameCanvas::Delay(const uint value)
+  {
+//--- too small
+   if(value<10)
+      return;
+//--- start delay
+   uint cnt=GetTickCount()+value;
+//--- delay
+   while(cnt>=GetTickCount());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObject.mqh b/Include/ChartObjects/ChartObject.mqh
new file mode 100644
index 0000000..bde74b8
--- /dev/null
+++ b/Include/ChartObjects/ChartObject.mqh
@@ -0,0 +1,1000 @@
+//+------------------------------------------------------------------+
+//|                                                  ChartObject.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Object.mqh>
+//+------------------------------------------------------------------+
+//| Class CChartObject.                                              |
+//| Pupose: Base class of chart objects.                             |
+//|              Derives from class CObject.                         |
+//+------------------------------------------------------------------+
+class CChartObject : public CObject
+  {
+protected:
+   long              m_chart_id;           // identifier of chart the object belongs to
+   int               m_window;             // number of subwindow (0 - main window)
+   string            m_name;               // unique name object name
+   int               m_num_points;         // number of anchor points of object
+
+public:
+                     CChartObject(void);
+                    ~CChartObject(void);
+   //--- methods of access to protected data
+   long              ChartId(void) const { return(m_chart_id); }
+   int               Window(void) const { return(m_window); }
+   string            Name(void) const { return(m_name); }
+   bool              Name(const string name);
+   int               NumPoints(void) const { return(m_num_points); }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(0x8888); }
+   //--- methods of filling the object
+   bool              Attach(long chart_id,const string name,const int window,const int points);
+   bool              SetPoint(const int point,const datetime time,const double price) const;
+   //--- methods of deleting
+   bool              Delete(void);
+   void              Detach(void);
+   //--- methods of access to properties of the object
+   datetime          Time(const int point) const;
+   bool              Time(const int point,const datetime time) const;
+   double            Price(const int point) const;
+   bool              Price(const int point,const double price) const;
+   color             Color(void) const;
+   bool              Color(const color new_color) const;
+   ENUM_LINE_STYLE   Style(void) const;
+   bool              Style(const ENUM_LINE_STYLE new_style) const;
+   int               Width(void) const;
+   bool              Width(const int new_width) const;
+   bool              Background(void) const;
+   bool              Background(const bool new_back) const;
+   bool              Fill(void) const;
+   bool              Fill(const bool new_fill) const;
+   long              Z_Order(void) const;
+   bool              Z_Order(const long value) const;
+   bool              Selected(void) const;
+   bool              Selected(const bool new_sel) const;
+   bool              Selectable(void) const;
+   bool              Selectable(const bool new_sel) const;
+   string            Description(void) const;
+   bool              Description(const string new_text) const;
+   string            Tooltip(void) const;
+   bool              Tooltip(const string new_text) const;
+   int               Timeframes(void) const;
+   virtual bool      Timeframes(const int timeframes) const;
+   datetime          CreateTime(void) const;
+   int               LevelsCount(void) const;
+   bool              LevelsCount(const int new_count) const;
+   //--- methods to access the properties of levels of objects
+   color             LevelColor(const int level) const;
+   bool              LevelColor(const int level,const color new_color) const;
+   ENUM_LINE_STYLE   LevelStyle(const int level) const;
+   bool              LevelStyle(const int level,const ENUM_LINE_STYLE new_style) const;
+   int               LevelWidth(const int level) const;
+   bool              LevelWidth(const int level,const int new_width) const;
+   double            LevelValue(const int level) const;
+   bool              LevelValue(const int level,const double new_value) const;
+   string            LevelDescription(const int level) const;
+   bool              LevelDescription(const int level,const string new_text) const;
+   //--- access methods to the API functions of MQL5
+   long              GetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const int modifier=-1) const;
+   bool              GetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const int modifier,long &value) const;
+   bool              SetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const int modifier,const long value) const;
+   bool              SetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const long value) const;
+   double            GetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const int modifier=-1) const;
+   bool              GetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const int modifier,double &value) const;
+   bool              SetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const int modifier,const double value) const;
+   bool              SetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const double value) const;
+   string            GetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const int modifier=-1) const;
+   bool              GetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const int modifier,string &value) const;
+   bool              SetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const int modifier,const string value) const;
+   bool              SetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const string value) const;
+   //--- methods of moving
+   bool              ShiftObject(const datetime d_time,const double d_price) const;
+   bool              ShiftPoint(const int point,const datetime d_time,const double d_price) const;
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObject::CChartObject(void)
+  {
+//--- initialize protected data
+   Detach();
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObject::~CChartObject(void)
+  {
+   if(m_chart_id!=-1)
+      ObjectDelete(m_chart_id,m_name);
+  }
+//+------------------------------------------------------------------+
+//| Changing name of the object                                      |
+//+------------------------------------------------------------------+
+bool CChartObject::Name(const string name)
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- change
+   if(ObjectSetString(m_chart_id,m_name,OBJPROP_NAME,name))
+     {
+      m_name=name;
+      return(true);
+     }
+//--- failure
+   return(false);
+  };
+//+------------------------------------------------------------------+
+//| Attach object                                                    |
+//+------------------------------------------------------------------+
+bool CChartObject::Attach(long chart_id,const string name,const int window,const int points)
+  {
+//--- check
+   if(ObjectFind(chart_id,name)<0)
+      return(false);
+//--- attach
+   if(chart_id==0)
+      chart_id=ChartID();
+   m_chart_id  =chart_id;
+   m_window    =window;
+   m_name      =name;
+   m_num_points=points;
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Setting new coordinates of anchor point of an object             |
+//+------------------------------------------------------------------+
+bool CChartObject::SetPoint(const int point,const datetime time,const double price) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(point>=m_num_points)
+      return(false);
+//--- result
+   return(ObjectMove(m_chart_id,m_name,point,time,price));
+  }
+//+------------------------------------------------------------------+
+//| Delete an object                                                 |
+//+------------------------------------------------------------------+
+bool CChartObject::Delete(void)
+  {
+//--- checki
+   if(m_chart_id==-1)
+      return(false);
+//--- actions
+   bool result=ObjectDelete(m_chart_id,m_name);
+   Detach();
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Detach object                                                    |
+//+------------------------------------------------------------------+
+void CChartObject::Detach(void)
+  {
+   m_chart_id  =-1;
+   m_window    =-1;
+   m_name      =NULL;
+   m_num_points=0;
+  }
+//+------------------------------------------------------------------+
+//| Get the time coordinate of the specified anchor point of object  |
+//+------------------------------------------------------------------+
+datetime CChartObject::Time(const int point) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+   if(point>=m_num_points)
+      return(0);
+//--- result
+   return((datetime)ObjectGetInteger(m_chart_id,m_name,OBJPROP_TIME,point));
+  }
+//+------------------------------------------------------------------+
+//| Set the time coordinate of the specified anchor point of object  |
+//+------------------------------------------------------------------+
+bool CChartObject::Time(const int point,const datetime time) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(point>=m_num_points)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_TIME,point,time));
+  }
+//+------------------------------------------------------------------+
+//| Get the price coordinate of the specified anchor point of object.|
+//+------------------------------------------------------------------+
+double CChartObject::Price(const int point) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+   if(point>=m_num_points)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_PRICE,point));
+  }
+//+------------------------------------------------------------------+
+//| Set the price coordinate of the specified anchor point of object.|
+//+------------------------------------------------------------------+
+bool CChartObject::Price(const int point,const double price) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(point>=m_num_points)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_PRICE,point,price));
+  }
+//+------------------------------------------------------------------+
+//| Get object color                                                 |
+//+------------------------------------------------------------------+
+color CChartObject::Color(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ObjectGetInteger(m_chart_id,m_name,OBJPROP_COLOR));
+  }
+//+------------------------------------------------------------------+
+//| Set object color                                                 |
+//+------------------------------------------------------------------+
+bool CChartObject::Color(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_COLOR,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get style of line of object                                      |
+//+------------------------------------------------------------------+
+ENUM_LINE_STYLE CChartObject::Style(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_LINE_STYLE)ObjectGetInteger(m_chart_id,m_name,OBJPROP_STYLE));
+  }
+//+------------------------------------------------------------------+
+//| Set style of line of object                                      |
+//+------------------------------------------------------------------+
+bool CChartObject::Style(const ENUM_LINE_STYLE new_style) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_STYLE,new_style));
+  }
+//+------------------------------------------------------------------+
+//| Get width of line of object                                      |
+//+------------------------------------------------------------------+
+int CChartObject::Width(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(-1);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_WIDTH));
+  }
+//+------------------------------------------------------------------+
+//| Set width of line of object                                      |
+//+------------------------------------------------------------------+
+bool CChartObject::Width(const int new_width) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_WIDTH,new_width));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Draw object as background" flag                         |
+//+------------------------------------------------------------------+
+bool CChartObject::Background(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_BACK));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Draw object as background" flag                         |
+//+------------------------------------------------------------------+
+bool CChartObject::Background(const bool new_back) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_BACK,new_back));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Filling" flag                                           |
+//+------------------------------------------------------------------+
+bool CChartObject::Fill(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_FILL));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Filling" flag                                           |
+//+------------------------------------------------------------------+
+bool CChartObject::Fill(const bool new_fill) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_FILL,new_fill));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Z-order" property                                       |
+//+------------------------------------------------------------------+
+long CChartObject::Z_Order(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_ZORDER));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Z-order" property                                       |
+//+------------------------------------------------------------------+
+bool CChartObject::Z_Order(const long value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_ZORDER,value));
+  }
+//+------------------------------------------------------------------+
+//| Get the "selected" flag                                          |
+//+------------------------------------------------------------------+
+bool CChartObject::Selected(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_SELECTED));
+  }
+//+------------------------------------------------------------------+
+//| Set the "selected" flag                                          |
+//+------------------------------------------------------------------+
+bool CChartObject::Selected(const bool new_sel) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_SELECTED,new_sel));
+  }
+//+------------------------------------------------------------------+
+//| Get the "selectable" flag                                        |
+//+------------------------------------------------------------------+
+bool CChartObject::Selectable(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_SELECTABLE));
+  }
+//+------------------------------------------------------------------+
+//| Set flag the "selectable" flag                                   |
+//+------------------------------------------------------------------+
+bool CChartObject::Selectable(const bool new_sel) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_SELECTABLE,new_sel));
+  }
+//+------------------------------------------------------------------+
+//| Get comment of object                                            |
+//+------------------------------------------------------------------+
+string CChartObject::Description(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_TEXT));
+  }
+//+------------------------------------------------------------------+
+//| Set comment of object                                            |
+//+------------------------------------------------------------------+
+bool CChartObject::Description(const string new_text) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- tune
+   if(new_text=="")
+      return(ObjectSetString(m_chart_id,m_name,OBJPROP_TEXT," "));
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_TEXT,new_text));
+  }
+//+------------------------------------------------------------------+
+//| Get tooltip of object                                            |
+//+------------------------------------------------------------------+
+string CChartObject::Tooltip(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_TOOLTIP));
+  }
+//+------------------------------------------------------------------+
+//| Set tooltip of object                                            |
+//+------------------------------------------------------------------+
+bool CChartObject::Tooltip(const string new_text) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- tune
+   if(new_text=="")
+      return(ObjectSetString(m_chart_id,m_name,OBJPROP_TOOLTIP," "));
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_TOOLTIP,new_text));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Timeframes" (visibility) flag                           |
+//+------------------------------------------------------------------+
+int CChartObject::Timeframes(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_TIMEFRAMES));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Timeframes" (visibility) flag                           |
+//+------------------------------------------------------------------+
+bool CChartObject::Timeframes(const int timeframes) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_TIMEFRAMES,timeframes));
+  }
+//+------------------------------------------------------------------+
+//| Get time of object creation                                      |
+//+------------------------------------------------------------------+
+datetime CChartObject::CreateTime(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((datetime)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CREATETIME));
+  }
+//+------------------------------------------------------------------+
+//| Get number of levels of object                                   |
+//+------------------------------------------------------------------+
+int CChartObject::LevelsCount(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELS));
+  }
+//+------------------------------------------------------------------+
+//| Set number of levels of object                                   |
+//+------------------------------------------------------------------+
+bool CChartObject::LevelsCount(const int new_count) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELS,new_count));
+  }
+//+------------------------------------------------------------------+
+//| Get color of the specified level of object                       |
+//+------------------------------------------------------------------+
+color CChartObject::LevelColor(const int level) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+   if(level>=LevelsCount())
+      return(CLR_NONE);
+//--- result
+   return((color)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELCOLOR,level));
+  }
+//+------------------------------------------------------------------+
+//| Set color of the specified level of object                       |
+//+------------------------------------------------------------------+
+bool CChartObject::LevelColor(const int level,const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(level>=LevelsCount())
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELCOLOR,level,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get line style of the specified level of object                  |
+//+------------------------------------------------------------------+
+ENUM_LINE_STYLE CChartObject::LevelStyle(const int level) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+   if(level>=LevelsCount())
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_LINE_STYLE)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELSTYLE,level));
+  }
+//+------------------------------------------------------------------+
+//| Set line style of the specified level of object                  |
+//+------------------------------------------------------------------+
+bool CChartObject::LevelStyle(const int level,const ENUM_LINE_STYLE new_style) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(level>=LevelsCount())
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELSTYLE,level,new_style));
+  }
+//+------------------------------------------------------------------+
+//| Get line width of the specified level of object                  |
+//+------------------------------------------------------------------+
+int CChartObject::LevelWidth(const int level) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(-1);
+   if(level>=LevelsCount())
+      return(-1);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELWIDTH,level));
+  }
+//+------------------------------------------------------------------+
+//| Set line width of the specified level of object                  |
+//+------------------------------------------------------------------+
+bool CChartObject::LevelWidth(const int level,const int new_width) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(level>=LevelsCount())
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELWIDTH,level,new_width));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the specified level of object                       |
+//+------------------------------------------------------------------+
+double CChartObject::LevelValue(const int level) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+   if(level>=LevelsCount())
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_LEVELVALUE,level));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the specified level of object                       |
+//+------------------------------------------------------------------+
+bool CChartObject::LevelValue(const int level,const double new_value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(level>=LevelsCount())
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_LEVELVALUE,level,new_value));
+  }
+//+------------------------------------------------------------------+
+//| Get comment of of the specified level of object                  |
+//+------------------------------------------------------------------+
+string CChartObject::LevelDescription(const int level) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+   if(level>=LevelsCount())
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_LEVELTEXT,level));
+  }
+//+------------------------------------------------------------------+
+//| Set comment to the specified level of object                     |
+//+------------------------------------------------------------------+
+bool CChartObject::LevelDescription(const int level,const string new_text) const
+  {
+//--- checking
+   if(m_chart_id==-1)
+      return(false);
+   if(level>=LevelsCount())
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_LEVELTEXT,level,new_text));
+  }
+//+------------------------------------------------------------------+
+//| Access function long ObjectGetInteger(...)                       |
+//+------------------------------------------------------------------+
+long CChartObject::GetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const int modifier) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//---
+   if(modifier==-1)
+      return(ObjectGetInteger(m_chart_id,m_name,prop_id));
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,prop_id,modifier));
+  }
+//+------------------------------------------------------------------+
+//| Access function bool ObjectGetInteger(...)                       |
+//+------------------------------------------------------------------+
+bool CChartObject::GetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const int modifier,long &value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,prop_id,modifier,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ObjectSetInteger(.,modifier,.)                   |
+//+------------------------------------------------------------------+
+bool CChartObject::SetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const int modifier,const long value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,prop_id,modifier,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ObjectSetInteger(...)                            |
+//+------------------------------------------------------------------+
+bool CChartObject::SetInteger(const ENUM_OBJECT_PROPERTY_INTEGER prop_id,const long value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function double ObjectGetDouble(...)                      |
+//+------------------------------------------------------------------+
+double CChartObject::GetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const int modifier) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//---
+   if(modifier==-1)
+      return(ObjectGetDouble(m_chart_id,m_name,prop_id));
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,prop_id,modifier));
+  }
+//+------------------------------------------------------------------+
+//| Access function bool ObjectGetDouble(...)                        |
+//+------------------------------------------------------------------+
+bool CChartObject::GetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const int modifier,double &value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,prop_id,modifier,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ObjectSetDouble(.,modifier,.)                    |
+//+------------------------------------------------------------------+
+bool CChartObject::SetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const int modifier,const double value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,prop_id,modifier,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ObjectSetDouble(...)                             |
+//+------------------------------------------------------------------+
+bool CChartObject::SetDouble(const ENUM_OBJECT_PROPERTY_DOUBLE prop_id,const double value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function string ObjectGetString (...)                     |
+//+------------------------------------------------------------------+
+string CChartObject::GetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const int modifier) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//---
+   if(modifier==-1)
+      return(ObjectGetString(m_chart_id,m_name,prop_id));
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,prop_id,modifier));
+  }
+//+------------------------------------------------------------------+
+//| Access function bool ObjectGetString(...)                        |
+//+------------------------------------------------------------------+
+bool CChartObject::GetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const int modifier,string &value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,prop_id,modifier,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ObjectSetString(.,modifier,.)                    |
+//+------------------------------------------------------------------+
+bool CChartObject::SetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const int modifier,const string value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,prop_id,modifier,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ObjectSetString(...)                             |
+//+------------------------------------------------------------------+
+bool CChartObject::SetString(const ENUM_OBJECT_PROPERTY_STRING prop_id,const string value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of object                                      |
+//+------------------------------------------------------------------+
+bool CChartObject::ShiftObject(const datetime d_time,const double d_price) const
+  {
+   bool result=true;
+   int  i;
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- move
+   for(i=0;i<m_num_points;i++)
+      result&=ShiftPoint(i,d_time,d_price);
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of the specified achor point of object         |
+//+------------------------------------------------------------------+
+bool CChartObject::ShiftPoint(const int point,const datetime d_time,const double d_price) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(point>=m_num_points)
+      return(false);
+//--- move
+   datetime time=(datetime)ObjectGetInteger(m_chart_id,m_name,OBJPROP_TIME,point);
+   double   price=ObjectGetDouble(m_chart_id,m_name,OBJPROP_PRICE,point);
+//--- result
+   return(ObjectMove(m_chart_id,m_name,point,time+d_time,price+d_price));
+  }
+//+------------------------------------------------------------------+
+//| Writing object parameters to file                                |
+//+------------------------------------------------------------------+
+bool CChartObject::Save(const int file_handle)
+  {
+   int    i,len;
+   int    levels;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write start marker - 0xFFFFFFFFFFFFFFFF
+   if(FileWriteLong(file_handle,-1)!=sizeof(long))
+      return(false);
+//--- write object type
+   if(FileWriteInteger(file_handle,Type(),INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write object name
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_NAME);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0) if(FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- write object color
+   if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_COLOR))!=sizeof(long))
+      return(false);
+//--- write object line style
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_STYLE))!=sizeof(int))
+      return(false);
+//--- write object line width
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_WIDTH))!=sizeof(int))
+      return(false);
+//--- write the property value "Background"
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_BACK),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write the property value "Selectable"
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_SELECTABLE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write the property value "Timeframes"
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_TIMEFRAMES),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write comment
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_TEXT);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0) if(FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- write number of points
+   if(FileWriteInteger(file_handle,m_num_points,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write points
+   for(i=0;i<m_num_points;i++)
+     {
+      if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_TIME,i))!=sizeof(long))
+         return(false);
+      if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_PRICE,i))!=sizeof(double))
+         return(false);
+     }
+//--- write number of levels
+   levels=(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELS);
+   if(FileWriteInteger(file_handle,levels,INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write levels
+   for(i=0;i<levels;i++)
+     {
+      //--- level color
+      if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELCOLOR,i))!=sizeof(long))
+         return(false);
+      //--- level line style
+      if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELSTYLE,i))!=sizeof(int))
+         return(false);
+      //--- level line width
+      if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_LEVELWIDTH,i))!=sizeof(int))
+         return(false);
+      //--- level value
+      if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_LEVELVALUE,i))!=sizeof(double))
+         return(false);
+      //--- level name
+      str=ObjectGetString(m_chart_id,m_name,OBJPROP_LEVELTEXT,i);
+      len=StringLen(str);
+      if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+         return(false);
+      if(len!=0) if(FileWriteString(file_handle,str,len)!=len)
+         return(false);
+     }
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading object parameters from file                              |
+//+------------------------------------------------------------------+
+bool CChartObject::Load(const int file_handle)
+  {
+   int    i,len,num;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read and check start marker - 0xFFFFFFFFFFFFFFFF
+   if(FileReadLong(file_handle)!=-1)
+      return(false);
+//--- read and check object type
+   if(FileReadInteger(file_handle,INT_VALUE)!=Type())
+      return(false);
+//--- read object name
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_NAME,str))
+      return(false);
+//--- read object color
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_COLOR,FileReadLong(file_handle)))
+      return(false);
+//--- read object line style
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_STYLE,FileReadInteger(file_handle)))
+      return(false);
+//--- read object line style
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_WIDTH,FileReadInteger(file_handle)))
+      return(false);
+//--- read the property value "Background"
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_BACK,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read the property value "Selectable"
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_SELECTABLE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read the property value "Timeframes"
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_TIMEFRAMES,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read comment
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_TEXT,str))
+      return(false);
+//--- read number of point
+   num=FileReadInteger(file_handle,INT_VALUE);
+//--- read points
+   if(num!=0)
+     {
+      for(i=0;i<num;i++)
+        {
+         if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_TIME,i,FileReadLong(file_handle)))
+            return(false);
+         if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_PRICE,i,FileReadDouble(file_handle)))
+            return(false);
+        }
+     }
+//--- read number of levels
+   num=FileReadInteger(file_handle,INT_VALUE);
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELS,0,FileReadLong(file_handle)))
+      return(false);
+//--- read levels
+   if(num!=0)
+     {
+      for(i=0;i<num;i++)
+        {
+         //--- level color
+         if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELCOLOR,i,FileReadLong(file_handle)))
+            return(false);
+         //--- levelline style
+         if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELSTYLE,i,FileReadInteger(file_handle)))
+            return(false);
+         //--- level line width
+         if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_LEVELWIDTH,i,FileReadInteger(file_handle)))
+            return(false);
+         //--- level value
+         if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_LEVELVALUE,i,FileReadDouble(file_handle)))
+            return(false);
+         //--- level name
+         len=FileReadInteger(file_handle,INT_VALUE);
+         str=(len!=0) ? FileReadString(file_handle,len) : "";
+         if(!ObjectSetString(m_chart_id,m_name,OBJPROP_LEVELTEXT,i,str))
+            return(false);
+        }
+     }
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectPanel.mqh b/Include/ChartObjects/ChartObjectPanel.mqh
new file mode 100644
index 0000000..e2a3ba2
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectPanel.mqh
@@ -0,0 +1,198 @@
+//+------------------------------------------------------------------+
+//|                                             ChartObjectPanel.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <ChartObjects\ChartObjectsTxtControls.mqh>
+#include <Arrays\ArrayObj.mqh>
+#include <Arrays\ArrayInt.mqh>
+//+------------------------------------------------------------------+
+//| Class CChartObjectPanel.                                         |
+//| Purpose: Class for grouping objects for managing a chart         |
+//+------------------------------------------------------------------+
+class CChartObjectPanel : public CChartObjectButton
+  {
+protected:
+   CArrayObj         m_attachment;       // array of attached objects
+   CArrayInt         m_dX;               // array of dX attached objects
+   CArrayInt         m_dY;               // array of dY attached objects
+   bool              m_expanded;         // collapsed/expanded flag
+
+public:
+                     CChartObjectPanel();
+                    ~CChartObjectPanel();
+   //--- method for attaching objects
+   bool              Attach(CChartObjectLabel *chart_object);
+   bool              X_Distance(const int X);
+   bool              Y_Distance(const int Y);
+   int               X_Size() const;
+   int               Y_Size() const;
+   virtual bool      Timeframes(const int timeframes);
+   bool              State(const bool state);
+   bool              CheckState();
+
+protected:
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+void CChartObjectPanel::CChartObjectPanel(void) : m_expanded(true)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor.                                                      |
+//+------------------------------------------------------------------+
+void CChartObjectPanel::~CChartObjectPanel(void)
+  {
+//--- All objects added by the method Add(), deleted automatically
+  }
+//+------------------------------------------------------------------+
+//| Method Attach                                                    |
+//+------------------------------------------------------------------+
+bool CChartObjectPanel::Attach(CChartObjectLabel *chart_object)
+  {
+   if(m_attachment.Add(chart_object))
+     {
+      int x,y;
+      x=chart_object.X_Distance();
+      m_dX.Add(chart_object.X_Distance());
+      x+=X_Distance();
+      chart_object.X_Distance(X_Distance()+chart_object.X_Distance());
+      y=CChartObjectButton::Y_Size();
+      y+=chart_object.Y_Distance();
+      m_dY.Add(chart_object.Y_Distance()+CChartObjectButton::Y_Size()+2);
+      chart_object.Y_Distance(Y_Distance()+chart_object.Y_Distance()+CChartObjectButton::Y_Size()+2);
+      return(true);
+     }
+//---
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Method X_Distance                                                |
+//+------------------------------------------------------------------+
+bool CChartObjectPanel::X_Distance(const int X)
+  {
+   CChartObjectLabel *chart_object;
+//---
+   for(int i=0;i<m_attachment.Total();i++)
+     {
+      chart_object=m_attachment.At(i);
+      chart_object.X_Distance(X+m_dX.At(i));
+     }
+//---
+   return(CChartObjectButton::X_Distance(X));
+  }
+//+------------------------------------------------------------------+
+//| Method Y_Distance                                                |
+//+------------------------------------------------------------------+
+bool CChartObjectPanel::Y_Distance(const int Y)
+  {
+   CChartObjectLabel *chart_object;
+//---
+   for(int i=0;i<m_attachment.Total();i++)
+     {
+      chart_object=m_attachment.At(i);
+      chart_object.Y_Distance(Y+m_dY.At(i));
+     }
+//---
+   return(CChartObjectButton::Y_Distance(Y));
+  }
+//+------------------------------------------------------------------+
+//| Method X_Size                                                    |
+//+------------------------------------------------------------------+
+int CChartObjectPanel::X_Size() const
+  {
+   int                max_x=CChartObjectButton::X_Size()+X_Distance();
+   CChartObjectLabel *chart_object;
+//---
+   if(m_expanded)
+     {
+      for(int i=0;i<m_attachment.Total();i++)
+         if((chart_object=m_attachment.At(i))!=NULL)
+            if(max_x<chart_object.X_Distance()+chart_object.X_Size())
+               max_x=chart_object.X_Distance()+chart_object.X_Size();
+      return(max_x-X_Distance()+2);
+     }
+//---
+   return(CChartObjectButton::X_Size()+2);
+  }
+//+------------------------------------------------------------------+
+//| Method Y_Size                                                    |
+//+------------------------------------------------------------------+
+int CChartObjectPanel::Y_Size() const
+  {
+   int                max_y=CChartObjectButton::Y_Size()+Y_Distance();
+   CChartObjectLabel *chart_object;
+//---
+   if(m_expanded)
+     {
+      for(int i=0;i<m_attachment.Total();i++)
+         if((chart_object=m_attachment.At(i))!=NULL)
+            if(max_y<chart_object.Y_Distance()+chart_object.Y_Size())
+               max_y=chart_object.Y_Distance()+chart_object.Y_Size();
+      return(max_y-Y_Distance()+2);
+     }
+//---
+   return(CChartObjectButton::Y_Size()+2);
+  }
+//+------------------------------------------------------------------+
+//| Method Timeframes                                                |
+//+------------------------------------------------------------------+
+bool CChartObjectPanel::Timeframes(const int timeframes)
+  {
+   int                i;
+   bool               res=CChartObject::Timeframes(timeframes);
+   CChartObjectLabel *chart_object;
+//---
+   if(m_expanded)
+      for(i=0;i<m_attachment.Total();i++)
+        {
+         chart_object=m_attachment.At(i);
+         res&=chart_object.Timeframes(timeframes);
+        }
+//---
+   return(res);
+  }
+//+------------------------------------------------------------------+
+//| Method State                                                     |
+//+------------------------------------------------------------------+
+bool CChartObjectPanel::State(const bool state)
+  {
+   if(CChartObjectButton::State(state))
+     {
+      m_expanded=state;
+      return(true);
+     }
+//---
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Method CheckState                                                |
+//+------------------------------------------------------------------+
+bool CChartObjectPanel::CheckState(void)
+  {
+   int                i;
+   CChartObjectLabel *chart_object;
+//---
+   if(m_expanded!=State())
+     {
+      if(m_expanded=State())
+         //--- make all objects visible
+         for(i=0;i<m_attachment.Total();i++)
+           {
+            chart_object=m_attachment.At(i);
+            chart_object.Timeframes(-1);
+           }
+      else
+         //--- make all objects invisible
+         for(i=0;i<m_attachment.Total();i++)
+           {
+            chart_object=m_attachment.At(i);
+            chart_object.Timeframes(0x100000);
+           }
+      return(true);
+     }
+//---
+   return(false);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectSubChart.mqh b/Include/ChartObjects/ChartObjectSubChart.mqh
new file mode 100644
index 0000000..4507028
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectSubChart.mqh
@@ -0,0 +1,397 @@
+//+------------------------------------------------------------------+
+//|                                          ChartObjectSubChart.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectSubChart.                                      |
+//| Purpose: Class of the "SubChart" object of chart.                |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectSubChart : public CChartObject
+  {
+public:
+                     CChartObjectSubChart(void);
+                    ~CChartObjectSubChart(void);
+   //--- methods of access to properties of the object
+   int               X_Distance(void) const;
+   bool              X_Distance(const int X) const;
+   int               Y_Distance(void) const;
+   bool              Y_Distance(const int Y) const;
+   ENUM_BASE_CORNER  Corner(void) const;
+   bool              Corner(const ENUM_BASE_CORNER corner) const;
+   int               X_Size(void) const;
+   bool              X_Size(const int size) const;
+   int               Y_Size(void) const;
+   bool              Y_Size(const int size) const;
+   string            Symbol(void) const;
+   bool              Symbol(const string symbol) const;
+   int               Period(void) const;
+   bool              Period(const int period) const;
+   int               Scale(void) const;
+   bool              Scale(const int scale) const;
+   bool              DateScale(void) const;
+   bool              DateScale(const bool scale) const;
+   bool              PriceScale(void) const;
+   bool              PriceScale(const bool scale) const;
+   //--- change of time/price coordinates is blocked
+   bool              Time(const datetime time) const { return(false); }
+   bool              Price(const double price) const { return(false); }
+   //--- method of creating object
+   bool              Create(long chart_id,const string name,const int window,
+                            const int X,const int Y,const int sizeX,const int sizeY);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_CHART); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectSubChart::CChartObjectSubChart(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectSubChart::~CChartObjectSubChart(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "SubChart"                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Create(long chart_id,const string name,const int window,
+                                  const int X,const int Y,const int sizeX,const int sizeY)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_CHART,window,0,0,0))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+   if(!X_Distance(X) || !Y_Distance(Y))
+      return(false);
+   if(!X_Size(sizeX) || !Y_Size(sizeY))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get the X-distance                                               |
+//+------------------------------------------------------------------+
+int CChartObjectSubChart::X_Distance(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE));
+  }
+//+------------------------------------------------------------------+
+//| Set the X-distance                                               |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::X_Distance(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE,X));
+  }
+//+------------------------------------------------------------------+
+//| Get the Y-distance                                               |
+//+------------------------------------------------------------------+
+int CChartObjectSubChart::Y_Distance(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE));
+  }
+//+------------------------------------------------------------------+
+//| Set the Y-distance                                               |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Y_Distance(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE,Y));
+  }
+//+------------------------------------------------------------------+
+//| Get base corner                                                  |
+//+------------------------------------------------------------------+
+ENUM_BASE_CORNER CChartObjectSubChart::Corner(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_BASE_CORNER)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CORNER));
+  }
+//+------------------------------------------------------------------+
+//| Set base corner                                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Corner(const ENUM_BASE_CORNER corner) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_CORNER,corner));
+  }
+//+------------------------------------------------------------------+
+//| Get the X-size                                                   |
+//+------------------------------------------------------------------+
+int CChartObjectSubChart::X_Size(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Set X-size                                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::X_Size(const int size) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XSIZE,size));
+  }
+//+------------------------------------------------------------------+
+//| Get the Y-size                                                   |
+//+------------------------------------------------------------------+
+int CChartObjectSubChart::Y_Size(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Set the Y-size                                                   |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Y_Size(const int size) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YSIZE,size));
+  }
+//+------------------------------------------------------------------+
+//| Get chart symbol                                                 |
+//+------------------------------------------------------------------+
+string CChartObjectSubChart::Symbol(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_SYMBOL));
+  }
+//+------------------------------------------------------------------+
+//| Set chart symbol                                                 |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Symbol(const string symbol) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_SYMBOL,symbol));
+  }
+//+------------------------------------------------------------------+
+//| Get chart period                                                 |
+//+------------------------------------------------------------------+
+int CChartObjectSubChart::Period(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_PERIOD));
+  }
+//+------------------------------------------------------------------+
+//| Set chart period                                                 |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Period(const int period) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_PERIOD,period));
+  }
+//+------------------------------------------------------------------+
+//| Get chart scale                                                  |
+//+------------------------------------------------------------------+
+int CChartObjectSubChart::Scale(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(-1);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CHART_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set chart scale                                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Scale(const int scale) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_CHART_SCALE,scale));
+  }
+//+------------------------------------------------------------------+
+//| Get the "time scale" flag                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::DateScale(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_DATE_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set the "time scale" flag                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::DateScale(const bool scale) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_DATE_SCALE,scale));
+  }
+//+------------------------------------------------------------------+
+//| Get the "price scale" flag                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::PriceScale(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_PRICE_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set the "price scale" flag                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::PriceScale(const bool scale) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_PRICE_SCALE,scale));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Save(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObject::Save(file_handle))
+      return(false);
+//--- write value of the "X-distance" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Y-distance" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "corner" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CORNER),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "X-size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Y-size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "symbol" property
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_SYMBOL);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0 && FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- write value of the "period" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_PERIOD),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "scale" property
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE))!=sizeof(double))
+      return(false);
+//--- write value of the "time scale" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_DATE_SCALE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "price scale" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_PRICE_SCALE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectSubChart::Load(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObject::Load(file_handle))
+      return(false);
+//--- read value of the "X-distance" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Y-distance" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "corner" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_CORNER,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "X-size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_XSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Y-size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_YSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "symbol" property
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_SYMBOL,str))
+      return(false);
+//--- read value of the "period" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_PERIOD,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "scale" property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,FileReadDatetime(file_handle)))
+      return(false);
+//--- read value of the "time scale" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_DATE_SCALE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "price scale" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_PRICE_SCALE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsArrows.mqh b/Include/ChartObjects/ChartObjectsArrows.mqh
new file mode 100644
index 0000000..23763b5
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsArrows.mqh
@@ -0,0 +1,486 @@
+//+------------------------------------------------------------------+
+//|                                           ChartObjectsArrows.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All arrows.                                                      |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrow.                                         |
+//| Purpose: Class of the "Arrow" object of chart.                   |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectArrow : public CChartObject
+  {
+public:
+                     CChartObjectArrow(void);
+                    ~CChartObjectArrow(void);
+   //--- methods of access to properties of the object
+   char              ArrowCode(void) const;
+   bool              ArrowCode(const char code) const;
+   ENUM_ARROW_ANCHOR Anchor(void) const;
+   bool              Anchor(const ENUM_ARROW_ANCHOR anchor) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price,const char code);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrow::CChartObjectArrow(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrow::~CChartObjectArrow(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Arrow"                                            |
+//+------------------------------------------------------------------+
+bool CChartObjectArrow::Create(long chart_id,const string name,const int window,
+                               const datetime time,const double price,const char code)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+   if(!ArrowCode(code))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get code of "arrow" symbol                                       |
+//+------------------------------------------------------------------+
+char CChartObjectArrow::ArrowCode(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((char)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ARROWCODE));
+  }
+//+------------------------------------------------------------------+
+//| Set code of "arrow" symbol                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectArrow::ArrowCode(const char code) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_ARROWCODE,code));
+  }
+//+------------------------------------------------------------------+
+//| Get anchor type                                                  |
+//+------------------------------------------------------------------+
+ENUM_ARROW_ANCHOR CChartObjectArrow::Anchor(void) const
+  {
+//--- result
+   return((ENUM_ARROW_ANCHOR)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ANCHOR));
+  }
+//+------------------------------------------------------------------+
+//| Set anchor type                                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectArrow::Anchor(const ENUM_ARROW_ANCHOR anchor) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_ANCHOR,anchor));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectArrow::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- writing
+   if(!CObject::Save(file_handle))
+      return(false);
+//--- write code of "arrow" symbol
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ARROWCODE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write anchor type
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ANCHOR),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectArrow::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- reading
+   if(!CObject::Load(file_handle))
+      return(false);
+//--- read code of "arrow" symbol
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_ARROWCODE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read anchor type
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_ANCHOR,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowThumbUp.                                  |
+//| Purpose: Class of the "Thumbs Up" object of chart.               |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowThumbUp : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowThumbUp(void);
+                    ~CChartObjectArrowThumbUp(void);
+   //--- change of arrow code is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_THUMB_UP); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowThumbUp::CChartObjectArrowThumbUp(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowThumbUp::~CChartObjectArrowThumbUp(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Thumbs Up"                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowThumbUp::Create(long chart_id,const string name,const int window,
+                                      const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_THUMB_UP,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowThumbDown.                                |
+//| Purpose: Class of the "Thumbs Down" object of chart.             |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowThumbDown : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowThumbDown(void);
+                    ~CChartObjectArrowThumbDown(void);
+   //--- change of arrow code is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_THUMB_DOWN); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowThumbDown::CChartObjectArrowThumbDown(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowThumbDown::~CChartObjectArrowThumbDown(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "ThumbsDown"                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowThumbDown::Create(long chart_id,const string name,const int window,
+                                        const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_THUMB_DOWN,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowUp.                                       |
+//| Purpose: Class of the "Arrow Up" object of chart.                |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowUp : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowUp(void);
+                    ~CChartObjectArrowUp(void);
+   //--- change of arrow code is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_UP); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowUp::CChartObjectArrowUp(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowUp::~CChartObjectArrowUp(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Arrow Up"                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowUp::Create(long chart_id,const string name,const int window,
+                                 const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_UP,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowDown.                                     |
+//| Purpose: Class of the "Arrow Down" object of chart.              |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowDown : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowDown(void);
+                    ~CChartObjectArrowDown(void);
+   //--- change of arrow code is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_DOWN); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowDown::CChartObjectArrowDown(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowDown::~CChartObjectArrowDown(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Arrow Down"                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowDown::Create(long chart_id,const string name,const int window,
+                                   const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_DOWN,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowStop.                                     |
+//| Purpose: Class of the "Stop Sign" object of chart.               |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowStop : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowStop(void);
+                    ~CChartObjectArrowStop(void);
+   //--- change of arrow code is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_STOP); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowStop::CChartObjectArrowStop(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowStop::~CChartObjectArrowStop(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Stop Sign"                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowStop::Create(long chart_id,const string name,const int window,
+                                   const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_STOP,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowCheck.                                    |
+//| Purpose: Class of the "Check Sign" object of chart.              |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowCheck : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowCheck(void);
+                    ~CChartObjectArrowCheck(void);
+   //--- change of arrow code is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_CHECK); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowCheck::CChartObjectArrowCheck(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowCheck::~CChartObjectArrowCheck(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Check Sign"                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowCheck::Create(long chart_id,const string name,const int window,
+                                    const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_CHECK,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowLeftPrice.                                |
+//| Purpose: Class of the "Left Price Label" object of chart.        |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowLeftPrice : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowLeftPrice(void);
+                    ~CChartObjectArrowLeftPrice(void);
+   //--- change of arrow code and anchor point is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   bool              Anchor(const ENUM_ANCHOR_POINT anchor) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_LEFT_PRICE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowLeftPrice::CChartObjectArrowLeftPrice(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowLeftPrice::~CChartObjectArrowLeftPrice(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Left Price Label"                                 |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowLeftPrice::Create(long chart_id,const string name,const int window,const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_LEFT_PRICE,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectArrowRightPrice.                               |
+//| Purpose: Class of the "Right Price Label" object of chart.       |
+//|          Derives from class CChartObjectArrow.                   |
+//+------------------------------------------------------------------+
+class CChartObjectArrowRightPrice : public CChartObjectArrow
+  {
+public:
+                     CChartObjectArrowRightPrice(void);
+                    ~CChartObjectArrowRightPrice(void);
+   //--- change of arrow code and anchor point is blocked
+   bool              ArrowCode(const char code) const { return(false); }
+   bool              Anchor(const ENUM_ANCHOR_POINT anchor) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ARROW_RIGHT_PRICE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectArrowRightPrice::CChartObjectArrowRightPrice(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectArrowRightPrice::~CChartObjectArrowRightPrice(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Right Price Label"                                |
+//+------------------------------------------------------------------+
+bool CChartObjectArrowRightPrice::Create(long chart_id,const string name,const int window,
+                                         const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ARROW_RIGHT_PRICE,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsBmpControls.mqh b/Include/ChartObjects/ChartObjectsBmpControls.mqh
new file mode 100644
index 0000000..61472b1
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsBmpControls.mqh
@@ -0,0 +1,512 @@
+//+------------------------------------------------------------------+
+//|                                      ChartObjectsBmpControls.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All objects with "bmp" pictures.                                 |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectBitmap.                                        |
+//| Purpose: Class of the "Bitmap" object of chart.                  |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectBitmap : public CChartObject
+  {
+public:
+                     CChartObjectBitmap(void);
+                    ~CChartObjectBitmap(void);
+   //--- methods of access to properties of the object
+   string            BmpFile(void) const;
+   bool              BmpFile(const string name) const;
+   int               X_Offset(void) const;
+   bool              X_Offset(const int X) const;
+   int               Y_Offset(void) const;
+   bool              Y_Offset(const int Y) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_BITMAP); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectBitmap::CChartObjectBitmap(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectBitmap::~CChartObjectBitmap(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Bitmapp"                                          |
+//+------------------------------------------------------------------+
+bool CChartObjectBitmap::Create(long chart_id,const string name,const int window,const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_BITMAP,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get name of bmp-file                                             |
+//+------------------------------------------------------------------+
+string CChartObjectBitmap::BmpFile(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_BMPFILE));
+  }
+//+------------------------------------------------------------------+
+//| Set name of bmp-file                                             |
+//+------------------------------------------------------------------+
+bool CChartObjectBitmap::BmpFile(const string name) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_BMPFILE,name));
+  }
+//+------------------------------------------------------------------+
+//| Get the XOffset property                                         |
+//+------------------------------------------------------------------+
+int CChartObjectBitmap::X_Offset(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XOFFSET));
+  }
+//+------------------------------------------------------------------+
+//| Set the XOffset property                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectBitmap::X_Offset(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XOFFSET,X));
+  }
+//+------------------------------------------------------------------+
+//| Get the YOffset property                                         |
+//+------------------------------------------------------------------+
+int CChartObjectBitmap::Y_Offset(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YOFFSET));
+  }
+//+------------------------------------------------------------------+
+//| Set the YOffset property                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectBitmap::Y_Offset(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YOFFSET,Y));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectBitmap::Save(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObject::Save(file_handle))
+      return(false);
+//--- write value of the "name of bmp-file" property
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_BMPFILE);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0 && FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectBitmap::Load(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObject::Load(file_handle))
+      return(false);
+//--- read value of the "name of bmp-file" property
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_BMPFILE,str))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectBmpLabel.                                      |
+//| Purpose: Class of the "Bitmap label" object of chart.            |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectBmpLabel : public CChartObject
+  {
+public:
+                     CChartObjectBmpLabel(void);
+                    ~CChartObjectBmpLabel(void);
+   //--- methods of access to properties of the object
+   int               X_Distance(void) const;
+   bool              X_Distance(const int X) const;
+   int               Y_Distance(void) const;
+   bool              Y_Distance(const int Y) const;
+   int               X_Size(void) const;
+   int               Y_Size(void) const;
+   ENUM_BASE_CORNER  Corner(void) const;
+   bool              Corner(const ENUM_BASE_CORNER corner) const;
+   string            BmpFileOn(void) const;
+   bool              BmpFileOn(const string name) const;
+   string            BmpFileOff(void) const;
+   bool              BmpFileOff(const string name) const;
+   bool              State(void) const;
+   bool              State(const bool state) const;
+   int               X_Offset(void) const;
+   bool              X_Offset(const int X) const;
+   int               Y_Offset(void) const;
+   bool              Y_Offset(const int Y) const;
+   //--- change of time/price coordinates is blocked
+   bool              Time(const datetime time) const { return(false); }
+   bool              Price(const double price) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const int X,const int Y);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_BITMAP_LABEL); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectBmpLabel::CChartObjectBmpLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectBmpLabel::~CChartObjectBmpLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Bitmap label"                                     |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::Create(long chart_id,const string name,const int window,const int X,const int Y)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_BITMAP_LABEL,window,0,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+   if(!X_Distance(X) || !Y_Distance(Y))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get the X-distance property                                      |
+//+------------------------------------------------------------------+
+int CChartObjectBmpLabel::X_Distance(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE));
+  }
+//+------------------------------------------------------------------+
+//| Set the X-distance property                                      |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::X_Distance(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE,X));
+  }
+//+------------------------------------------------------------------+
+//| Get the Y-distance property                                      |
+//+------------------------------------------------------------------+
+int CChartObjectBmpLabel::Y_Distance(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE));
+  }
+//+------------------------------------------------------------------+
+//| Set the Y-distance property                                      |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::Y_Distance(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE,Y));
+  }
+//+------------------------------------------------------------------+
+//| Get the X-size                                                   |
+//+------------------------------------------------------------------+
+int CChartObjectBmpLabel::X_Size(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Get the Y-size                                                   |
+//+------------------------------------------------------------------+
+int CChartObjectBmpLabel::Y_Size(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Get the Corner property                                          |
+//+------------------------------------------------------------------+
+ENUM_BASE_CORNER CChartObjectBmpLabel::Corner(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_BASE_CORNER)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CORNER));
+  }
+//+------------------------------------------------------------------+
+//| Set the Corner property                                          |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::Corner(const ENUM_BASE_CORNER corner) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_CORNER,corner));
+  }
+//+------------------------------------------------------------------+
+//| Get filename of the "bmp-ON" property                            |
+//+------------------------------------------------------------------+
+string CChartObjectBmpLabel::BmpFileOn(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_BMPFILE,0));
+  }
+//+------------------------------------------------------------------+
+//| Set filename for the "bmp-ON" property                           |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::BmpFileOn(const string name) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_BMPFILE,0,name));
+  }
+//+------------------------------------------------------------------+
+//| Get filename of the "bmp-OFF" property                           |
+//+------------------------------------------------------------------+
+string CChartObjectBmpLabel::BmpFileOff(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_BMPFILE,1));
+  }
+//+------------------------------------------------------------------+
+//| Set filename for the "bmp-OFF" property                          |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::BmpFileOff(const string name) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_BMPFILE,1,name));
+  }
+//+------------------------------------------------------------------+
+//| Get the State property                                           |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::State(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_STATE));
+  }
+//+------------------------------------------------------------------+
+//| Set the State property                                           |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::State(const bool state) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_STATE,state));
+  }
+//+------------------------------------------------------------------+
+//| Get the XOffset property                                         |
+//+------------------------------------------------------------------+
+int CChartObjectBmpLabel::X_Offset(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XOFFSET));
+  }
+//+------------------------------------------------------------------+
+//| Set the XOffset property                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::X_Offset(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XOFFSET,X));
+  }
+//+------------------------------------------------------------------+
+//| Get the YOffset property                                         |
+//+------------------------------------------------------------------+
+int CChartObjectBmpLabel::Y_Offset(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YOFFSET));
+  }
+//+------------------------------------------------------------------+
+//| Set the YOffset property                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::Y_Offset(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YOFFSET,Y));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::Save(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObject::Save(file_handle))
+      return(false);
+//--- write value of the "X-distance" property 
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Y-distance" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Corner" property 
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CORNER),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "filename bmp-ON" property 
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_BMPFILE,0);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0 && FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- write value of the "filename bmp-OFF" property
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_BMPFILE,1);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0 && FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- write state
+   if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_STATE))!=sizeof(long))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading object parameters from file                              |
+//+------------------------------------------------------------------+
+bool CChartObjectBmpLabel::Load(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObject::Load(file_handle))
+      return(false);
+//--- read value of the "X-distance" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Y-distance" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of "Corner" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_CORNER,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "filename bmp-ON" property
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_BMPFILE,0,str))
+      return(false);
+//--- read value of the "filename bmp-OFF" property
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_BMPFILE,1,str))
+      return(false);
+//--- read state
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_STATE,FileReadLong(file_handle)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsChannels.mqh b/Include/ChartObjects/ChartObjectsChannels.mqh
new file mode 100644
index 0000000..fce7bc1
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsChannels.mqh
@@ -0,0 +1,246 @@
+//+------------------------------------------------------------------+
+//|                                         ChartObjectsChannels.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All channels.                                                    |
+//+------------------------------------------------------------------+
+#include "ChartObjectsLines.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectChannel.                                       |
+//| Purpose: Class of the "Equidistant channel" object of chart.     |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectChannel : public CChartObjectTrend
+  {
+public:
+                     CChartObjectChannel(void);
+                    ~CChartObjectChannel(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_CHANNEL); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectChannel::CChartObjectChannel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectChannel::~CChartObjectChannel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Equidistant channel"                              |
+//+------------------------------------------------------------------+
+bool CChartObjectChannel::Create(long chart_id,const string name,const int window,
+                                 const datetime time1,const double price1,
+                                 const datetime time2,const double price2,
+                                 const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_CHANNEL,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectStdDevChannel.                                 |
+//| Purpose: Class of the "Standrad deviation channel"               |
+//|          object of chart.                                        |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectStdDevChannel : public CChartObjectTrend
+  {
+public:
+                     CChartObjectStdDevChannel(void);
+                    ~CChartObjectStdDevChannel(void);
+   //--- methods of access to properties of the object
+   double            Deviations(void) const;
+   bool              Deviations(const double deviation) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const datetime time2,const double deviation);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_STDDEVCHANNEL); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectStdDevChannel::CChartObjectStdDevChannel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectStdDevChannel::~CChartObjectStdDevChannel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Standard deviation channel"                       |
+//+------------------------------------------------------------------+
+bool CChartObjectStdDevChannel::Create(long chart_id,const string name,const int window,
+                                       const datetime time1,const datetime time2,const double deviation)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_STDDEVCHANNEL,window,time1,0.0,time2,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+   if(!Deviations(deviation))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Deviations" property                           |
+//+------------------------------------------------------------------+
+double CChartObjectStdDevChannel::Deviations(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_DEVIATION));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "Deviations" property                          |
+//+------------------------------------------------------------------+
+bool CChartObjectStdDevChannel::Deviations(const double deviation) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_DEVIATION,deviation));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectStdDevChannel::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectTrend::Save(file_handle))
+      return(false);
+//--- write value of the "Deviations" property
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_DEVIATION))!=sizeof(double))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectStdDevChannel::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectTrend::Load(file_handle))
+      return(false);
+//--- read value of the "Deviations" property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_DEVIATION,FileReadDouble(file_handle)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectRegression.                                    |
+//| Purpose: Class of the "Regression channel" object of chart.      |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectRegression : public CChartObjectTrend
+  {
+public:
+                     CChartObjectRegression(void);
+                    ~CChartObjectRegression(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const datetime time2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_REGRESSION); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectRegression::CChartObjectRegression(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectRegression::~CChartObjectRegression(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Regression channel"                               |
+//+------------------------------------------------------------------+
+bool CChartObjectRegression::Create(long chart_id,const string name,const int window,
+                                    const datetime time1,const datetime time2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_REGRESSION,window,time1,0.0,time2,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectPitchfork.                                     |
+//| Purpose: Class of the "Andrews pitchfork" object of chart        |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectPitchfork : public CChartObjectTrend
+  {
+public:
+                     CChartObjectPitchfork(void);
+                    ~CChartObjectPitchfork(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_CHANNEL); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectPitchfork::CChartObjectPitchfork(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectPitchfork::~CChartObjectPitchfork(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Andrews pitchfork"                                |
+//+------------------------------------------------------------------+
+bool CChartObjectPitchfork::Create(long chart_id,const string name,const int window,
+                                   const datetime time1,const double price1,
+                                   const datetime time2,const double price2,
+                                   const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_PITCHFORK,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsElliott.mqh b/Include/ChartObjects/ChartObjectsElliott.mqh
new file mode 100644
index 0000000..e1dbeef
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsElliott.mqh
@@ -0,0 +1,201 @@
+//+------------------------------------------------------------------+
+//|                                          ChartObjectsElliott.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All Elliott tools.                                               |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectElliottWave3.                                  |
+//| Purpose: Class of the "ElliottCorrectiveWave" object of chart.   |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectElliottWave3 : public CChartObject
+  {
+public:
+                     CChartObjectElliottWave3(void);
+                    ~CChartObjectElliottWave3(void);
+   //--- methods of access to properties of the object
+   ENUM_ELLIOT_WAVE_DEGREE Degree(void) const;
+   bool              Degree(const ENUM_ELLIOT_WAVE_DEGREE degree) const;
+   bool              Lines(void) const;
+   bool              Lines(const bool lines) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ELLIOTWAVE3); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectElliottWave3::CChartObjectElliottWave3(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectElliottWave3::~CChartObjectElliottWave3(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "ElliottCorrectiveWave"                            |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave3::Create(long chart_id,const string name,const int window,
+                                      const datetime time1,const double price1,
+                                      const datetime time2,const double price2,
+                                      const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ELLIOTWAVE3,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Degree" property                               |
+//+------------------------------------------------------------------+
+ENUM_ELLIOT_WAVE_DEGREE CChartObjectElliottWave3::Degree(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_ELLIOT_WAVE_DEGREE)ObjectGetInteger(m_chart_id,m_name,OBJPROP_DEGREE));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "Degree" property                              |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave3::Degree(const ENUM_ELLIOT_WAVE_DEGREE degree) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_DEGREE,degree));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Lines" property                                |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave3::Lines(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_DRAWLINES));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "Lines" property                               |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave3::Lines(const bool lines) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_DRAWLINES,lines));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave3::Save(const int file_handle)
+  {
+   bool result;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   result=CChartObject::Save(file_handle);
+   if(result)
+     {
+      //--- write value of the "Degree" property
+      if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_DEGREE),INT_VALUE)!=sizeof(int))
+         return(false);
+      //--- write value of the "Lines" property
+      if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_DRAWLINES),INT_VALUE)!=sizeof(int))
+         return(false);
+     }
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave3::Load(const int file_handle)
+  {
+   bool result;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   result=CChartObject::Load(file_handle);
+   if(result)
+     {
+      //--- read value of the "Degree" property
+      if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_DEGREE,FileReadInteger(file_handle,INT_VALUE)))
+         return(false);
+      //--- read value of the "Lines" property
+      if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_DRAWLINES,FileReadInteger(file_handle,INT_VALUE)))
+         return(false);
+     }
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectElliottWave5.                                  |
+//| Purpose: Class of the "ElliottMotiveWave" object of chart.       |
+//|          Derives from class CChartObjectElliottWave3.            |
+//+------------------------------------------------------------------+
+class CChartObjectElliottWave5 : public CChartObjectElliottWave3
+  {
+public:
+                     CChartObjectElliottWave5(void);
+                    ~CChartObjectElliottWave5(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3,
+                            const datetime time4,const double price4,
+                            const datetime time5,const double price5);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ELLIOTWAVE5); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectElliottWave5::CChartObjectElliottWave5(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectElliottWave5::~CChartObjectElliottWave5(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "ElliottMotiveWave"                                |
+//+------------------------------------------------------------------+
+bool CChartObjectElliottWave5::Create(long chart_id,const string name,const int window,
+                                      const datetime time1,const double price1,
+                                      const datetime time2,const double price2,
+                                      const datetime time3,const double price3,
+                                      const datetime time4,const double price4,
+                                      const datetime time5,const double price5)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ELLIOTWAVE5,window,time1,price1,time2,price2,time3,price3,time4,price4,time5,price5))
+      return(false);
+   if(!Attach(chart_id,name,window,5))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsFibo.mqh b/Include/ChartObjects/ChartObjectsFibo.mqh
new file mode 100644
index 0000000..0f03542
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsFibo.mqh
@@ -0,0 +1,365 @@
+//+------------------------------------------------------------------+
+//|                                             ChartObjectsFibo.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All Fibonacci tools.                                             |
+//+------------------------------------------------------------------+
+#include "ChartObjectsLines.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectFibo.                                          |
+//| Purpose: Class of the "Fibonacci Lines" object.                  |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectFibo : public CChartObjectTrend
+  {
+public:
+                     CChartObjectFibo(void);
+                    ~CChartObjectFibo(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_FIBO); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectFibo::CChartObjectFibo(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectFibo::~CChartObjectFibo(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Fibonacci Lines"                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectFibo::Create(long chart_id,const string name,const int window,
+                              const datetime time1,const double price1,
+                              const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_FIBO,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectFiboTimes.                                     |
+//| Purpose: Class of the "Fibonacci Time Zones" object of chart     |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectFiboTimes : public CChartObject
+  {
+public:
+                     CChartObjectFiboTimes(void);
+                    ~CChartObjectFiboTimes(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_FIBOTIMES); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectFiboTimes::CChartObjectFiboTimes(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectFiboTimes::~CChartObjectFiboTimes(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Fibonacci Time Zones"                             |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboTimes::Create(long chart_id,const string name,const int window,
+                                   const datetime time1,const double price1,
+                                   const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_FIBOTIMES,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectFiboFan.                                       |
+//| Purpose: Class of the "Fibonacci Fan" object of chart.           |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectFiboFan : public CChartObject
+  {
+public:
+                     CChartObjectFiboFan(void);
+                    ~CChartObjectFiboFan(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_FIBOFAN); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectFiboFan::CChartObjectFiboFan(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectFiboFan::~CChartObjectFiboFan(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Fibonacci Fan"                                    |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboFan::Create(long chart_id,const string name,const int window,
+                                 const datetime time1,const double price1,
+                                 const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_FIBOFAN,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectFiboArc.                                       |
+//| Purpose: Class of the "Fibonacci Arcs" object of chart.          |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectFiboArc : public CChartObject
+  {
+public:
+                     CChartObjectFiboArc(void);
+                    ~CChartObjectFiboArc(void);
+   //--- methods of access to properties of the object
+   double            Scale(void) const;
+   bool              Scale(const double scale) const;
+   bool              Ellipse(void) const;
+   bool              Ellipse(const bool ellipse) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,const double scale);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_FIBOARC); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectFiboArc::CChartObjectFiboArc(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectFiboArc::~CChartObjectFiboArc(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Fibonacci Arcs"                                   |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboArc::Create(long chart_id,const string name,const int window,
+                                 const datetime time1,const double price1,
+                                 const datetime time2,const double price2,const double scale)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_FIBOARC,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+   if(!Scale(scale))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Scale" property                                |
+//+------------------------------------------------------------------+
+double CChartObjectFiboArc::Scale(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "Scale" property                               |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboArc::Scale(const double scale) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,scale));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Ellipse" property                              |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboArc::Ellipse(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_ELLIPSE));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "Ellipse" property                             |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboArc::Ellipse(const bool ellipse) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_ELLIPSE,ellipse));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameter of object to file                              |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboArc::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObject::Save(file_handle))
+      return(false);
+//--- write value of the "Scale" property
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE))!=sizeof(double))
+      return(false);
+//--- write value of the "Ellipse" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ELLIPSE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboArc::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObject::Load(file_handle))
+      return(false);
+//--- read value of the "Scale" property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,FileReadDouble(file_handle)))
+      return(false);
+//--- read value of the "Ellipse" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_ELLIPSE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectFiboChannel.                                   |
+//| Purpose: Class of the "Fibonacci Channel" object of chart.       |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectFiboChannel : public CChartObjectTrend
+  {
+public:
+                     CChartObjectFiboChannel(void);
+                    ~CChartObjectFiboChannel(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_FIBOCHANNEL); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectFiboChannel::CChartObjectFiboChannel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectFiboChannel::~CChartObjectFiboChannel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Fibonacci Channel"                                |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboChannel::Create(long chart_id,const string name,const int window,
+                                     const datetime time1,const double price1,
+                                     const datetime time2,const double price2,
+                                     const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_FIBOCHANNEL,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectFiboExpansion.                                 |
+//| Purpose: Class of the "Fibonacci Expansion" object.              |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectFiboExpansion : public CChartObjectTrend
+  {
+public:
+                     CChartObjectFiboExpansion(void);
+                    ~CChartObjectFiboExpansion(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_EXPANSION); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectFiboExpansion::CChartObjectFiboExpansion(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectFiboExpansion::~CChartObjectFiboExpansion(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Fibonacci Expansion"                              |
+//+------------------------------------------------------------------+
+bool CChartObjectFiboExpansion::Create(long chart_id,const string name,const int window,
+                                       const datetime time1,const double price1,
+                                       const datetime time2,const double price2,
+                                       const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_EXPANSION,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsGann.mqh b/Include/ChartObjects/ChartObjectsGann.mqh
new file mode 100644
index 0000000..56d149f
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsGann.mqh
@@ -0,0 +1,390 @@
+//+------------------------------------------------------------------+
+//|                                             ChartObjectsGann.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All Gann tools.                                                  |
+//+------------------------------------------------------------------+
+#include "ChartObjectsLines.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectGannLine.                                      |
+//| Purpose: Class of the "Gann Line" object of chart.               |
+//|          Derives from class CChartObjectTrendByAngle.            |
+//+------------------------------------------------------------------+
+class CChartObjectGannLine : public CChartObjectTrendByAngle
+  {
+public:
+                     CChartObjectGannLine(void);
+                    ~CChartObjectGannLine(void);
+   //--- methods of access to properties of the object
+   double            PipsPerBar(void) const;
+   bool              PipsPerBar(const double ppb) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double ppb);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_GANNLINE); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectGannLine::CChartObjectGannLine(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectGannLine::~CChartObjectGannLine(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Gann Line"                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectGannLine::Create(long chart_id,const string name,const int window,
+                                  const datetime time1,const double price1,
+                                  const datetime time2,const double ppb)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_GANNLINE,window,time1,price1,time2,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+   if(!PipsPerBar(ppb))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "PipsPerBar" property                           |
+//+------------------------------------------------------------------+
+double CChartObjectGannLine::PipsPerBar(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "PipsPerBar" property                          |
+//+------------------------------------------------------------------+
+bool CChartObjectGannLine::PipsPerBar(const double ppb) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,ppb));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectGannLine::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectTrend::Save(file_handle))
+      return(false);
+//--- write value of the "PipsPerBar"
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE))!=sizeof(double))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectGannLine::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectTrend::Load(file_handle))
+      return(false);
+//--- read value of the "PipsPerBar" property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,FileReadDouble(file_handle)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectGannFan.                                       |
+//| Purpose: Class of the "Gann Fan" object of chart.                |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectGannFan : public CChartObjectTrend
+  {
+public:
+                     CChartObjectGannFan(void);
+                    ~CChartObjectGannFan(void);
+   //--- methods of access to properties of the object
+   double            PipsPerBar(void) const;
+   bool              PipsPerBar(const double ppb) const;
+   bool              Downtrend(void) const;
+   bool              Downtrend(const bool downtrend) const;
+   //--- method of create the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double ppb);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_GANNFAN); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectGannFan::CChartObjectGannFan(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectGannFan::~CChartObjectGannFan(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Gann Fan"                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectGannFan::Create(long chart_id,const string name,const int window,
+                                 const datetime time1,const double price1,
+                                 const datetime time2,const double ppb)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_GANNFAN,window,time1,price1,time2,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+   if(!PipsPerBar(ppb))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "PipsPerBar" property                           |
+//+------------------------------------------------------------------+
+double CChartObjectGannFan::PipsPerBar(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "PipsPerBar" property                          |
+//+------------------------------------------------------------------+
+bool CChartObjectGannFan::PipsPerBar(const double ppb) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,ppb));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Downtrend" property                            |
+//+------------------------------------------------------------------+
+bool CChartObjectGannFan::Downtrend(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_DIRECTION));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "Downtrend" property                           |
+//+------------------------------------------------------------------+
+bool CChartObjectGannFan::Downtrend(const bool downtrend) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_DIRECTION,downtrend));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectGannFan::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectTrend::Save(file_handle))
+      return(false);
+//--- write value of the "PipsPerBar" property
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE))!=sizeof(double))
+      return(false);
+//--- write value of the "Downtrend" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_DIRECTION),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading object parameters from file                              |
+//+------------------------------------------------------------------+
+bool CChartObjectGannFan::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectTrend::Load(file_handle))
+      return(false);
+//--- read value of the "PipsPerBar"  property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,FileReadDouble(file_handle)))
+      return(false);
+//--- read value of the "Downtrend"  property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_DIRECTION,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectGannGrid.                                      |
+//| Purpose: Class of the "Gann Grid" object of chart.               |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectGannGrid : public CChartObjectTrend
+  {
+public:
+                     CChartObjectGannGrid(void);
+                    ~CChartObjectGannGrid(void);
+   //--- methods of access to properties of the object
+   double            PipsPerBar(void) const;
+   bool              PipsPerBar(const double ppb) const;
+   bool              Downtrend(void) const;
+   bool              Downtrend(const bool downtrend) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double ppb);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_GANNGRID); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectGannGrid::CChartObjectGannGrid(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectGannGrid::~CChartObjectGannGrid(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Gann Grid"                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectGannGrid::Create(long chart_id,const string name,const int window,
+                                  const datetime time1,const double price1,
+                                  const datetime time2,const double ppb)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_GANNGRID,window,time1,price1,time2,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+   if(!PipsPerBar(ppb))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the"PipsPerBar" property                            |
+//+------------------------------------------------------------------+
+double CChartObjectGannGrid::PipsPerBar(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set value for the "PipsPerBar" property                          |
+//+------------------------------------------------------------------+
+bool CChartObjectGannGrid::PipsPerBar(const double ppb) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,ppb));
+  }
+//+------------------------------------------------------------------+
+//| Get the property value "Downtrend"                               |
+//+------------------------------------------------------------------+
+bool CChartObjectGannGrid::Downtrend(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_DIRECTION));
+  }
+//+------------------------------------------------------------------+
+//| Set the property value "Downtrend"                               |
+//+------------------------------------------------------------------+
+bool CChartObjectGannGrid::Downtrend(const bool downtrend) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_DIRECTION,downtrend));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectGannGrid::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectTrend::Save(file_handle))
+      return(false);
+//--- write value of the "PipsPerBar" property
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_SCALE))!=sizeof(double))
+      return(false);
+//--- write value of the "Downtrend" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_DIRECTION),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading paprameters of object from file                          |
+//+------------------------------------------------------------------+
+bool CChartObjectGannGrid::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectTrend::Load(file_handle))
+      return(false);
+//--- read value of the "PipsPerBar" property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_SCALE,FileReadDouble(file_handle)))
+      return(false);
+//--- read value of the "Downtrend" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_DIRECTION,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsLines.mqh b/Include/ChartObjects/ChartObjectsLines.mqh
new file mode 100644
index 0000000..0848307
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsLines.mqh
@@ -0,0 +1,335 @@
+//+------------------------------------------------------------------+
+//|                                            ChartObjectsLines.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All lines.                                                       |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectVLine.                                         |
+//| Purpose: Class of the "Vertical line" object of chart.           |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectVLine : public CChartObject
+  {
+public:
+                     CChartObjectVLine(void);
+                    ~CChartObjectVLine(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const datetime time);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_VLINE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectVLine::CChartObjectVLine(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectVLine::~CChartObjectVLine(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Vertical line"                                    |
+//+------------------------------------------------------------------+
+bool CChartObjectVLine::Create(long chart_id,const string name,const int window,const datetime time)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_VLINE,window,time,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectHLine.                                         |
+//| Purpose: Class of the "Horizontal line" object of chart.         |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectHLine : public CChartObject
+  {
+public:
+                     CChartObjectHLine(void);
+                    ~CChartObjectHLine(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_HLINE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectHLine::CChartObjectHLine(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectHLine::~CChartObjectHLine(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Horizontal line"                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectHLine::Create(long chart_id,const string name,const int window,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_HLINE,window,0,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectTrend.                                         |
+//| Purpose: Class of the "Trendline" object of chart.               |
+//|          Derives from class CChartObject.                        |
+//| It is the parent class for all objects that have properties      |
+//| RAY_LEFT and RAY_RIGHT.                                          |
+//+------------------------------------------------------------------+
+class CChartObjectTrend : public CChartObject
+  {
+public:
+                     CChartObjectTrend(void);
+                    ~CChartObjectTrend(void);
+   //--- methods of access to properties of the object
+   bool              RayLeft(void) const;
+   bool              RayLeft(const bool new_sel) const;
+   bool              RayRight(void) const;
+   bool              RayRight(const bool new_sel) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_TREND); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectTrend::CChartObjectTrend(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectTrend::~CChartObjectTrend(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Trendline"                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::Create(long chart_id,const string name,const int window,
+                               const datetime time1,const double price1,
+                               const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_TREND,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get the "Ray left" flag                                          |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::RayLeft(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_RAY_LEFT));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Ray left" flag                                          |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::RayLeft(const bool new_ray) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_RAY_LEFT,new_ray));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Ray right" flag                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::RayRight(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_RAY_RIGHT));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Ray right" flag                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::RayRight(const bool new_ray) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_RAY_RIGHT,new_ray));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of objject to file                            |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObject::Save(file_handle))
+      return(false);
+//--- write value of the "Ray left" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_RAY_LEFT),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "Ray right" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_RAY_RIGHT),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectTrend::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObject::Load(file_handle))
+      return(false);
+//--- read value of the "Ray left" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_RAY_LEFT,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "Ray right" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_RAY_RIGHT,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectTrendByAngle.                                  |
+//| Puprose: Class of the "Trendline by angle" object of chart.      |
+//|          Derives from class CChartObjectTrend.                   |
+//+------------------------------------------------------------------+
+class CChartObjectTrendByAngle : public CChartObjectTrend
+  {
+public:
+                     CChartObjectTrendByAngle(void);
+                    ~CChartObjectTrendByAngle(void);
+   //--- methods of access to properties of the object
+   double            Angle(void) const;
+   bool              Angle(const double angle) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_TRENDBYANGLE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectTrendByAngle::CChartObjectTrendByAngle(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectTrendByAngle::~CChartObjectTrendByAngle(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Trendline by angle"                               |
+//+------------------------------------------------------------------+
+bool CChartObjectTrendByAngle::Create(long chart_id,const string name,const int window,
+                                      const datetime time1,const double price1,
+                                      const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_TRENDBYANGLE,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get the "Angle" property                                         |
+//+------------------------------------------------------------------+
+double CChartObjectTrendByAngle::Angle(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//---
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_ANGLE));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Angle" property                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectTrendByAngle::Angle(const double angle) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_ANGLE,angle));
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectCycles.                                        |
+//| Purpose: Class of the "Cycle lines" object of chart.             |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectCycles : public CChartObject
+  {
+public:
+                     CChartObjectCycles(void);
+                    ~CChartObjectCycles(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_TREND); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectCycles::CChartObjectCycles(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectCycles::~CChartObjectCycles(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Cycle lines"                                      |
+//+------------------------------------------------------------------+
+bool CChartObjectCycles::Create(long chart_id,const string name,const int window,
+                                const datetime time1,const double price1,
+                                const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_CYCLES,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsShapes.mqh b/Include/ChartObjects/ChartObjectsShapes.mqh
new file mode 100644
index 0000000..99c1eb7
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsShapes.mqh
@@ -0,0 +1,142 @@
+//+------------------------------------------------------------------+
+//|                                           ChartObjectsShapes.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All shapes.                                                      |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectRectangle.                                     |
+//| Purpose: Class of the "Rectangle" object of chart.               |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectRectangle : public CChartObject
+  {
+public:
+                     CChartObjectRectangle(void);
+                    ~CChartObjectRectangle(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_RECTANGLE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectRectangle::CChartObjectRectangle(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectRectangle::~CChartObjectRectangle(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Rectangle"                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectRectangle::Create(long chart_id,const string name,const int window,
+                                   const datetime time1,const double price1,
+                                   const datetime time2,const double price2)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_RECTANGLE,window,time1,price1,time2,price2))
+      return(false);
+   if(!Attach(chart_id,name,window,2))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectTriangle.                                      |
+//| Purpose: Class of the "Triangle" object of chart.                |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectTriangle : public CChartObject
+  {
+public:
+                     CChartObjectTriangle(void);
+                    ~CChartObjectTriangle(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_TRIANGLE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectTriangle::CChartObjectTriangle(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectTriangle::~CChartObjectTriangle(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Triangle"                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectTriangle::Create(long chart_id,const string name,const int window,
+                                  const datetime time1,const double price1,
+                                  const datetime time2,const double price2,
+                                  const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_TRIANGLE,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectEllipse.                                       |
+//| Purpose: Class of the "Ellipse" object of chart.                 |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectEllipse : public CChartObject
+  {
+public:
+                     CChartObjectEllipse(void);
+                    ~CChartObjectEllipse(void);
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time1,const double price1,
+                            const datetime time2,const double price2,
+                            const datetime time3,const double price3);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_ELLIPSE); }
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectEllipse::CChartObjectEllipse(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectEllipse::~CChartObjectEllipse(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Ellipse"                                          |
+//+------------------------------------------------------------------+
+bool CChartObjectEllipse::Create(long chart_id,const string name,const int window,
+                                 const datetime time1,const double price1,
+                                 const datetime time2,const double price2,
+                                 const datetime time3,const double price3)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_ELLIPSE,window,time1,price1,time2,price2,time3,price3))
+      return(false);
+   if(!Attach(chart_id,name,window,3))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/ChartObjects/ChartObjectsTxtControls.mqh b/Include/ChartObjects/ChartObjectsTxtControls.mqh
new file mode 100644
index 0000000..d46c4d5
--- /dev/null
+++ b/Include/ChartObjects/ChartObjectsTxtControls.mqh
@@ -0,0 +1,887 @@
+//+------------------------------------------------------------------+
+//|                                      ChartObjectsTxtControls.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//| All text objects.                                                |
+//+------------------------------------------------------------------+
+#include "ChartObject.mqh"
+//+------------------------------------------------------------------+
+//| Class CChartObjectText.                                          |
+//| Purpose: Class of the "Text" object of chart.                    |
+//|          Derives from class CChartObject.                        |
+//+------------------------------------------------------------------+
+class CChartObjectText : public CChartObject
+  {
+public:
+                     CChartObjectText(void);
+                    ~CChartObjectText(void);
+   //--- methods of access to properties of the object
+   double            Angle(void) const;
+   bool              Angle(const double angle) const;
+   string            Font(void) const;
+   bool              Font(const string font) const;
+   int               FontSize(void) const;
+   bool              FontSize(const int size) const;
+   ENUM_ANCHOR_POINT Anchor(void) const;
+   bool              Anchor(const ENUM_ANCHOR_POINT anchor) const;
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,
+                            const datetime time,const double price);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_TEXT); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectText::CChartObjectText(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectText::~CChartObjectText(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Text"                                             |
+//+------------------------------------------------------------------+
+bool CChartObjectText::Create(long chart_id,const string name,const int window,
+                              const datetime time,const double price)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_TEXT,window,time,price))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Angle" property                                |
+//+------------------------------------------------------------------+
+double CChartObjectText::Angle(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ObjectGetDouble(m_chart_id,m_name,OBJPROP_ANGLE));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "Angle" property                                |
+//+------------------------------------------------------------------+
+bool CChartObjectText::Angle(const double angle) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetDouble(m_chart_id,m_name,OBJPROP_ANGLE,angle));
+  }
+//+------------------------------------------------------------------+
+//| Get font name                                                    |
+//+------------------------------------------------------------------+
+string CChartObjectText::Font(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ObjectGetString(m_chart_id,m_name,OBJPROP_FONT));
+  }
+//+------------------------------------------------------------------+
+//| Set font name                                                    |
+//+------------------------------------------------------------------+
+bool CChartObjectText::Font(const string font) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetString(m_chart_id,m_name,OBJPROP_FONT,font));
+  }
+//+------------------------------------------------------------------+
+//| Get font size                                                    |
+//+------------------------------------------------------------------+
+int CChartObjectText::FontSize(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_FONTSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Set font size                                                    |
+//+------------------------------------------------------------------+
+bool CChartObjectText::FontSize(const int size) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_FONTSIZE,size));
+  }
+//+------------------------------------------------------------------+
+//| Get anchor point                                                 |
+//+------------------------------------------------------------------+
+ENUM_ANCHOR_POINT CChartObjectText::Anchor(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_ANCHOR_POINT)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ANCHOR));
+  }
+//+------------------------------------------------------------------+
+//| Set anchor point                                                 |
+//+------------------------------------------------------------------+
+bool CChartObjectText::Anchor(const ENUM_ANCHOR_POINT anchor) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_ANCHOR,anchor));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectText::Save(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObject::Save(file_handle))
+      return(false);
+//--- write value of the "Angle" property
+   if(FileWriteDouble(file_handle,ObjectGetDouble(m_chart_id,m_name,OBJPROP_ANGLE))!=sizeof(double))
+      return(false);
+//--- write value of the "Font Name" property
+   str=ObjectGetString(m_chart_id,m_name,OBJPROP_FONT);
+   len=StringLen(str);
+   if(FileWriteInteger(file_handle,len,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(len!=0 && FileWriteString(file_handle,str,len)!=len)
+      return(false);
+//--- write value of the "Font Size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_FONTSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Anchor Point" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ANCHOR),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectText::Load(const int file_handle)
+  {
+   int    len;
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObject::Load(file_handle))
+      return(false);
+//--- reading value of the "Angle" property
+   if(!ObjectSetDouble(m_chart_id,m_name,OBJPROP_ANGLE,0,FileReadDouble(file_handle)))
+      return(false);
+//--- read value of the "Font Name" property
+   len=FileReadInteger(file_handle,INT_VALUE);
+   str=(len!=0) ? FileReadString(file_handle,len) : "";
+   if(!ObjectSetString(m_chart_id,m_name,OBJPROP_FONT,str))
+      return(false);
+//--- read value of the "Font Size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_FONTSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Anchor Point" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_ANCHOR,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectLabel.                                         |
+//| Purpose: Class of the "Label" object of chart.                   |
+//|          Derives from class CChartObjectText.                    |
+//+------------------------------------------------------------------+
+class CChartObjectLabel : public CChartObjectText
+  {
+public:
+                     CChartObjectLabel(void);
+                    ~CChartObjectLabel(void);
+   //--- methods of access to properties of the object
+   int               X_Distance(void) const;
+   bool              X_Distance(const int X) const;
+   int               Y_Distance(void) const;
+   bool              Y_Distance(const int Y) const;
+   int               X_Size(void) const;
+   int               Y_Size(void) const;
+   ENUM_BASE_CORNER  Corner(void) const;
+   bool              Corner(const ENUM_BASE_CORNER corner) const;
+   //--- change of time/price coordinates is blocked
+   bool              Time(const datetime time) const { return(false); }
+   bool              Price(const double price) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const int X,const int Y);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_LABEL); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectLabel::CChartObjectLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectLabel::~CChartObjectLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Label"                                            |
+//+------------------------------------------------------------------+
+bool CChartObjectLabel::Create(long chart_id,const string name,const int window,const int X,const int Y)
+  {
+   if(!ObjectCreate(chart_id,name,OBJ_LABEL,window,0,0.0))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+   if(!Description(name))
+      return(false);
+   if(!X_Distance(X) || !Y_Distance(Y))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Get the X-distance                                               |
+//+------------------------------------------------------------------+
+int CChartObjectLabel::X_Distance(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE));
+  }
+//+------------------------------------------------------------------+
+//| Set the X-distance                                               |
+//+------------------------------------------------------------------+
+bool CChartObjectLabel::X_Distance(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE,X));
+  }
+//+------------------------------------------------------------------+
+//| Get the Y-distance                                               |
+//+------------------------------------------------------------------+
+int CChartObjectLabel::Y_Distance(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE));
+  }
+//+------------------------------------------------------------------+
+//| Set the Y-distance                                               |
+//+------------------------------------------------------------------+
+bool CChartObjectLabel::Y_Distance(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE,Y));
+  }
+//+------------------------------------------------------------------+
+//| Get the X-size                                                   |
+//+------------------------------------------------------------------+
+int CChartObjectLabel::X_Size(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Get the Y-size                                                   |
+//+------------------------------------------------------------------+
+int CChartObjectLabel::Y_Size(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YSIZE));
+  }
+//+------------------------------------------------------------------+
+//| Get base corner                                                  |
+//+------------------------------------------------------------------+
+ENUM_BASE_CORNER CChartObjectLabel::Corner(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_BASE_CORNER)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CORNER));
+  }
+//+------------------------------------------------------------------+
+//| Set base corner                                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectLabel::Corner(const ENUM_BASE_CORNER corner) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_CORNER,corner));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectLabel::Save(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectText::Save(file_handle))
+      return(false);
+//--- write value of the "X-distance" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Y-distance" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Corner" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_CORNER),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectLabel::Load(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectText::Load(file_handle))
+      return(false);
+//--- reading value of the "X-distance" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_XDISTANCE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Y-distance" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_YDISTANCE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Corner" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_CORNER,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectEdit.                                          |
+//| Purpose: Class of the "Edit" object of chart.                    |
+//|          Derives from class CChartObjectLabel.                   |
+//+------------------------------------------------------------------+
+class CChartObjectEdit : public CChartObjectLabel
+  {
+public:
+                     CChartObjectEdit(void);
+                    ~CChartObjectEdit(void);
+   //--- methods of access to properties of the object
+   bool              X_Size(const int X) const;
+   bool              Y_Size(const int Y) const;
+   color             BackColor(void) const;
+   bool              BackColor(const color new_color) const;
+   color             BorderColor(void) const;
+   bool              BorderColor(const color new_color) const;
+   bool              ReadOnly(void) const;
+   bool              ReadOnly(const bool flag) const;
+   ENUM_ALIGN_MODE   TextAlign(void) const;
+   bool              TextAlign(const ENUM_ALIGN_MODE align) const;
+   //--- change of angle is blocked
+   bool              Angle(const double angle) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const int X,const int Y,const int sizeX,const int sizeY);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_EDIT); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectEdit::CChartObjectEdit(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectEdit::~CChartObjectEdit(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Edit"                                             |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::Create(long chart_id,const string name,const int window,const int X,const int Y,const int sizeX,const int sizeY)
+  {
+   if(!ObjectCreate(chart_id,name,(ENUM_OBJECT)Type(),window,0,0,0))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+   if(!X_Distance(X) || !Y_Distance(Y))
+      return(false);
+   if(!X_Size(sizeX) || !Y_Size(sizeY))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set X-size                                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::X_Size(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XSIZE,X));
+  }
+//+------------------------------------------------------------------+
+//| Set Y-size                                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::Y_Size(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YSIZE,Y));
+  }
+//+------------------------------------------------------------------+
+//| Get background color                                             |
+//+------------------------------------------------------------------+
+color CChartObjectEdit::BackColor(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ObjectGetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR));
+  }
+//+------------------------------------------------------------------+
+//| Set background color                                             |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::BackColor(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get border color                                                 |
+//+------------------------------------------------------------------+
+color CChartObjectEdit::BorderColor(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ObjectGetInteger(m_chart_id,m_name,OBJPROP_BORDER_COLOR));
+  }
+//+------------------------------------------------------------------+
+//| Set border color                                                 |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::BorderColor(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_BORDER_COLOR,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Read only" property                                     |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::ReadOnly(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return((int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_READONLY));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Read only" property                                     |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::ReadOnly(const bool flag) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_READONLY,flag));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Align" property                                         |
+//+------------------------------------------------------------------+
+ENUM_ALIGN_MODE CChartObjectEdit::TextAlign(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return((ENUM_ALIGN_MODE)ObjectGetInteger(m_chart_id,m_name,OBJPROP_ALIGN));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Align" property                                         |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::TextAlign(const ENUM_ALIGN_MODE align) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_ALIGN,align));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::Save(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectLabel::Save(file_handle))
+      return(false);
+//--- write value of the "X-size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Y-size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write background color
+   if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR))!=sizeof(long))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectEdit::Load(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectLabel::Load(file_handle))
+      return(false);
+//--- read value of the "X-size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_XSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Y-size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_YSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read background color
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR,FileReadLong(file_handle)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectButton.                                        |
+//| Purpose: Class of the "Button" object of chart.                  |
+//|          Derives from class CChartObjectEdit.                    |
+//+------------------------------------------------------------------+
+class CChartObjectButton : public CChartObjectEdit
+  {
+public:
+                     CChartObjectButton(void);
+                    ~CChartObjectButton(void);
+   //--- methods of access to properties of the object
+   bool              State(void) const;
+   bool              State(const bool state) const;
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_BUTTON); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectButton::CChartObjectButton(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectButton::~CChartObjectButton(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Get state                                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectButton::State(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectGetInteger(m_chart_id,m_name,OBJPROP_STATE));
+  }
+//+------------------------------------------------------------------+
+//| Set state                                                        |
+//+------------------------------------------------------------------+
+bool CChartObjectButton::State(const bool state) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_STATE,state));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectButton::Save(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectEdit::Save(file_handle))
+      return(false);
+//--- write state
+   if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_STATE))!=sizeof(long))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectButton::Load(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectEdit::Load(file_handle))
+      return(false);
+//--- read state
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_STATE,FileReadLong(file_handle)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CChartObjectRectLabel.                                     |
+//| Purpose: Class of the "Rectangle Label" object of chart.         |
+//|          Derives from class CChartObjectLabel.                   |
+//+------------------------------------------------------------------+
+class CChartObjectRectLabel : public CChartObjectLabel
+  {
+public:
+                     CChartObjectRectLabel(void);
+                    ~CChartObjectRectLabel(void);
+   //--- methods of access to properties of the object
+   bool              X_Size(const int X) const;
+   bool              Y_Size(const int Y) const;
+   color             BackColor(void) const;
+   bool              BackColor(const color new_color) const;
+   ENUM_BORDER_TYPE  BorderType(void) const;
+   bool              BorderType(const ENUM_BORDER_TYPE flag) const;
+   //--- change of angle is blocked
+   bool              Angle(const double angle) const { return(false); }
+   //--- method of creating the object
+   bool              Create(long chart_id,const string name,const int window,const int X,const int Y,const int sizeX,const int sizeY);
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(OBJ_RECTANGLE_LABEL); }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChartObjectRectLabel::CChartObjectRectLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChartObjectRectLabel::~CChartObjectRectLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create object "Ractangle Label"                                  |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::Create(long chart_id,const string name,const int window,const int X,const int Y,const int sizeX,const int sizeY)
+  {
+   if(!ObjectCreate(chart_id,name,(ENUM_OBJECT)Type(),window,0,0,0))
+      return(false);
+   if(!Attach(chart_id,name,window,1))
+      return(false);
+   if(!X_Distance(X) || !Y_Distance(Y))
+      return(false);
+   if(!X_Size(sizeX) || !Y_Size(sizeY))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set X-size                                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::X_Size(const int X) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_XSIZE,X));
+  }
+//+------------------------------------------------------------------+
+//| Set Y-size                                                       |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::Y_Size(const int Y) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_YSIZE,Y));
+  }
+//+------------------------------------------------------------------+
+//| Get background color                                             |
+//+------------------------------------------------------------------+
+color CChartObjectRectLabel::BackColor(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ObjectGetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR));
+  }
+//+------------------------------------------------------------------+
+//| Set background color                                             |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::BackColor(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get the "Border type" property                                   |
+//+------------------------------------------------------------------+
+ENUM_BORDER_TYPE CChartObjectRectLabel::BorderType(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return((ENUM_BORDER_TYPE)ObjectGetInteger(m_chart_id,m_name,OBJPROP_BORDER_TYPE));
+  }
+//+------------------------------------------------------------------+
+//| Set the "Border type" property                                   |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::BorderType(const ENUM_BORDER_TYPE type) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ObjectSetInteger(m_chart_id,m_name,OBJPROP_BORDER_TYPE,type));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of object to file                             |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::Save(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write
+   if(!CChartObjectLabel::Save(file_handle))
+      return(false);
+//--- write value of the "X-size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_XSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Y-size" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_YSIZE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write background color
+   if(FileWriteLong(file_handle,ObjectGetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR))!=sizeof(long))
+      return(false);
+//--- write value of the "Border type" property
+   if(FileWriteInteger(file_handle,(int)ObjectGetInteger(m_chart_id,m_name,OBJPROP_BORDER_TYPE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of object from file                           |
+//+------------------------------------------------------------------+
+bool CChartObjectRectLabel::Load(const int file_handle)
+  {
+   string str;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read
+   if(!CChartObjectLabel::Load(file_handle))
+      return(false);
+//--- read value of the "X-size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_XSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Y-size" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_YSIZE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read background color
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_BGCOLOR,FileReadLong(file_handle)))
+      return(false);
+//--- read value of the "Border type" property
+   if(!ObjectSetInteger(m_chart_id,m_name,OBJPROP_BORDER_TYPE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Charts/Chart.mqh b/Include/Charts/Chart.mqh
new file mode 100644
index 0000000..35167c6
--- /dev/null
+++ b/Include/Charts/Chart.mqh
@@ -0,0 +1,1549 @@
+//+------------------------------------------------------------------+
+//|                                                       Chart.mqh  |
+//|                   Copyright 2009-2016, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Object.mqh>
+//+------------------------------------------------------------------+
+//| Class CChart.                                                    |
+//| Purpose: Class of the "Chart" object.                            |
+//|          Derives from class CObject.                             |
+//+------------------------------------------------------------------+
+class CChart : public CObject
+  {
+protected:
+   long              m_chart_id;           // chart identifier
+public:
+                     CChart(void);
+                    ~CChart(void);
+   //--- methods of access to protected data
+   long              ChartId(void) const { return(m_chart_id); }
+   //--- method of identifying the object
+   virtual int       Type(void) const { return(0x1111); }
+   //--- methods of access to properties of the chart
+   //--- common properties
+   ENUM_CHART_MODE   Mode(void) const;
+   bool              Mode(const ENUM_CHART_MODE mode) const;
+   bool              Foreground(void) const;
+   bool              Foreground(const bool foreground) const;
+   bool              Shift(void) const;
+   bool              Shift(const bool shift) const;
+   double            ShiftSize(void) const;
+   bool              ShiftSize(double shift) const;
+   bool              AutoScroll(void) const;
+   bool              AutoScroll(const bool auto_scroll) const;
+   int               Scale(void) const;
+   bool              Scale(int scale) const;
+   bool              ScaleFix(void) const;
+   bool              ScaleFix(const bool scale_fix) const;
+   bool              ScaleFix_11(void) const;
+   bool              ScaleFix_11(const bool scale_fix_11) const;
+   double            FixedMax(void) const;
+   bool              FixedMax(const double fixed_max) const;
+   double            FixedMin(void) const;
+   bool              FixedMin(const double fixed_min) const;
+   bool              ScalePPB(void) const;
+   bool              ScalePPB(const bool scale_ppb) const;
+   double            PointsPerBar(void) const;
+   bool              PointsPerBar(const double points_per_bar) const;
+   //--- show properties
+   bool              ShowOHLC(void) const;
+   bool              ShowOHLC(const bool show) const;
+   bool              ShowLineBid(void) const;
+   bool              ShowLineBid(const bool show) const;
+   bool              ShowLineAsk(void) const;
+   bool              ShowLineAsk(const bool show) const;
+   bool              ShowLastLine(void) const;
+   bool              ShowLastLine(const bool show) const;
+   bool              ShowPeriodSep(void) const;
+   bool              ShowPeriodSep(const bool show) const;
+   bool              ShowGrid(void) const;
+   bool              ShowGrid(const bool show) const;
+   ENUM_CHART_VOLUME_MODE ShowVolumes(void) const;
+   bool              ShowVolumes(const ENUM_CHART_VOLUME_MODE show) const;
+   bool              ShowObjectDescr(void) const;
+   bool              ShowObjectDescr(const bool show) const;
+   bool              ShowDateScale(const bool show) const;
+   bool              ShowPriceScale(const bool show) const;
+   //--- color properties
+   color             ColorBackground(void) const;
+   bool              ColorBackground(const color new_color) const;
+   color             ColorForeground(void) const;
+   bool              ColorForeground(const color new_color) const;
+   color             ColorGrid(void) const;
+   bool              ColorGrid(const color new_color) const;
+   color             ColorBarUp(void) const;
+   bool              ColorBarUp(const color new_color) const;
+   color             ColorBarDown(void) const;
+   bool              ColorBarDown(const color new_color) const;
+   color             ColorCandleBull(void) const;
+   bool              ColorCandleBull(const color new_color) const;
+   color             ColorCandleBear(void) const;
+   bool              ColorCandleBear(const color new_color) const;
+   color             ColorChartLine(void) const;
+   bool              ColorChartLine(const color new_color) const;
+   color             ColorVolumes(void) const;
+   bool              ColorVolumes(const color new_color) const;
+   color             ColorLineBid(void) const;
+   bool              ColorLineBid(const color new_color) const;
+   color             ColorLineAsk(void) const;
+   bool              ColorLineAsk(const color new_color) const;
+   color             ColorLineLast(void) const;
+   bool              ColorLineLast(const color new_color) const;
+   color             ColorStopLevels(void) const;
+   bool              ColorStopLevels(const color new_color) const;
+   //--- other properties
+   bool              BringToTop(void) const;
+   bool              EventObjectCreate(const bool flag=true) const;
+   bool              EventObjectDelete(const bool flag=true) const;
+   bool              EventMouseMove(const bool flag=true) const;
+   bool              MouseScroll(const bool flag=true) const;
+   //--- methods of access to READ ONLY properties of the chart
+   int               VisibleBars(void) const;
+   int               WindowsTotal(void) const;
+   bool              WindowIsVisible(const int num) const;
+   int               WindowHandle(void) const;
+   int               FirstVisibleBar(void) const;
+   int               WidthInBars(void) const;
+   int               WidthInPixels(void) const;
+   int               HeightInPixels(const int num) const;
+   int               SubwindowY(const int num) const;
+   double            PriceMin(const int num) const;
+   double            PriceMax(const int num) const;
+   bool              IsObject(void) const;
+   //--- methods of binding chart
+   void              Attach(void) { m_chart_id=ChartID(); }
+   void              Attach(const long chart) { m_chart_id=chart; }
+   void              FirstChart(void) { m_chart_id=ChartFirst(); }
+   void              NextChart(void) { m_chart_id=ChartNext(m_chart_id); }
+   long              Open(const string symbol_name,const ENUM_TIMEFRAMES timeframe);
+   void              Detach(void) { m_chart_id=-1;                    }
+   void              Close(void);
+   //--- navigation method
+   bool              Navigate(const ENUM_CHART_POSITION position,const int shift=0) const;
+   //--- methods of access to the API functions of MQL5
+   string            Symbol(void) const { return(ChartSymbol(m_chart_id)); }
+   ENUM_TIMEFRAMES   Period(void) const { return(ChartPeriod(m_chart_id)); }
+   void              Redraw(void) const { ChartRedraw(m_chart_id); }
+   long              GetInteger(const ENUM_CHART_PROPERTY_INTEGER prop_id,const int sub_window=0) const;
+   bool              GetInteger(const ENUM_CHART_PROPERTY_INTEGER prop_id,const int sub_window,long &value) const;
+   bool              SetInteger(const ENUM_CHART_PROPERTY_INTEGER prop_id,const long value) const;
+   double            GetDouble(const ENUM_CHART_PROPERTY_DOUBLE prop_id,const int sub_window=0) const;
+   bool              GetDouble(const ENUM_CHART_PROPERTY_DOUBLE prop_id,const int sub_window,double &value) const;
+   bool              SetDouble(const ENUM_CHART_PROPERTY_DOUBLE prop_id,const double value) const;
+   string            GetString(const ENUM_CHART_PROPERTY_STRING prop_id) const;
+   bool              GetString(const ENUM_CHART_PROPERTY_STRING prop_id,string &value) const;
+   bool              SetString(const ENUM_CHART_PROPERTY_STRING prop_id,const string value) const;
+   bool              SetSymbolPeriod(const string symbol,const ENUM_TIMEFRAMES period) const;
+   bool              ApplyTemplate(const string filename) const;
+   bool              ScreenShot(const string filename,const int width,const int height,
+                                const ENUM_ALIGN_MODE align_mode=ALIGN_RIGHT) const;
+   int               WindowOnDropped(void) const;
+   double            PriceOnDropped(void) const;
+   datetime          TimeOnDropped(void) const;
+   int               XOnDropped(void) const;
+   int               YOnDropped(void) const;
+   //--- methods for working with indicators
+   bool              IndicatorAdd(const int subwin,const int handle) const;
+   bool              IndicatorDelete(const int subwin,const string name) const;
+   int               IndicatorsTotal(const int subwin) const;
+   string            IndicatorName(const int subwin,const int index) const;
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CChart::CChart(void) : m_chart_id(-1)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CChart::~CChart(void)
+  {
+   if(m_chart_id!=-1)
+      Close();
+  }
+//+------------------------------------------------------------------+
+//| Opening chart                                                    |
+//+------------------------------------------------------------------+
+long CChart::Open(const string symbol_name,const ENUM_TIMEFRAMES timeframe)
+  {
+   m_chart_id=ChartOpen(symbol_name,timeframe);
+   if(m_chart_id==0)
+      m_chart_id=-1;
+   return(m_chart_id);
+  }
+//+------------------------------------------------------------------+
+//| Get the type of representation of chart                          |
+//+------------------------------------------------------------------+
+ENUM_CHART_MODE CChart::Mode(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_CHART_MODE)ChartGetInteger(m_chart_id,CHART_MODE));
+  }
+//+------------------------------------------------------------------+
+//| Set the type of representation chart                             |
+//+------------------------------------------------------------------+
+bool CChart::Mode(const ENUM_CHART_MODE mode) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_MODE,mode));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Foreground" property                           |
+//+------------------------------------------------------------------+
+bool CChart::Foreground(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_FOREGROUND));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "Foreground" property                           |
+//+------------------------------------------------------------------+
+bool CChart::Foreground(const bool foreground) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_FOREGROUND,foreground));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Shift" property                                |
+//+------------------------------------------------------------------+
+bool CChart::Shift(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHIFT));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "Shift"property                                 |
+//+------------------------------------------------------------------+
+bool CChart::Shift(const bool shift) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHIFT,shift));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShiftSize" property                            |
+//+------------------------------------------------------------------+
+double CChart::ShiftSize(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(DBL_MAX);
+//--- result
+   return(ChartGetDouble(m_chart_id,CHART_SHIFT_SIZE));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShiftSize" property                            |
+//+------------------------------------------------------------------+
+bool CChart::ShiftSize(double shift) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(shift<10)
+      shift=10;
+   if(shift>50)
+      shift=50;
+//--- result
+   return(ChartSetDouble(m_chart_id,CHART_SHIFT_SIZE,shift));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "AutoScroll" property                           |
+//+------------------------------------------------------------------+
+bool CChart::AutoScroll(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_AUTOSCROLL));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "AutoScroll" property                           |
+//+------------------------------------------------------------------+
+bool CChart::AutoScroll(const bool auto_scroll) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_AUTOSCROLL,auto_scroll));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "Scale" property                                |
+//+------------------------------------------------------------------+
+int CChart::Scale(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_SCALE));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "Scale" property                                |
+//+------------------------------------------------------------------+
+bool CChart::Scale(int shift) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+   if(shift<0)
+      shift=0;
+   if(shift>32)
+      shift=32;
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SCALE,shift));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ScaleFix" property                             |
+//+------------------------------------------------------------------+
+bool CChart::ScaleFix(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SCALEFIX));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ScaleFix" property                             |
+//+------------------------------------------------------------------+
+bool CChart::ScaleFix(const bool scale_fix) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SCALEFIX,scale_fix));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ScaleFix_11" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ScaleFix_11(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SCALEFIX_11));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ScaleFix_11" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ScaleFix_11(const bool scale_fix_11) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SCALEFIX_11,scale_fix_11));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "FixedMax" property                             |
+//+------------------------------------------------------------------+
+double CChart::FixedMax(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartGetDouble(m_chart_id,CHART_FIXED_MAX));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "FixedMax" property                             |
+//+------------------------------------------------------------------+
+bool CChart::FixedMax(const double fixed_max) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetDouble(m_chart_id,CHART_FIXED_MAX,fixed_max));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "FixedMin" property                             |
+//+------------------------------------------------------------------+
+double CChart::FixedMin(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartGetDouble(m_chart_id,CHART_FIXED_MIN));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "FixedMin" property                             |
+//+------------------------------------------------------------------+
+bool CChart::FixedMin(const double fixed_min) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetDouble(m_chart_id,CHART_FIXED_MIN,fixed_min));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ScalePointsPerBar" property                    |
+//+------------------------------------------------------------------+
+bool CChart::ScalePPB(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SCALE_PT_PER_BAR));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ScalePointsPerBar" property                    |
+//+------------------------------------------------------------------+
+bool CChart::ScalePPB(const bool scale_ppb) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SCALE_PT_PER_BAR,scale_ppb));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "PointsPerBar" property                         |
+//+------------------------------------------------------------------+
+double CChart::PointsPerBar(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartGetDouble(m_chart_id,CHART_POINTS_PER_BAR));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "PointsPerBar" property                         |
+//+------------------------------------------------------------------+
+bool CChart::PointsPerBar(const double points_per_bar) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetDouble(m_chart_id,CHART_POINTS_PER_BAR,points_per_bar));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowOHLC" property                             |
+//+------------------------------------------------------------------+
+bool CChart::ShowOHLC(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_OHLC));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowOHLC" property                             |
+//+------------------------------------------------------------------+
+bool CChart::ShowOHLC(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_OHLC,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowLineBid" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ShowLineBid(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_BID_LINE));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowLineBid" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ShowLineBid(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_BID_LINE,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowLineAsk" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ShowLineAsk(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_ASK_LINE));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowLineAsk" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ShowLineAsk(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_ASK_LINE,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowLastLine" property                         |
+//+------------------------------------------------------------------+
+bool CChart::ShowLastLine(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_LAST_LINE));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowLastLine" property                         |
+//+------------------------------------------------------------------+
+bool CChart::ShowLastLine(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_LAST_LINE,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowPeriodSep" property                        |
+//+------------------------------------------------------------------+
+bool CChart::ShowPeriodSep(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_PERIOD_SEP));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowPeriodSep" property                        |
+//+------------------------------------------------------------------+
+bool CChart::ShowPeriodSep(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_PERIOD_SEP,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowGrid" property                             |
+//+------------------------------------------------------------------+
+bool CChart::ShowGrid(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_GRID));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowGrid" property                             |
+//+------------------------------------------------------------------+
+bool CChart::ShowGrid(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_GRID,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowVolumes" property                          |
+//+------------------------------------------------------------------+
+ENUM_CHART_VOLUME_MODE CChart::ShowVolumes(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(WRONG_VALUE);
+//--- result
+   return((ENUM_CHART_VOLUME_MODE)ChartGetInteger(m_chart_id,CHART_SHOW_VOLUMES));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowVolumes" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ShowVolumes(const ENUM_CHART_VOLUME_MODE show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_VOLUMES,show));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "ShowObjectDescr" property                      |
+//+------------------------------------------------------------------+
+bool CChart::ShowObjectDescr(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_SHOW_OBJECT_DESCR));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowObjectDescr" property                      |
+//+------------------------------------------------------------------+
+bool CChart::ShowObjectDescr(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_OBJECT_DESCR,show));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowDateScale" property                        |
+//+------------------------------------------------------------------+
+bool CChart::ShowDateScale(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_DATE_SCALE,show));
+  }
+//+------------------------------------------------------------------+
+//| Set value of the "ShowPriceScale" property                       |
+//+------------------------------------------------------------------+
+bool CChart::ShowPriceScale(const bool show) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_SHOW_PRICE_SCALE,show));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Background" property                     |
+//+------------------------------------------------------------------+
+color CChart::ColorBackground(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_BACKGROUND));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Background" property                     |
+//+------------------------------------------------------------------+
+bool CChart::ColorBackground(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_BACKGROUND,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Foreground" property                     |
+//+------------------------------------------------------------------+
+color CChart::ColorForeground(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_FOREGROUND));
+  }
+//+------------------------------------------------------------------+
+//| Set color value for the "Foreground" property                    |
+//+------------------------------------------------------------------+
+bool CChart::ColorForeground(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_FOREGROUND,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Grid" property                           |
+//+------------------------------------------------------------------+
+color CChart::ColorGrid(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_GRID));
+  }
+//+------------------------------------------------------------------+
+//| Set color value for the "Grid" property                          |
+//+------------------------------------------------------------------+
+bool CChart::ColorGrid(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_GRID,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Bar Up" property                         |
+//+------------------------------------------------------------------+
+color CChart::ColorBarUp(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_CHART_UP));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Bar Up" property                         |
+//+------------------------------------------------------------------+
+bool CChart::ColorBarUp(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_CHART_UP,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Bar Down" property                       |
+//+------------------------------------------------------------------+
+color CChart::ColorBarDown(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_CHART_DOWN));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Bar Down" property                       |
+//+------------------------------------------------------------------+
+bool CChart::ColorBarDown(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_CHART_DOWN,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Candle Bull" property                    |
+//+------------------------------------------------------------------+
+color CChart::ColorCandleBull(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_CANDLE_BULL));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Candle Bull" property                    |
+//+------------------------------------------------------------------+
+bool CChart::ColorCandleBull(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_CANDLE_BULL,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Candle Bear" property                    |
+//+------------------------------------------------------------------+
+color CChart::ColorCandleBear(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_CANDLE_BEAR));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Candle Bear" property                    |
+//+------------------------------------------------------------------+
+bool CChart::ColorCandleBear(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_CANDLE_BEAR,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Chart Line" property                     |
+//+------------------------------------------------------------------+
+color CChart::ColorChartLine(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_CHART_LINE));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Chart Line" property                     |
+//+------------------------------------------------------------------+
+bool CChart::ColorChartLine(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_CHART_LINE,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Volumes" property                        |
+//+------------------------------------------------------------------+
+color CChart::ColorVolumes(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_VOLUME));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Volumes" property                        |
+//+------------------------------------------------------------------+
+bool CChart::ColorVolumes(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_VOLUME,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Line Bid" property                       |
+//+------------------------------------------------------------------+
+color CChart::ColorLineBid(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_BID));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Line Bid" property                       |
+//+------------------------------------------------------------------+
+bool CChart::ColorLineBid(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_BID,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Line Ask" property                       |
+//+------------------------------------------------------------------+
+color CChart::ColorLineAsk(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_ASK));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Line Ask" property                       |
+//+------------------------------------------------------------------+
+bool CChart::ColorLineAsk(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_ASK,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Line Last" property                      |
+//+------------------------------------------------------------------+
+color CChart::ColorLineLast(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_LAST));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Line Last" property                      |
+//+------------------------------------------------------------------+
+bool CChart::ColorLineLast(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_LAST,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Get color value of the "Stop Levels" property                    |
+//+------------------------------------------------------------------+
+color CChart::ColorStopLevels(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(CLR_NONE);
+//--- result
+   return((color)ChartGetInteger(m_chart_id,CHART_COLOR_STOP_LEVEL));
+  }
+//+------------------------------------------------------------------+
+//| Set color value of the "Stop Levels" property                    |
+//+------------------------------------------------------------------+
+bool CChart::ColorStopLevels(const color new_color) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_COLOR_STOP_LEVEL,new_color));
+  }
+//+------------------------------------------------------------------+
+//| Shows chart always on top                                        |
+//+------------------------------------------------------------------+
+bool CChart::BringToTop(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_BRING_TO_TOP,true));
+  }
+//+------------------------------------------------------------------+
+//| Sets flag to generate event of creating objects                  |
+//+------------------------------------------------------------------+
+bool CChart::EventObjectCreate(const bool flag) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_EVENT_OBJECT_CREATE,flag));
+  }
+//+------------------------------------------------------------------+
+//| Sets flag to generate event of deleting objects                  |
+//+------------------------------------------------------------------+
+bool CChart::EventObjectDelete(const bool flag) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_EVENT_OBJECT_DELETE,flag));
+  }
+//+------------------------------------------------------------------+
+//| Sets flag to generate event of moving mouse cursor               |
+//+------------------------------------------------------------------+
+bool CChart::EventMouseMove(const bool flag) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_EVENT_MOUSE_MOVE,flag));
+  }
+//+------------------------------------------------------------------+
+//| Sets flag to mouse scrolling                                     |
+//+------------------------------------------------------------------+
+bool CChart::MouseScroll(const bool flag) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetInteger(m_chart_id,CHART_MOUSE_SCROLL,flag));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "VisibleBars" property                          |
+//+------------------------------------------------------------------+
+int CChart::VisibleBars(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_WIDTH_IN_BARS));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "WindowsTotal" property                         |
+//+------------------------------------------------------------------+
+int CChart::WindowsTotal(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_WINDOWS_TOTAL));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "WindowIsVisible" property                      |
+//+------------------------------------------------------------------+
+bool CChart::WindowIsVisible(const int num) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,CHART_WINDOW_IS_VISIBLE,num));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "WindowHandle" property                         |
+//+------------------------------------------------------------------+
+int CChart::WindowHandle(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(INVALID_HANDLE);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_WINDOW_HANDLE));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "FirstVisibleBar" property                      |
+//+------------------------------------------------------------------+
+int CChart::FirstVisibleBar(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(-1);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_FIRST_VISIBLE_BAR));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "WidthInBars" property                          |
+//+------------------------------------------------------------------+
+int CChart::WidthInBars(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_WIDTH_IN_BARS));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "WidthInPixels" property                        |
+//+------------------------------------------------------------------+
+int CChart::WidthInPixels(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_WIDTH_IN_PIXELS));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "HeightInPixels" property                       |
+//+------------------------------------------------------------------+
+int CChart::HeightInPixels(const int num) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_HEIGHT_IN_PIXELS,num));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "WindowYDistance" property                      |
+//+------------------------------------------------------------------+
+int CChart::SubwindowY(const int num) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return((int)ChartGetInteger(m_chart_id,CHART_WINDOW_YDISTANCE,num));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "PriceMin" property                             |
+//+------------------------------------------------------------------+
+double CChart::PriceMin(const int num) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartGetDouble(m_chart_id,CHART_PRICE_MIN,num));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "PriceMax" property                             |
+//+------------------------------------------------------------------+
+double CChart::PriceMax(const int num) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartGetDouble(m_chart_id,CHART_PRICE_MAX,num));
+  }
+//+------------------------------------------------------------------+
+//| Get value of the "IsObject" property                             |
+//+------------------------------------------------------------------+
+bool CChart::IsObject(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return((bool)ChartGetInteger(m_chart_id,CHART_IS_OBJECT));
+  }
+//+------------------------------------------------------------------+
+//| Chart close                                                      |
+//+------------------------------------------------------------------+
+void CChart::Close(void)
+  {
+   if(m_chart_id!=-1)
+     {
+      ChartClose(m_chart_id);
+      m_chart_id=-1;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Chart navigation                                                 |
+//+------------------------------------------------------------------+
+bool CChart::Navigate(const ENUM_CHART_POSITION position,const int shift) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartNavigate(m_chart_id,position,shift));
+  }
+//+------------------------------------------------------------------+
+//| Access functions long ChartGetInteger(...)                       |
+//+------------------------------------------------------------------+
+long CChart::GetInteger(const ENUM_CHART_PROPERTY_INTEGER prop_id,const int subwindow) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ChartGetInteger(m_chart_id,prop_id,subwindow));
+  }
+//+------------------------------------------------------------------+
+//| Access function bool ChartGetInteger(...)                        |
+//+------------------------------------------------------------------+
+bool CChart::GetInteger(const ENUM_CHART_PROPERTY_INTEGER prop_id,const int subwindow,long &value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetInteger(m_chart_id,prop_id,subwindow,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function  ChartSetInteger(...)                            |
+//+------------------------------------------------------------------+
+bool CChart::SetInteger(const ENUM_CHART_PROPERTY_INTEGER prop_id,const long value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//---
+   return(ChartSetInteger(m_chart_id,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function double ChartGetDouble(...)                       |
+//+------------------------------------------------------------------+
+double CChart::GetDouble(const ENUM_CHART_PROPERTY_DOUBLE prop_id,const int subwindow) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartGetDouble(m_chart_id,prop_id,subwindow));
+  }
+//+------------------------------------------------------------------+
+//| Access function bool ChartGetDouble(...)                         |
+//+------------------------------------------------------------------+
+bool CChart::GetDouble(const ENUM_CHART_PROPERTY_DOUBLE prop_id,const int subwindow,double &value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ChartGetDouble(m_chart_id,prop_id,subwindow,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ChartSetDouble(...)                              |
+//+------------------------------------------------------------------+
+bool CChart::SetDouble(const ENUM_CHART_PROPERTY_DOUBLE prop_id,const double value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetDouble(m_chart_id,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function string ChartGetString(...)                       |
+//+------------------------------------------------------------------+
+string CChart::GetString(const ENUM_CHART_PROPERTY_STRING prop_id) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ChartGetString(m_chart_id,prop_id));
+  }
+//+------------------------------------------------------------------+
+//| Access functions bool ChartGetString(...)                        |
+//+------------------------------------------------------------------+
+bool CChart::GetString(const ENUM_CHART_PROPERTY_STRING prop_id,string &value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartGetString(m_chart_id,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ChartSetString(...)                              |
+//+------------------------------------------------------------------+
+bool CChart::SetString(const ENUM_CHART_PROPERTY_STRING prop_id,const string value) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetString(m_chart_id,prop_id,value));
+  }
+//+------------------------------------------------------------------+
+//| Access function ChartSetSymbolPeriod(...)                        |
+//+------------------------------------------------------------------+
+bool CChart::SetSymbolPeriod(const string symbol,const ENUM_TIMEFRAMES period) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartSetSymbolPeriod(m_chart_id,symbol,period));
+  }
+//+------------------------------------------------------------------+
+//| Access function ChartApplyTemplate(...)                          |
+//+------------------------------------------------------------------+
+bool CChart::ApplyTemplate(const string filename) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartApplyTemplate(m_chart_id,filename));
+  }
+//+------------------------------------------------------------------+
+//| Access function ChartScreenShot(...)                             |
+//+------------------------------------------------------------------+
+bool CChart::ScreenShot(const string filename,const int width,const int height,const ENUM_ALIGN_MODE align_mode) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartScreenShot(m_chart_id,filename,width,height,align_mode));
+  }
+//+------------------------------------------------------------------+
+//| Access function WindowOnDropped()                                |
+//+------------------------------------------------------------------+
+int CChart::WindowOnDropped(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ChartWindowOnDropped());
+  }
+//+------------------------------------------------------------------+
+//| Access function PriceOnDropped()                                 |
+//+------------------------------------------------------------------+
+double CChart::PriceOnDropped(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(EMPTY_VALUE);
+//--- result
+   return(ChartPriceOnDropped());
+  }
+//+------------------------------------------------------------------+
+//| Access function TimeOnDropped()                                  |
+//+------------------------------------------------------------------+
+datetime CChart::TimeOnDropped(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartTimeOnDropped());
+  }
+//+------------------------------------------------------------------+
+//| Access functions XOnDropped()                                    |
+//+------------------------------------------------------------------+
+int CChart::XOnDropped(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ChartXOnDropped());
+  }
+//+------------------------------------------------------------------+
+//| Access functions YOnDropped()                                    |
+//+------------------------------------------------------------------+
+int CChart::YOnDropped(void) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ChartYOnDropped());
+  }
+//+------------------------------------------------------------------+
+//| Adds indicator to chart                                          |
+//+------------------------------------------------------------------+
+bool CChart::IndicatorAdd(const int subwin,const int handle) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartIndicatorAdd(m_chart_id,subwin,handle));
+  }
+//+------------------------------------------------------------------+
+//| Deletes indicator from chart                                     |
+//+------------------------------------------------------------------+
+bool CChart::IndicatorDelete(const int subwin,const string name) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(false);
+//--- result
+   return(ChartIndicatorDelete(m_chart_id,subwin,name));
+  }
+//+------------------------------------------------------------------+
+//| Gets number of indicators in chart subwindow                     |
+//+------------------------------------------------------------------+
+int CChart::IndicatorsTotal(const int subwin) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return(0);
+//--- result
+   return(ChartIndicatorsTotal(m_chart_id,subwin));
+  }
+//+------------------------------------------------------------------+
+//| Gets short name of indicator                                     |
+//+------------------------------------------------------------------+
+string CChart::IndicatorName(const int subwin,const int index) const
+  {
+//--- check
+   if(m_chart_id==-1)
+      return("");
+//--- result
+   return(ChartIndicatorName(m_chart_id,subwin,index));
+  }
+//+------------------------------------------------------------------+
+//| Writing parameters of chart to file                              |
+//+------------------------------------------------------------------+
+bool CChart::Save(const int file_handle)
+  {
+   string work_str;
+   int    work_int;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- write start marker - 0xFFFFFFFFFFFFFFFF
+   if(FileWriteLong(file_handle,-1)!=sizeof(long))
+      return(false);
+//--- write chart type
+   if(FileWriteInteger(file_handle,Type(),INT_VALUE)!=INT_VALUE)
+      return(false);
+//--- write chart symbol
+   work_str=Symbol();
+   work_int=StringLen(work_str);
+   if(FileWriteInteger(file_handle,work_int,INT_VALUE)!=INT_VALUE)
+      return(false);
+   if(work_int!=0) if(FileWriteString(file_handle,work_str,work_int)!=work_int)
+      return(false);
+//--- write period of chart
+   if(FileWriteInteger(file_handle,Period(),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Mode" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_MODE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "Foreground" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_FOREGROUND),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "Shift" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHIFT),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShiftSize" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHIFT),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "AutoScroll" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_AUTOSCROLL),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "Scale" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SCALE),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "ScaleFix" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SCALEFIX),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ScaleFix_11" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SCALEFIX_11),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "FixedMax" property
+   if(FileWriteDouble(file_handle,ChartGetDouble(m_chart_id,CHART_FIXED_MAX))!=sizeof(double))
+      return(false);
+//--- write value of the "FixedMin" property
+   if(FileWriteDouble(file_handle,ChartGetDouble(m_chart_id,CHART_FIXED_MIN))!=sizeof(double))
+      return(false);
+//--- write the "ScalePPB" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SCALE_PT_PER_BAR),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "PointsPerBar" property
+   if(FileWriteDouble(file_handle,ChartGetDouble(m_chart_id,CHART_POINTS_PER_BAR))!=sizeof(double))
+      return(false);
+//--- write value of the "ShowOHLC" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_OHLC),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShowLineBid" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_BID_LINE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShowLineAsk" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_ASK_LINE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShowLastLine" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_LAST_LINE),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShowPeriodSep" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_PERIOD_SEP),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShowGrid" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_GRID),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- write value of the "ShowVolumes" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_VOLUMES),INT_VALUE)!=sizeof(int))
+      return(false);
+//--- write value of the "ShowObjectDescr" property
+   if(FileWriteInteger(file_handle,(int)ChartGetInteger(m_chart_id,CHART_SHOW_OBJECT_DESCR),CHAR_VALUE)!=sizeof(char))
+      return(false);
+//--- successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Reading parameters of chart from file                            |
+//+------------------------------------------------------------------+
+bool CChart::Load(const int file_handle)
+  {
+   bool   resutl=true;
+   string work_str;
+   int    work_int;
+//--- check
+   if(file_handle==INVALID_HANDLE || m_chart_id==-1)
+      return(false);
+//--- read and checking start marker - 0xFFFFFFFFFFFFFFFF
+   if(FileReadLong(file_handle)!=-1) return(false);
+//--- read and checking chart type
+   if(FileReadInteger(file_handle,INT_VALUE)!=Type()) return(false);
+//--- read chart symbol
+   work_int=FileReadInteger(file_handle);
+   if(work_int!=0) work_str=FileReadString(file_handle,work_int);
+   else            work_str="";
+//--- read chart period
+   work_int=FileReadInteger(file_handle);
+   SetSymbolPeriod(work_str,(ENUM_TIMEFRAMES)work_int);
+//--- read value of the "Mode" property
+   if(!ChartSetInteger(m_chart_id,CHART_MODE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "Foreground" property
+   if(!ChartSetInteger(m_chart_id,CHART_FOREGROUND,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "Shift" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHIFT,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShiftSize" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHIFT,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "AutoScroll" property
+   if(!ChartSetInteger(m_chart_id,CHART_AUTOSCROLL,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "Scale" property
+   if(!ChartSetInteger(m_chart_id,CHART_SCALE,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "ScaleFix" property
+   if(!ChartSetInteger(m_chart_id,CHART_SCALEFIX,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ScaleFix_11" property
+   if(!ChartSetInteger(m_chart_id,CHART_SCALEFIX_11,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "FixedMax" property
+   if(!ChartSetDouble(m_chart_id,CHART_FIXED_MAX,FileReadDatetime(file_handle)))
+      return(false);
+//--- read value of the "FixedMin" property
+   if(!ChartSetDouble(m_chart_id,CHART_FIXED_MIN,FileReadDatetime(file_handle)))
+      return(false);
+//--- read value of the "ScalePPB" property
+   if(!ChartSetInteger(m_chart_id,CHART_SCALE_PT_PER_BAR,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "PointsPerBar" property
+   if(!ChartSetDouble(m_chart_id,CHART_POINTS_PER_BAR,FileReadDatetime(file_handle)))
+      return(false);
+//--- read value of the "ShowOHLC" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_OHLC,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShowLineBid" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_BID_LINE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShowLineAsk" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_ASK_LINE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShowLastLine" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_LAST_LINE,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShowPeriodSep" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_PERIOD_SEP,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShowGrid" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_GRID,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- read value of the "ShowVolumes" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_VOLUMES,FileReadInteger(file_handle,INT_VALUE)))
+      return(false);
+//--- read value of the "ShowObjectDescr" property
+   if(!ChartSetInteger(m_chart_id,CHART_SHOW_OBJECT_DESCR,FileReadInteger(file_handle,CHAR_VALUE)))
+      return(false);
+//--- successful
+   return(resutl);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/BmpButton.mqh b/Include/Controls/BmpButton.mqh
new file mode 100644
index 0000000..080541d
--- /dev/null
+++ b/Include/Controls/BmpButton.mqh
@@ -0,0 +1,268 @@
+//+------------------------------------------------------------------+
+//|                                                    BmpButton.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndObj.mqh"
+#include <ChartObjects\ChartObjectsBmpControls.mqh>
+//+------------------------------------------------------------------+
+//| Class CBmpButton                                                 |
+//| Usage: control that is displayed by                              |
+//|             the CChartObjectBmpLabel object                      |
+//+------------------------------------------------------------------+
+class CBmpButton : public CWndObj
+  {
+private:
+   CChartObjectBmpLabel m_button;           // chart object
+   //--- parameters of the chart object
+   int               m_border;              // border width
+   string            m_bmp_off_name;        // name of BMP file for the "OFF" state (default state)
+   string            m_bmp_on_name;         // name of BMP file for the "ON" state
+   string            m_bmp_passive_name;
+   string            m_bmp_active_name;
+
+public:
+                     CBmpButton(void);
+                    ~CBmpButton(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- parameters of the chart object
+   int               Border(void)          const { return(m_border);                   }
+   bool              Border(const int value);
+   bool              BmpNames(const string off="",const string on="");
+   string            BmpOffName(void)      const { return(m_bmp_off_name);             }
+   bool              BmpOffName(const string name);
+   string            BmpOnName(void)       const { return(m_bmp_on_name);              }
+   bool              BmpOnName(const string name);
+   string            BmpPassiveName(void)  const { return(m_bmp_passive_name);         }
+   bool              BmpPassiveName(const string name);
+   string            BmpActiveName(void)   const { return(m_bmp_active_name);          }
+   bool              BmpActiveName(const string name);
+   //--- state
+   bool              Pressed(void)         const { return(m_button.State());           }
+   bool              Pressed(const bool pressed) { return(m_button.State(pressed));    }
+   //--- properties
+   bool              Locking(void)         const { return(IS_CAN_LOCK);                }
+   void              Locking(const bool locking);
+
+protected:
+   //--- handlers of object settings
+   virtual bool      OnSetZOrder(void)           { return(m_button.Z_Order(m_zorder)); }
+   //--- internal event handlers
+   virtual bool      OnCreate(void);
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnMove(void);
+   virtual bool      OnChange(void);
+   //--- íîâûå îáðàáîò÷èêè
+   virtual bool      OnActivate(void);
+   virtual bool      OnDeactivate(void);
+   virtual bool      OnMouseDown(void);
+   virtual bool      OnMouseUp(void);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CBmpButton::CBmpButton(void) : m_border(0),
+                               m_bmp_off_name(NULL),
+                               m_bmp_on_name(NULL),
+                               m_bmp_passive_name(NULL),
+                               m_bmp_active_name(NULL)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CBmpButton::~CBmpButton(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CBmpButton::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndObj::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create the chart object
+   if(!m_button.Create(chart,name,subwin,x1,y1))
+      return(false);
+//--- call the settings handler
+   return(OnChange());
+  }
+//+------------------------------------------------------------------+
+//| Set border width                                                 |
+//+------------------------------------------------------------------+
+bool CBmpButton::Border(const int value)
+  {
+//--- save new value of parameter
+   m_border=value;
+//--- set up the chart object
+   return(m_button.Width(value));
+  }
+//+------------------------------------------------------------------+
+//| Set two images at once                                           |
+//+------------------------------------------------------------------+
+bool CBmpButton::BmpNames(const string off,const string on)
+  {
+//--- save new values of parameters
+   m_bmp_off_name=off;
+   m_bmp_on_name =on;
+//--- set up the chart object
+   if(!m_button.BmpFileOff(off))
+      return(false);
+   if(!m_button.BmpFileOn(on))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set image for the "OFF" state                                    |
+//+------------------------------------------------------------------+
+bool CBmpButton::BmpOffName(const string name)
+  {
+//--- save new value of parameter
+   m_bmp_off_name=name;
+//--- set up the chart object
+   if(!m_button.BmpFileOff(name))
+      return(false);
+//--- set size by image dimensions
+   Width(m_button.X_Size());
+   Height(m_button.Y_Size());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set image for the "ON" state                                     |
+//+------------------------------------------------------------------+
+bool CBmpButton::BmpOnName(const string name)
+  {
+//--- save new value of parameter
+   m_bmp_on_name=name;
+//--- set up the chart object
+   if(!m_button.BmpFileOn(name))
+      return(false);
+//--- set size by image dimensions
+   Width(m_button.X_Size());
+   Height(m_button.Y_Size());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set image for the "OFF" state (passive)                          |
+//+------------------------------------------------------------------+
+bool CBmpButton::BmpPassiveName(const string name)
+  {
+//--- save new value of parameter
+   m_bmp_passive_name=name;
+//--- set up the chart object
+   if(!IS_ACTIVE)
+      return(BmpOffName(name));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set image for the "OFF" state (active)                           |
+//+------------------------------------------------------------------+
+bool CBmpButton::BmpActiveName(const string name)
+  {
+//--- save new value of parameter
+   m_bmp_active_name=name;
+//--- set up the chart object
+   if(IS_ACTIVE)
+      return(BmpOffName(name));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Locking flag                                                     |
+//+------------------------------------------------------------------+
+void CBmpButton::Locking(const bool flag)
+  {
+   if(flag)
+      PropFlagsSet(WND_PROP_FLAG_CAN_LOCK);
+   else
+      PropFlagsReset(WND_PROP_FLAG_CAN_LOCK);
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart                                           |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnCreate(void)
+  {
+//--- create the chart object by previously set parameters
+   return(m_button.Create(m_chart_id,m_name,m_subwin,m_rect.left,m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Display object on chart                                          |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnShow(void)
+  {
+   return(m_button.Timeframes(OBJ_ALL_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Hide object from chart                                           |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnHide(void)
+  {
+   return(m_button.Timeframes(OBJ_NO_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the chart object                            |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnMove(void)
+  {
+//--- position the chart object
+   return(m_button.X_Distance(m_rect.left) && m_button.Y_Distance(m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Set up the chart object                                          |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnChange(void)
+  {
+//--- set up the chart object
+   return(m_button.Width(m_border) && m_button.BmpFileOff(m_bmp_off_name) && m_button.BmpFileOn(m_bmp_on_name));
+  }
+//+------------------------------------------------------------------+
+//| Handler of activating the group of controls                      |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnActivate(void)
+  {
+   if(m_bmp_active_name!=NULL)
+      BmpOffName(m_bmp_active_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of deactivating the group of controls                    |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnDeactivate(void)
+  {
+   if(m_bmp_passive_name!=NULL)
+      BmpOffName(m_bmp_passive_name);
+   if(!IS_CAN_LOCK)
+      Pressed(false);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the left mouse button                        |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnMouseDown(void)
+  {
+   if(!IS_CAN_LOCK)
+      Pressed(!Pressed());
+//--- call of the method of the parent class
+   return(CWnd::OnMouseDown());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the left mouse button                        |
+//+------------------------------------------------------------------+
+bool CBmpButton::OnMouseUp(void)
+  {
+//--- depress the button if it is not fixed
+   if(m_button.State() && !IS_CAN_LOCK)
+      m_button.State(false);
+//--- call of the method of the parent class
+   return(CWnd::OnMouseUp());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Button.mqh b/Include/Controls/Button.mqh
new file mode 100644
index 0000000..08d5a76
--- /dev/null
+++ b/Include/Controls/Button.mqh
@@ -0,0 +1,146 @@
+//+------------------------------------------------------------------+
+//|                                                       Button.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndObj.mqh"
+#include <ChartObjects\ChartObjectsTxtControls.mqh>
+//+------------------------------------------------------------------+
+//| Class CButton                                                    |
+//| Usage: control that is displayed by                              |
+//|             the CChartObjectButton object                        |
+//+------------------------------------------------------------------+
+class CButton : public CWndObj
+  {
+private:
+   CChartObjectButton m_button;             // chart object
+
+public:
+                     CButton(void);
+                    ~CButton(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- state
+   bool              Pressed(void)          const { return(m_button.State());                       }
+   bool              Pressed(const bool pressed)  { return(m_button.State(pressed));                }
+   //--- properties
+   bool              Locking(void)          const { return(IS_CAN_LOCK);                            }
+   void              Locking(const bool flag);
+
+protected:
+   //--- handlers of object settings
+   virtual bool      OnSetText(void)              { return(m_button.Description(m_text));           }
+   virtual bool      OnSetColor(void)             { return(m_button.Color(m_color));                }
+   virtual bool      OnSetColorBackground(void)   { return(m_button.BackColor(m_color_background)); }
+   virtual bool      OnSetColorBorder(void)       { return(m_button.BorderColor(m_color_border));   }
+   virtual bool      OnSetFont(void)              { return(m_button.Font(m_font));                  }
+   virtual bool      OnSetFontSize(void)          { return(m_button.FontSize(m_font_size));         }
+   //--- internal event handlers
+   virtual bool      OnCreate(void);
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnMove(void);
+   virtual bool      OnResize(void);
+   //--- íîâûå îáðàáîò÷èêè
+   virtual bool      OnMouseDown(void);
+   virtual bool      OnMouseUp(void);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CButton::CButton(void)
+  {
+   m_color           =CONTROLS_BUTTON_COLOR;
+   m_color_background=CONTROLS_BUTTON_COLOR_BG;
+   m_color_border    =CONTROLS_BUTTON_COLOR_BORDER;
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CButton::~CButton(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CButton::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndObj::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create the chart object
+   if(!m_button.Create(chart,name,subwin,x1,y1,Width(),Height()))
+      return(false);
+//--- call the settings handler
+   return(OnChange());
+  }
+//+------------------------------------------------------------------+
+//| Locking flag                                                     |
+//+------------------------------------------------------------------+
+void CButton::Locking(const bool flag)
+  {
+   if(flag)
+      PropFlagsSet(WND_PROP_FLAG_CAN_LOCK);
+   else
+      PropFlagsReset(WND_PROP_FLAG_CAN_LOCK);
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart                                           |
+//+------------------------------------------------------------------+
+bool CButton::OnCreate(void)
+  {
+//--- create the chart object by previously set parameters
+   return(m_button.Create(m_chart_id,m_name,m_subwin,m_rect.left,m_rect.top,m_rect.Width(),m_rect.Height()));
+  }
+//+------------------------------------------------------------------+
+//| Display object on chart                                          |
+//+------------------------------------------------------------------+
+bool CButton::OnShow(void)
+  {
+   return(m_button.Timeframes(OBJ_ALL_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Hide object from chart                                           |
+//+------------------------------------------------------------------+
+bool CButton::OnHide(void)
+  {
+   return(m_button.Timeframes(OBJ_NO_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the chart object                            |
+//+------------------------------------------------------------------+
+bool CButton::OnMove(void)
+  {
+//--- position the chart object
+   return(m_button.X_Distance(m_rect.left) && m_button.Y_Distance(m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Resize the chart object                                          |
+//+------------------------------------------------------------------+
+bool CButton::OnResize(void)
+  {
+//--- resize the chart object
+   return(m_button.X_Size(m_rect.Width()) && m_button.Y_Size(m_rect.Height()));
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the left mouse button                        |
+//+------------------------------------------------------------------+
+bool CButton::OnMouseDown(void)
+  {
+   if(!IS_CAN_LOCK)
+      Pressed(!Pressed());
+//--- call of the method of the parent class
+   return(CWnd::OnMouseDown());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the left mouse button                        |
+//+------------------------------------------------------------------+
+bool CButton::OnMouseUp(void)
+  {
+//--- depress the button if it is not fixed
+   if(m_button.State() && !IS_CAN_LOCK)
+      m_button.State(false);
+//--- call of the method of the parent class
+   return(CWnd::OnMouseUp());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/CheckBox.mqh b/Include/Controls/CheckBox.mqh
new file mode 100644
index 0000000..e8186fd
--- /dev/null
+++ b/Include/Controls/CheckBox.mqh
@@ -0,0 +1,183 @@
+//+------------------------------------------------------------------+
+//|                                                     CheckBox.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "BmpButton.mqh"
+#include "Edit.mqh"
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+#resource "res\\CheckBoxOn.bmp"
+#resource "res\\CheckBoxOff.bmp"
+//+------------------------------------------------------------------+
+//| Class CCheckBox                                                  |
+//| Usage: class that implements the "CheckBox" control              |
+//+------------------------------------------------------------------+
+class CCheckBox : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CBmpButton        m_button;              // button object
+   CEdit             m_label;               // label object
+   //--- data
+   int               m_value;               // value
+
+public:
+                     CCheckBox(void);
+                    ~CCheckBox(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- settings
+   string            Text(void)          const { return(m_label.Text());         }
+   bool              Text(const string value)  { return(m_label.Text(value));    }
+   color             Color(void)         const { return(m_label.Color());        }
+   bool              Color(const color value)  { return(m_label.Color(value));   }
+   //--- state
+   bool              Checked(void)       const { return(m_button.Pressed());     }
+   bool              Checked(const bool flag)  { return(m_button.Pressed(flag)); }
+   //--- data
+   int               Value(void)         const { return(m_value);                }
+   void              Value(const int value)    { m_value=value;                  }
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateButton(void);
+   virtual bool      CreateLabel(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickButton(void);
+   virtual bool      OnClickLabel(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CCheckBox)
+   ON_EVENT(ON_CLICK,m_button,OnClickButton)
+   ON_EVENT(ON_CLICK,m_label,OnClickLabel)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CCheckBox::CCheckBox(void) : m_value(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CCheckBox::~CCheckBox(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CCheckBox::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateButton())
+      return(false);
+   if(!CreateLabel())
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create button                                                    |
+//+------------------------------------------------------------------+
+bool CCheckBox::CreateButton(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_CHECK_BUTTON_X_OFF;
+   int y1=CONTROLS_CHECK_BUTTON_Y_OFF;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE-CONTROLS_BORDER_WIDTH;
+//--- create
+   if(!m_button.Create(m_chart_id,m_name+"Button",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_button.BmpNames("::res\\CheckBoxOff.bmp","::res\\CheckBoxOn.bmp"))
+      return(false);
+   if(!Add(m_button))
+      return(false);
+   m_button.Locking(true);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create label                                                     |
+//+------------------------------------------------------------------+
+bool CCheckBox::CreateLabel(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_CHECK_LABEL_X_OFF;
+   int y1=CONTROLS_CHECK_LABEL_Y_OFF;
+   int x2=Width();
+   int y2=Height();
+//--- create
+   if(!m_label.Create(m_chart_id,m_name+"Label",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_label.Text(m_name))
+      return(false);
+   if(!Add(m_label))
+      return(false);
+   m_label.ReadOnly(true);
+   m_label.ColorBackground(CONTROLS_CHECKGROUP_COLOR_BG);
+   m_label.ColorBorder(CONTROLS_CHECKGROUP_COLOR_BG);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CCheckBox::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   FileWriteInteger(file_handle,Checked());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CCheckBox::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   if(!FileIsEnding(file_handle))
+      Checked(FileReadInteger(file_handle));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on button                                       |
+//+------------------------------------------------------------------+
+bool CCheckBox::OnClickButton(void)
+  {
+//--- send the "changed state" event
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on label                                        |
+//+------------------------------------------------------------------+
+bool CCheckBox::OnClickLabel(void)
+  {
+//--- change button state
+   m_button.Pressed(!m_button.Pressed());
+//--- return the result of the button click handler
+   return(OnClickButton());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/CheckGroup.mqh b/Include/Controls/CheckGroup.mqh
new file mode 100644
index 0000000..6d5de34
--- /dev/null
+++ b/Include/Controls/CheckGroup.mqh
@@ -0,0 +1,377 @@
+//+------------------------------------------------------------------+
+//|                                                   CheckGroup.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndClient.mqh"
+#include "CheckBox.mqh"
+#include <Arrays\ArrayString.mqh>
+#include <Arrays\ArrayLong.mqh>
+#include <Arrays\ArrayInt.mqh>
+//+------------------------------------------------------------------+
+//| Class CCheckGroup                                                |
+//| Usage: view and edit group of flags                              |
+//+------------------------------------------------------------------+
+class CCheckGroup : public CWndClient
+  {
+private:
+   //--- dependent controls
+   CCheckBox         m_rows[];              // array of the row objects
+   //--- set up
+   int               m_offset;              // index of first visible row in array of rows
+   int               m_total_view;          // number of visible rows
+   int               m_item_height;         // height of visible row
+   //--- data
+   CArrayString      m_strings;             // array of rows
+   CArrayLong        m_values;              // array of values
+   CArrayInt         m_states;              // array of states
+   long              m_value;               // current value
+   int               m_current;             // index of current row in array of rows
+
+public:
+                     CCheckGroup(void);
+                    ~CCheckGroup(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   virtual void      Destroy(const int reason=0);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- fill
+   virtual bool      AddItem(const string item,const long value=0);
+   //--- data
+   long              Value(void) const;
+   bool              Value(const long value);
+   int               Check(const int idx) const;
+   bool              Check(const int idx,const int value);
+   //--- state
+   virtual bool      Show(void);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   bool              CreateButton(int index);
+   //--- handlers of the dependent controls events
+   virtual bool      OnVScrollShow(void);
+   virtual bool      OnVScrollHide(void);
+   virtual bool      OnScrollLineDown(void);
+   virtual bool      OnScrollLineUp(void);
+   virtual bool      OnChangeItem(const int row_index);
+   //--- redraw
+   bool              Redraw(void);
+   bool              RowState(const int index,const bool select);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CCheckGroup)
+   ON_INDEXED_EVENT(ON_CHANGE,m_rows,OnChangeItem)
+EVENT_MAP_END(CWndClient)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CCheckGroup::CCheckGroup(void) : m_offset(0),
+                                 m_total_view(0),
+                                 m_item_height(CONTROLS_LIST_ITEM_HEIGHT),
+                                 m_current(CONTROLS_INVALID_INDEX),
+                                 m_value(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CCheckGroup::~CCheckGroup(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- determine the number of visible rows
+   m_total_view=(y2-y1)/m_item_height;
+//--- check the number of visible rows
+   if(m_total_view<1)
+      return(false);
+//--- call method of the parent class
+   if(!CWndClient::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- set up
+   if(!m_background.ColorBackground(CONTROLS_CHECKGROUP_COLOR_BG))
+      return(false);
+   if(!m_background.ColorBorder(CONTROLS_CHECKGROUP_COLOR_BORDER))
+      return(false);
+//--- create dependent controls
+   ArrayResize(m_rows,m_total_view);
+   for(int i=0;i<m_total_view;i++)
+      if(!CreateButton(i))
+         return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Delete group of controls                                         |
+//+------------------------------------------------------------------+
+void CCheckGroup::Destroy(const int reason)
+  {
+//--- call of the method of the parent class
+   CWndClient::Destroy(reason);
+//--- clear items
+   m_strings.Clear();
+   m_values.Clear();
+   m_states.Clear();
+  }
+//+------------------------------------------------------------------+
+//| Create "row"                                                     |
+//+------------------------------------------------------------------+
+bool CCheckGroup::CreateButton(int index)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH+m_item_height*index;
+   int x2=Width()-CONTROLS_BORDER_WIDTH;
+   int y2=y1+m_item_height;
+//--- create
+   if(!m_rows[index].Create(m_chart_id,m_name+"Item"+IntegerToString(index),m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_rows[index].Text(""))
+      return(false);
+   if(!Add(m_rows[index]))
+      return(false);
+   m_rows[index].Hide();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Add item (row)                                                   |
+//+------------------------------------------------------------------+
+bool CCheckGroup::AddItem(const string item,const long value)
+  {
+//--- add
+   if(!m_strings.Add(item))
+      return(false);
+   if(!m_values.Add(value))
+      return(false);
+   if(!m_states.Add(0))
+      return(false);
+//--- number of items
+   int total=m_strings.Total();
+//--- exit if number of items does not exceed the size of visible area
+   if(total<m_total_view+1)
+     {
+      if(IS_VISIBLE && total!=0)
+         m_rows[total-1].Show();
+      return(Redraw());
+     }
+//--- if number of items exceeded the size of visible area
+   if(total==m_total_view+1)
+     {
+      //--- enable vertical scrollbar
+      if(!VScrolled(true))
+         return(false);
+      //--- and immediately make it invisible (if needed)
+      if(!IS_VISIBLE)
+         m_scroll_v.Visible(false);
+     }
+//--- set up the scrollbar
+   m_scroll_v.MaxPos(m_strings.Total()-m_total_view);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+long CCheckGroup::Value(void) const
+  {
+   return(m_value);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Value(const long value)
+  {
+   m_value=value;
+//---
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+int CCheckGroup::Check(const int idx) const
+  {
+//--- check
+   if(idx>=m_values.Total())
+      return(0);
+//---
+   return(m_states[idx]);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Check(const int idx,const int value)
+  {
+//--- check
+   if(idx>=m_values.Total())
+      return(false);
+//---
+   bool res=(m_states.Update(idx,value) && Redraw());
+//--- change value
+   if(res && idx<64)
+     {
+      if(m_rows[idx].Checked())
+         Value(m_value|m_values.At(idx));
+      else
+         Value(m_value&(~m_values.At(idx)));
+     }
+//---
+   return(res);
+  }
+//+------------------------------------------------------------------+
+//| Makes the group visible                                          |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Show(void)
+  {
+//--- call of the method of the parent class
+   if(!CWndClient::Show())
+      return(false);
+//--- loop by rows
+   int total=m_values.Total();
+   for(int i=total;i<m_total_view;i++)
+      m_rows[i].Hide();
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   FileWriteLong(file_handle,Value());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   if(!FileIsEnding(file_handle))
+      Value(FileReadLong(file_handle));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Redraw                                                           |
+//+------------------------------------------------------------------+
+bool CCheckGroup::Redraw(void)
+  {
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- copy text
+      if(!m_rows[i].Text(m_strings[i+m_offset]))
+         return(false);
+      //--- select
+      if(!RowState(i,m_states[i+m_offset]!=0))
+         return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Change state                                                     |
+//+------------------------------------------------------------------+
+bool CCheckGroup::RowState(const int index,const bool select)
+  {
+//--- check index
+   if(index<0 || index>=ArraySize(m_rows))
+      return(true);
+//--- change state
+   return(m_rows[index].Checked(select));
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Show vertical scrollbar" event                   |
+//+------------------------------------------------------------------+
+bool CCheckGroup::OnVScrollShow(void)
+  {
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- resize "rows" according to shown vertical scrollbar
+      m_rows[i].Width(Width()-(CONTROLS_SCROLL_SIZE+CONTROLS_BORDER_WIDTH));
+     }
+//--- check visibility
+   if(!IS_VISIBLE)
+     {
+      m_scroll_v.Visible(false);
+      return(true);
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Hide vertical scrollbar" event                   |
+//+------------------------------------------------------------------+
+bool CCheckGroup::OnVScrollHide(void)
+  {
+//--- check visibility
+   if(!IS_VISIBLE)
+      return(true);
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- resize "rows" according to hidden vertical scroll bar
+      m_rows[i].Width(Width()-CONTROLS_BORDER_WIDTH);
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Scroll up for one row" event                     |
+//+------------------------------------------------------------------+
+bool CCheckGroup::OnScrollLineUp(void)
+  {
+//--- get new offset
+   m_offset=m_scroll_v.CurrPos();
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Scroll down for one row" event                   |
+//+------------------------------------------------------------------+
+bool CCheckGroup::OnScrollLineDown(void)
+  {
+//--- get new offset
+   m_offset=m_scroll_v.CurrPos();
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of changing a "row" state                                |
+//+------------------------------------------------------------------+
+bool CCheckGroup::OnChangeItem(const int row_index)
+  {
+//--- change value
+   m_states.Update(row_index+m_offset,m_rows[row_index].Checked());
+   if(row_index+m_offset<64)
+     {
+      if(m_rows[row_index].Checked())
+         Value(m_value|m_values.At(row_index+m_offset));
+      else
+         Value(m_value&(~m_values.At(row_index+m_offset)));
+     }
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/ComboBox.mqh b/Include/Controls/ComboBox.mqh
new file mode 100644
index 0000000..9ced314
--- /dev/null
+++ b/Include/Controls/ComboBox.mqh
@@ -0,0 +1,324 @@
+//+------------------------------------------------------------------+
+//|                                                     ComboBox.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "Edit.mqh"
+#include "BmpButton.mqh"
+#include "ListView.mqh"
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+//--- Can not place the same file into resource twice
+#resource "res\\DropOn.bmp"                 // image file
+#resource "res\\DropOff.bmp"                // image file
+//+------------------------------------------------------------------+
+//| Class CComboBox                                                  |
+//| Usage: drop-down list                                            |
+//+------------------------------------------------------------------+
+class CComboBox : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CEdit             m_edit;                // the entry field object
+   CBmpButton        m_drop;                // the button object
+   CListView         m_list;                // the drop-down list object
+   //--- set up
+   int               m_item_height;         // height of visible row
+   int               m_view_items;          // number of visible rows in the drop-down list
+
+public:
+                     CComboBox(void);
+                    ~CComboBox(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- fill
+   bool              AddItem(const string item,const long value=0);
+   //--- set up
+   void              ListViewItems(const int value) { m_view_items=value; }
+   //--- data
+   virtual bool      ItemAdd(const string item,const long value=0)                    { return(m_list.ItemAdd(item,value));          }
+   virtual bool      ItemInsert(const int index,const string item,const long value=0) { return(m_list.ItemInsert(index,item,value)); }
+   virtual bool      ItemUpdate(const int index,const string item,const long value=0) { return(m_list.ItemUpdate(index,item,value)); }
+   virtual bool      ItemDelete(const int index)                                      { return(m_list.ItemDelete(index));            }
+   virtual bool      ItemsClear(void)                                                 { return(m_list.ItemsClear());                 }
+   //--- data
+   string            Select(void) { return(m_edit.Text()); }
+   bool              Select(const int index);
+   bool              SelectByText(const string text);
+   bool              SelectByValue(const long value);
+   //--- data (read only)
+   long              Value(void) { return(m_list.Value()); }
+   //--- state
+   virtual bool      Show(void);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateEdit(void);
+   virtual bool      CreateButton(void);
+   virtual bool      CreateList(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickEdit(void);
+   virtual bool      OnClickButton(void);
+   virtual bool      OnChangeList(void);
+   //--- show drop-down list
+   bool              ListShow(void);
+   bool              ListHide(void);
+   void              CheckListHide(const int id,int x,int y);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CComboBox)
+   ON_EVENT(ON_CLICK,m_edit,OnClickEdit)
+   ON_EVENT(ON_CLICK,m_drop,OnClickButton)
+   ON_EVENT(ON_CHANGE,m_list,OnChangeList)
+CheckListHide(id,(int)lparam,(int)dparam);
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CComboBox::CComboBox(void) : m_item_height(CONTROLS_COMBO_ITEM_HEIGHT),
+                             m_view_items(CONTROLS_COMBO_ITEMS_VIEW)
+
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CComboBox::~CComboBox(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CComboBox::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- check height
+   if(y2-y1<CONTROLS_COMBO_MIN_HEIGHT)
+      return(false);
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateEdit())
+      return(false);
+   if(!CreateButton())
+      return(false);
+   if(!CreateList())
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create main entry field                                          |
+//+------------------------------------------------------------------+
+bool CComboBox::CreateEdit(void)
+  {
+//--- create
+   if(!m_edit.Create(m_chart_id,m_name+"Edit",m_subwin,0,0,Width(),Height()))
+      return(false);
+   if(!m_edit.Text(""))
+      return(false);
+   if(!m_edit.ReadOnly(true))
+      return(false);
+   if(!Add(m_edit))
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create button                                                    |
+//+------------------------------------------------------------------+
+bool CComboBox::CreateButton(void)
+  {
+//--- right align button (try to make equal offsets from top and bottom)
+   int x1=Width()-(CONTROLS_BUTTON_SIZE+CONTROLS_COMBO_BUTTON_X_OFF);
+   int y1=(Height()-CONTROLS_BUTTON_SIZE)/2;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_drop.Create(m_chart_id,m_name+"Drop",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_drop.BmpNames("::res\\DropOff.bmp","::res\\DropOn.bmp"))
+      return(false);
+   if(!Add(m_drop))
+      return(false);
+   m_drop.Locking(true);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create drop-down list                                            |
+//+------------------------------------------------------------------+
+bool CComboBox::CreateList(void)
+  {
+//--- create
+   if(m_list.TotalView(m_view_items))
+     {
+      if(!m_list.Create(m_chart_id,m_name+"List",m_subwin,0,Height(),Width(),0))
+         return(false);
+      if(!Add(m_list))
+         return(false);
+      m_list.Hide();
+     }
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Add item (row)                                                   |
+//+------------------------------------------------------------------+
+bool CComboBox::AddItem(const string item,const long value)
+  {
+//--- add item to list
+   return(m_list.AddItem(item,value));
+  }
+//+------------------------------------------------------------------+
+//| Select item                                                      |
+//+------------------------------------------------------------------+
+bool CComboBox::Select(const int index)
+  {
+   if(!m_list.Select(index))
+      return(false);
+//--- call the handler
+   return(OnChangeList());
+  }
+//+------------------------------------------------------------------+
+//| Select item (by text)                                            |
+//+------------------------------------------------------------------+
+bool CComboBox::SelectByText(const string text)
+  {
+   if(!m_list.SelectByText(text))
+      return(false);
+//--- call the handler
+   return(OnChangeList());
+  }
+//+------------------------------------------------------------------+
+//| Select item (by value)                                           |
+//+------------------------------------------------------------------+
+bool CComboBox::SelectByValue(const long value)
+  {
+   if(!m_list.SelectByValue(value))
+      return(false);
+//--- call the handler
+   return(OnChangeList());
+  }
+//+------------------------------------------------------------------+
+//| Makes the control visible                                        |
+//+------------------------------------------------------------------+
+bool CComboBox::Show(void)
+  {
+   m_edit.Show();
+   m_drop.Show();
+   m_list.Hide();
+//--- call of the method of the parent class
+   return(CWnd::Show());
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CComboBox::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   FileWriteLong(file_handle,Value());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CComboBox::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   if(!FileIsEnding(file_handle))
+      SelectByValue(FileReadLong(file_handle));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on main entry field                             |
+//+------------------------------------------------------------------+
+bool CComboBox::OnClickEdit(void)
+  {
+//--- change button state
+   if(!m_drop.Pressed(!m_drop.Pressed()))
+      return(false);
+//--- call the click on button handler
+   return(OnClickButton());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on button                                       |
+//+------------------------------------------------------------------+
+bool CComboBox::OnClickButton(void)
+  {
+//--- show or hide the drop-down list depending on the button state
+   return((m_drop.Pressed()) ? ListShow() : ListHide());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on drop-down list                               |
+//+------------------------------------------------------------------+
+bool CComboBox::OnChangeList(void)
+  {
+   string text=m_list.Select();
+//--- hide the list, depress the button
+   ListHide();
+   m_drop.Pressed(false);
+//--- set text in the main entry field
+   m_edit.Text(text);
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Show the drop-down list                                          |
+//+------------------------------------------------------------------+
+bool CComboBox::ListShow(void)
+  {
+   BringToTop();
+//--- show the list
+   return(m_list.Show());
+  }
+//+------------------------------------------------------------------+
+//| Hide drop-down list                                              |
+//+------------------------------------------------------------------+
+bool CComboBox::ListHide(void)
+  {
+//--- hide the list
+   return(m_list.Hide());
+  }
+//+------------------------------------------------------------------+
+//| Hide the drop-down element if necessary                          |
+//+------------------------------------------------------------------+
+void CComboBox::CheckListHide(const int id,int x,int y)
+  {
+//--- check event ID
+   if(id!=CHARTEVENT_CLICK)
+      return;
+//--- check visibility of the drop-down element
+   if(!m_list.IsVisible())
+      return;
+//--- check mouse cursor's position
+   y-=(int)ChartGetInteger(m_chart_id,CHART_WINDOW_YDISTANCE,m_subwin);
+   if(!m_edit.Contains(x,y) && !m_list.Contains(x,y))
+     {
+      m_drop.Pressed(false);
+      m_list.Hide();
+     }
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/DateDropList.mqh b/Include/Controls/DateDropList.mqh
new file mode 100644
index 0000000..26baeae
--- /dev/null
+++ b/Include/Controls/DateDropList.mqh
@@ -0,0 +1,413 @@
+//+------------------------------------------------------------------+
+//|                                                 DateDropList.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "BmpButton.mqh"
+#include "Picture.mqh"
+#include <Canvas\Canvas.mqh>
+#include <Tools\DateTime.mqh>
+//+------------------------------------------------------------------+
+//| Enumerations                                                     |
+//+------------------------------------------------------------------+
+//--- date modes
+enum ENUM_DATE_MODES
+  {
+   DATE_MODE_MON,                           // month mode
+   DATE_MODE_YEAR                           // year mode
+  };
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+//--- Can not place the same file into resource twice
+#resource "res\\LeftTransp.bmp"
+#resource "res\\RightTransp.bmp"
+//+------------------------------------------------------------------+
+//| Class CDateDropList                                              |
+//| Usage: drop-down list                                            |
+//+------------------------------------------------------------------+
+class CDateDropList : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CBmpButton        m_dec;                 // the button object
+   CBmpButton        m_inc;                 // the button object
+   CPicture          m_list;                // the drop-down list object
+   CCanvas           m_canvas;              // and its canvas
+   //--- data
+   CDateTime         m_value;               // current value
+   //--- variable
+   ENUM_DATE_MODES   m_mode;                // operation mode
+   CRect             m_click_rect[32];      // array of click sensibility areas on canvas
+
+public:
+                     CDateDropList(void);
+                    ~CDateDropList(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- data
+   datetime          Value(void)                    { return(StructToTime(m_value)); }
+   void              Value(datetime value)          { m_value.Date(value);           }
+   void              Value(MqlDateTime& value)      { m_value=value;                 }
+   //--- state
+   virtual bool      Show(void);
+
+protected:
+   //--- internal event handlers
+   virtual bool      OnClick(void);
+   //--- create dependent controls
+   virtual bool      CreateButtons(void);
+   virtual bool      CreateList(void);
+   //--- draw
+   void              DrawCanvas(void);
+   void              DrawClickRect(const int idx,int x,int y,string text,const uint clr,uint alignment=0);
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickDec(void);
+   virtual bool      OnClickInc(void);
+   virtual bool      OnClickList(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CDateDropList)
+   ON_EVENT(ON_CLICK,m_dec,OnClickDec)
+   ON_EVENT(ON_CLICK,m_inc,OnClickInc)
+   ON_EVENT(ON_CLICK,m_list,OnClickList)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CDateDropList::CDateDropList(void) : m_mode(DATE_MODE_MON)
+  {
+   ZeroMemory(m_value);
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CDateDropList::~CDateDropList(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CDateDropList::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- need to find dimensions depending on font size
+//--- width 7 columns + 2 offsets
+   int w=7*(2*CONTROLS_FONT_SIZE)+2*CONTROLS_FONT_SIZE;
+//--- header height + 7 rows
+   int h=(CONTROLS_BUTTON_SIZE+4*CONTROLS_BORDER_WIDTH)+7*(2*CONTROLS_FONT_SIZE);
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x1+w,y1+h))
+      return(false);
+//--- create dependent controls
+   if(!CreateList())
+      return(false);
+   if(!CreateButtons())
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create drop-down list                                            |
+//+------------------------------------------------------------------+
+bool CDateDropList::CreateList(void)
+  {
+//--- create object
+   if(!m_list.Create(m_chart_id,m_name+"List",m_subwin,0,0,Width(),Height()))
+      return(false);
+   if(!Add(m_list))
+      return(false);
+//--- create canvas
+   if(!m_canvas.Create(m_name,Width(),Height()))
+      return(false);
+   m_canvas.FontSet(CONTROLS_FONT_NAME,CONTROLS_FONT_SIZE*(-10));
+   m_list.BmpName(m_canvas.ResourceName());
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create buttons                                                   |
+//+------------------------------------------------------------------+
+bool CDateDropList::CreateButtons(void)
+  {
+//--- right align button (try to make equal offsets from top and bottom)
+   int x1=2*CONTROLS_BORDER_WIDTH;
+   int y1=2*CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create "Dec" button
+   if(!m_dec.Create(m_chart_id,m_name+"Dec",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_dec.BmpNames("::res\\LeftTransp.bmp"))
+      return(false);
+   if(!Add(m_dec))
+      return(false);
+//---
+   x2=Width()-2*CONTROLS_BORDER_WIDTH;
+   x1=x2-CONTROLS_BUTTON_SIZE;
+//--- create "Inc" button
+   if(!m_inc.Create(m_chart_id,m_name+"Inc",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_inc.BmpNames("::res\\RightTransp.bmp"))
+      return(false);
+   if(!Add(m_inc))
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Makes the control visible                                        |
+//+------------------------------------------------------------------+
+bool CDateDropList::Show(void)
+  {
+//--- draw canvas
+   DrawCanvas();
+//--- call method of the parent class
+   return(CWndContainer::Show());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on button                                       |
+//+------------------------------------------------------------------+
+bool CDateDropList::OnClickDec(void)
+  {
+   switch(m_mode)
+     {
+      //--- within the month
+      case DATE_MODE_MON:
+         m_value.MonDec();
+         break;
+         //--- within the year
+      case DATE_MODE_YEAR:
+         m_value.YearDec();
+         break;
+     }
+   DrawCanvas();
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on button                                       |
+//+------------------------------------------------------------------+
+bool CDateDropList::OnClickInc(void)
+  {
+   switch(m_mode)
+     {
+      //--- within the month
+      case DATE_MODE_MON:
+         m_value.MonInc();
+         break;
+         //--- within the year
+      case DATE_MODE_YEAR:
+         m_value.YearInc();
+         break;
+     }
+   DrawCanvas();
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on picture                                      |
+//+------------------------------------------------------------------+
+bool CDateDropList::OnClickList(void)
+  {
+   m_mouse_x=m_list.MouseX();
+   m_mouse_y=m_list.MouseY();
+//---
+   OnClick();
+//---
+   m_mouse_x=0;
+   m_mouse_y=0;
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "click" event                                     |
+//+------------------------------------------------------------------+
+bool CDateDropList::OnClick(void)
+  {
+   for(int i=0;i<32;i++)
+     {
+      if(m_click_rect[i].Contains(m_mouse_x,m_mouse_y))
+        {
+         if(i==0)
+           {
+            //--- clicked on the header
+            switch(m_mode)
+              {
+               //--- within the month
+               case DATE_MODE_MON:
+                  //--- switch to the "within the year" mode
+                  m_mode=DATE_MODE_YEAR;
+                  DrawCanvas();
+                  break;
+                  //--- within the year
+               case DATE_MODE_YEAR:
+                  //--- do nothing for now
+                  break;
+              }
+           }
+         else
+           {
+            //--- selected
+            switch(m_mode)
+              {
+               //--- within the month
+               case DATE_MODE_MON:
+                  m_value.Day(i);
+                  Hide();
+                  //--- send notification
+                  EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+                  break;
+                  //--- within the year
+               case DATE_MODE_YEAR:
+                  m_value.Mon(i);
+                  m_mode=DATE_MODE_MON;
+                  DrawCanvas();
+                  break;
+               default:
+                  break;
+              }
+           }
+         break;
+        }
+     }
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Draw canvas                                                      |
+//+------------------------------------------------------------------+
+void CDateDropList::DrawCanvas(void)
+  {
+   int         x,y;
+   int         dx,dy;
+   string      text;
+   uint        text_al=TA_CENTER|TA_VCENTER;
+   CDateTime   tmp_date;
+   int         rows,cols;
+   int         idx;
+//--- zero out array of areas
+   for(int i=0;i<32;i++)
+      ZeroMemory(m_click_rect[i]);
+//---
+   m_canvas.Erase(COLOR2RGB(CONTROLS_EDIT_COLOR_BG));
+   m_canvas.Rectangle(0,0,Width()-1,Height()-1,COLOR2RGB(CONTROLS_EDIT_COLOR_BORDER));
+   x=Width()/2;
+   y=CONTROLS_BUTTON_SIZE/2+2*CONTROLS_BORDER_WIDTH;
+   switch(m_mode)
+     {
+      //--- within the month
+      case DATE_MODE_MON:
+         text=m_value.MonthName()+" "+IntegerToString(m_value.year);
+         DrawClickRect(0,x,y,text,COLOR2RGB(CONTROLS_EDIT_COLOR),text_al);
+         rows=6;
+         cols=7;
+         x=dx=Width()/(cols+1);
+         y+=y;
+         dy=(Height()-y-2*CONTROLS_BORDER_WIDTH)/(rows+1);
+         y+=dy/2;
+         for(int i=0;i<cols;i++,x+=dx)
+            m_canvas.TextOut(x,y,m_value.ShortDayName(i),COLOR2RGB(CONTROLS_EDIT_COLOR),text_al);
+         //--- backup data
+         tmp_date=m_value;
+         //--- find the beginning of the first displayed week
+         tmp_date.DayDec(tmp_date.day_of_week);
+         while(tmp_date.mon==m_value.mon && tmp_date.day!=1)
+            tmp_date.DayDec(cols);
+         //--- draw
+         idx=1;
+         y+=dy;
+         for(int i=0;i<rows;i++,y+=dy)
+           {
+            x=dx;
+            for(int j=0;j<cols;j++,x+=dx)
+              {
+               text=IntegerToString(tmp_date.day);
+               if(tmp_date.mon==m_value.mon)
+                 {
+                  if(tmp_date.day==m_value.day)
+                     m_canvas.FillRectangle(x-dx/2,y-dy/2,x+dx/2,y+dy/2,COLOR2RGB(CONTROLS_COLOR_BG_SEL));
+                  DrawClickRect(idx++,x,y,text,COLOR2RGB(CONTROLS_EDIT_COLOR),text_al);
+                 }
+               else
+                  m_canvas.TextOut(x,y,text,COLOR2RGB(CONTROLS_BUTTON_COLOR_BORDER),text_al);
+               tmp_date.DayInc();
+              }
+           }
+         break;
+         //--- within the year
+      case DATE_MODE_YEAR:
+         text=IntegerToString(m_value.year);
+         DrawClickRect(0,x,y,text,COLOR2RGB(CONTROLS_EDIT_COLOR),text_al);
+         rows=3;
+         cols=4;
+         x=dx=Width()/(cols+1);
+         y+=y;
+         dy=(Height()-y)/rows;
+         y+=dy/2;
+         for(int i=0;i<rows*cols;i++)
+           {
+            if(i+1==m_value.mon)
+               m_canvas.FillRectangle(x-dx/2,y-dy/4,x+dx/2,y+dy/4,COLOR2RGB(CONTROLS_COLOR_BG_SEL));
+            DrawClickRect(i+1,x,y,m_value.ShortMonthName(i+1),COLOR2RGB(CONTROLS_EDIT_COLOR),text_al);
+            if(i%cols==cols-1)
+              {
+               x=dx;
+               y+=dy;
+              }
+            else
+               x+=dx;
+           }
+         break;
+      default:
+         break;
+     }
+   m_canvas.Update();
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+void CDateDropList::DrawClickRect(const int idx,int x,int y,string text,const uint clr,uint alignment)
+  {
+   int text_w,text_h;
+//--- display the text
+   m_canvas.TextOut(x,y,text,clr,alignment);
+//--- determine area occupied by text
+   m_canvas.TextSize(text,text_w,text_h);
+//--- convert relative coordinated to absolute ones
+   x+=Left();
+   y+=Top();
+//--- check flags of horizontal alignment
+   switch(alignment&(TA_LEFT|TA_CENTER|TA_RIGHT))
+     {
+      case TA_LEFT:
+         m_click_rect[idx].left=x;
+         break;
+      case TA_CENTER:
+         m_click_rect[idx].left=x-text_w/2;
+         break;
+      case TA_RIGHT:
+         m_click_rect[idx].left=x-text_w;
+         break;
+     }
+   m_click_rect[idx].Width(text_w);
+//--- check flags of vertical alignment
+   switch(alignment&(TA_TOP|TA_VCENTER|TA_BOTTOM))
+     {
+      case TA_TOP:
+         m_click_rect[idx].top=y;
+         break;
+      case TA_VCENTER:
+         m_click_rect[idx].top=y-text_h/2;
+         break;
+      case TA_BOTTOM:
+         m_click_rect[idx].top=y-text_h;
+         break;
+     }
+   m_click_rect[idx].Height(text_h);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/DatePicker.mqh b/Include/Controls/DatePicker.mqh
new file mode 100644
index 0000000..59bb494
--- /dev/null
+++ b/Include/Controls/DatePicker.mqh
@@ -0,0 +1,264 @@
+//+------------------------------------------------------------------+
+//|                                                   DatePicker.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "Edit.mqh"
+#include "BmpButton.mqh"
+#include "DateDropList.mqh"
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+//--- Can not place the same file into resource twice
+#resource "res\\DateDropOn.bmp"                 // image file
+#resource "res\\DateDropOff.bmp"                // image file
+//+------------------------------------------------------------------+
+//| Class CDatePicker                                                |
+//| Usage: date picker                                               |
+//+------------------------------------------------------------------+
+class CDatePicker : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CEdit             m_edit;                // the entry field object
+   CBmpButton        m_drop;                // the button object
+   CDateDropList     m_list;                // the drop-down list object
+   //--- data
+   datetime          m_value;               // current value
+
+public:
+                     CDatePicker(void);
+                    ~CDatePicker(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- data
+   datetime          Value(void)              const { return(m_value);                                    }
+   void              Value(datetime value)          { m_edit.Text(TimeToString(m_value=value,TIME_DATE)); }
+   //--- state
+   virtual bool      Show(void);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateEdit(void);
+   virtual bool      CreateButton(void);
+   virtual bool      CreateList(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickEdit(void);
+   virtual bool      OnClickButton(void);
+   virtual bool      OnChangeList(void);
+   //--- show drop-down list
+   bool              ListShow(void);
+   bool              ListHide(void);
+   void              CheckListHide(const int id,int x,int y);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CDatePicker)
+   ON_EVENT(ON_CLICK,m_edit,OnClickEdit)
+   ON_EVENT(ON_CLICK,m_drop,OnClickButton)
+   ON_EVENT(ON_CHANGE,m_list,OnChangeList)
+CheckListHide(id,(int)lparam,(int)dparam);
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CDatePicker::CDatePicker(void) : m_value(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CDatePicker::~CDatePicker(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CDatePicker::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateEdit())
+      return(false);
+   if(!CreateButton())
+      return(false);
+   if(!CreateList())
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create main entry field                                          |
+//+------------------------------------------------------------------+
+bool CDatePicker::CreateEdit(void)
+  {
+//--- create
+   if(!m_edit.Create(m_chart_id,m_name+"Edit",m_subwin,0,0,Width(),Height()))
+      return(false);
+   if(!m_edit.Text(""))
+      return(false);
+   if(!m_edit.ReadOnly(true))
+      return(false);
+   if(!Add(m_edit))
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create button                                                    |
+//+------------------------------------------------------------------+
+bool CDatePicker::CreateButton(void)
+  {
+//--- right align button (try to make equal offsets from top and bottom)
+   int x1=Width()-(2*CONTROLS_BUTTON_SIZE+CONTROLS_COMBO_BUTTON_X_OFF);
+   int y1=(Height()-CONTROLS_BUTTON_SIZE)/2;
+   int x2=x1+2*CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_drop.Create(m_chart_id,m_name+"Drop",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_drop.BmpNames("::res\\DateDropOff.bmp","::res\\DateDropOn.bmp"))
+      return(false);
+   if(!Add(m_drop))
+      return(false);
+   m_drop.Locking(true);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create drop-down list                                            |
+//+------------------------------------------------------------------+
+bool CDatePicker::CreateList(void)
+  {
+//--- create
+   if(!m_list.Create(m_chart_id,m_name+"List",m_subwin,0,Height()-1,Width(),0))
+      return(false);
+   if(!Add(m_list))
+      return(false);
+   m_list.Hide();
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Makes the control visible                                        |
+//+------------------------------------------------------------------+
+bool CDatePicker::Show(void)
+  {
+   m_edit.Show();
+   m_drop.Show();
+   m_list.Hide();
+//--- call method of the parent class
+   return(CWnd::Show());
+  }
+//+------------------------------------------------------------------+
+//| save                                                             |
+//+------------------------------------------------------------------+
+bool CDatePicker::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- write
+   FileWriteLong(file_handle,Value());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| load                                                             |
+//+------------------------------------------------------------------+
+bool CDatePicker::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- load
+   if(!FileIsEnding(file_handle))
+      Value(FileReadLong(file_handle));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on main entry field                             |
+//+------------------------------------------------------------------+
+bool CDatePicker::OnClickEdit(void)
+  {
+//--- change button state
+   if(!m_drop.Pressed(!m_drop.Pressed()))
+      return(false);
+//--- call the click on button handler
+   return(OnClickButton());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on button                                       |
+//+------------------------------------------------------------------+
+bool CDatePicker::OnClickButton(void)
+  {
+//--- show or hide the drop-down list depending on the button state
+   return((m_drop.Pressed()) ? ListShow():ListHide());
+  }
+//+------------------------------------------------------------------+
+//| Handler of change on drop-down list                              |
+//+------------------------------------------------------------------+
+bool CDatePicker::OnChangeList(void)
+  {
+   string text=TimeToString(m_value=m_list.Value(),TIME_DATE);
+//--- hide the list, depress the button
+   ListHide();
+   m_drop.Pressed(false);
+//--- set text in the main entry field
+   m_edit.Text(text);
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Show the drop-down list                                          |
+//+------------------------------------------------------------------+
+bool CDatePicker::ListShow(void)
+  {
+//--- set value
+   m_list.Value(m_value);
+//--- show the list
+   return(m_list.Show());
+  }
+//+------------------------------------------------------------------+
+//| Hide drop-down list                                              |
+//+------------------------------------------------------------------+
+bool CDatePicker::ListHide(void)
+  {
+//--- hide the list
+   return(m_list.Hide());
+  }
+//+------------------------------------------------------------------+
+//| Hide the drop-down element if necessary                          |
+//+------------------------------------------------------------------+
+void CDatePicker::CheckListHide(const int id,int x,int y)
+  {
+//--- check event ID
+   if(id!=CHARTEVENT_CLICK)
+      return;
+//--- check visibility of the drop-down element
+   if(!m_list.IsVisible())
+      return;
+//--- check mouse cursor's position
+   y-=(int)ChartGetInteger(m_chart_id,CHART_WINDOW_YDISTANCE,m_subwin);
+   if(!m_edit.Contains(x,y) && !m_list.Contains(x,y))
+     {
+      m_drop.Pressed(false);
+      m_list.Hide();
+     }
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Defines.mqh b/Include/Controls/Defines.mqh
new file mode 100644
index 0000000..549cc3f
--- /dev/null
+++ b/Include/Controls/Defines.mqh
@@ -0,0 +1,190 @@
+//+------------------------------------------------------------------+
+//|                                                      Defines.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//+------------------------------------------------------------------+
+//| Enumerations                                                     |
+//+------------------------------------------------------------------+
+//--- properties flags
+enum ENUM_WND_PROP_FLAGS
+  {
+   WND_PROP_FLAG_CAN_DBL_CLICK  = 1,                              // can be double clicked by mouse
+   WND_PROP_FLAG_CAN_DRAG       = 2,                              // can be dragged by mouse
+   WND_PROP_FLAG_CLICKS_BY_PRESS= 4,                              // generates the "click" event series on pressing left mouse button
+   WND_PROP_FLAG_CAN_LOCK       = 8,                              // control with fixed state (usually it is a button)
+   WND_PROP_FLAG_READ_ONLY      =16                               // read only (usually it is a edit)
+  };
+//--- state flags
+enum ENUM_WND_STATE_FLAGS
+  {
+   WND_STATE_FLAG_ENABLE        = 1,                              // "object is enabled" flag
+   WND_STATE_FLAG_VISIBLE       = 2,                              // "object is visible" flag
+   WND_STATE_FLAG_ACTIVE        = 4,                              // "object is active" flag
+  };
+//--- mouse flags
+enum ENUM_MOUSE_FLAGS
+  {
+   MOUSE_INVALID_FLAGS          =-1,                              // no buttons state
+   MOUSE_EMPTY                  = 0,                              // buttons are not pressed
+   MOUSE_LEFT                   = 1,                              // left button pressed
+   MOUSE_RIGHT                  = 2                               // right button pressed
+  };
+//--- alignment flags
+enum ENUM_WND_ALIGN_FLAGS
+  {
+   WND_ALIGN_NONE               = 0,                               // no alignment
+   WND_ALIGN_LEFT               = 1,                               // align by left border
+   WND_ALIGN_TOP                = 2,                               // align by top border
+   WND_ALIGN_RIGHT              = 4,                               // align by right border
+   WND_ALIGN_BOTTOM             = 8,                               // align by bottom border
+   WND_ALIGN_WIDTH              = WND_ALIGN_LEFT|WND_ALIGN_RIGHT,  // justify
+   WND_ALIGN_HEIGHT             = WND_ALIGN_TOP|WND_ALIGN_BOTTOM,  // align by top and bottom border
+   WND_ALIGN_CLIENT             = WND_ALIGN_WIDTH|WND_ALIGN_HEIGHT // align by all sides
+  };
+//+------------------------------------------------------------------+
+//| Drawing styles and colors                                        |
+//+------------------------------------------------------------------+
+//--- common
+#define CONTROLS_FONT_NAME                  "Trebuchet MS"
+#define CONTROLS_FONT_SIZE                  (10)
+//--- Text
+#define CONTROLS_COLOR_TEXT                 C'0x3B,0x29,0x28'
+#define CONTROLS_COLOR_TEXT_SEL             White
+#define CONTROLS_COLOR_BG                   White
+#define CONTROLS_COLOR_BG_SEL               C'0x33,0x99,0xFF'
+//--- Button
+#define CONTROLS_BUTTON_COLOR               C'0x3B,0x29,0x28'
+#define CONTROLS_BUTTON_COLOR_BG            C'0xDD,0xE2,0xEB'
+#define CONTROLS_BUTTON_COLOR_BORDER        C'0xB2,0xC3,0xCF'
+//--- Label
+#define CONTROLS_LABEL_COLOR                C'0x3B,0x29,0x28'
+//--- Edit
+#define CONTROLS_EDIT_COLOR                 C'0x3B,0x29,0x28'
+#define CONTROLS_EDIT_COLOR_BG              White
+#define CONTROLS_EDIT_COLOR_BORDER          C'0xB2,0xC3,0xCF'
+//--- Scrolls
+#define CONTROLS_SCROLL_COLOR_BG            C'0xEC,0xEC,0xEC'
+#define CONTROLS_SCROLL_COLOR_BORDER        C'0xD3,0xD3,0xD3'
+//--- Client
+#define CONTROLS_CLIENT_COLOR_BG            C'0xDE,0xDE,0xDE'
+#define CONTROLS_CLIENT_COLOR_BORDER        C'0x2C,0x2C,0x2C'
+//--- ListView
+#define CONTROLS_LISTITEM_COLOR_TEXT        C'0x3B,0x29,0x28'
+#define CONTROLS_LISTITEM_COLOR_TEXT_SEL    White
+#define CONTROLS_LISTITEM_COLOR_BG          White
+#define CONTROLS_LISTITEM_COLOR_BG_SEL      C'0x33,0x99,0xFF'
+#define CONTROLS_LIST_COLOR_BG              White
+#define CONTROLS_LIST_COLOR_BORDER          C'0xB2,0xC3,0xCF'
+//--- CheckGroup
+#define CONTROLS_CHECKGROUP_COLOR_BG        C'0xF7,0xF7,0xF7'
+#define CONTROLS_CHECKGROUP_COLOR_BORDER    C'0xB2,0xC3,0xCF'
+//--- RadioGroup
+#define CONTROLS_RADIOGROUP_COLOR_BG        C'0xF7,0xF7,0xF7'
+#define CONTROLS_RADIOGROUP_COLOR_BORDER    C'0xB2,0xC3,0xCF'
+//--- Dialog
+#define CONTROLS_DIALOG_COLOR_BORDER_LIGHT  White
+#define CONTROLS_DIALOG_COLOR_BORDER_DARK   C'0xB6,0xB6,0xB6'
+#define CONTROLS_DIALOG_COLOR_BG            C'0xF0,0xF0,0xF0'
+#define CONTROLS_DIALOG_COLOR_CAPTION_TEXT  C'0x28,0x29,0x3B'
+#define CONTROLS_DIALOG_COLOR_CLIENT_BG     C'0xF7,0xF7,0xF7'
+#define CONTROLS_DIALOG_COLOR_CLIENT_BORDER C'0xC8,0xC8,0xC8'
+//+------------------------------------------------------------------+
+//| Constants for the controls                                       |
+//+------------------------------------------------------------------+
+//--- common
+#define CONTROLS_INVALID_ID                 (-1)     // invalid ID
+#define CONTROLS_INVALID_INDEX              (-1)     // invalid index of array
+#define CONTROLS_SELF_MESSAGE               (-1)     // message to oneself
+#define CONTROLS_MAXIMUM_ID                 (10000)  // maximum number of IDs in application
+#define CONTROLS_BORDER_WIDTH               (1)      // border width
+#define CONTROLS_SUBWINDOW_GAP              (3)      // gap between sub-windows along the Y axis
+#define CONTROLS_DRAG_SPACING               (50)     // sensitivity threshold for dragging
+#define CONTROLS_DBL_CLICK_TIME             (100)    // double click interval
+//--- BmpButton
+#define CONTROLS_BUTTON_SIZE                (16)     // default size of button (16 x 16)
+//--- Scrolls
+#define CONTROLS_SCROLL_SIZE                (18)     // default lateral size of scrollbar
+#define CONTROLS_SCROLL_THUMB_SIZE          (22)     // default length of scroll box
+//--- RadioButton
+#define CONTROLS_RADIO_BUTTON_X_OFF         (3)      // X offset of radio button (for RadioButton)
+#define CONTROLS_RADIO_BUTTON_Y_OFF         (3)      // Y offset of radio button (for RadioButton)
+#define CONTROLS_RADIO_LABEL_X_OFF          (20)     // X offset of label (for RadioButton)
+#define CONTROLS_RADIO_LABEL_Y_OFF          (0)      // Y offset of label (for RadioButton)
+//--- CheckBox
+#define CONTROLS_CHECK_BUTTON_X_OFF         (3)      // X offset of check button (for CheckBox)
+#define CONTROLS_CHECK_BUTTON_Y_OFF         (3)      // Y offset of check button (for CheckBox)
+#define CONTROLS_CHECK_LABEL_X_OFF          (20)     // X offset of label (for CheckBox)
+#define CONTROLS_CHECK_LABEL_Y_OFF          (0)      // Y offset of label (for CheckBox)
+//--- Spin
+#define CONTROLS_SPIN_BUTTON_X_OFF          (2)      // X offset of button from right (for SpinEdit)
+#define CONTROLS_SPIN_MIN_HEIGHT            (18)     // minimal height (for SpinEdit)
+#define CONTROLS_SPIN_BUTTON_SIZE           (8)      // default size of button (16 x 8) (for SpinEdit)
+//--- Combo
+#define CONTROLS_COMBO_BUTTON_X_OFF         (2)      // X offset of button from right (for ComboBox)
+#define CONTROLS_COMBO_MIN_HEIGHT           (18)     // minimal height (for ComboBox)
+#define CONTROLS_COMBO_ITEM_HEIGHT          (18)     // height of combo box item (for ComboBox)
+#define CONTROLS_COMBO_ITEMS_VIEW           (8)      // number of items in combo box (for ComboBox)
+//--- ListView
+#define CONTROLS_LIST_ITEM_HEIGHT           (18)     // height of list item (for ListView)
+//--- Dialog
+#define CONTROLS_DIALOG_CAPTION_HEIGHT      (22)     // height of dialog header
+#define CONTROLS_DIALOG_BUTTON_OFF          (3)      // offset of dialog buttons
+#define CONTROLS_DIALOG_CLIENT_OFF          (2)      // offset of dialog client area
+#define CONTROLS_DIALOG_MINIMIZE_LEFT       (10)     // left coordinate of dialog in minimized state
+#define CONTROLS_DIALOG_MINIMIZE_TOP        (10)     // top coordinate of dialog in minimized state
+#define CONTROLS_DIALOG_MINIMIZE_WIDTH      (100)    // width of dialog in minimized state
+#define CONTROLS_DIALOG_MINIMIZE_HEIGHT     (4*CONTROLS_BORDER_WIDTH+CONTROLS_DIALOG_CAPTION_HEIGHT) // height of dialog in minimized state
+//+------------------------------------------------------------------+
+//| Macro                                                            |
+//+------------------------------------------------------------------+
+//--- check properties
+#define IS_CAN_DBL_CLICK     ((m_prop_flags&WND_PROP_FLAG_CAN_DBL_CLICK)!=0)
+#define IS_CAN_DRAG          ((m_prop_flags&WND_PROP_FLAG_CAN_DRAG)!=0)
+#define IS_CLICKS_BY_PRESS   ((m_prop_flags&WND_PROP_FLAG_CLICKS_BY_PRESS)!=0)
+#define IS_CAN_LOCK          ((m_prop_flags&WND_PROP_FLAG_CAN_LOCK)!=0)
+#define IS_READ_ONLY         ((m_prop_flags&WND_PROP_FLAG_READ_ONLY)!=0)
+//--- check state
+#define IS_ENABLED           ((m_state_flags&WND_STATE_FLAG_ENABLE)!=0)
+#define IS_VISIBLE           ((m_state_flags&WND_STATE_FLAG_VISIBLE)!=0)
+#define IS_ACTIVE            ((m_state_flags&WND_STATE_FLAG_ACTIVE)!=0)
+//+------------------------------------------------------------------+
+//| Macro of event handling map                                      |
+//+------------------------------------------------------------------+
+#define INTERNAL_EVENT                           (-1)
+//--- beginning of map
+#define EVENT_MAP_BEGIN(class_name)              bool class_name::OnEvent(const int id,const long& lparam,const double& dparam,const string& sparam) {
+//--- end of map
+#define EVENT_MAP_END(parent_class_name)         return(parent_class_name::OnEvent(id,lparam,dparam,sparam)); }
+//--- event handling by numeric ID
+#define ON_EVENT(event,control,handler)          if(id==(event+CHARTEVENT_CUSTOM) && lparam==control.Id()) { handler(); return(true); }
+//--- event handling by numeric ID by pointer of control
+#define ON_EVENT_PTR(event,control,handler)      if(control!=NULL && id==(event+CHARTEVENT_CUSTOM) && lparam==control.Id()) { handler(); return(true); }
+//--- event handling without ID analysis
+#define ON_NO_ID_EVENT(event,handler)            if(id==(event+CHARTEVENT_CUSTOM)) { return(handler()); }
+//--- event handling by row ID
+#define ON_NAMED_EVENT(event,control,handler)    if(id==(event+CHARTEVENT_CUSTOM) && sparam==control.Name()) { handler(); return(true); }
+//--- handling of indexed event
+#define ON_INDEXED_EVENT(event,controls,handler) { int total=ArraySize(controls); for(int i=0;i<total;i++) if(id==(event+CHARTEVENT_CUSTOM) && lparam==controls[i].Id()) return(handler(i)); }
+//--- handling of external event
+#define ON_EXTERNAL_EVENT(event,handler)         if(id==(event+CHARTEVENT_CUSTOM)) { handler(lparam,dparam,sparam); return(true); }
+//+------------------------------------------------------------------+
+//| Events                                                           |
+//+------------------------------------------------------------------+
+#define ON_CLICK                (0)   // clicking on control event
+#define ON_DBL_CLICK            (1)   // double clicking on control event
+#define ON_SHOW                 (2)   // showing control event
+#define ON_HIDE                 (3)   // hiding control event
+#define ON_CHANGE               (4)   // changing control event
+#define ON_START_EDIT           (5)   // start of editing event
+#define ON_END_EDIT             (6)   // end of editing event
+#define ON_SCROLL_INC           (7)   // increment of scrollbar event
+#define ON_SCROLL_DEC           (8)   // decrement of scrollbar event
+#define ON_MOUSE_FOCUS_SET      (9)   // the "mouse cursor entered the control" event
+#define ON_MOUSE_FOCUS_KILL     (10)  // the "mouse cursor exited the control" event
+#define ON_DRAG_START           (11)  // the "control dragging start" event
+#define ON_DRAG_PROCESS         (12)  // the "control is being dragged" event
+#define ON_DRAG_END             (13)  // the "control dragging end" event
+#define ON_BRING_TO_TOP         (14)  // the "mouse events priority increase" event
+#define ON_APP_CLOSE            (100) // "closing the application" event
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Dialog.mqh b/Include/Controls/Dialog.mqh
new file mode 100644
index 0000000..0e2c428
--- /dev/null
+++ b/Include/Controls/Dialog.mqh
@@ -0,0 +1,971 @@
+//+------------------------------------------------------------------+
+//|                                                       Dialog.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "WndClient.mqh"
+#include "Panel.mqh"
+#include "Edit.mqh"
+#include "BmpButton.mqh"
+#include <Charts\Chart.mqh>
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+#resource "res\\Close.bmp"
+#resource "res\\Restore.bmp"
+#resource "res\\Turn.bmp"
+//+------------------------------------------------------------------+
+//| Class CDialog                                                    |
+//| Usage: base class to create dialog boxes                         |
+//|             and indicator panels                                 |
+//+------------------------------------------------------------------+
+class CDialog : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CPanel            m_white_border;        // the "white border" object
+   CPanel            m_background;          // the background object
+   CEdit             m_caption;             // the window title object
+   CBmpButton        m_button_close;        // the "Close" button object
+   CWndClient        m_client_area;         // the client area object
+
+protected:
+   //--- flags
+   bool              m_panel_flag;          // the "panel in a separate window" flag
+   //--- flags
+   bool              m_minimized;           // "create in minimized state" flag
+   //--- additional areas
+   CRect             m_min_rect;            // minimal area coordinates
+   CRect             m_norm_rect;           // normal area coordinates
+
+public:
+                     CDialog(void);
+                    ~CDialog(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- set up
+   string            Caption(void)                   const { return(m_caption.Text());               }
+   bool              Caption(const string text)            { return(m_caption.Text(text));           }
+   //--- fill
+   bool              Add(CWnd *control);
+   bool              Add(CWnd &control);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateWhiteBorder(void);
+   virtual bool      CreateBackground(void);
+   virtual bool      CreateCaption(void);
+   virtual bool      CreateButtonClose(void);
+   virtual bool      CreateClientArea(void);
+   //--- handlers of the dependent controls events
+   virtual void      OnClickCaption(void);
+   virtual void      OnClickButtonClose(void);
+   //--- access properties of caption
+   void              CaptionAlignment(const int flags,const int left,const int top,const int right,const int bottom)
+                        { m_caption.Alignment(flags,left,top,right,bottom); }
+   //--- access properties of client area
+   bool              ClientAreaVisible(const bool visible) { return(m_client_area.Visible(visible)); }
+   int               ClientAreaLeft(void)            const { return(m_client_area.Left());           }
+   int               ClientAreaTop(void)             const { return(m_client_area.Top());            }
+   int               ClientAreaRight(void)           const { return(m_client_area.Right());          }
+   int               ClientAreaBottom(void)          const { return(m_client_area.Bottom());         }
+   int               ClientAreaWidth(void)           const { return(m_client_area.Width());          }
+   int               ClientAreaHeight(void)          const { return(m_client_area.Height());         }
+   //--- handlers of drag
+   virtual bool      OnDialogDragStart(void);
+   virtual bool      OnDialogDragProcess(void);
+   virtual bool      OnDialogDragEnd(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of events                                         |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CDialog)
+   ON_EVENT(ON_CLICK,m_button_close,OnClickButtonClose)
+   ON_EVENT(ON_CLICK,m_caption,OnClickCaption)
+   ON_EVENT(ON_DRAG_START,m_caption,OnDialogDragStart)
+   ON_EVENT_PTR(ON_DRAG_PROCESS,m_drag_object,OnDialogDragProcess)
+   ON_EVENT_PTR(ON_DRAG_END,m_drag_object,OnDialogDragEnd)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CDialog::CDialog(void) : m_panel_flag(false),
+                         m_minimized(false)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CDialog::~CDialog(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CDialog::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!m_panel_flag && !CreateWhiteBorder())
+      return(false);
+   if(!CreateBackground())
+      return(false);
+   if(!CreateCaption())
+      return(false);
+   if(!CreateButtonClose())
+      return(false);
+   if(!CreateClientArea())
+      return(false);
+//--- set up additional areas
+   m_norm_rect.SetBound(m_rect);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Add control to the client area (by pointer)                      |
+//+------------------------------------------------------------------+
+bool CDialog::Add(CWnd *control)
+  {
+   return(m_client_area.Add(control));
+  }
+//+------------------------------------------------------------------+
+//| Add control to the client area (by reference)                    |
+//+------------------------------------------------------------------+
+bool CDialog::Add(CWnd &control)
+  {
+   return(m_client_area.Add(control));
+  }
+//+------------------------------------------------------------------+
+//| Save                                                             |
+//+------------------------------------------------------------------+
+bool CDialog::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- save
+   FileWriteStruct(file_handle,m_norm_rect);
+   FileWriteInteger(file_handle,m_min_rect.left);
+   FileWriteInteger(file_handle,m_min_rect.top);
+   FileWriteInteger(file_handle,m_minimized);
+//--- result
+   return(CWndContainer::Save(file_handle));
+  }
+//+------------------------------------------------------------------+
+//| Load                                                             |
+//+------------------------------------------------------------------+
+bool CDialog::Load(const int file_handle)
+  {
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//--- load
+   if(!FileIsEnding(file_handle))
+     {
+      FileReadStruct(file_handle,m_norm_rect);
+      int left=FileReadInteger(file_handle);
+      int top=FileReadInteger(file_handle);
+      m_min_rect.Move(left,top);
+      m_minimized=FileReadInteger(file_handle);
+     }
+//--- result
+   return(CWndContainer::Load(file_handle));
+  }
+//+------------------------------------------------------------------+
+//| Create "white border"                                            |
+//+------------------------------------------------------------------+
+bool CDialog::CreateWhiteBorder(void)
+  {
+//--- coordinates
+   int x1=0;
+   int y1=0;
+   int x2=Width();
+   int y2=Height();
+//--- create
+   if(!m_white_border.Create(m_chart_id,m_name+"Border",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_white_border.ColorBackground(CONTROLS_DIALOG_COLOR_BG))
+      return(false);
+   if(!m_white_border.ColorBorder(CONTROLS_DIALOG_COLOR_BORDER_LIGHT))
+      return(false);
+   if(!CWndContainer::Add(m_white_border))
+      return(false);
+   m_white_border.Alignment(WND_ALIGN_CLIENT,0,0,0,0);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create background                                                |
+//+------------------------------------------------------------------+
+bool CDialog::CreateBackground(void)
+  {
+   int off=(m_panel_flag) ? 0:CONTROLS_BORDER_WIDTH;
+//--- coordinates
+   int x1=off;
+   int y1=off;
+   int x2=Width()-off;
+   int y2=Height()-off;
+//--- create
+   if(!m_background.Create(m_chart_id,m_name+"Back",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_background.ColorBackground(CONTROLS_DIALOG_COLOR_BG))
+      return(false);
+   color border=(m_panel_flag) ? CONTROLS_DIALOG_COLOR_BG : CONTROLS_DIALOG_COLOR_BORDER_DARK;
+   if(!m_background.ColorBorder(border))
+      return(false);
+   if(!CWndContainer::Add(m_background))
+      return(false);
+   m_background.Alignment(WND_ALIGN_CLIENT,off,off,off,off);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create window title                                              |
+//+------------------------------------------------------------------+
+bool CDialog::CreateCaption(void)
+  {
+   int off=(m_panel_flag) ? 0:2*CONTROLS_BORDER_WIDTH;
+//--- coordinates
+   int x1=off;
+   int y1=off;
+   int x2=Width()-off;
+   int y2=y1+CONTROLS_DIALOG_CAPTION_HEIGHT;
+//--- create
+   if(!m_caption.Create(m_chart_id,m_name+"Caption",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_caption.Color(CONTROLS_DIALOG_COLOR_CAPTION_TEXT))
+      return(false);
+   if(!m_caption.ColorBackground(CONTROLS_DIALOG_COLOR_BG))
+      return(false);
+   if(!m_caption.ColorBorder(CONTROLS_DIALOG_COLOR_BG))
+      return(false);
+   if(!m_caption.ReadOnly(true))
+      return(false);
+   if(!m_caption.Text(m_name))
+      return(false);
+   if(!CWndContainer::Add(m_caption))
+      return(false);
+   m_caption.Alignment(WND_ALIGN_WIDTH,off,0,off,0);
+   if(!m_panel_flag)
+      m_caption.PropFlags(WND_PROP_FLAG_CAN_DRAG);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create the "Close" button                                        |
+//+------------------------------------------------------------------+
+bool CDialog::CreateButtonClose(void)
+  {
+   int off=(m_panel_flag) ? 0 : 2*CONTROLS_BORDER_WIDTH;
+//--- coordinates
+   int x1=Width()-off-(CONTROLS_BUTTON_SIZE+CONTROLS_DIALOG_BUTTON_OFF);
+   int y1=off+CONTROLS_DIALOG_BUTTON_OFF;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_button_close.Create(m_chart_id,m_name+"Close",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_button_close.BmpNames("::res\\Close.bmp"))
+      return(false);
+   if(!CWndContainer::Add(m_button_close))
+      return(false);
+   m_button_close.Alignment(WND_ALIGN_RIGHT,0,0,off+CONTROLS_DIALOG_BUTTON_OFF,0);
+//--- change caption
+   CaptionAlignment(WND_ALIGN_WIDTH,off,0,off+(CONTROLS_BUTTON_SIZE+CONTROLS_DIALOG_BUTTON_OFF),0);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create client area                                               |
+//+------------------------------------------------------------------+
+bool CDialog::CreateClientArea(void)
+  {
+   int off=(m_panel_flag) ? 0:2*CONTROLS_BORDER_WIDTH;
+//--- coordinates
+   int x1=off+CONTROLS_DIALOG_CLIENT_OFF;
+   int y1=off+CONTROLS_DIALOG_CAPTION_HEIGHT;
+   int x2=Width()-(off+CONTROLS_DIALOG_CLIENT_OFF);
+   int y2=Height()-(off+CONTROLS_DIALOG_CLIENT_OFF);
+//--- create
+   if(!m_client_area.Create(m_chart_id,m_name+"Client",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_client_area.ColorBackground(CONTROLS_DIALOG_COLOR_CLIENT_BG))
+      return(false);
+   if(!m_client_area.ColorBorder(CONTROLS_DIALOG_COLOR_CLIENT_BORDER))
+      return(false);
+   CWndContainer::Add(m_client_area);
+   m_client_area.Alignment(WND_ALIGN_CLIENT,x1,y1,x1,x1);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the window title                             |
+//+------------------------------------------------------------------+
+void CDialog::OnClickCaption(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the "Close" button                           |
+//+------------------------------------------------------------------+
+void CDialog::OnClickButtonClose(void)
+  {
+   Visible(false);
+  }
+//+------------------------------------------------------------------+
+//| Start dragging the dialog box                                    |
+//+------------------------------------------------------------------+
+bool CDialog::OnDialogDragStart(void)
+  {
+   if(m_drag_object==NULL)
+     {
+      m_drag_object=new CDragWnd;
+      if(m_drag_object==NULL)
+         return(false);
+     }
+//--- calculate coordinates
+   int x1=Left()-CONTROLS_DRAG_SPACING;
+   int y1=Top()-CONTROLS_DRAG_SPACING;
+   int x2=Right()+CONTROLS_DRAG_SPACING;
+   int y2=Bottom()+CONTROLS_DRAG_SPACING;
+//--- create
+   m_drag_object.Create(m_chart_id,"",m_subwin,x1,y1,x2,y2);
+   m_drag_object.PropFlags(WND_PROP_FLAG_CAN_DRAG);
+//--- constraints
+   CChart chart;
+   chart.Attach(m_chart_id);
+   m_drag_object.Limits(-CONTROLS_DRAG_SPACING,-CONTROLS_DRAG_SPACING,
+                        chart.WidthInPixels()+CONTROLS_DRAG_SPACING,
+                        chart.HeightInPixels(m_subwin)+CONTROLS_DRAG_SPACING);
+   chart.Detach();
+//--- set mouse params
+   m_drag_object.MouseX(m_caption.MouseX());
+   m_drag_object.MouseY(m_caption.MouseY());
+   m_drag_object.MouseFlags(m_caption.MouseFlags());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Continue dragging the dialog box                                 |
+//+------------------------------------------------------------------+
+bool CDialog::OnDialogDragProcess(void)
+  {
+//--- checking
+   if(m_drag_object==NULL)
+      return(false);
+//--- calculate coordinates
+   int x=m_drag_object.Left()+50;
+   int y=m_drag_object.Top()+50;
+//--- move dialog
+   Move(x,y);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| End dragging the dialog box                                      |
+//+------------------------------------------------------------------+
+bool CDialog::OnDialogDragEnd(void)
+  {
+   if(m_drag_object!=NULL)
+     {
+      m_caption.MouseFlags(m_drag_object.MouseFlags());
+      delete m_drag_object;
+      m_drag_object=NULL;
+     }
+//--- set up additional areas
+   if(m_minimized)
+      m_min_rect.SetBound(m_rect);
+   else
+      m_norm_rect.SetBound(m_rect);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CAppDialog                                                 |
+//| Usage: main dialog box of MQL5 application                       |
+//+------------------------------------------------------------------+
+class CAppDialog : public CDialog
+  {
+private:
+   //--- dependent controls
+   CBmpButton        m_button_minmax;       // the "Minimize/Maximize" button object
+   //--- variables
+   string            m_program_name;        // name of program
+   string            m_instance_id;         // unique string ID
+   ENUM_PROGRAM_TYPE m_program_type;        // type of program
+   string            m_indicator_name;
+   int               m_deinit_reason;
+   //--- for mouse
+   int               m_subwin_Yoff;         // subwindow Y offset
+   CWnd*             m_focused_wnd;         // pointer to object that has mouse focus
+   CWnd*             m_top_wnd;             // pointer to object that has priority over mouse events handling
+
+protected:
+   CChart            m_chart;               // object to access chart
+
+public:
+                     CAppDialog(void);
+                    ~CAppDialog(void);
+   //--- main application dialog creation and destroy
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   virtual void      Destroy(const int reason=REASON_PROGRAM);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- dialog run
+   bool              Run(void);
+   //--- chart events processing
+   void              ChartEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- set up
+   void              Minimized(const bool flag) { m_minimized=flag; }
+   //--- to save/restore state
+   void              IniFileSave(void);
+   void              IniFileLoad(void);
+   virtual string    IniFileName(void) const;
+   virtual string    IniFileExt(void) const { return(".dat"); }
+   virtual bool      Load(const int file_handle);
+   virtual bool      Save(const int file_handle);
+
+private:
+   bool              CreateCommon(const long chart,const string name,const int subwin);
+   bool              CreateExpert(const int x1,const int y1,const int x2,const int y2);
+   bool              CreateIndicator(const int x1,const int y1,const int x2,const int y2);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateButtonMinMax(void);
+   //--- handlers of the dependent controls events
+   virtual void      OnClickButtonClose(void);
+   virtual void      OnClickButtonMinMax(void);
+   //--- external event handlers
+   virtual void      OnAnotherApplicationClose(const long &lparam,const double &dparam,const string &sparam);
+   //--- methods
+   virtual bool      Rebound(const CRect &rect);
+   virtual void      Minimize(void);
+   virtual void      Maximize(void);
+   string            CreateInstanceId(void);
+   string            ProgramName(void) const { return(m_program_name); }
+   void              SubwinOff(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of events                                         |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CAppDialog)
+ON_EVENT(ON_CLICK,m_button_minmax,OnClickButtonMinMax)
+ON_EXTERNAL_EVENT(ON_APP_CLOSE,OnAnotherApplicationClose)
+EVENT_MAP_END(CDialog)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CAppDialog::CAppDialog(void) : m_program_type(WRONG_VALUE),
+                               m_deinit_reason(WRONG_VALUE),
+                               m_subwin_Yoff(0),
+                               m_focused_wnd(NULL),
+                               m_top_wnd(NULL)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CAppDialog::~CAppDialog(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Application dialog initialization function                       |
+//+------------------------------------------------------------------+
+bool CAppDialog::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+   if(!CreateCommon(chart,name,subwin))
+      return(false);
+//---
+   switch(m_program_type)
+     {
+      case PROGRAM_EXPERT:
+         if(!CreateExpert(x1,y1,x2,y2))
+         return(false);
+         break;
+      case PROGRAM_INDICATOR:
+         if(!CreateIndicator(x1,y1,x2,y2))
+         return(false);
+         break;
+      default:
+         Print("CAppDialog: invalid program type");
+         return(false);
+     }
+//--- Title of dialog window
+   if(!Caption(m_program_name))
+      return(false);
+//--- create dependent controls
+   if(!CreateButtonMinMax())
+      return(false);
+//--- get subwindow offset
+   SubwinOff();
+//--- if flag is set, minimize the dialog
+   if(m_minimized)
+      Minimize();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Initialize common area                                           |
+//+------------------------------------------------------------------+
+bool CAppDialog::CreateCommon(const long chart,const string name,const int subwin)
+  {
+//--- save parameters
+   m_chart_id     =chart;
+   m_name         =name;
+   m_subwin       =subwin;
+   m_program_name =name;
+   m_deinit_reason=WRONG_VALUE;
+//--- get unique ID
+   m_instance_id=CreateInstanceId();
+//--- initialize chart object
+   m_chart.Attach(chart);
+//--- determine type of program
+   m_program_type=(ENUM_PROGRAM_TYPE)MQL5InfoInteger(MQL5_PROGRAM_TYPE);
+//--- specify object and mouse events
+   if(!m_chart.EventObjectCreate() || !m_chart.EventObjectDelete() || !m_chart.EventMouseMove())
+     {
+      Print("CAppDialog: object events specify error");
+      m_chart.Detach();
+      return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Initialize in Expert Advisor                                     |
+//+------------------------------------------------------------------+
+bool CAppDialog::CreateExpert(const int x1,const int y1,const int x2,const int y2)
+  {
+//--- EA works only in main window
+   m_subwin=0;
+//--- geometry for the minimized state
+   m_min_rect.SetBound(CONTROLS_DIALOG_MINIMIZE_LEFT,
+                       CONTROLS_DIALOG_MINIMIZE_TOP,
+                       CONTROLS_DIALOG_MINIMIZE_LEFT+CONTROLS_DIALOG_MINIMIZE_WIDTH,
+                       CONTROLS_DIALOG_MINIMIZE_TOP+CONTROLS_DIALOG_MINIMIZE_HEIGHT);
+//--- call method of the parent class
+   if(!CDialog::Create(m_chart.ChartId(),m_instance_id,m_subwin,x1,y1,x2,y2))
+     {
+      Print("CAppDialog: expert dialog create error");
+      m_chart.Detach();
+      return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Initialize in Indicator                                          |
+//+------------------------------------------------------------------+
+bool CAppDialog::CreateIndicator(const int x1,const int y1,const int x2,const int y2)
+  {
+   int width=m_chart.WidthInPixels();
+//--- geometry for the minimized state
+   m_min_rect.LeftTop(0,0);
+   m_min_rect.Width(width);
+   m_min_rect.Height(CONTROLS_DIALOG_MINIMIZE_HEIGHT-2*CONTROLS_BORDER_WIDTH);
+//--- determine subwindow
+   m_subwin=ChartWindowFind();
+   if(m_subwin==-1)
+     {
+      Print("CAppDialog: find subwindow error");
+      m_chart.Detach();
+      return(false);
+     }
+//---
+   int total=ChartIndicatorsTotal(m_chart.ChartId(),m_subwin);
+   m_indicator_name=ChartIndicatorName(m_chart.ChartId(),m_subwin,total-1);
+//--- if subwindow number is 0 (main window), then our program is
+//--- not an indicator panel, but is an indicator with built-in settings dialog
+//--- dialog of such an indicator should behave as an Expert Advisor dialog
+   if(m_subwin==0)
+      return(CreateExpert(x1,y1,x2,y2));
+//--- if subwindow number is not 0, then our program is an indicator panel
+//--- check if subwindow is not occupied by other indicators
+   if(total!=1)
+     {
+      Print("CAppDialog: subwindow busy");
+      ChartIndicatorDelete(m_chart.ChartId(),m_subwin,ChartIndicatorName(m_chart.ChartId(),m_subwin,total-1));
+      m_chart.Detach();
+      return(false);
+     }
+//--- resize subwindow by dialog height
+   if(!IndicatorSetInteger(INDICATOR_HEIGHT,(y2-y1)+1))
+     {
+      Print("CAppDialog: subwindow resize error");
+      ChartIndicatorDelete(m_chart.ChartId(),m_subwin,ChartIndicatorName(m_chart.ChartId(),m_subwin,total-1));
+      m_chart.Detach();
+      return(false);
+     }
+//--- indicator short name
+   m_indicator_name=m_program_name+IntegerToString(m_subwin);
+   if(!IndicatorSetString(INDICATOR_SHORTNAME,m_indicator_name))
+     {
+      Print("CAppDialog: shortname error");
+      ChartIndicatorDelete(m_chart.ChartId(),m_subwin,ChartIndicatorName(m_chart.ChartId(),m_subwin,total-1));
+      m_chart.Detach();
+      return(false);
+     }
+//--- set flag 
+   m_panel_flag=true;
+//--- call method of the parent class
+   if(!CDialog::Create(m_chart.ChartId(),m_instance_id,m_subwin,0,0,width,y2-y1))
+     {
+      Print("CAppDialog: indicator dialog create error");
+      ChartIndicatorDelete(m_chart.ChartId(),m_subwin,ChartIndicatorName(m_chart.ChartId(),m_subwin,total-1));
+      m_chart.Detach();
+      return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Application dialog deinitialization function                     |
+//+------------------------------------------------------------------+
+void CAppDialog::Destroy(const int reason)
+  {
+//--- destroyed already?
+   if(m_deinit_reason!=WRONG_VALUE)
+      return;
+//---
+   m_deinit_reason=reason;
+   IniFileSave();
+//--- detach chart object from chart
+   m_chart.Detach();
+//--- call parent destroy
+   CDialog::Destroy();
+//---
+   if(reason==REASON_PROGRAM)
+     {
+      if(m_program_type==PROGRAM_EXPERT)
+         ExpertRemove();
+      if(m_program_type==PROGRAM_INDICATOR)
+         ChartIndicatorDelete(m_chart_id,m_subwin,m_indicator_name);
+     }
+//--- send message
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_APP_CLOSE,m_subwin,0.0,m_program_name);
+  }
+//+------------------------------------------------------------------+
+//| Calculate subwindow offset                                       |
+//+------------------------------------------------------------------+
+void CAppDialog::SubwinOff(void)
+  {
+   m_subwin_Yoff=m_chart.SubwindowY(m_subwin);
+  }
+//+------------------------------------------------------------------+
+//| Create the "Minimize/Maximize" button                            |
+//+------------------------------------------------------------------+
+bool CAppDialog::CreateButtonMinMax(void)
+  {
+   int off=(m_panel_flag) ? 0:2*CONTROLS_BORDER_WIDTH;
+//--- coordinates
+   int x1=Width()-off-2*(CONTROLS_BUTTON_SIZE+CONTROLS_DIALOG_BUTTON_OFF);
+   int y1=off+CONTROLS_DIALOG_BUTTON_OFF;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_button_minmax.Create(m_chart_id,m_name+"MinMax",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_button_minmax.BmpNames("::res\\Turn.bmp","::res\\Restore.bmp"))
+      return(false);
+   if(!CWndContainer::Add(m_button_minmax))
+      return(false);
+   m_button_minmax.Locking(true);
+   m_button_minmax.Alignment(WND_ALIGN_RIGHT,0,0,off+CONTROLS_BUTTON_SIZE+2*CONTROLS_DIALOG_BUTTON_OFF,0);
+//--- change caption
+   CaptionAlignment(WND_ALIGN_WIDTH,off,0,off+2*(CONTROLS_BUTTON_SIZE+CONTROLS_DIALOG_BUTTON_OFF),0);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Charts event processing                                          |
+//+------------------------------------------------------------------+
+void CAppDialog::ChartEvent(const int id,const long &lparam,const double &dparam,const string &sparam)
+  {
+   int mouse_x=(int)lparam;
+   int mouse_y=(int)dparam-m_subwin_Yoff;
+//--- separate mouse events from others
+   switch(id)
+     {
+      case CHARTEVENT_CHART_CHANGE:
+         //--- assumed that the CHARTEVENT_CHART_CHANGE event can handle only the application dialog
+         break;
+      case CHARTEVENT_OBJECT_CLICK:
+         //--- we won't handle the CHARTEVENT_OBJECT_CLICK event, as we are working with the CHARTEVENT_MOUSE_MOVE events
+         return;
+      case CHARTEVENT_CUSTOM+ON_MOUSE_FOCUS_SET:
+         //--- the CHARTEVENT_CUSTOM + ON_MOUSE_FOCUS_SET event
+         if(CheckPointer(m_focused_wnd)!=POINTER_INVALID)
+           {
+            //--- if there is an element with focus, try to take its focus away
+            if(!m_focused_wnd.MouseFocusKill(lparam))
+               return;
+           }
+         m_focused_wnd=ControlFind(lparam);
+         return;
+      case CHARTEVENT_CUSTOM+ON_BRING_TO_TOP:
+         m_top_wnd=ControlFind(lparam);
+         return;
+      case CHARTEVENT_MOUSE_MOVE:
+         //--- the CHARTEVENT_MOUSE_MOVE event
+         if(CheckPointer(m_top_wnd)!=POINTER_INVALID)
+           {
+            //--- if a priority element already exists, pass control to it
+            if(m_top_wnd.OnMouseEvent(mouse_x,mouse_y,(int)StringToInteger(sparam)))
+              {
+               //--- event handled
+               m_chart.Redraw();
+               return;
+              }
+           }
+         if(OnMouseEvent(mouse_x,mouse_y,(int)StringToInteger(sparam)))
+            m_chart.Redraw();
+         return;
+      default:
+         //--- call event processing and redraw chart if event handled
+         if(OnEvent(id,lparam,dparam,sparam))
+         m_chart.Redraw();
+         return;
+     }
+//--- if event was not handled, try to handle the CHARTEVENT_CHART_CHANGE event
+   if(id==CHARTEVENT_CHART_CHANGE)
+     {
+      //--- if subwindow number is not 0, and dialog subwindow has changed its number, then restart
+      if(m_subwin!=0 && m_subwin!=ChartWindowFind())
+        {
+         long fiction=1;
+         OnAnotherApplicationClose(fiction,dparam,sparam);
+        }
+      //--- if subwindow height is less that dialog height, minimize application window (always)
+      if(m_chart.HeightInPixels(m_subwin)<Height()+CONTROLS_BORDER_WIDTH)
+        {
+         m_button_minmax.Pressed(true);
+         Minimize();
+         m_chart.Redraw();
+        }
+      //--- if chart width is less that dialog width, and subwindow number is not 0, try to modify dialog width
+      if(m_chart.WidthInPixels()!=Width() && m_subwin!=0)
+        {
+         Width(m_chart.WidthInPixels());
+         m_chart.Redraw();
+        }
+      //--- get subwindow offset
+      SubwinOff();
+      return;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Run application                                                  |
+//+------------------------------------------------------------------+
+bool CAppDialog::Run(void)
+  {
+//--- redraw chart for dialog invalidate
+   m_chart.Redraw();
+//--- here we begin to assign IDs to controls
+   if(Id(m_subwin*CONTROLS_MAXIMUM_ID)>CONTROLS_MAXIMUM_ID)
+     {
+      Print("CAppDialog: too many objects");
+      return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Stop application                                                 |
+//+------------------------------------------------------------------+
+void CAppDialog::OnClickButtonClose(void)
+  {
+//--- destroy application
+   Destroy();
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the "Minimize/Maximize" button               |
+//+------------------------------------------------------------------+
+void CAppDialog::OnClickButtonMinMax(void)
+  {
+   if(m_button_minmax.Pressed())
+      Minimize();
+   else
+      Maximize();
+//--- get subwindow offset
+   SubwinOff();
+  }
+//+------------------------------------------------------------------+
+//| Resize                                                           |
+//+------------------------------------------------------------------+
+bool CAppDialog::Rebound(const CRect &rect)
+  {
+   if(!Move(rect.LeftTop()))
+      return(false);
+   if(!Size(rect.Size()))
+      return(false);
+//--- resize subwindow
+   if(m_program_type==PROGRAM_INDICATOR && !IndicatorSetInteger(INDICATOR_HEIGHT,rect.Height()+1))
+     {
+      Print("CAppDialog: subwindow resize error");
+      return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Minimize dialog window                                           |
+//+------------------------------------------------------------------+
+void CAppDialog::Minimize(void)
+  {
+//--- set flag
+   m_minimized=true;
+//--- resize
+   Rebound(m_min_rect);
+//--- hide client area
+   ClientAreaVisible(false);
+  }
+//+------------------------------------------------------------------+
+//| Restore dialog window                                            |
+//+------------------------------------------------------------------+
+void CAppDialog::Maximize(void)
+  {
+//--- reset flag
+   m_minimized=false;
+//--- resize
+   Rebound(m_norm_rect);
+//--- show client area
+   ClientAreaVisible(true);
+  }
+//+------------------------------------------------------------------+
+//| Create unique prefix for object names                            |
+//+------------------------------------------------------------------+
+string CAppDialog::CreateInstanceId(void)
+  {
+   return(IntegerToString(rand(),5,'0'));
+  }
+//+------------------------------------------------------------------+
+//| Handler of the ON_APP_CLOSE external event                       |
+//+------------------------------------------------------------------+
+void CAppDialog::OnAnotherApplicationClose(const long &lparam,const double &dparam,const string &sparam)
+  {
+//--- exit if we are in the main window
+   if(m_subwin==0)
+      return;
+//--- exit if external program was closed in main window
+   if(lparam==0)
+      return;
+//--- get subwindow offset
+   SubwinOff();
+//--- exit if external program was closed in subwindow with greater number
+   if(lparam>=m_subwin)
+      return;
+//--- after all the checks we must change the subwindow
+//--- get the new number of subwindow
+   m_subwin=ChartWindowFind();
+//--- change short name
+   m_indicator_name=m_program_name+IntegerToString(m_subwin);
+   IndicatorSetString(INDICATOR_SHORTNAME,m_indicator_name);
+//--- change dialog title
+   Caption(m_program_name);
+//--- reassign IDs
+   Run();
+  }
+//+------------------------------------------------------------------+
+//| Save the current state of the program                            |
+//+------------------------------------------------------------------+
+void CAppDialog::IniFileSave(void)
+  {
+   string filename=IniFileName()+IniFileExt();
+   int handle=FileOpen(filename,FILE_WRITE|FILE_BIN|FILE_ANSI);
+//---
+   if(handle!=INVALID_HANDLE)
+     {
+      Save(handle);
+      FileClose(handle);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Read the previous state of the program                           |
+//+------------------------------------------------------------------+
+void CAppDialog::IniFileLoad(void)
+  {
+   string filename=IniFileName()+IniFileExt();
+   int handle=FileOpen(filename,FILE_READ|FILE_BIN|FILE_ANSI);
+//---
+   if(handle!=INVALID_HANDLE)
+     {
+      Load(handle);
+      FileClose(handle);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Generate the filename                                            |
+//+------------------------------------------------------------------+
+string CAppDialog::IniFileName(void) const
+  {
+   string name;
+//---
+   name=(m_indicator_name!=NULL) ? m_indicator_name : m_program_name;
+//---
+   name+="_"+Symbol();
+   name+="_Ini";
+//---
+   return(name);
+  }
+//+------------------------------------------------------------------+
+//| Load data                                                        |
+//+------------------------------------------------------------------+
+bool CAppDialog::Load(const int file_handle)
+  {
+   if(CDialog::Load(file_handle))
+     {
+      if(m_minimized)
+        {
+         m_button_minmax.Pressed(true);
+         Minimize();
+        }
+      else
+        {
+         m_button_minmax.Pressed(false);
+         Maximize();
+        }
+      int prev_deinit_reason=FileReadInteger(file_handle);
+      if(prev_deinit_reason==REASON_CHARTCLOSE || prev_deinit_reason==REASON_CLOSE)
+        {
+         //--- if the previous time program ended after closing the chart window,
+         //--- delete object left since the last start of the program
+         string prev_instance_id=IntegerToString(FileReadInteger(file_handle),5,'0');
+         if(prev_instance_id!=m_instance_id)
+           {
+            long chart_id=m_chart.ChartId();
+            int  total=ObjectsTotal(chart_id,m_subwin);
+            for(int i=total-1;i>=0;i--)
+              {
+               string obj_name=ObjectName(chart_id,i,m_subwin);
+               if(StringFind(obj_name,prev_instance_id)==0)
+                  ObjectDelete(chart_id,obj_name);
+              }
+           }
+        }
+      return(true);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Save data                                                        |
+//+------------------------------------------------------------------+
+bool CAppDialog::Save(const int file_handle)
+  {
+   if(CDialog::Save(file_handle))
+     {
+      FileWriteInteger(file_handle,m_deinit_reason);
+      FileWriteInteger(file_handle,(int)StringToInteger(m_instance_id));
+      return(true);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Edit.mqh b/Include/Controls/Edit.mqh
new file mode 100644
index 0000000..e2e7538
--- /dev/null
+++ b/Include/Controls/Edit.mqh
@@ -0,0 +1,187 @@
+//+------------------------------------------------------------------+
+//|                                                         Edit.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndObj.mqh"
+#include <ChartObjects\ChartObjectsTxtControls.mqh>
+//+------------------------------------------------------------------+
+//| Class CEdit                                                      |
+//| Usage: control that is displayed by                              |
+//|             the CChartObjectEdit object                          |
+//+------------------------------------------------------------------+
+class CEdit : public CWndObj
+  {
+private:
+   CChartObjectEdit  m_edit;                // chart object
+   //--- parameters of the chart object
+   bool              m_read_only;           // "read-only" mode flag
+   ENUM_ALIGN_MODE   m_align_mode;          // align mode
+
+public:
+                     CEdit(void);
+                    ~CEdit(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- parameters of the chart object
+   bool              ReadOnly(void)         const { return(m_read_only);                          }
+   bool              ReadOnly(const bool flag);
+   ENUM_ALIGN_MODE   TextAlign(void)        const { return(m_align_mode);                         }
+   bool              TextAlign(const ENUM_ALIGN_MODE align);
+   //--- data access
+   string            Text(void)             const { return(m_edit.Description());                 }
+
+protected:
+   //--- handlers of object events
+   virtual bool      OnObjectEndEdit(void);
+   //--- handlers of object settings
+   virtual bool      OnSetText(void)              { return(m_edit.Description(m_text));           }
+   virtual bool      OnSetColor(void)             { return(m_edit.Color(m_color));                }
+   virtual bool      OnSetColorBackground(void)   { return(m_edit.BackColor(m_color_background)); }
+   virtual bool      OnSetColorBorder(void)       { return(m_edit.BorderColor(m_color_border));   }
+   virtual bool      OnSetFont(void)              { return(m_edit.Font(m_font));                  }
+   virtual bool      OnSetFontSize(void)          { return(m_edit.FontSize(m_font_size));         }
+   virtual bool      OnSetZOrder(void)            { return(m_edit.Z_Order(m_zorder));             }
+   //--- internal event handlers
+   virtual bool      OnCreate(void);
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnMove(void);
+   virtual bool      OnResize(void);
+   virtual bool      OnChange(void);
+   virtual bool      OnClick(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+bool CEdit::OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam)
+  {
+   if(m_name==sparam && id==CHARTEVENT_OBJECT_ENDEDIT)
+      return(OnObjectEndEdit());
+//--- event was not handled
+   return(CWndObj::OnEvent(id,lparam,dparam,sparam));
+  }
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CEdit::CEdit(void) : m_read_only(false),
+                     m_align_mode(ALIGN_LEFT)
+  {
+   m_color           =CONTROLS_EDIT_COLOR;
+   m_color_background=CONTROLS_EDIT_COLOR_BG;
+   m_color_border    =CONTROLS_EDIT_COLOR_BORDER;
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CEdit::~CEdit(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CEdit::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndObj::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create the chart object
+   if(!m_edit.Create(chart,name,subwin,x1,y1,Width(),Height()))
+      return(false);
+//--- call the settings handler
+   return(OnChange());
+  }
+//+------------------------------------------------------------------+
+//| Set parameter                                                    |
+//+------------------------------------------------------------------+
+bool CEdit::ReadOnly(const bool flag)
+  {
+//--- save new value of parameter
+   m_read_only=flag;
+//--- set up the chart object
+   return(m_edit.ReadOnly(flag));
+  }
+//+------------------------------------------------------------------+
+//| Set parameter                                                    |
+//+------------------------------------------------------------------+
+bool CEdit::TextAlign(const ENUM_ALIGN_MODE align)
+  {
+//--- save new value of parameter
+   m_align_mode=align;
+//--- set up the chart object
+   return(m_edit.TextAlign(align));
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart                                           |
+//+------------------------------------------------------------------+
+bool CEdit::OnCreate(void)
+  {
+//--- create the chart object by previously set parameters
+   return(m_edit.Create(m_chart_id,m_name,m_subwin,m_rect.left,m_rect.top,m_rect.Width(),m_rect.Height()));
+  }
+//+------------------------------------------------------------------+
+//| Display object on chart                                          |
+//+------------------------------------------------------------------+
+bool CEdit::OnShow(void)
+  {
+   return(m_edit.Timeframes(OBJ_ALL_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Hide object from chart                                           |
+//+------------------------------------------------------------------+
+bool CEdit::OnHide(void)
+  {
+   return(m_edit.Timeframes(OBJ_NO_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the chart object                            |
+//+------------------------------------------------------------------+
+bool CEdit::OnMove(void)
+  {
+//--- position the chart object
+   return(m_edit.X_Distance(m_rect.left) && m_edit.Y_Distance(m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Resize the chart object                                          |
+//+------------------------------------------------------------------+
+bool CEdit::OnResize(void)
+  {
+//--- resize the chart object
+   return(m_edit.X_Size(m_rect.Width()) && m_edit.Y_Size(m_rect.Height()));
+  }
+//+------------------------------------------------------------------+
+//| Set up the chart object                                          |
+//+------------------------------------------------------------------+
+bool CEdit::OnChange(void)
+  {
+//--- set up the chart object
+   return(CWndObj::OnChange() && ReadOnly(m_read_only) && TextAlign(m_align_mode));
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "End of editing" event                            |
+//+------------------------------------------------------------------+
+bool CEdit::OnObjectEndEdit(void)
+  {
+//--- send the ON_END_EDIT notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_END_EDIT,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "click" event                                     |
+//+------------------------------------------------------------------+
+bool CEdit::OnClick(void)
+  {
+//--- if editing is enabled, send the ON_START_EDIT notification
+   if(!m_read_only)
+     {
+      EventChartCustom(CONTROLS_SELF_MESSAGE,ON_START_EDIT,m_id,0.0,m_name);
+      //--- handled
+      return(true);
+     }
+//--- else send the ON_CLICK notification
+   return(CWnd::OnClick());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Label.mqh b/Include/Controls/Label.mqh
new file mode 100644
index 0000000..d1095a0
--- /dev/null
+++ b/Include/Controls/Label.mqh
@@ -0,0 +1,93 @@
+//+------------------------------------------------------------------+
+//|                                                        Label.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndObj.mqh"
+#include <ChartObjects\ChartObjectsTxtControls.mqh>
+//+------------------------------------------------------------------+
+//| Class CLabel                                                     |
+//| Usage: control that is displayed by                              |
+//|             the CChartObjectLabel object                         |
+//+------------------------------------------------------------------+
+class CLabel : public CWndObj
+  {
+private:
+   CChartObjectLabel m_label;               // chart object
+
+public:
+                     CLabel(void);
+                    ~CLabel(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+
+protected:
+   //--- handlers of object settings
+   virtual bool      OnSetText(void)     { return(m_label.Description(m_text));   }
+   virtual bool      OnSetColor(void)    { return(m_label.Color(m_color));        }
+   virtual bool      OnSetFont(void)     { return(m_label.Font(m_font));          }
+   virtual bool      OnSetFontSize(void) { return(m_label.FontSize(m_font_size)); }
+   //--- internal event handlers
+   virtual bool      OnCreate(void);
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnMove(void);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CLabel::CLabel(void)
+  {
+   m_color=CONTROLS_LABEL_COLOR;
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CLabel::~CLabel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CLabel::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndObj::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create the chart object
+   if(!m_label.Create(chart,name,subwin,x1,y1))
+      return(false);
+//--- call the settings handler
+   return(OnChange());
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart                                           |
+//+------------------------------------------------------------------+
+bool CLabel::OnCreate(void)
+  {
+//--- create the chart object by previously set parameters
+   return(m_label.Create(m_chart_id,m_name,m_subwin,m_rect.left,m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Display object on chart                                          |
+//+------------------------------------------------------------------+
+bool CLabel::OnShow(void)
+  {
+   return(m_label.Timeframes(OBJ_ALL_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Hide object from chart                                           |
+//+------------------------------------------------------------------+
+bool CLabel::OnHide(void)
+  {
+   return(m_label.Timeframes(OBJ_NO_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the chart object                            |
+//+------------------------------------------------------------------+
+bool CLabel::OnMove(void)
+  {
+//--- position the chart object
+   return(m_label.X_Distance(m_rect.left) && m_label.Y_Distance(m_rect.top));
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/ListView.mqh b/Include/Controls/ListView.mqh
new file mode 100644
index 0000000..00b3ff3
--- /dev/null
+++ b/Include/Controls/ListView.mqh
@@ -0,0 +1,544 @@
+//+------------------------------------------------------------------+
+//|                                                     ListView.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndClient.mqh"
+#include "Edit.mqh"
+#include <Arrays\ArrayString.mqh>
+#include <Arrays\ArrayLong.mqh>
+//+------------------------------------------------------------------+
+//| Class CListView                                                  |
+//| Usage: display lists                                             |
+//+------------------------------------------------------------------+
+class CListView : public CWndClient
+  {
+private:
+   //--- dependent controls
+   CEdit             m_rows[];              // array of the row objects
+   //--- set up
+   int               m_offset;              // index of first visible row in array of rows
+   int               m_total_view;          // number of visible rows
+   int               m_item_height;         // height of visible row
+   bool              m_height_variable;     // ïðèçíàê ïåðåìåííîé âûñîòû ñïèñêà
+   //--- data
+   CArrayString      m_strings;             // array of rows
+   CArrayLong        m_values;              // array of values
+   int               m_current;             // index of current row in array of rows
+
+public:
+                     CListView(void);
+                    ~CListView(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   virtual void      Destroy(const int reason=0);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- set up
+   bool              TotalView(const int value);
+   //--- fill
+   virtual bool      AddItem(const string item,const long value=0);
+   //--- data
+   virtual bool      ItemAdd(const string item,const long value=0);
+   virtual bool      ItemInsert(const int index,const string item,const long value=0);
+   virtual bool      ItemUpdate(const int index,const string item,const long value=0);
+   virtual bool      ItemDelete(const int index);
+   virtual bool      ItemsClear(void);
+   //--- data
+   int               Current(void) { return(m_current);               }
+   string            Select(void)  { return(m_strings.At(m_current)); }
+   bool              Select(const int index);
+   bool              SelectByText(const string text);
+   bool              SelectByValue(const long value);
+   //--- data (read only)
+   long              Value(void) { return(m_values.At(m_current));  }
+   //--- state
+   virtual bool      Show(void);
+
+protected:
+   //--- create dependent controls
+   bool              CreateRow(const int index);
+   //--- event handlers
+   virtual bool      OnResize(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnVScrollShow(void);
+   virtual bool      OnVScrollHide(void);
+   virtual bool      OnScrollLineDown(void);
+   virtual bool      OnScrollLineUp(void);
+   virtual bool      OnItemClick(const int index);
+   //--- redraw
+   bool              Redraw(void);
+   bool              RowState(const int index,const bool select);
+   bool              CheckView(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CListView)
+   ON_INDEXED_EVENT(ON_CLICK,m_rows,OnItemClick)
+EVENT_MAP_END(CWndClient)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CListView::CListView(void) : m_offset(0),
+                             m_total_view(0),
+                             m_item_height(CONTROLS_LIST_ITEM_HEIGHT),
+                             m_current(CONTROLS_INVALID_INDEX),
+                             m_height_variable(false)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CListView::~CListView(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CListView::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+   int y=y2;
+//--- if the number of visible rows is previously determined, adjust the vertical size
+   if(!TotalView((y2-y1)/m_item_height))
+      y=m_item_height+y1+2*CONTROLS_BORDER_WIDTH;
+//--- check the number of visible rows
+   if(m_total_view<1)
+      return(false);
+//--- call method of the parent class
+   if(!CWndClient::Create(chart,name,subwin,x1,y1,x2,y))
+      return(false);
+//--- set up
+   if(!m_background.ColorBackground(CONTROLS_LIST_COLOR_BG))
+      return(false);
+   if(!m_background.ColorBorder(CONTROLS_LIST_COLOR_BORDER))
+      return(false);
+//--- create dependent controls
+   ArrayResize(m_rows,m_total_view);
+   for(int i=0;i<m_total_view;i++)
+     {
+      if(!CreateRow(i))
+         return(false);
+      if(m_height_variable && i>0)
+         m_rows[i].Hide();
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Delete group of controls                                         |
+//+------------------------------------------------------------------+
+void CListView::Destroy(const int reason)
+  {
+//--- call of the method of the parent class
+   CWndClient::Destroy(reason);
+//--- clear items
+   m_strings.Clear();
+   m_values.Clear();
+//---
+   m_offset    =0;
+   m_total_view=0;
+  }
+//+------------------------------------------------------------------+
+//| Set parameter                                                    |
+//+------------------------------------------------------------------+
+bool CListView::TotalView(const int value)
+  {
+//--- if parameter is not equal to 0, modifications are not possible
+   if(m_total_view!=0)
+     {
+      m_height_variable=true;
+      return(false);
+     }
+//--- save value
+   m_total_view=value;
+//--- parameter has been changed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Makes the control visible                                        |
+//+------------------------------------------------------------------+
+bool CListView::Show(void)
+  {
+//--- call of the method of the parent class
+   CWndClient::Show();
+//--- number of items
+   int total=m_strings.Total();
+//---
+   if(total==0)
+      total=1;
+//---
+   if(m_height_variable && total<m_total_view)
+      for(int i=total;i<m_total_view;i++)
+         m_rows[i].Hide();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create "row"                                                     |
+//+------------------------------------------------------------------+
+bool CListView::CreateRow(const int index)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH+m_item_height*index;
+   int x2=Width()-2*CONTROLS_BORDER_WIDTH;
+   int y2=y1+m_item_height;
+//--- create
+   if(!m_rows[index].Create(m_chart_id,m_name+"Item"+IntegerToString(index),m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_rows[index].Text(""))
+      return(false);
+   if(!m_rows[index].ReadOnly(true))
+      return(false);
+   if(!RowState(index,false))
+      return(false);
+   if(!Add(m_rows[index]))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Add item (row)                                                   |
+//+------------------------------------------------------------------+
+bool CListView::AddItem(const string item,const long value)
+  {
+//--- method left for compatibility with previous version
+   return(ItemAdd(item,value));
+  }
+//+------------------------------------------------------------------+
+//| Add item (row)                                                   |
+//+------------------------------------------------------------------+
+bool CListView::ItemAdd(const string item,const long value)
+  {
+//--- add
+   if(!m_strings.Add(item))
+      return(false);
+   if(!m_values.Add((value)?value:m_values.Total()))
+      return(false);
+//--- number of items
+   int total=m_strings.Total();
+//--- exit if number of items does not exceed the size of visible area
+   if(total<m_total_view+1)
+     {
+      if(m_height_variable && total!=1)
+        {
+         Height(total*m_item_height+2*CONTROLS_BORDER_WIDTH);
+         if(IS_VISIBLE)
+            m_rows[total-1].Show();
+        }
+      return(Redraw());
+     }
+//--- if number of items exceeded the size of visible area
+   if(total==m_total_view+1)
+     {
+      //--- enable vertical scrollbar
+      if(!VScrolled(true))
+         return(false);
+      //--- and immediately make it invisible (if needed)
+      if(IS_VISIBLE && !OnVScrollShow())
+         return(false);
+     }
+//--- set up the scrollbar
+   m_scroll_v.MaxPos(m_strings.Total()-m_total_view);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Insert item (row)                                                |
+//+------------------------------------------------------------------+
+bool CListView::ItemInsert(const int index,const string item,const long value)
+  {
+//--- insert
+   if(!m_strings.Insert(item,index))
+      return(false);
+   if(!m_values.Insert(value,index))
+      return(false);
+//--- number of items
+   int total=m_strings.Total();
+//--- exit if number of items does not exceed the size of visible area
+   if(total<m_total_view+1)
+     {
+      if(m_height_variable && total!=1)
+        {
+         Height(total*m_item_height+2*CONTROLS_BORDER_WIDTH);
+         if(IS_VISIBLE)
+            m_rows[total-1].Show();
+        }
+      return(Redraw());
+     }
+//--- if number of items exceeded the size of visible area
+   if(total==m_total_view+1)
+     {
+      //--- enable vertical scrollbar
+      if(!VScrolled(true))
+         return(false);
+      //--- and immediately make it invisible (if needed)
+      if(IS_VISIBLE && !OnVScrollShow())
+         return(false);
+     }
+//--- set up the scrollbar
+   m_scroll_v.MaxPos(m_strings.Total()-m_total_view);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Update item (row)                                                |
+//+------------------------------------------------------------------+
+bool CListView::ItemUpdate(const int index,const string item,const long value)
+  {
+//--- update
+   if(!m_strings.Update(index,item))
+      return(false);
+   if(!m_values.Update(index,value))
+      return(false);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Delete item (row)                                                |
+//+------------------------------------------------------------------+
+bool CListView::ItemDelete(const int index)
+  {
+//--- delete
+   if(!m_strings.Delete(index))
+      return(false);
+   if(!m_values.Delete(index))
+      return(false);
+//--- number of items
+   int total=m_strings.Total();
+//--- exit if number of items does not exceed the size of visible area
+   if(total<m_total_view)
+     {
+      if(m_height_variable && total!=0)
+        {
+         Height(total*m_item_height+2*CONTROLS_BORDER_WIDTH);
+         m_rows[total].Hide();
+        }
+      return(Redraw());
+     }
+//--- if number of items exceeded the size of visible area
+   if(total==m_total_view)
+     {
+      //--- disable vertical scrollbar
+      if(!VScrolled(false))
+         return(false);
+      //--- and immediately make it unvisible
+      if(!OnVScrollHide())
+         return(false);
+     }
+//--- set up the scrollbar
+   m_scroll_v.MaxPos(m_strings.Total()-m_total_view);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Delete all items                                                 |
+//+------------------------------------------------------------------+
+bool CListView::ItemsClear(void)
+  {
+   m_offset=0;
+//--- clear
+   if(!m_strings.Shutdown())
+      return(false);
+   if(!m_values.Shutdown())
+      return(false);
+//---
+   if(m_height_variable)
+     {
+      Height(m_item_height+2*CONTROLS_BORDER_WIDTH);
+      for(int i=1;i<m_total_view;i++)
+         m_rows[i].Hide();
+     }
+//--- disable vertical scrollbar
+   if(!VScrolled(false))
+      return(false);
+//--- and immediately make it unvisible (if needed)
+   if(!OnVScrollHide())
+      return(false);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Sett current item                                                |
+//+------------------------------------------------------------------+
+bool CListView::Select(const int index)
+  {
+//--- check index
+   if(index>=m_strings.Total())
+      return(false);
+   if(index<0 && index!=CONTROLS_INVALID_INDEX)
+      return(false);
+//--- unselect
+   if(m_current!=CONTROLS_INVALID_INDEX)
+      RowState(m_current-m_offset,false);
+//--- select
+   if(index!=CONTROLS_INVALID_INDEX)
+      RowState(index-m_offset,true);
+//--- save value
+   m_current=index;
+//--- succeed
+   return(CheckView());
+  }
+//+------------------------------------------------------------------+
+//| Set current item (by text)                                       |
+//+------------------------------------------------------------------+
+bool CListView::SelectByText(const string text)
+  {
+//--- find text
+   int index=m_strings.SearchLinear(text);
+//--- if text is not found, exit without changing the selection
+   if(index==CONTROLS_INVALID_INDEX)
+      return(false);
+//--- change selection
+   return(Select(index));
+  }
+//+------------------------------------------------------------------+
+//| Set current item (by value)                                      |
+//+------------------------------------------------------------------+
+bool CListView::SelectByValue(const long value)
+  {
+//--- find value
+   int index=m_values.SearchLinear(value);
+//--- if value is not found, exit without changing the selection
+   if(index==CONTROLS_INVALID_INDEX)
+      return(false);
+//--- change selection
+   return(Select(index));
+  }
+//+------------------------------------------------------------------+
+//| Redraw                                                           |
+//+------------------------------------------------------------------+
+bool CListView::Redraw(void)
+  {
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- copy text
+      if(!m_rows[i].Text(m_strings.At(i+m_offset)))
+         return(false);
+      //--- select
+      if(!RowState(i,(m_current==i+m_offset)))
+         return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Change state                                                     |
+//+------------------------------------------------------------------+
+bool CListView::RowState(const int index,const bool select)
+  {
+//--- check index
+   if(index<0 || index>=ArraySize(m_rows))
+      return(true);
+//--- determine colors
+   color  text_color=(select) ? CONTROLS_LISTITEM_COLOR_TEXT_SEL : CONTROLS_LISTITEM_COLOR_TEXT;
+   color  back_color=(select) ? CONTROLS_LISTITEM_COLOR_BG_SEL : CONTROLS_LISTITEM_COLOR_BG;
+//--- get pointer
+   CEdit *item=GetPointer(m_rows[index]);
+//--- recolor the "row"
+   return(item.Color(text_color) && item.ColorBackground(back_color) && item.ColorBorder(back_color));
+  }
+//+------------------------------------------------------------------+
+//| Check visibility of selected row                                 |
+//+------------------------------------------------------------------+
+bool CListView::CheckView(void)
+  {
+//--- check visibility
+   if(m_current>=m_offset && m_current<m_offset+m_total_view)
+      return(true);
+//--- selected row is not visible
+   int total=m_strings.Total();
+   m_offset=(total-m_current>m_total_view) ? m_current : total-m_total_view;
+//--- adjust the scrollbar
+   m_scroll_v.CurrPos(m_offset);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of resizing                                              |
+//+------------------------------------------------------------------+
+bool CListView::OnResize(void)
+  {
+//--- call of the method of the parent class
+   if(!CWndClient::OnResize())
+      return(false);
+//--- set up the size of "row"
+   if(VScrolled())
+      OnVScrollShow();
+   else
+      OnVScrollHide();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Show vertical scrollbar" event                   |
+//+------------------------------------------------------------------+
+bool CListView::OnVScrollShow(void)
+  {
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- resize "rows" according to shown vertical scrollbar
+      m_rows[i].Width(Width()-(CONTROLS_SCROLL_SIZE+CONTROLS_BORDER_WIDTH));
+     }
+//--- check visibility
+   if(!IS_VISIBLE)
+     {
+      m_scroll_v.Visible(false);
+      return(true);
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Hide vertical scrollbar" event                   |
+//+------------------------------------------------------------------+
+bool CListView::OnVScrollHide(void)
+  {
+//--- check visibility
+   if(!IS_VISIBLE)
+      return(true);
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- resize "rows" according to hidden vertical scroll bar
+      m_rows[i].Width(Width()-2*CONTROLS_BORDER_WIDTH);
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Scroll up for one row" event                     |
+//+------------------------------------------------------------------+
+bool CListView::OnScrollLineUp(void)
+  {
+//--- get new offset
+   m_offset=m_scroll_v.CurrPos();
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Scroll down for one row" event                   |
+//+------------------------------------------------------------------+
+bool CListView::OnScrollLineDown(void)
+  {
+//--- get new offset
+   m_offset=m_scroll_v.CurrPos();
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on row                                          |
+//+------------------------------------------------------------------+
+bool CListView::OnItemClick(const int index)
+  {
+//--- select "row"
+   Select(index+m_offset);
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Panel.mqh b/Include/Controls/Panel.mqh
new file mode 100644
index 0000000..84fd9f8
--- /dev/null
+++ b/Include/Controls/Panel.mqh
@@ -0,0 +1,124 @@
+//+------------------------------------------------------------------+
+//|                                                        Panel.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndObj.mqh"
+#include <ChartObjects\ChartObjectsTxtControls.mqh>
+//+------------------------------------------------------------------+
+//| Class CPanel                                                     |
+//| Usage: control that is displayed by                              |
+//|             the CChartObjectRectLabel object                     |
+//+------------------------------------------------------------------+
+class CPanel : public CWndObj
+  {
+private:
+   CChartObjectRectLabel m_rectangle;       // chart object
+   //--- parameters of the chart object
+   ENUM_BORDER_TYPE  m_border;              // border type
+
+public:
+                     CPanel(void);
+                    ~CPanel(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- parameters of the chart object
+   ENUM_BORDER_TYPE  BorderType(void)       const { return(m_border);                                  }
+   bool              BorderType(const ENUM_BORDER_TYPE type);
+
+protected:
+   //--- handlers of object settings
+   virtual bool      OnSetText(void)              { return(m_rectangle.Description(m_text));           }
+   virtual bool      OnSetColorBackground(void)   { return(m_rectangle.BackColor(m_color_background)); }
+   virtual bool      OnSetColorBorder(void)       { return(m_rectangle.Color(m_color_border));         }
+   //--- internal event handlers
+   virtual bool      OnCreate(void);
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnMove(void);
+   virtual bool      OnResize(void);
+   virtual bool      OnChange(void);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CPanel::CPanel(void) : m_border(BORDER_FLAT)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CPanel::~CPanel(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CPanel::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndObj::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create the chart object
+   if(!m_rectangle.Create(chart,name,subwin,x1,y1,Width(),Height()))
+      return(false);
+//--- call the settings handler
+   return(OnChange());
+  }
+//+------------------------------------------------------------------+
+//| Set border type                                                  |
+//+------------------------------------------------------------------+
+bool CPanel::BorderType(const ENUM_BORDER_TYPE type)
+  {
+//--- save new value of parameter
+   m_border=type;
+//--- set up the chart object
+   return(m_rectangle.BorderType(type));
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart                                           |
+//+------------------------------------------------------------------+
+bool CPanel::OnCreate(void)
+  {
+//--- create the chart object by previously set parameters
+   return(m_rectangle.Create(m_chart_id,m_name,m_subwin,m_rect.left,m_rect.top,m_rect.Width(),m_rect.Height()));
+  }
+//+------------------------------------------------------------------+
+//| Display object on chart                                          |
+//+------------------------------------------------------------------+
+bool CPanel::OnShow(void)
+  {
+   return(m_rectangle.Timeframes(OBJ_ALL_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Hide object from chart                                           |
+//+------------------------------------------------------------------+
+bool CPanel::OnHide(void)
+  {
+   return(m_rectangle.Timeframes(OBJ_NO_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the chart object                            |
+//+------------------------------------------------------------------+
+bool CPanel::OnMove(void)
+  {
+//--- position the chart object
+   return(m_rectangle.X_Distance(m_rect.left) && m_rectangle.Y_Distance(m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Resize the chart object                                          |
+//+------------------------------------------------------------------+
+bool CPanel::OnResize(void)
+  {
+//--- resize the chart object
+   return(m_rectangle.X_Size(m_rect.Width()) && m_rectangle.Y_Size(m_rect.Height()));
+  }
+//+------------------------------------------------------------------+
+//| Set up the chart object                                          |
+//+------------------------------------------------------------------+
+bool CPanel::OnChange(void)
+  {
+//--- set up the chart object
+   return(CWndObj::OnChange() && m_rectangle.BorderType(m_border));
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Picture.mqh b/Include/Controls/Picture.mqh
new file mode 100644
index 0000000..771c29f
--- /dev/null
+++ b/Include/Controls/Picture.mqh
@@ -0,0 +1,125 @@
+//+------------------------------------------------------------------+
+//|                                                      Picture.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndObj.mqh"
+#include <ChartObjects\ChartObjectsBmpControls.mqh>
+//+------------------------------------------------------------------+
+//| Class CPicture                                                   |
+//| Note: image displayed by                                         |
+//|             the CChartObjectBmpLabel object                      |
+//+------------------------------------------------------------------+
+class CPicture : public CWndObj
+  {
+private:
+   CChartObjectBmpLabel m_picture;          // chart object
+   //--- parameters of the chart object
+   int               m_border;              // border width
+   string            m_bmp_name;            // filename
+
+public:
+                     CPicture(void);
+                    ~CPicture(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- parameters of the chart object
+   int               Border(void) const { return(m_border); }
+   bool              Border(const int value);
+   string            BmpName(void) const { return(m_bmp_name); }
+   bool              BmpName(const string name);
+
+protected:
+   //--- internal event handlers
+   virtual bool      OnCreate(void);
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnMove(void);
+   virtual bool      OnChange(void);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CPicture::CPicture(void) : m_border(0),
+                           m_bmp_name(NULL)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CPicture::~CPicture(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CPicture::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndObj::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create the chart object
+   if(!m_picture.Create(chart,name,subwin,x1,y1))
+      return(false);
+//--- call the settings handler
+   return(OnChange());
+  }
+//+------------------------------------------------------------------+
+//| Set border width                                                 |
+//+------------------------------------------------------------------+
+bool CPicture::Border(const int value)
+  {
+//--- save new value of parameter
+   m_border=value;
+//--- set up the chart object
+   return(m_picture.Width(value));
+  }
+//+------------------------------------------------------------------+
+//| Set image                                                        |
+//+------------------------------------------------------------------+
+bool CPicture::BmpName(const string name)
+  {
+//--- save new value of parameter
+   m_bmp_name=name;
+//--- set up the chart object
+   return(m_picture.BmpFileOn(name));
+  }
+//+------------------------------------------------------------------+
+//| Create object on chart                                           |
+//+------------------------------------------------------------------+
+bool CPicture::OnCreate(void)
+  {
+//--- create the chart object by previously set parameters
+   return(m_picture.Create(m_chart_id,m_name,m_subwin,m_rect.left,m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Display object on chart                                          |
+//+------------------------------------------------------------------+
+bool CPicture::OnShow(void)
+  {
+   return(m_picture.Timeframes(OBJ_ALL_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Hide object from chart                                           |
+//+------------------------------------------------------------------+
+bool CPicture::OnHide(void)
+  {
+   return(m_picture.Timeframes(OBJ_NO_PERIODS));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the chart object                            |
+//+------------------------------------------------------------------+
+bool CPicture::OnMove(void)
+  {
+//--- position the chart object
+   return(m_picture.X_Distance(m_rect.left) && m_picture.Y_Distance(m_rect.top));
+  }
+//+------------------------------------------------------------------+
+//| Set up the chart object                                          |
+//+------------------------------------------------------------------+
+bool CPicture::OnChange(void)
+  {
+//--- set up the chart object
+   return(m_picture.Width(m_border) && m_picture.BmpFileOn(m_bmp_name));
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/RadioButton.mqh b/Include/Controls/RadioButton.mqh
new file mode 100644
index 0000000..4f4350d
--- /dev/null
+++ b/Include/Controls/RadioButton.mqh
@@ -0,0 +1,160 @@
+//+------------------------------------------------------------------+
+//|                                                  RadioButton.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "BmpButton.mqh"
+#include "Edit.mqh"
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+#resource "res\\RadioButtonOn.bmp"
+#resource "res\\RadioButtonOff.bmp"
+//+------------------------------------------------------------------+
+//| Class CRadioButton                                               |
+//| Usage: class that implements the "RadioButton" control           |
+//+------------------------------------------------------------------+
+class CRadioButton : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CBmpButton        m_button;              // button object
+   CEdit             m_label;               // label object
+
+public:
+                     CRadioButton(void);
+                    ~CRadioButton(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- settings
+   string            Text(void)          const { return(m_label.Text());         }
+   bool              Text(const string value)  { return(m_label.Text(value));    }
+   color             Color(void)         const { return(m_label.Color());        }
+   bool              Color(const color value)  { return(m_label.Color(value));   }
+   //--- state
+   bool              State(void)         const { return(m_button.Pressed());     }
+   bool              State(const bool flag)    { return(m_button.Pressed(flag)); }
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateButton(void);
+   virtual bool      CreateLabel(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickButton(void);
+   virtual bool      OnClickLabel(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CRadioButton)
+   ON_EVENT(ON_CLICK,m_button,OnClickButton)
+   ON_EVENT(ON_CLICK,m_label,OnClickLabel)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CRadioButton::CRadioButton(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CRadioButton::~CRadioButton(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CRadioButton::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateButton())
+      return(false);
+   if(!CreateLabel())
+      return(false);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create button                                                    |
+//+------------------------------------------------------------------+
+bool CRadioButton::CreateButton(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_RADIO_BUTTON_X_OFF;
+   int y1=CONTROLS_RADIO_BUTTON_Y_OFF;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE-CONTROLS_BORDER_WIDTH;
+//--- create
+   if(!m_button.Create(m_chart_id,m_name+"Button",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_button.BmpNames("::res\\RadioButtonOff.bmp","::res\\RadioButtonOn.bmp"))
+      return(false);
+   if(!Add(m_button))
+      return(false);
+   m_button.Locking(true);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create label                                                     |
+//+------------------------------------------------------------------+
+bool CRadioButton::CreateLabel(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_RADIO_LABEL_X_OFF;
+   int y1=CONTROLS_RADIO_LABEL_Y_OFF;
+   int x2=Width();
+   int y2=Height();
+//--- create
+   if(!m_label.Create(m_chart_id,m_name+"Label",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_label.Text(m_name))
+      return(false);
+   if(!Add(m_label))
+      return(false);
+   m_label.ReadOnly(true);
+   m_label.ColorBackground(CONTROLS_CHECKGROUP_COLOR_BG);
+   m_label.ColorBorder(CONTROLS_CHECKGROUP_COLOR_BG);
+//--- succeeded
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on button                                       |
+//+------------------------------------------------------------------+
+bool CRadioButton::OnClickButton(void)
+  {
+//--- if button is in the "turned off" state, turn it on again and complete the handling
+//--- this is due to that radio button can not be turned off by clicking on it (it can be only turned on)
+   if(!m_button.Pressed())
+     {
+      //--- turn on the radio button
+      if(!m_button.Pressed(true))
+         return(false);
+     }
+//--- send the "changed state" event
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on label                                        |
+//+------------------------------------------------------------------+
+bool CRadioButton::OnClickLabel(void)
+  {
+//--- if button is in the "turned on" state, simply complete the handling
+//--- this is due to that radio button can not be turned off by clicking on it (it can be only turned on)
+   if(m_button.Pressed())
+      return(true);
+//--- turn on the radio button
+   m_button.Pressed(true);
+//--- return the result of the button click handler
+   return(OnClickButton());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/RadioGroup.mqh b/Include/Controls/RadioGroup.mqh
new file mode 100644
index 0000000..f2fa8d3
--- /dev/null
+++ b/Include/Controls/RadioGroup.mqh
@@ -0,0 +1,361 @@
+//+------------------------------------------------------------------+
+//|                                                   RadioGroup.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndClient.mqh"
+#include "RadioButton.mqh"
+#include <Arrays\ArrayString.mqh>
+#include <Arrays\ArrayLong.mqh>
+//+------------------------------------------------------------------+
+//| Class CRadioGroup                                                |
+//| Usage: view and edit radio buttons                               |
+//+------------------------------------------------------------------+
+class CRadioGroup : public CWndClient
+  {
+private:
+   //--- dependent controls
+   CRadioButton      m_rows[];              // array of the row objects
+   //--- set up
+   int               m_offset;              // index of first visible row in array of rows
+   int               m_total_view;          // number of visible rows
+   int               m_item_height;         // height of visible row
+   //--- data
+   CArrayString      m_strings;             // array of rows
+   CArrayLong        m_values;              // array of values
+   int               m_current;             // index of current row in array of rows
+
+public:
+                     CRadioGroup(void);
+                    ~CRadioGroup(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   virtual void      Destroy(const int reason=0);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- fill
+   virtual bool      AddItem(const string item,const long value=0);
+   //--- data
+   long              Value(void) const { return(m_values.At(m_current)); }
+   bool              Value(const long value);
+   bool              ValueCheck(long value) const;
+   //--- state
+   virtual bool      Show(void);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   bool              CreateButton(const int index);
+   //--- handlers of the dependent controls events
+   virtual bool      OnVScrollShow(void);
+   virtual bool      OnVScrollHide(void);
+   virtual bool      OnScrollLineDown(void);
+   virtual bool      OnScrollLineUp(void);
+   virtual bool      OnChangeItem(const int row_index);
+   //--- redraw
+   bool              Redraw(void);
+   bool              RowState(const int index,const bool select);
+   void              Select(const int index);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CRadioGroup)
+   ON_INDEXED_EVENT(ON_CHANGE,m_rows,OnChangeItem)
+EVENT_MAP_END(CWndClient)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CRadioGroup::CRadioGroup(void) : m_offset(0),
+                                 m_total_view(0),
+                                 m_item_height(CONTROLS_LIST_ITEM_HEIGHT),
+                                 m_current(CONTROLS_INVALID_INDEX)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CRadioGroup::~CRadioGroup(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CRadioGroup::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- determine the number of visible rows
+   m_total_view=(y2-y1)/m_item_height;
+//--- check the number of visible rows
+   if(m_total_view<1)
+      return(false);
+//--- call method of the parent class
+   if(!CWndClient::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- set up
+   if(!m_background.ColorBackground(CONTROLS_RADIOGROUP_COLOR_BG))
+      return(false);
+   if(!m_background.ColorBorder(CONTROLS_RADIOGROUP_COLOR_BORDER))
+      return(false);
+//--- create dependent controls
+   ArrayResize(m_rows,m_total_view);
+   for(int i=0;i<m_total_view;i++)
+      if(!CreateButton(i))
+         return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Delete group of controls                                         |
+//+------------------------------------------------------------------+
+void CRadioGroup::Destroy(const int reason)
+  {
+//--- call of the method of the parent class
+   CWndClient::Destroy(reason);
+//--- clear items
+   m_strings.Clear();
+   m_values.Clear();
+  }
+//+------------------------------------------------------------------+
+//| Create "row"                                                     |
+//+------------------------------------------------------------------+
+bool CRadioGroup::CreateButton(const int index)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH+m_item_height*index;
+   int x2=Width()-CONTROLS_BORDER_WIDTH;
+   int y2=y1+m_item_height;
+//--- create
+   if(!m_rows[index].Create(m_chart_id,m_name+"Item"+IntegerToString(index),m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_rows[index].Text(""))
+      return(false);
+   if(!Add(m_rows[index]))
+      return(false);
+   m_rows[index].Hide();
+//---
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Add item (row)                                                   |
+//+------------------------------------------------------------------+
+bool CRadioGroup::AddItem(const string item,const long value)
+  {
+//--- check value
+   if(value!=0 && !ValueCheck(value))
+      return(false);
+//--- add
+   if(!m_strings.Add(item))
+      return(false);
+   if(!m_values.Add(value))
+      return(false);
+//--- number of items
+   int total=m_strings.Total();
+//--- exit if number of items does not exceed the size of visible area
+   if(total<m_total_view+1)
+     {
+      if(IS_VISIBLE && total!=0)
+         m_rows[total-1].Show();
+      return(Redraw());
+     }
+//--- if number of items exceeded the size of visible area
+   if(total==m_total_view+1)
+     {
+      //--- enable vertical scrollbar
+      if(!VScrolled(true))
+         return(false);
+      //--- and immediately make it invisible (if needed)
+      if(!IS_VISIBLE)
+         m_scroll_v.Visible(false);
+
+     }
+//--- set up the scrollbar
+   m_scroll_v.MaxPos(m_strings.Total()-m_total_view);
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CRadioGroup::Value(const long value)
+  {
+//--- çíà÷åíèå äîëæíî ïðèñóòñòâîâàòü â íàáîðå
+   int total=m_values.Total();
+//---
+   for(int i=0;i<total;i++)
+      if(m_values.At(i)==value)
+         Select(i+m_offset);
+//---
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CRadioGroup::ValueCheck(long value) const
+  {
+//--- ïðîâåðÿåìîå çíà÷åíèå íå äîëæíî äóáëèðîâàòü óæå ñóùåñòâóþùåå
+   int total=m_values.Total();
+//---
+   for(int i=0;i<total;i++)
+      if(m_values.At(i)==value)
+         return(false);
+//---
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Makes the group visible                                          |
+//+------------------------------------------------------------------+
+bool CRadioGroup::Show(void)
+  {
+//--- call of the method of the parent class
+   if(!CWndClient::Show())
+      return(false);
+//--- loop by rows
+   int total=m_values.Total();
+   for(int i=total;i<m_total_view;i++)
+      m_rows[i].Hide();
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CRadioGroup::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   FileWriteLong(file_handle,Value());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CRadioGroup::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   if(!FileIsEnding(file_handle))
+      Value(FileReadLong(file_handle));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Sett current item                                                |
+//+------------------------------------------------------------------+
+void CRadioGroup::Select(const int index)
+  {
+//--- disable the "ON" state
+   if(m_current!=-1)
+      RowState(m_current-m_offset,false);
+//--- enable the "ON" state
+   if(index!=-1)
+      RowState(index-m_offset,true);
+//--- save value
+   m_current=index;
+  }
+//+------------------------------------------------------------------+
+//| Redraw                                                           |
+//+------------------------------------------------------------------+
+bool CRadioGroup::Redraw(void)
+  {
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- copy text
+      if(!m_rows[i].Text(m_strings.At(i+m_offset)))
+         return(false);
+      //--- select
+      if(!RowState(i,(m_current==i+m_offset)))
+         return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Change state                                                     |
+//+------------------------------------------------------------------+
+bool CRadioGroup::RowState(const int index,const bool select)
+  {
+//--- check index
+   if(index<0 || index>=ArraySize(m_rows))
+      return(true);
+//--- change state
+   return(m_rows[index].State(select));
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Show vertical scrollbar" event                   |
+//+------------------------------------------------------------------+
+bool CRadioGroup::OnVScrollShow(void)
+  {
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- resize "rows" according to shown vertical scrollbar
+      m_rows[i].Width(Width()-(CONTROLS_SCROLL_SIZE+CONTROLS_BORDER_WIDTH));
+     }
+//--- check visibility
+   if(!IS_VISIBLE)
+     {
+      m_scroll_v.Visible(false);
+      return(true);
+     }
+//---
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Hide vertical scrollbar" event                   |
+//+------------------------------------------------------------------+
+bool CRadioGroup::OnVScrollHide(void)
+  {
+//--- check visibility
+   if(!IS_VISIBLE)
+      return(true);
+//--- loop by "rows"
+   for(int i=0;i<m_total_view;i++)
+     {
+      //--- resize "rows" according to hidden vertical scroll bar
+      m_rows[i].Width(Width()-CONTROLS_BORDER_WIDTH);
+     }
+//---
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Scroll up for one row" event                     |
+//+------------------------------------------------------------------+
+bool CRadioGroup::OnScrollLineUp(void)
+  {
+//--- get new offset
+   m_offset=m_scroll_v.CurrPos();
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Scroll down for one row" event                   |
+//+------------------------------------------------------------------+
+bool CRadioGroup::OnScrollLineDown(void)
+  {
+//--- get new offset
+   m_offset=m_scroll_v.CurrPos();
+//--- redraw
+   return(Redraw());
+  }
+//+------------------------------------------------------------------+
+//| Handler of changing a "row" state                                |
+//+------------------------------------------------------------------+
+bool CRadioGroup::OnChangeItem(const int row_index)
+  {
+//--- select "row"
+   Select(row_index+m_offset);
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Rect.mqh b/Include/Controls/Rect.mqh
new file mode 100644
index 0000000..3963291
--- /dev/null
+++ b/Include/Controls/Rect.mqh
@@ -0,0 +1,279 @@
+//+------------------------------------------------------------------+
+//|                                                         Rect.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//+------------------------------------------------------------------+
+//| Structure CPoint                                                 |
+//| Usage: point of chart in Cartesian coordinates                   |
+//+------------------------------------------------------------------+
+struct CPoint
+  {
+   int               x;                   // horizontal coordinate
+   int               y;                   // vertical coordinate
+  };
+//+------------------------------------------------------------------+
+//| Structure CSize                                                  |
+//| Usage: size of area of chart in Cartesian coordinates            |
+//+------------------------------------------------------------------+
+struct CSize
+  {
+   int               cx;                  // horizontal size
+   int               cy;                  // vertical size
+  };
+//+------------------------------------------------------------------+
+//| Structure CRect                                                  |
+//| Usage: area of chart in Cartesian coordinates                    |
+//+------------------------------------------------------------------+
+struct CRect
+  {
+   int               left;                // left coordinate
+   int               top;                 // top coordinate
+   int               right;               // right coordinate
+   int               bottom;              // bottom coordinate
+
+   //--- methods
+   CPoint            LeftTop(void)            const;
+   void              LeftTop(const int x,const int y);
+   void              LeftTop(const CPoint& point);
+   CPoint            RightBottom(void)        const;
+   void              RightBottom(const int x,const int y);
+   void              RightBottom(const CPoint& point);
+   CPoint            CenterPoint(void) const;
+   int               Width(void)              const { return(right-left); }
+   void              Width(const int w)             { right=left+w;       }
+   int               Height(void)             const { return(bottom-top); }
+   void              Height(const int h)            { bottom=top+h;       }
+   CSize             Size(void)               const;
+   void              Size(const int cx,const int cy);
+   void              Size(const CSize& size);
+   void              SetBound(const int l,const int t,const int r,const int b);
+   void              SetBound(const CRect& rect);
+   void              SetBound(const CPoint& point,const CSize& size);
+   void              SetBound(const CPoint& left_top,const CPoint& right_bottom);
+   void              Move(const int x,const int y);
+   void              Move(const CPoint& point);
+   void              Shift(const int dx,const int dy);
+   void              Shift(const CPoint& point);
+   void              Shift(const CSize& size);
+   bool              Contains(const int x,const int y) const;
+   bool              Contains(const CPoint& point) const;
+   void              Normalize(void);
+  };
+//+------------------------------------------------------------------+
+//| Get parameters of area                                           |
+//+------------------------------------------------------------------+
+CPoint CRect::LeftTop(void) const
+  {
+   CPoint point;
+//--- action
+   point.x=left;
+   point.y=top;
+//--- result
+   return(point);
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::LeftTop(const int x,const int y)
+  {
+   left=x;
+   top =y;
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::LeftTop(const CPoint& point)
+  {
+   left=point.x;
+   top =point.y;
+  }
+//+------------------------------------------------------------------+
+//| Get parameters of area                                           |
+//+------------------------------------------------------------------+
+CPoint CRect::RightBottom(void) const
+  {
+   CPoint point;
+//--- action
+   point.x=right;
+   point.y=bottom;
+//--- result
+   return(point);
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::RightBottom(const int x,const int y)
+  {
+   right =x;
+   bottom=y;
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::RightBottom(const CPoint& point)
+  {
+   right =point.x;
+   bottom=point.y;
+  }
+//+------------------------------------------------------------------+
+//| Get parameters of area                                           |
+//+------------------------------------------------------------------+
+CPoint CRect::CenterPoint(void) const
+  {
+   CPoint point;
+//--- action
+   point.x=left+Width()/2;
+   point.y=top+Height()/2;
+//--- result
+   return(point);
+  }
+//+------------------------------------------------------------------+
+//| Get parameters of area                                           |
+//+------------------------------------------------------------------+
+CSize CRect::Size(void) const
+  {
+   CSize size;
+//--- action
+   size.cx=right-left;
+   size.cy=bottom-top;
+//--- result
+   return(size);
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::Size(const int cx,const int cy)
+  {
+   right =left+cx;
+   bottom=top+cy;
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::Size(const CSize& size)
+  {
+   right =left+size.cx;
+   bottom=top+size.cy;
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::SetBound(const int l,const int t,const int r,const int b)
+  {
+   left  =l;
+   top   =t;
+   right =r;
+   bottom=b;
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::SetBound(const CRect& rect)
+  {
+   left  =rect.left;
+   top   =rect.top;
+   right =rect.right;
+   bottom=rect.bottom;
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::SetBound(const CPoint& point,const CSize& size)
+  {
+   LeftTop(point);
+   Size(size);
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of area                                           |
+//+------------------------------------------------------------------+
+void CRect::SetBound(const CPoint& left_top,const CPoint& right_bottom)
+  {
+   LeftTop(left_top);
+   RightBottom(right_bottom);
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of area                                        |
+//+------------------------------------------------------------------+
+void CRect::Move(const int x,const int y)
+  {
+   right +=x-left;
+   bottom+=y-top;
+   left   =x;
+   top    =y;
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of area                                        |
+//+------------------------------------------------------------------+
+void CRect::Move(const CPoint& point)
+  {
+   right +=point.x-left;
+   bottom+=point.y-top;
+   left   =point.x;
+   top    =point.y;
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of area                                        |
+//+------------------------------------------------------------------+
+void CRect::Shift(const int dx,const int dy)
+  {
+   left  +=dx;
+   top   +=dy;
+   right +=dx;
+   bottom+=dy;
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of area                                        |
+//+------------------------------------------------------------------+
+void CRect::Shift(const CPoint& point)
+  {
+   left  +=point.x;
+   top   +=point.y;
+   right +=point.x;
+   bottom+=point.y;
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of area                                        |
+//+------------------------------------------------------------------+
+void CRect::Shift(const CSize& size)
+  {
+   left  +=size.cx;
+   top   +=size.cy;
+   right +=size.cx;
+   bottom+=size.cy;
+  }
+//+------------------------------------------------------------------+
+//| Check if a point is within the area                              |
+//+------------------------------------------------------------------+
+bool CRect::Contains(const int x,const int y) const
+  {
+//--- check and return the result
+   return(x>=left && x<=right && y>=top && y<=bottom);
+  }
+//+------------------------------------------------------------------+
+//| Check if a point is within the area                              |
+//+------------------------------------------------------------------+
+bool CRect::Contains(const CPoint& point) const
+  {
+//--- check and return the result
+   return(point.x>=left && point.x<=right && point.y>=top && point.y<=bottom);
+  }
+//+------------------------------------------------------------------+
+//| Standardizes the height and width                                |
+//+------------------------------------------------------------------+
+void CRect::Normalize(void)
+  {
+   if(left>right)
+     {
+      int tmp=left;
+      left=right;
+      right=tmp;
+     }
+   if(top>bottom)
+     {
+      int tmp=top;
+      top=bottom;
+      bottom=tmp;
+     }
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Scrolls.mqh b/Include/Controls/Scrolls.mqh
new file mode 100644
index 0000000..dbf52c3
--- /dev/null
+++ b/Include/Controls/Scrolls.mqh
@@ -0,0 +1,675 @@
+//+------------------------------------------------------------------+
+//|                                                      Scrolls.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "Panel.mqh"
+#include "BmpButton.mqh"
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+#resource "res\\Up.bmp"
+#resource "res\\ThumbVert.bmp"
+#resource "res\\Down.bmp"
+#resource "res\\Left.bmp"
+#resource "res\\ThumbHor.bmp"
+#resource "res\\Right.bmp"
+//+------------------------------------------------------------------+
+//| Class CScroll                                                    |
+//| Usage: base class for scrollbars                                 |
+//+------------------------------------------------------------------+
+class CScroll : public CWndContainer
+  {
+protected:
+   //--- dependent controls
+   CPanel            m_back;                // the "scrollbar background" object
+   CBmpButton        m_inc;                 // the "increment button" object ("down" for vertical scrollbar, "right" for horizontal scrollbar)
+   CBmpButton        m_dec;                 // the "decrement button" object ("up" for vertical scrollbar, "left" for horizontal scrollbar)
+   CBmpButton        m_thumb;               // the "scroll box" object
+   //--- set up
+   int               m_min_pos;             // minimum value
+   int               m_max_pos;             // maximum value
+   //--- state
+   int               m_curr_pos;            // current value
+
+public:
+                     CScroll(void);
+                    ~CScroll(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- set up
+   int               MinPos(void)           const { return(m_min_pos);  }
+   void              MinPos(const int value);
+   int               MaxPos(void)           const { return(m_max_pos);  }
+   void              MaxPos(const int value);
+   //--- state
+   int               CurrPos(void)          const { return(m_curr_pos); }
+   bool              CurrPos(int value);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateBack(void);
+   virtual bool      CreateInc(void)              { return(true);       }
+   virtual bool      CreateDec(void)              { return(true);       }
+   virtual bool      CreateThumb(void)            { return(true);       }
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickInc(void);
+   virtual bool      OnClickDec(void);
+   //--- internal event handlers
+   virtual bool      OnShow(void);
+   virtual bool      OnHide(void);
+   virtual bool      OnChangePos(void)             { return(true);       }
+   //--- handlers of dragging
+   virtual bool      OnThumbDragStart(void)        { return(true);       }
+   virtual bool      OnThumbDragProcess(void)      { return(true);       }
+   virtual bool      OnThumbDragEnd(void)          { return(true);       }
+   //--- calculate position by coordinate
+   virtual int       CalcPos(const int coord)      { return(0);          }
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CScroll)
+   ON_EVENT(ON_CLICK,m_inc,OnClickInc)
+   ON_EVENT(ON_CLICK,m_dec,OnClickDec)
+   ON_EVENT(ON_DRAG_START,m_thumb,OnThumbDragStart)
+   ON_EVENT_PTR(ON_DRAG_PROCESS,m_drag_object,OnThumbDragProcess)
+   ON_EVENT_PTR(ON_DRAG_END,m_drag_object,OnThumbDragEnd)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CScroll::CScroll(void) : m_curr_pos(0),
+                         m_min_pos(0),
+                         m_max_pos(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CScroll::~CScroll(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CScroll::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateBack())
+      return(false);
+   if(!CreateInc())
+      return(false);
+   if(!CreateDec())
+      return(false);
+   if(!CreateThumb())
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create scrollbar background                                      |
+//+------------------------------------------------------------------+
+bool CScroll::CreateBack(void)
+  {
+//--- create
+   if(!m_back.Create(m_chart_id,m_name+"Back",m_subwin,0,0,Width(),Height()))
+      return(false);
+   if(!m_back.ColorBackground(CONTROLS_SCROLL_COLOR_BG))
+      return(false);
+   if(!m_back.ColorBorder(CONTROLS_SCROLL_COLOR_BORDER))
+      return(false);
+   if(!Add(m_back))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set current value                                                |
+//+------------------------------------------------------------------+
+bool CScroll::CurrPos(int value)
+  {
+//--- check value
+   if(value<m_min_pos)
+      value=m_min_pos;
+   if(value>m_max_pos)
+      value=m_max_pos;
+//--- if value was changed
+   if(m_curr_pos!=value)
+     {
+      m_curr_pos=value;
+      //--- call virtual handler
+      return(OnChangePos());
+     }
+//--- value has not been changed
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Set minimum value                                                |
+//+------------------------------------------------------------------+
+void CScroll::MinPos(const int value)
+  {
+//--- if value was changed
+   if(m_min_pos!=value)
+     {
+      m_min_pos=value;
+      //--- adjust the scroll box position
+      CurrPos(m_curr_pos);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Set maximum value                                                |
+//+------------------------------------------------------------------+
+void CScroll::MaxPos(const int value)
+  {
+//--- if value was changed
+   if(m_max_pos!=value)
+     {
+      m_max_pos=value;
+      //--- adjust the scroll box position
+      CurrPos(m_curr_pos);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Show scrollbar" event                            |
+//+------------------------------------------------------------------+
+bool CScroll::OnShow(void)
+  {
+   if(m_id==CONTROLS_INVALID_ID)
+      return(true);
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_SHOW,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Hide scrollbar" event                            |
+//+------------------------------------------------------------------+
+bool CScroll::OnHide(void)
+  {
+   if(m_id==CONTROLS_INVALID_ID)
+      return(true);
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_HIDE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the "increment" button                       |
+//+------------------------------------------------------------------+
+bool CScroll::OnClickInc(void)
+  {
+//--- try to increment current value
+   if(!CurrPos(m_curr_pos+1))
+      return(true);
+//--- if value was changed, send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_SCROLL_INC,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the "decrement" button                       |
+//+------------------------------------------------------------------+
+bool CScroll::OnClickDec(void)
+  {
+//--- try to decrement current value
+   if(!CurrPos(m_curr_pos-1))
+      return(true);
+//--- if value was changed, send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_SCROLL_DEC,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CScrollV                                                   |
+//| Usage: class of vertical scrollbar                               |
+//+------------------------------------------------------------------+
+class CScrollV : public CScroll
+  {
+public:
+                     CScrollV(void);
+                    ~CScrollV(void);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateInc(void);
+   virtual bool      CreateDec(void);
+   virtual bool      CreateThumb(void);
+   //--- internal event handlers
+   virtual bool      OnResize(void);
+   virtual bool      OnChangePos(void);
+   //--- handlers of dragging
+   virtual bool      OnThumbDragStart(void);
+   virtual bool      OnThumbDragProcess(void);
+   virtual bool      OnThumbDragEnd(void);
+   //--- calculate position by coordinate
+   virtual int       CalcPos(const int coord);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CScrollV::CScrollV(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CScrollV::~CScrollV(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create the "Increment" button                                    |
+//+------------------------------------------------------------------+
+bool CScrollV::CreateInc(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=Height()-CONTROLS_SCROLL_SIZE+CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_inc.Create(m_chart_id,m_name+"Inc",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_inc.BmpNames("::res\\Down.bmp"))
+      return(false);
+   if(!Add(m_inc))
+      return(false);
+//--- property
+   m_inc.PropFlags(WND_PROP_FLAG_CLICKS_BY_PRESS);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create the "Decrement" button                                    |
+//+------------------------------------------------------------------+
+bool CScrollV::CreateDec(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_dec.Create(m_chart_id,m_name+"Dec",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_dec.BmpNames("::res\\Up.bmp"))
+      return(false);
+   if(!Add(m_dec))
+      return(false);
+//--- property
+   m_dec.PropFlags(WND_PROP_FLAG_CLICKS_BY_PRESS);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create scroll box                                                |
+//+------------------------------------------------------------------+
+bool CScrollV::CreateThumb(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_SCROLL_SIZE-CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_SCROLL_THUMB_SIZE;
+//--- create
+   if(!m_thumb.Create(m_chart_id,m_name+"Thumb",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_thumb.BmpNames("::res\\ThumbVert.bmp"))
+      return(false);
+   if(!Add(m_thumb))
+      return(false);
+   m_thumb.PropFlags(WND_PROP_FLAG_CAN_DRAG);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of changing current state                                |
+//+------------------------------------------------------------------+
+bool CScrollV::OnChangePos(void)
+  {
+//--- check if scrolling is possible
+   if(m_max_pos-m_min_pos<=0)
+      return(Visible(false));
+   else
+      if(!Visible(true))
+         return(false);
+//--- calculate new coordinated of the scrollbar
+   int steps    =m_max_pos-m_min_pos;           // number of steps to change position
+   int min_coord=m_dec.Bottom();                // minimum possible coordinate (corresponds to the m_min_pos value)
+   int max_coord=m_inc.Top()-m_thumb.Height();  // maximum possible coordinate (corresponds to the m_max_pos value)
+   int new_coord=min_coord+(max_coord-min_coord)*m_curr_pos/steps;  // new coordinate
+//--- adjust the scroll box position
+   return(m_thumb.Move(m_thumb.Left(),new_coord));
+  }
+//+------------------------------------------------------------------+
+//| Handler of resizing                                              |
+//+------------------------------------------------------------------+
+bool CScrollV::OnResize(void)
+  {
+//--- can not change the lateral size
+   if(Width()!=CONTROLS_SCROLL_SIZE)
+      m_rect.Width(CONTROLS_SCROLL_SIZE);
+//--- resize the scrollbar background
+   if(!m_back.Size(Size()))
+      return(false);
+//--- move the "Increment" button
+   if(!m_inc.Move(m_inc.Left(),Bottom()-CONTROLS_SCROLL_SIZE))
+      return(false);
+//--- adjust the scroll box position
+   return(OnChangePos());
+  }
+//+------------------------------------------------------------------+
+//| Start dragging the "slider"                                      |
+//+------------------------------------------------------------------+
+bool CScrollV::OnThumbDragStart(void)
+  {
+   if(m_drag_object==NULL)
+     {
+      m_drag_object=new CDragWnd;
+      if(m_drag_object==NULL)
+         return(false);
+     }
+//--- calculate coordinates
+   int x1=m_thumb.Left()-CONTROLS_DRAG_SPACING;
+   int y1=m_thumb.Top()-CONTROLS_DRAG_SPACING;
+   int x2=m_thumb.Right()+CONTROLS_DRAG_SPACING;
+   int y2=m_thumb.Bottom()+CONTROLS_DRAG_SPACING;
+//--- create
+   m_drag_object.Create(m_chart_id,"",m_subwin,x1,y1,x2,y2);
+   m_drag_object.PropFlags(WND_PROP_FLAG_CAN_DRAG);
+//--- îãðàíè÷åíèÿ
+   m_drag_object.Limits(x1,m_dec.Bottom()-CONTROLS_DRAG_SPACING,x2,m_inc.Top()+CONTROLS_DRAG_SPACING);
+//--- set mouse params
+   m_drag_object.MouseX(m_thumb.MouseX());
+   m_drag_object.MouseY(m_thumb.MouseY());
+   m_drag_object.MouseFlags(m_thumb.MouseFlags());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Continue dragging the "slider"                                   |
+//+------------------------------------------------------------------+
+bool CScrollV::OnThumbDragProcess(void)
+  {
+//--- checking
+   if(m_drag_object==NULL)
+      return(false);
+//--- calculate coordinates
+   int x=m_drag_object.Left()+CONTROLS_DRAG_SPACING;
+   int y=m_drag_object.Top()+CONTROLS_DRAG_SPACING;
+//--- calculate new position
+   int new_pos=CalcPos(y);
+   if(new_pos!=m_curr_pos)
+     {
+      ushort event_id=(m_curr_pos<new_pos) ? ON_SCROLL_INC : ON_SCROLL_DEC;
+      m_curr_pos=new_pos;
+      EventChartCustom(CONTROLS_SELF_MESSAGE,event_id,m_id,0.0,m_name);
+     }
+//--- move thumb
+   m_thumb.Move(x,y);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| End dragging the "slider"                                        |
+//+------------------------------------------------------------------+
+bool CScrollV::OnThumbDragEnd(void)
+  {
+   if(m_drag_object!=NULL)
+     {
+      m_thumb.MouseFlags(m_drag_object.MouseFlags());
+      delete m_drag_object;
+      m_drag_object=NULL;
+     }
+//--- succeed
+   return(m_thumb.Pressed(false));
+  }
+//+------------------------------------------------------------------+
+//| Calculate position by coordinate                                 |
+//+------------------------------------------------------------------+
+int CScrollV::CalcPos(const int coord)
+  {
+//--- calculate new position of the scrollbar
+   int steps    =m_max_pos-m_min_pos;           // number of steps to change position
+   int min_coord=m_dec.Bottom();                // minimum possible coordinate (corresponds to the m_min_pos value)
+   int max_coord=m_inc.Top()-m_thumb.Height();  // maximum possible coordinate (corresponds to the m_max_pos value)
+//--- checkeng
+   if(max_coord==min_coord)
+      return(0);
+   if(coord<min_coord || coord>max_coord)
+      return(m_curr_pos);
+//---
+   int new_pos=(int)MathRound((((double)(coord-min_coord))/(max_coord-min_coord))*steps);  // new position
+//---
+   return(new_pos);
+  }
+//+------------------------------------------------------------------+
+//| Class CScrollH                                                   |
+//| Usage: class of horizontal scrollbar                             |
+//+------------------------------------------------------------------+
+class CScrollH : public CScroll
+  {
+public:
+                     CScrollH(void);
+                    ~CScrollH(void);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateInc(void);
+   virtual bool      CreateDec(void);
+   virtual bool      CreateThumb(void);
+   //--- internal event handlers
+   virtual bool      OnResize(void);
+   virtual bool      OnChangePos(void);
+   //--- handlers of dragging
+   virtual bool      OnThumbDragStart(void);
+   virtual bool      OnThumbDragProcess(void);
+   virtual bool      OnThumbDragEnd(void);
+   //--- calculate position by coordinate
+   virtual int       CalcPos(const int coord);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CScrollH::CScrollH(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CScrollH::~CScrollH(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create the "Increment" button                                    |
+//+------------------------------------------------------------------+
+bool CScrollH::CreateInc(void)
+  {
+//--- calculate coordinates
+   int x1=Width()-CONTROLS_SCROLL_SIZE+CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_inc.Create(m_chart_id,m_name+"Inc",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_inc.BmpNames("::res\\Right.bmp"))
+      return(false);
+   if(!Add(m_inc))
+      return(false);
+//--- property
+   m_inc.PropFlags(WND_PROP_FLAG_CLICKS_BY_PRESS);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create the "Decrement" button                                    |
+//+------------------------------------------------------------------+
+bool CScrollH::CreateDec(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_dec.Create(m_chart_id,m_name+"Dec",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_dec.BmpNames("::res\\Left.bmp"))
+      return(false);
+   if(!Add(m_dec))
+      return(false);
+//--- property
+   m_dec.PropFlags(WND_PROP_FLAG_CLICKS_BY_PRESS);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create scroll box                                                |
+//+------------------------------------------------------------------+
+bool CScrollH::CreateThumb(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_SCROLL_SIZE-CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH;
+   int x2=x1+CONTROLS_SCROLL_THUMB_SIZE;
+   int y2=y1+CONTROLS_BUTTON_SIZE;
+//--- create
+   if(!m_thumb.Create(m_chart_id,m_name+"Thumb",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_thumb.BmpNames("::res\\ThumbHor.bmp"))
+      return(false);
+   if(!Add(m_thumb))
+      return(false);
+   m_thumb.PropFlags(WND_PROP_FLAG_CAN_DRAG);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of changing current state                                |
+//+------------------------------------------------------------------+
+bool CScrollH::OnChangePos(void)
+  {
+//--- check if scrolling is possible
+   if(m_max_pos-m_min_pos<=0)
+      return(Visible(false));
+   else
+      if(!Visible(true))
+         return(false);
+//--- calculate new coordinated of the scrollbar
+   int steps=m_max_pos-m_min_pos;            // number of steps to change position
+   int min_coord=m_dec.Right();                   // minimum possible coordinate (corresponds to the m_min_pos value)
+   int max_coord=m_inc.Left()-m_thumb.Width();  // maximum possible coordinate (corresponds to the m_max_pos value)
+   int new_coord=min_coord+(max_coord-min_coord)*m_curr_pos/steps;  // new coordinate
+//--- adjust the scroll box position
+   return(m_thumb.Move(new_coord,m_thumb.Top()));
+  }
+//+------------------------------------------------------------------+
+//| Handler of resizing                                              |
+//+------------------------------------------------------------------+
+bool CScrollH::OnResize(void)
+  {
+//--- can not change the lateral size
+   if(Height()!=CONTROLS_SCROLL_SIZE)
+      m_rect.Height(CONTROLS_SCROLL_SIZE);
+//--- resize the scrollbar background
+   if(!m_back.Size(Size()))
+      return(false);
+//--- move the "Increment" button
+   if(!m_inc.Move(Right()-CONTROLS_SCROLL_SIZE,m_inc.Top()))
+      return(false);
+//--- adjust the scroll box position
+   return(OnChangePos());
+  }
+//+------------------------------------------------------------------+
+//| Start dragging the "slider"                                      |
+//+------------------------------------------------------------------+
+bool CScrollH::OnThumbDragStart(void)
+  {
+   if(m_drag_object==NULL)
+     {
+      m_drag_object=new CDragWnd;
+      if(m_drag_object==NULL)
+         return(false);
+     }
+//--- calculate coordinates
+   int x1=m_thumb.Left()-CONTROLS_DRAG_SPACING;
+   int y1=m_thumb.Top()-CONTROLS_DRAG_SPACING;
+   int x2=m_thumb.Right()+CONTROLS_DRAG_SPACING;
+   int y2=m_thumb.Bottom()+CONTROLS_DRAG_SPACING;
+//--- create
+   m_drag_object.Create(m_chart_id,"",m_subwin,x1,y1,x2,y2);
+   m_drag_object.PropFlags(WND_PROP_FLAG_CAN_DRAG);
+//--- îãðàíè÷åíèÿ
+   m_drag_object.Limits(m_dec.Right()-CONTROLS_DRAG_SPACING,y1,m_inc.Left()+CONTROLS_DRAG_SPACING,y2);
+//--- set mouse params
+   m_drag_object.MouseX(m_thumb.MouseX());
+   m_drag_object.MouseY(m_thumb.MouseY());
+   m_drag_object.MouseFlags(m_thumb.MouseFlags());
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Continue dragging the "slider"                                   |
+//+------------------------------------------------------------------+
+bool CScrollH::OnThumbDragProcess(void)
+  {
+//--- checking
+   if(m_drag_object==NULL)
+      return(false);
+//--- calculate coordinates
+   int x=m_drag_object.Left()+CONTROLS_DRAG_SPACING;
+   int y=m_drag_object.Top()+CONTROLS_DRAG_SPACING;
+//--- calculate new position
+   int new_pos=CalcPos(x);
+   if(new_pos!=m_curr_pos)
+     {
+      ushort event_id=(m_curr_pos<new_pos)?ON_SCROLL_INC:ON_SCROLL_DEC;
+      m_curr_pos=new_pos;
+      EventChartCustom(CONTROLS_SELF_MESSAGE,event_id,m_id,0.0,m_name);
+     }
+//--- move thumb
+   m_thumb.Move(x,y);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| End dragging the "slider"                                        |
+//+------------------------------------------------------------------+
+bool CScrollH::OnThumbDragEnd(void)
+  {
+   if(m_drag_object!=NULL)
+     {
+      m_thumb.MouseFlags(m_drag_object.MouseFlags());
+      delete m_drag_object;
+      m_drag_object=NULL;
+     }
+//--- succeed
+   return(m_thumb.Pressed(false));
+  }
+//+------------------------------------------------------------------+
+//| Calculate position by coordinate                                 |
+//+------------------------------------------------------------------+
+int CScrollH::CalcPos(const int coord)
+  {
+//--- calculate new position of the scrollbar
+   int steps    =m_max_pos-m_min_pos;           // number of steps to change position
+   int min_coord=m_dec.Right();                 // minimum possible coordinate (corresponds to the m_min_pos value)
+   int max_coord=m_inc.Left()-m_thumb.Width();  // maximum possible coordinate (corresponds to the m_max_pos value)
+//--- checkeng
+   if(max_coord==min_coord)
+      return(0);
+   if(coord<min_coord || coord>max_coord)
+      return(m_curr_pos);
+//---
+   int new_pos=(int)MathRound((((double)(coord-min_coord))/(max_coord-min_coord))*steps);  // new position
+//---
+   return(new_pos);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/SpinEdit.mqh b/Include/Controls/SpinEdit.mqh
new file mode 100644
index 0000000..d793ee6
--- /dev/null
+++ b/Include/Controls/SpinEdit.mqh
@@ -0,0 +1,265 @@
+//+------------------------------------------------------------------+
+//|                                                     SpinEdit.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "Edit.mqh"
+#include "BmpButton.mqh"
+//+------------------------------------------------------------------+
+//| Resources                                                        |
+//+------------------------------------------------------------------+
+#resource "res\\SpinInc.bmp"
+#resource "res\\SpinDec.bmp"
+//+------------------------------------------------------------------+
+//| Class CSpinEdit                                                  |
+//| Usage: class that implements the "Up-Down" control               |
+//+------------------------------------------------------------------+
+class CSpinEdit : public CWndContainer
+  {
+private:
+   //--- dependent controls
+   CEdit             m_edit;                // the entry field object
+   CBmpButton        m_inc;                 // the "Increment button" object
+   CBmpButton        m_dec;                 // the "Decrement button" object
+   //--- adjusted parameters
+   int               m_min_value;           // minimum value
+   int               m_max_value;           // maximum value
+   //--- state
+   int               m_value;               // current value
+
+public:
+                     CSpinEdit(void);
+                    ~CSpinEdit(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- set up
+   int               MinValue(void) const { return(m_min_value); }
+   void              MinValue(const int value);
+   int               MaxValue(void) const { return(m_min_value); }
+   void              MaxValue(const int value);
+   //--- state
+   int               Value(void) const { return(m_value); }
+   bool              Value(int value);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateEdit(void);
+   virtual bool      CreateInc(void);
+   virtual bool      CreateDec(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnClickInc(void);
+   virtual bool      OnClickDec(void);
+   //--- internal event handlers
+   virtual bool      OnChangeValue(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CSpinEdit)
+   ON_EVENT(ON_CLICK,m_inc,OnClickInc)
+   ON_EVENT(ON_CLICK,m_dec,OnClickDec)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CSpinEdit::CSpinEdit(void) : m_min_value(0),
+                             m_max_value(0),
+                             m_value(0)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CSpinEdit::~CSpinEdit(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CSpinEdit::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- check height
+   if(y2-y1<CONTROLS_SPIN_MIN_HEIGHT)
+      return(false);
+//--- call method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateEdit())
+      return(false);
+   if(!CreateInc())
+      return(false);
+   if(!CreateDec())
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set current value                                                |
+//+------------------------------------------------------------------+
+bool CSpinEdit::Value(int value)
+  {
+//--- check value
+   if(value<m_min_value)
+      value=m_min_value;
+   if(value>m_max_value)
+      value=m_max_value;
+//--- if value was changed
+   if(m_value!=value)
+     {
+      m_value=value;
+      //--- call virtual handler
+      return(OnChangeValue());
+     }
+//--- value has not been changed
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CSpinEdit::Save(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   FileWriteInteger(file_handle,m_value);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//|                                                                  |
+//+------------------------------------------------------------------+
+bool CSpinEdit::Load(const int file_handle)
+  {
+//--- check
+   if(file_handle==INVALID_HANDLE)
+      return(false);
+//---
+   if(!FileIsEnding(file_handle))
+      Value(FileReadInteger(file_handle));
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set minimum value                                                |
+//+------------------------------------------------------------------+
+void CSpinEdit::MinValue(const int value)
+  {
+//--- if value was changed
+   if(m_min_value!=value)
+     {
+      m_min_value=value;
+      //--- adjust the edit value
+      Value(m_value);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Set maximum value                                                |
+//+------------------------------------------------------------------+
+void CSpinEdit::MaxValue(const int value)
+  {
+//--- if value was changed
+   if(m_max_value!=value)
+     {
+      m_max_value=value;
+      //--- adjust the edit value
+      Value(m_value);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Create the edit field                                            |
+//+------------------------------------------------------------------+
+bool CSpinEdit::CreateEdit(void)
+  {
+//--- create
+   if(!m_edit.Create(m_chart_id,m_name+"Edit",m_subwin,0,0,Width(),Height()))
+      return(false);
+   if(!m_edit.Text(""))
+      return(false);
+   if(!m_edit.ReadOnly(true))
+      return(false);
+   if(!Add(m_edit))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create the "Increment" button                                    |
+//+------------------------------------------------------------------+
+bool CSpinEdit::CreateInc(void)
+  {
+//--- right align button (try to make equal offsets from top and bottom)
+   int x1=Width()-(CONTROLS_BUTTON_SIZE+CONTROLS_SPIN_BUTTON_X_OFF);
+   int y1=(Height()-2*CONTROLS_SPIN_BUTTON_SIZE)/2;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_SPIN_BUTTON_SIZE;
+//--- create
+   if(!m_inc.Create(m_chart_id,m_name+"Inc",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_inc.BmpNames("::res\\SpinInc.bmp"))
+      return(false);
+   if(!Add(m_inc))
+      return(false);
+//--- property
+   m_inc.PropFlags(WND_PROP_FLAG_CLICKS_BY_PRESS);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create the "Decrement" button                                    |
+//+------------------------------------------------------------------+
+bool CSpinEdit::CreateDec(void)
+  {
+//--- right align button (try to make equal offsets from top and bottom)
+   int x1=Width()-(CONTROLS_BUTTON_SIZE+CONTROLS_SPIN_BUTTON_X_OFF);
+   int y1=(Height()-2*CONTROLS_SPIN_BUTTON_SIZE)/2+CONTROLS_SPIN_BUTTON_SIZE;
+   int x2=x1+CONTROLS_BUTTON_SIZE;
+   int y2=y1+CONTROLS_SPIN_BUTTON_SIZE;
+//--- create
+   if(!m_dec.Create(m_chart_id,m_name+"Dec",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!m_dec.BmpNames("::res\\SpinDec.bmp"))
+      return(false);
+   if(!Add(m_dec))
+      return(false);
+//--- property
+   m_dec.PropFlags(WND_PROP_FLAG_CLICKS_BY_PRESS);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the "increment" button                       |
+//+------------------------------------------------------------------+
+bool CSpinEdit::OnClickInc(void)
+  {
+//--- try to increment current value
+   return(Value(m_value+1));
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the "decrement" button                       |
+//+------------------------------------------------------------------+
+bool CSpinEdit::OnClickDec(void)
+  {
+//--- try to decrement current value
+   return(Value(m_value-1));
+  }
+//+------------------------------------------------------------------+
+//| Handler of changing current state                                |
+//+------------------------------------------------------------------+
+bool CSpinEdit::OnChangeValue(void)
+  {
+//--- copy text to the edit field edit
+   m_edit.Text(IntegerToString(m_value));
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CHANGE,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/Wnd.mqh b/Include/Controls/Wnd.mqh
new file mode 100644
index 0000000..e5b06f4
--- /dev/null
+++ b/Include/Controls/Wnd.mqh
@@ -0,0 +1,755 @@
+//+------------------------------------------------------------------+
+//|                                                          Wnd.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Rect.mqh"
+#include "Defines.mqh"
+#include <Object.mqh>
+class CDragWnd;
+//+------------------------------------------------------------------+
+//| Class CWnd                                                       |
+//| Usage: base class of the control object that creates             |
+//|             control panels and indicator panels                  |
+//+------------------------------------------------------------------+
+class CWnd : public CObject
+  {
+protected:
+   //--- parameters of creation
+   long              m_chart_id;            // chart ID
+   int               m_subwin;              // chart subwindow
+   string            m_name;                // object name
+   //--- geometry
+   CRect             m_rect;                // chart area
+   //--- ID
+   long              m_id;                  // object ID
+   //--- state flags
+   int               m_state_flags;
+   //--- properties flags
+   int               m_prop_flags;
+   //--- alignment
+   int               m_align_flags;         // alignment flags
+   int               m_align_left;          // fixed offset from left border
+   int               m_align_top;           // fixed offset from top border
+   int               m_align_right;         // fixed offset from right border
+   int               m_align_bottom;        // fixed offset from bottom border
+   //--- the last saved state of mouse
+   int               m_mouse_x;             // X coordinate
+   int               m_mouse_y;             // Y coordinate
+   int               m_mouse_flags;         // state of buttons
+   uint              m_last_click;          // last click time
+   //--- drag object
+   CDragWnd         *m_drag_object;         // pointer to the dragged object
+
+public:
+                     CWnd(void);
+                    ~CWnd(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- release memory
+   virtual void      Destroy(const int reason=0);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   virtual bool      OnMouseEvent(const int x,const int y,const int flags);
+   //--- naming (read only)
+   string            Name(void)                        const { return(m_name);               }
+   //--- access the contents of container
+   int               ControlsTotal(void)               const { return(0);                    }
+   CWnd*             Control(const int ind)            const { return(NULL);                 }
+   virtual CWnd*     ControlFind(const long id);
+   //--- geometry
+   const CRect       Rect(void)                        const { return(m_rect);               }
+   int               Left(void)                        const { return(m_rect.left);          }
+   virtual void      Left(const int x)                       { m_rect.left=x;                }
+   int               Top(void)                         const { return(m_rect.top);           }
+   virtual void      Top(const int y)                        { m_rect.top=y;                 }
+   int               Right(void)                       const { return(m_rect.right);         }
+   virtual void      Right(const int x)                      { m_rect.right=x;               }
+   int               Bottom(void)                      const { return(m_rect.bottom);        }
+   virtual void      Bottom(const int y)                     { m_rect.bottom=y;              }
+   int               Width(void)                       const { return(m_rect.Width());       }
+   virtual bool      Width(const int w);
+   int               Height(void)                      const { return(m_rect.Height());      }
+   virtual bool      Height(const int h);
+   CSize             Size(void)                        const { return(m_rect.Size());        }
+   virtual bool      Size(const int w,const int h);
+   virtual bool      Size(const CSize &size);
+   virtual bool      Move(const int x,const int y);
+   virtual bool      Move(const CPoint &point);
+   virtual bool      Shift(const int dx,const int dy);
+   bool              Contains(const int x,const int y) const { return(m_rect.Contains(x,y)); }
+   bool              Contains(CWnd *control) const;
+   //--- alignment
+   void              Alignment(const int flags,const int left,const int top,const int right,const int bottom);
+   virtual bool      Align(const CRect &rect);
+   //--- ID
+   virtual long      Id(const long id);
+   long              Id(void)                          const { return(m_id);                 }
+   //--- state
+   bool              IsEnabled(void)                   const { return(IS_ENABLED);           }
+   virtual bool      Enable(void);
+   virtual bool      Disable(void);
+   bool              IsVisible(void)                   const { return(IS_VISIBLE);           }
+   virtual bool      Visible(const bool flag);
+   virtual bool      Show(void);
+   virtual bool      Hide(void);
+   bool              IsActive(void)                    const { return(IS_ACTIVE);            }
+   virtual bool      Activate(void);
+   virtual bool      Deactivate(void);
+   //--- state flags
+   int               StateFlags(void)                  const { return(m_state_flags);        }
+   void              StateFlags(const int flags)             { m_state_flags=flags;          }
+   void              StateFlagsSet(const int flags)          { m_state_flags|=flags;         }
+   void              StateFlagsReset(const int flags)        { m_state_flags&=~flags;        }
+   //--- properties flags
+   int               PropFlags(void)                   const { return(m_prop_flags);         }
+   void              PropFlags(const int flags)              { m_prop_flags=flags;           }
+   void              PropFlagsSet(const int flags)           { m_prop_flags|=flags;          }
+   void              PropFlagsReset(const int flags)         { m_prop_flags&=~flags;         }
+   //--- for mouse operations
+   int               MouseX(void)                      const { return(m_mouse_x);            }
+   void              MouseX(const int value)                 { m_mouse_x=value;              }
+   int               MouseY(void)                      const { return(m_mouse_y);            }
+   void              MouseY(const int value)                 { m_mouse_y=value;              }
+   int               MouseFlags(void)                  const { return(m_mouse_flags);        }
+   virtual void      MouseFlags(const int value)             { m_mouse_flags=value;          }
+   bool              MouseFocusKill(const long id=CONTROLS_INVALID_ID);
+   bool              BringToTop(void);
+
+protected:
+   //--- internal event handlers
+   virtual bool      OnCreate(void)                          { return(true);                 }
+   virtual bool      OnDestroy(void)                         { return(true);                 }
+   virtual bool      OnMove(void)                            { return(true);                 }
+   virtual bool      OnResize(void)                          { return(true);                 }
+   virtual bool      OnEnable(void)                          { return(true);                 }
+   virtual bool      OnDisable(void)                         { return(true);                 }
+   virtual bool      OnShow(void)                            { return(true);                 }
+   virtual bool      OnHide(void)                            { return(true);                 }
+   virtual bool      OnActivate(void)                        { return(true);                 }
+   virtual bool      OnDeactivate(void)                      { return(true);                 }
+   virtual bool      OnClick(void);
+   virtual bool      OnDblClick(void);
+   virtual bool      OnChange(void)                          { return(true);                 }
+   //--- mouse event handlers
+   virtual bool      OnMouseDown(void);
+   virtual bool      OnMouseUp(void);
+   //--- handlers of dragging
+   virtual bool      OnDragStart(void);
+   virtual bool      OnDragProcess(const int x,const int y);
+   virtual bool      OnDragEnd(void);
+   //--- methods for drag-object
+   virtual bool      DragObjectCreate(void)                  { return(false);                }
+   virtual bool      DragObjectDestroy(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+bool CWnd::OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam)
+  {
+   if((id!=CHARTEVENT_MOUSE_MOVE))
+      return(false);
+   if(!IS_VISIBLE)
+      return(false);
+   int x=(int)lparam;
+   int y=(int)dparam;
+   int flags=(int)StringToInteger(sparam);
+//---
+   if(m_drag_object!=NULL)
+      return(m_drag_object.OnMouseEvent(x,y,flags));
+//---
+   return(OnMouseEvent(x,y,flags));
+  }
+//+------------------------------------------------------------------+
+//| Common handler of mouse events                                   |
+//+------------------------------------------------------------------+
+bool CWnd::OnMouseEvent(const int x,const int y,const int flags)
+  {
+   if(!Contains(x,y))
+     {
+      //--- if cursor is not inside the element and this element is active - deactivate
+      if(IS_ACTIVE)
+        {
+         //--- reset state and coordinates
+         m_mouse_x    =0;
+         m_mouse_y    =0;
+         m_mouse_flags=MOUSE_INVALID_FLAGS;
+         //--- deactivate
+         Deactivate();
+        }
+      return(false);
+     }
+//--- check the state of the left mouse button
+   if((flags&MOUSE_LEFT)!=0)
+     {
+      //--- left mouse button is pressed
+      if(m_mouse_flags==MOUSE_INVALID_FLAGS)
+        {
+         //--- but not in this control (i.e., cursor entered the element with mouse button pressed)
+         //--- activate the control, but there will be no click
+         if(!IS_ACTIVE)
+           {
+            //--- generate event
+            EventChartCustom(CONTROLS_SELF_MESSAGE,ON_MOUSE_FOCUS_SET,m_id,0.0,m_name);
+            //--- activate
+            return(Activate());
+           }
+         return(true);
+        }
+      if((m_mouse_flags&MOUSE_LEFT)!=0)
+        {
+         //--- mouse button has already been pressed
+         if(IS_CAN_DRAG)
+            return(OnDragProcess(x,y));
+         if(IS_CLICKS_BY_PRESS)
+           {
+            EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CLICK,m_id,0.0,m_name);
+            //--- handled
+            return(true);
+           }
+        }
+      else
+        {
+         //--- mouse button has been released (pressing)
+         //--- save the state and coordinates
+         m_mouse_flags=flags;
+         m_mouse_x    =x;
+         m_mouse_y    =y;
+         //--- call the handler
+         return(OnMouseDown());
+        }
+     }
+   else
+     {
+      //--- left mouse button is released
+      if(m_mouse_flags==MOUSE_INVALID_FLAGS)
+        {
+         //--- cursor entered the control with mouse button released
+         //--- activate control and save state to the member
+         m_mouse_flags=flags;
+         //--- generate event
+         EventChartCustom(CONTROLS_SELF_MESSAGE,ON_MOUSE_FOCUS_SET,m_id,0.0,m_name);
+         //--- activate
+         return(Activate());
+        }
+      if((m_mouse_flags&MOUSE_LEFT)!=0)
+        {
+         //--- mouse button has been pressed (clicking)
+         //--- save the state and coordinates
+         m_mouse_flags=flags;
+         m_mouse_x    =x;
+         m_mouse_y    =y;
+         //--- call the handler
+         return(OnMouseUp());
+        }
+     }
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CWnd::CWnd(void) : m_chart_id(CONTROLS_INVALID_ID),
+                   m_subwin(CONTROLS_INVALID_ID),
+                   m_name(NULL),
+                   m_id(CONTROLS_INVALID_ID),
+                   m_state_flags(WND_STATE_FLAG_ENABLE+WND_STATE_FLAG_VISIBLE),
+                   m_prop_flags(0),
+                   m_align_flags(WND_ALIGN_NONE),
+                   m_align_left(0),
+                   m_align_top(0),
+                   m_align_right(0),
+                   m_align_bottom(0),
+                   m_mouse_x(0),
+                   m_mouse_y(0),
+                   m_mouse_flags(MOUSE_INVALID_FLAGS),
+                   m_last_click(0),
+                   m_drag_object(NULL)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CWnd::~CWnd(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CWnd::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- attach to chart
+   m_chart_id=chart;
+   m_name    =name;
+   m_subwin  =subwin;
+//--- set coordinates of area
+   Left(x1);
+   Top(y1);
+   Right(x2);
+   Bottom(y2);
+//--- always successful
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Destruction of the control                                       |
+//+------------------------------------------------------------------+
+void CWnd::Destroy(const int reason)
+  {
+//--- call virtual event handler
+   if(OnDestroy())
+      m_name="";
+  }
+//+------------------------------------------------------------------+
+//| Find control by specified ID                                     |
+//+------------------------------------------------------------------+
+CWnd* CWnd::ControlFind(const long id)
+  {
+   CWnd *result=NULL;
+//--- check
+   if(id==m_id)
+      result=GetPointer(this);
+//--- return the result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Change width of control                                          |
+//+------------------------------------------------------------------+
+bool CWnd::Width(const int w)
+  {
+//--- change width
+   m_rect.Width(w);
+//--- call virtual event handler
+   return(OnResize());
+  }
+//+------------------------------------------------------------------+
+//| Change height of control                                         |
+//+------------------------------------------------------------------+
+bool CWnd::Height(const int h)
+  {
+//--- change height
+   m_rect.Height(h);
+//--- call virtual event handler
+   return(OnResize());
+  }
+//+------------------------------------------------------------------+
+//| Resize control                                                   |
+//+------------------------------------------------------------------+
+bool CWnd::Size(const int w,const int h)
+  {
+//--- change size
+   m_rect.Size(w,h);
+//--- call virtual event handler
+   return(OnResize());
+  }
+//+------------------------------------------------------------------+
+//| Resize control                                                   |
+//+------------------------------------------------------------------+
+bool CWnd::Size(const CSize &size)
+  {
+//--- change size
+   m_rect.Size(size);
+//--- call virtual event handler
+   return(OnResize());
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the control 	                              |
+//+------------------------------------------------------------------+
+bool CWnd::Move(const int x,const int y)
+  {
+//--- moving
+   m_rect.Move(x,y);
+//--- call virtual event handler
+   return(OnMove());
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the control 	                              |
+//+------------------------------------------------------------------+
+bool CWnd::Move(const CPoint &point)
+  {
+//--- moving
+   m_rect.Move(point);
+//--- call virtual event handler
+   return(OnMove());
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of the control 	                              |
+//+------------------------------------------------------------------+
+bool CWnd::Shift(const int dx,const int dy)
+  {
+//--- moving
+   m_rect.Shift(dx,dy);
+//--- call virtual event handler
+   return(OnMove());
+  }
+//+------------------------------------------------------------------+
+//| Check contains                                                   |
+//+------------------------------------------------------------------+
+bool CWnd::Contains(CWnd *control) const
+  {
+//--- check
+   if(control==NULL)
+      return(false);
+//--- result
+   return(Contains(control.Left(),control.Top()) && Contains(control.Right(),control.Bottom()));
+  }
+//+------------------------------------------------------------------+
+//| Enables event handling by the control                            |
+//+------------------------------------------------------------------+
+bool CWnd::Enable(void)
+  {
+//--- if there are now changes, then succeed
+   if(IS_ENABLED)
+      return(true);
+//--- change flag
+   StateFlagsSet(WND_STATE_FLAG_ENABLE);
+//--- call virtual event handler
+   return(OnEnable());
+  }
+//+------------------------------------------------------------------+
+//| Disables event handling by the control                           |
+//+------------------------------------------------------------------+
+bool CWnd::Disable(void)
+  {
+//--- if there are now changes, then succeed
+   if(!IS_ENABLED)
+      return(true);
+//--- change flag
+   StateFlagsReset(WND_STATE_FLAG_ENABLE);
+//--- call virtual event handler
+   return(OnDisable());
+  }
+//+------------------------------------------------------------------+
+//| Set the "object is visible" flag for the control                 |
+//+------------------------------------------------------------------+
+bool CWnd::Visible(const bool flag)
+  {
+//--- if there are now changes, then succeed
+   if(IS_VISIBLE==flag)
+      return(true);
+//--- call virtual event handler
+   return(flag ? Show() : Hide());
+  }
+//+------------------------------------------------------------------+
+//| Makes the control visible                                        |
+//+------------------------------------------------------------------+
+bool CWnd::Show(void)
+  {
+//--- change flag
+   StateFlagsSet(WND_STATE_FLAG_VISIBLE);
+//--- call virtual event handler
+   return(OnShow());
+  }
+//+------------------------------------------------------------------+
+//| Makes the control hidden                                         |
+//+------------------------------------------------------------------+
+bool CWnd::Hide(void)
+  {
+//--- change flag
+   StateFlagsReset(WND_STATE_FLAG_VISIBLE);
+//--- call virtual event handler
+   return(OnHide());
+  }
+//+------------------------------------------------------------------+
+//| Makes the control active                                         |
+//+------------------------------------------------------------------+
+bool CWnd::Activate(void)
+  {
+//--- if there are now changes, then succeed
+   if(IS_ACTIVE)
+      return(true);
+//--- change flag
+   StateFlagsSet(WND_STATE_FLAG_ACTIVE);
+//--- call virtual event handler
+   return(OnActivate());
+  }
+//+------------------------------------------------------------------+
+//| Makes the control inactive                                       |
+//+------------------------------------------------------------------+
+bool CWnd::Deactivate(void)
+  {
+//--- if there are now changes, then succeed
+   if(!IS_ACTIVE)
+      return(true);
+//--- change flag
+   StateFlagsReset(WND_STATE_FLAG_ACTIVE);
+//--- call virtual event handler
+   return(OnDeactivate());
+  }
+//+------------------------------------------------------------------+
+//| Set ID of control                                                |
+//+------------------------------------------------------------------+
+long CWnd::Id(const long id)
+  {
+   m_id=id;
+//--- always use only one ID
+   return(1);
+  }
+//+------------------------------------------------------------------+
+//| Set parameters of alignment                                      |
+//+------------------------------------------------------------------+
+void CWnd::Alignment(const int flags,const int left,const int top,const int right,const int bottom)
+  {
+   m_align_flags =flags;
+   m_align_left  =left;
+   m_align_top   =top;
+   m_align_right =right;
+   m_align_bottom=bottom;
+  }
+//+------------------------------------------------------------------+
+//| Align element in specified chart area                            |
+//+------------------------------------------------------------------+
+bool CWnd::Align(const CRect &rect)
+  {
+   int new_value=0;
+//--- check
+   if(m_align_flags==WND_ALIGN_NONE)
+      return(true);
+//--- we are interested only in alignment by right and bottom borders,
+//--- as left and right borders are processed in the OnMove()
+   if((m_align_flags&WND_ALIGN_RIGHT)!=0)
+     {
+      //--- there is alignment by right border,
+      if((m_align_flags&WND_ALIGN_LEFT)!=0)
+        {
+         //--- and by left border (change size)
+         new_value=rect.Width()-m_align_left-m_align_right;
+         if(!Size(new_value,Height()))
+            return(false);
+        }
+      else
+        {
+         //--- no alignment by left border (move)
+         new_value=rect.right-Width()-m_align_right;
+         if(!Move(new_value,Top()))
+            return(false);
+        }
+     }
+   if((m_align_flags&WND_ALIGN_BOTTOM)!=0)
+     {
+      //--- there is alignment by bottom border,
+      if((m_align_flags&WND_ALIGN_TOP)!=0)
+        {
+         //--- and by top border (change size)
+         new_value=rect.Height()-m_align_top-m_align_bottom;
+         if(!Size(Width(),new_value))
+            return(false);
+        }
+      else
+        {
+         //--- no alignment by top border (move)
+         new_value=rect.bottom-Height()-m_align_bottom;
+         if(!Move(Left(),new_value))
+            return(false);
+        }
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Remove the mouse focus from control                              |
+//+------------------------------------------------------------------+
+bool CWnd::MouseFocusKill(const long id)
+  {
+//--- check
+   if(id==m_id)
+      return(false);
+//--- reset flag
+   Deactivate();
+//--- clean
+   m_mouse_x    =0;
+   m_mouse_y    =0;
+   m_mouse_flags=MOUSE_INVALID_FLAGS;
+//--- call the handler
+   return(OnDeactivate());
+  }
+//+------------------------------------------------------------------+
+//| Increases the priority of an element                             |
+//+------------------------------------------------------------------+
+bool CWnd::BringToTop(void)
+  {
+//--- generate event
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_BRING_TO_TOP,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "click" event                                     |
+//+------------------------------------------------------------------+
+bool CWnd::OnClick(void)
+  {
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_CLICK,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "doubl click" event                               |
+//+------------------------------------------------------------------+
+bool CWnd::OnDblClick(void)
+  {
+//--- send notification
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_DBL_CLICK,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of click on the left mouse button                        |
+//+------------------------------------------------------------------+
+bool CWnd::OnMouseDown(void)
+  {
+   if(IS_CAN_DRAG)
+      return(OnDragStart());
+   if(IS_CLICKS_BY_PRESS)
+      return(OnClick());
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of releasing the left mouse button                       |
+//+------------------------------------------------------------------+
+bool CWnd::OnMouseUp(void)
+  {
+   if(IS_CAN_DBL_CLICK)
+     {
+      uint last_time=GetTickCount();
+      if(m_last_click==0 || last_time-m_last_click>CONTROLS_DBL_CLICK_TIME)
+        {
+         m_last_click=(last_time==0) ? 1 : last_time;
+        }
+      else
+        {
+         m_last_click=0;
+         return(OnDblClick());
+        }
+     }
+   if(IS_CAN_DRAG)
+      return(OnDragEnd());
+   if(!IS_CLICKS_BY_PRESS)
+      return(OnClick());
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the control dragging start                            |
+//+------------------------------------------------------------------+
+bool CWnd::OnDragStart(void)
+  {
+   if(!IS_CAN_DRAG)
+      return(true);
+//--- disable scrolling of chart with mouse
+   ChartSetInteger(m_chart_id,CHART_MOUSE_SCROLL,false);
+//--- generate event
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_DRAG_START,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of control dragging process                              |
+//+------------------------------------------------------------------+
+bool CWnd::OnDragProcess(const int x,const int y)
+  {
+   Shift(x-m_mouse_x,y-m_mouse_y);
+//--- save
+   m_mouse_x=x;
+   m_mouse_y=y;
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the control dragging end                              |
+//+------------------------------------------------------------------+
+bool CWnd::OnDragEnd(void)
+  {
+   if(!IS_CAN_DRAG)
+      return(true);
+//--- enable scrolling of chart with mouse
+   ChartSetInteger(m_chart_id,CHART_MOUSE_SCROLL,true);
+//--- generate event
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_DRAG_END,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Destroy the dragged object                                       |
+//+------------------------------------------------------------------+
+bool CWnd::DragObjectDestroy(void)
+  {
+   if(m_drag_object!=NULL)
+     {
+      delete m_drag_object;
+      m_drag_object=NULL;
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Class CDragWnd                                                   |
+//| Usage: base class for drag                                       |
+//+------------------------------------------------------------------+
+class CDragWnd : public CWnd
+  {
+protected:
+   int               m_limit_left;          // left constraint
+   int               m_limit_top;           // top constraint
+   int               m_limit_right;         // right constraint
+   int               m_limit_bottom;        // bottom constraint
+
+public:
+                     CDragWnd(void);
+                    ~CDragWnd(void);
+   //--- constraints
+   void              Limits(const int l,const int t,const int r,const int b);
+
+protected:
+   virtual bool      OnDragProcess(const int x,const int y);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CDragWnd::CDragWnd(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CDragWnd::~CDragWnd(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Constrain the control dragging                                   |
+//+------------------------------------------------------------------+
+void CDragWnd::Limits(const int l,const int t,const int r,const int b)
+  {
+//--- save
+   m_limit_left  =l;
+   m_limit_top   =t;
+   m_limit_right =r;
+   m_limit_bottom=b;
+  }
+//+------------------------------------------------------------------+
+//| Handler of control dragging process                              |
+//+------------------------------------------------------------------+
+bool CDragWnd::OnDragProcess(const int x,const int y)
+  {
+   int dx=x-m_mouse_x;
+   int dy=y-m_mouse_y;
+//--- check shift
+   if(Left()+dx<m_limit_left)
+      dx=m_limit_left-Left();
+   if(Top()+dy<m_limit_top)
+      dy=m_limit_top-Top();
+   if(Right()+dx>m_limit_right)
+      dx=m_limit_right-Right();
+   if(Bottom()+dy>m_limit_bottom)
+      dy=m_limit_bottom-Bottom();
+//--- shift
+   Shift(dx,dy);
+//--- save
+   m_mouse_x=x;
+   m_mouse_y=y;
+//--- generate event
+   EventChartCustom(CONTROLS_SELF_MESSAGE,ON_DRAG_PROCESS,m_id,0.0,m_name);
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/WndClient.mqh b/Include/Controls/WndClient.mqh
new file mode 100644
index 0000000..c6b32ee
--- /dev/null
+++ b/Include/Controls/WndClient.mqh
@@ -0,0 +1,307 @@
+//+------------------------------------------------------------------+
+//|                                                    WndClient.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "WndContainer.mqh"
+#include "Panel.mqh"
+#include "Scrolls.mqh"
+//+------------------------------------------------------------------+
+//| Class CWndClient                                                 |
+//| Usage: base class to create areas with                           |
+//|             the scrollbars                                       |
+//+------------------------------------------------------------------+
+class CWndClient : public CWndContainer
+  {
+protected:
+   //--- flags
+   bool              m_v_scrolled;          // "vertical scrolling is possible" flag
+   bool              m_h_scrolled;          // "horizontal scrolling is possible" flag
+   //--- dependent controls
+   CPanel            m_background;          // the "scrollbar background" object
+   CScrollV          m_scroll_v;            // the vertical scrollbar object
+   CScrollH          m_scroll_h;            // the horizontal scrollbar object
+
+public:
+                     CWndClient(void);
+                    ~CWndClient(void);
+   //--- create
+   virtual bool      Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- parameters
+   virtual bool      ColorBackground(const color value)          { return(m_background.ColorBackground(value)); }
+   virtual bool      ColorBorder(const color value)              { return(m_background.ColorBorder(value));     }
+   virtual bool      BorderType(const ENUM_BORDER_TYPE flag)     { return(m_background.BorderType(flag));       }
+   //--- settings
+   virtual bool      VScrolled(void) { return(m_v_scrolled); }
+   virtual bool      VScrolled(const bool flag);
+   virtual bool      HScrolled(void) { return(m_h_scrolled); }
+   virtual bool      HScrolled(const bool flag);
+   //--- ID
+   virtual long      Id(const long id);
+   //--- state
+   virtual bool      Show(void);
+
+protected:
+   //--- create dependent controls
+   virtual bool      CreateBack(void);
+   virtual bool      CreateScrollV(void);
+   virtual bool      CreateScrollH(void);
+   //--- internal event handlers
+   virtual bool      OnResize(void);
+   //--- handlers of the dependent controls events
+   virtual bool      OnVScrollShow(void)                         { return(true); }
+   virtual bool      OnVScrollHide(void)                         { return(true); }
+   virtual bool      OnHScrollShow(void)                         { return(true); }
+   virtual bool      OnHScrollHide(void)                         { return(true); }
+   virtual bool      OnScrollLineDown(void)                      { return(true); }
+   virtual bool      OnScrollLineUp(void)                        { return(true); }
+   virtual bool      OnScrollLineLeft(void)                      { return(true); }
+   virtual bool      OnScrollLineRight(void)                     { return(true); }
+   //--- resize
+   virtual bool      Rebound(const CRect &rect);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+EVENT_MAP_BEGIN(CWndClient)
+   ON_NAMED_EVENT(ON_SHOW,m_scroll_v,OnVScrollShow)
+   ON_NAMED_EVENT(ON_HIDE,m_scroll_v,OnVScrollHide)
+   ON_EVENT(ON_SCROLL_DEC,m_scroll_v,OnScrollLineUp)
+   ON_EVENT(ON_SCROLL_INC,m_scroll_v,OnScrollLineDown)
+   ON_NAMED_EVENT(ON_SHOW,m_scroll_h,OnHScrollShow)
+   ON_NAMED_EVENT(ON_HIDE,m_scroll_h,OnHScrollHide)
+   ON_EVENT(ON_SCROLL_DEC,m_scroll_h,OnScrollLineLeft)
+   ON_EVENT(ON_SCROLL_INC,m_scroll_h,OnScrollLineRight)
+EVENT_MAP_END(CWndContainer)
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CWndClient::CWndClient(void) : m_v_scrolled(false),
+                               m_h_scrolled(false)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CWndClient::~CWndClient(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Create a control                                                 |
+//+------------------------------------------------------------------+
+bool CWndClient::Create(const long chart,const string name,const int subwin,const int x1,const int y1,const int x2,const int y2)
+  {
+//--- call of the method of the parent class
+   if(!CWndContainer::Create(chart,name,subwin,x1,y1,x2,y2))
+      return(false);
+//--- create dependent controls
+   if(!CreateBack())
+      return(false);
+   if(m_v_scrolled && !CreateScrollV())
+      return(false);
+   if(m_h_scrolled && !CreateScrollH())
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create scrollbar background                                      |
+//+------------------------------------------------------------------+
+bool CWndClient::CreateBack(void)
+  {
+//--- create
+   if(!m_background.Create(m_chart_id,m_name+"Back",m_subwin,0,0,Width(),Height()))
+      return(false);
+   if(!m_background.ColorBorder(CONTROLS_CLIENT_COLOR_BORDER))
+      return(false);
+   if(!m_background.ColorBackground(CONTROLS_CLIENT_COLOR_BG))
+      return(false);
+   if(!Add(m_background))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create vertical scrollbar                                        |
+//+------------------------------------------------------------------+
+bool CWndClient::CreateScrollV(void)
+  {
+//--- calculate coordinates
+   int x1=Width()-CONTROLS_SCROLL_SIZE-CONTROLS_BORDER_WIDTH;
+   int y1=CONTROLS_BORDER_WIDTH;
+   int x2=Width()-CONTROLS_BORDER_WIDTH;
+   int y2=Height()-CONTROLS_BORDER_WIDTH;
+   if(m_h_scrolled) y2-=CONTROLS_SCROLL_SIZE;
+//--- create
+   if(!m_scroll_v.Create(m_chart_id,m_name+"VScroll",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!Add(m_scroll_v))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Create horizontal scrollbar                                      |
+//+------------------------------------------------------------------+
+bool CWndClient::CreateScrollH(void)
+  {
+//--- calculate coordinates
+   int x1=CONTROLS_BORDER_WIDTH;
+   int y1=Height()-CONTROLS_SCROLL_SIZE-CONTROLS_BORDER_WIDTH;
+   int x2=Width()-CONTROLS_BORDER_WIDTH;
+   int y2=Height()-CONTROLS_BORDER_WIDTH;
+   if(m_v_scrolled) x2-=CONTROLS_SCROLL_SIZE;
+//--- create
+   if(!m_scroll_h.Create(m_chart_id,m_name+"HScroll",m_subwin,x1,y1,x2,y2))
+      return(false);
+   if(!Add(m_scroll_h))
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set up vertical scrollbar                                        |
+//+------------------------------------------------------------------+
+bool CWndClient::VScrolled(const bool flag)
+  {
+   if(m_v_scrolled==flag)
+      return(true);
+//--- there are changes
+   int d_size=0;
+   if(flag)
+     {
+      //--- create vertical scrollbar
+      if(!CreateScrollV())
+         return(false);
+      //--- need to shorten horizontal scrollbar (if there is one)
+      d_size=-CONTROLS_SCROLL_SIZE;
+     }
+   else
+     {
+      //--- delete vertical scrollbar
+      m_scroll_v.Destroy();
+      if(!Delete(m_scroll_v))
+         return(false);
+      //--- need to lengthen horizontal scrollbar (if there is one)
+      d_size=CONTROLS_SCROLL_SIZE;
+     }
+   m_v_scrolled=flag;
+//--- change width of horizontal scrollbar (if there is one)
+   if(m_h_scrolled)
+     {
+      if(!m_scroll_h.Width(m_scroll_h.Width()+d_size))
+         return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set up horizontal scrollbar                                      |
+//+------------------------------------------------------------------+
+bool CWndClient::HScrolled(const bool flag)
+  {
+   if(m_h_scrolled==flag)
+      return(true);
+//--- there are changes
+   int d_size=0;
+   if(flag)
+     {
+      //--- create horizontal scrollbar
+      if(!CreateScrollH())
+         return(false);
+      //--- need to shorten vertical scrollbar (if there is one)
+      d_size=-CONTROLS_SCROLL_SIZE;
+     }
+   else
+     {
+      //--- delete horizontal scrollbar
+      m_scroll_h.Destroy();
+      if(!Delete(m_scroll_h))
+         return(false);
+      //--- need to lengthen vertical scrollbar (if there is one)
+      d_size=CONTROLS_SCROLL_SIZE;
+     }
+   m_h_scrolled=flag;
+//--- change width of vertical scrollbar (if there is one)
+   if(m_v_scrolled)
+     {
+      if(!m_scroll_v.Height(m_scroll_v.Height()+d_size))
+         return(false);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set ID of control                                                |
+//+------------------------------------------------------------------+
+long CWndClient::Id(const long id)
+  {
+//--- reserve ID for container
+   long id_used=CWndContainer::Id(id);
+//---
+   if(!m_v_scrolled)
+      id_used+=m_scroll_v.Id(id+id_used);
+   if(!m_h_scrolled)
+      id_used+=m_scroll_h.Id(id+id_used);
+//--- return number of used IDs
+   return(id_used);
+  }
+//+------------------------------------------------------------------+
+//| Makes the control visible                                        |
+//+------------------------------------------------------------------+
+bool CWndClient::Show(void)
+  {
+//--- call of the method of the parent class
+   CWndContainer::Show();
+//---
+   if(!m_v_scrolled)
+      m_scroll_v.Hide();
+   if(!m_h_scrolled)
+      m_scroll_h.Hide();
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of resizing                                              |
+//+------------------------------------------------------------------+
+bool CWndClient::OnResize(void)
+  {
+//--- call of the method of the parent class
+   if(!CWndContainer::OnResize())
+      return(false);
+//--- resize background
+   int d_size=0;
+   m_background.Width(Width());
+   m_background.Height(Height());
+//---
+   if(m_v_scrolled)
+     {
+      //--- move vertical scrollbar
+      m_scroll_v.Move(Right()-CONTROLS_SCROLL_SIZE,Top());
+      //--- modify vertical scrollbar
+      d_size=(m_h_scrolled) ? CONTROLS_SCROLL_SIZE : 0;
+      m_scroll_v.Height(Height()-d_size);
+     }
+   if(m_h_scrolled)
+     {
+      //--- move horizontal scrollbar
+      m_scroll_h.Move(Left(),Bottom()-CONTROLS_SCROLL_SIZE);
+      //--- modify horizontal scrollbar
+      d_size=(m_v_scrolled) ? CONTROLS_SCROLL_SIZE : 0;
+      m_scroll_h.Width(Width()-d_size);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Resize                                                           |
+//+------------------------------------------------------------------+
+bool CWndClient::Rebound(const CRect &rect)
+  {
+   m_rect.SetBound(rect);
+//--- call virtual event handler
+   return(OnResize());
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/WndContainer.mqh b/Include/Controls/WndContainer.mqh
new file mode 100644
index 0000000..4a5df27
--- /dev/null
+++ b/Include/Controls/WndContainer.mqh
@@ -0,0 +1,472 @@
+//+------------------------------------------------------------------+
+//|                                                 WndContainer.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Wnd.mqh"
+#include <Arrays\ArrayObj.mqh>
+//+------------------------------------------------------------------+
+//| Class CWndContainer                                              |
+//| Usage: base class of the combined control                        |
+//+------------------------------------------------------------------+
+class CWndContainer : public CWnd
+  {
+private:
+   CArrayObj         m_controls;            // container of the control
+
+public:
+                     CWndContainer(void);
+                    ~CWndContainer(void);
+   //--- release memory
+   virtual void      Destroy(const int reason=0);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   virtual bool      OnMouseEvent(const int x,const int y,const int flags);
+   //--- access the contents of container
+   int               ControlsTotal(void)               const { return(m_controls.Total()); }
+   CWnd*             Control(const int ind)            const { return(dynamic_cast<CWnd *>(m_controls.At(ind))); }
+   virtual CWnd*     ControlFind(const long id);
+   //--- for mouse cursor focus
+   virtual bool      MouseFocusKill(const long id=-1);
+   //--- fill
+   bool              Add(CWnd *control);
+   bool              Add(CWnd &control);
+   //--- underflowing
+   bool              Delete(CWnd *control);
+   bool              Delete(CWnd &control);
+   //--- geometry
+   virtual bool      Move(const int x,const int y);
+   virtual bool      Move(const CPoint &point);
+   virtual bool      Shift(const int dx,const int dy);
+   //--- ID
+   virtual long      Id(const long id);
+   //--- state
+   virtual bool      Enable(void);
+   virtual bool      Disable(void);
+   virtual bool      Show(void);
+   virtual bool      Hide(void);
+   //--- methods for working with files
+   virtual bool      Save(const int file_handle);
+   virtual bool      Load(const int file_handle);
+
+protected:
+   //--- internal event handlers
+   virtual bool      OnResize(void);
+   virtual bool      OnActivate(void);
+   virtual bool      OnDeactivate(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+bool CWndContainer::OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam)
+  {
+//--- if an object is being dragged, pass control to the special drag object
+   if(m_drag_object!=NULL && m_drag_object.OnEvent(id,lparam,dparam,sparam))
+      return(true);
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=total-1;i>=0;i--)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      if(control.OnEvent(id,lparam,dparam,sparam))
+         return(true);
+     }
+//--- not handled
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Common handler of mouse events                                   |
+//+------------------------------------------------------------------+
+bool CWndContainer::OnMouseEvent(const int x,const int y,const int flags)
+  {
+   if(!IS_VISIBLE)
+      return(false);
+//--- if an object is being dragged, pass control to the special drag object
+   if(m_drag_object!=NULL && m_drag_object.OnMouseEvent(x,y,flags))
+      return(true);
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=total-1;i>=0;i--)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      if(control.OnMouseEvent(x,y,flags))
+         return(true);
+     }
+//--- call of the method of the parent class
+   return(CWnd::OnMouseEvent(x,y,flags));
+  }
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CWndContainer::CWndContainer(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CWndContainer::~CWndContainer(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Delete group of controls                                         |
+//+------------------------------------------------------------------+
+void CWndContainer::Destroy(const int reason)
+  {
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(0);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Destroy();
+      m_controls.Delete(0);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Find control by specified ID                                     |
+//+------------------------------------------------------------------+
+CWnd* CWndContainer::ControlFind(const long id)
+  {
+   CWnd *result=CWnd::ControlFind(id);
+//---
+   if(result!=NULL)
+      return(result);
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      result=control.ControlFind(id);
+      if(result!=NULL)
+         break;
+     }
+//--- return the result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Remove the mouse focus from control                              |
+//+------------------------------------------------------------------+
+bool CWndContainer::MouseFocusKill(const long id=-1)
+  {
+   if(!IS_ACTIVE)
+      return(false);
+   Deactivate();
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.MouseFocusKill();
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Add control to the group (by pointer)                            |
+//+------------------------------------------------------------------+
+bool CWndContainer::Add(CWnd *control)
+  {
+//--- check of pointer
+   if(control==NULL)
+      return(false);
+//--- correct the coordinates of added control
+   control.Shift(Left(),Top());
+ //--- "projecting" the group flag "visibility" to the added element
+   if(IS_VISIBLE && control.IsVisible())
+     {
+      //--- element will be "visible" only if the group is "visible" and the element is completely "within" this group
+      control.Visible(Contains(control));
+     }
+   else
+      control.Hide();
+//--- "projecting" the group flag "enabled" to the added element
+   if(IS_ENABLED)
+      control.Enable();
+   else
+      control.Disable();
+//--- adding
+   return(m_controls.Add(control));
+  }
+//+------------------------------------------------------------------+
+//| Add control to the group (by reference)                          |
+//+------------------------------------------------------------------+
+bool CWndContainer::Add(CWnd &control)
+  {
+//--- add by pointer
+   return(Add((CWnd*)GetPointer(control)));
+  }
+//+------------------------------------------------------------------+
+//| Delete control from the group (by pointer)                       |
+//+------------------------------------------------------------------+
+bool CWndContainer::Delete(CWnd *control)
+  {
+//--- check of pointer
+   if(control==NULL)
+      return(false);
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *pointer=Control(i);
+      //--- check of pointer
+      if(pointer==NULL)
+         continue;
+      //--- delete item from group
+      if(pointer==control)
+         return(m_controls.Delete(i));
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Delete control from the group (by reference)                     |
+//+------------------------------------------------------------------+
+bool CWndContainer::Delete(CWnd &control)
+  {
+//--- delete by pointer
+   return(Delete((CWnd*)GetPointer(control)));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the controls group                          |
+//+------------------------------------------------------------------+
+bool CWndContainer::Move(const int x,const int y)
+  {
+//--- relative movement
+   return(Shift(x-Left(),y-Top()));
+  }
+//+------------------------------------------------------------------+
+//| Absolute movement of the controls group                          |
+//+------------------------------------------------------------------+
+bool CWndContainer::Move(const CPoint &point)
+  {
+//--- relative movement
+   return(Shift(point.x-Left(),point.y-Top()));
+  }
+//+------------------------------------------------------------------+
+//| Relative movement of the controls group                          |
+//+------------------------------------------------------------------+
+bool CWndContainer::Shift(const int dx,const int dy)
+  {
+//--- call of the method of the parent class
+   if(!CWnd::Shift(dx,dy)) return(false);
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      //--- move the group item
+      control.Shift(dx,dy);
+     }
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set ID of control                                                |
+//+------------------------------------------------------------------+
+long CWndContainer::Id(const long id)
+  {
+//--- reserve ID for container
+   long id_used=1;
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      id_used+=control.Id(id+id_used);
+     }
+   m_id=id;
+//--- return number of used IDs
+   return(id_used);
+  }
+//+------------------------------------------------------------------+
+//| Enables event handling by the group of controls                  |
+//+------------------------------------------------------------------+
+bool CWndContainer::Enable(void)
+  {
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Enable();
+     }
+//--- call of the method of the parent class
+   return(CWnd::Enable());
+  }
+//+------------------------------------------------------------------+
+//| Disables event handling by the group of controls                 |
+//+------------------------------------------------------------------+
+bool CWndContainer::Disable(void)
+  {
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Disable();
+     }
+//--- call of the method of the parent class
+   return(CWnd::Disable());
+  }
+//+------------------------------------------------------------------+
+//| Makes the group of controls visible                              |
+//+------------------------------------------------------------------+
+bool CWndContainer::Show(void)
+  {
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Show();
+     }
+//--- call of the method of the parent class
+   return(CWnd::Show());
+  }
+//+------------------------------------------------------------------+
+//| Makes the group of controls hidden                               |
+//+------------------------------------------------------------------+
+bool CWndContainer::Hide(void)
+  {
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Hide();
+     }
+//--- call of the method of the parent class
+   return(CWnd::Hide());
+  }
+//+------------------------------------------------------------------+
+//| Handler of resizing                                              |
+//+------------------------------------------------------------------+
+bool CWndContainer::OnResize()
+  {
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      if(!control.Align(Rect()))
+         return(false);
+     }
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of activating the group of controls                      |
+//+------------------------------------------------------------------+
+bool CWndContainer::OnActivate(void)
+  {
+   if(IS_ACTIVE)
+      return(false);
+   Activate();
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Activate();
+     }
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of deactivating the group of controls                    |
+//+------------------------------------------------------------------+
+bool CWndContainer::OnDeactivate(void)
+  {
+   if(!IS_ACTIVE)
+      return(false);
+   Deactivate();
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      control.Deactivate();
+     }
+//--- handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Save                                                             |
+//+------------------------------------------------------------------+
+bool CWndContainer::Save(const int file_handle)
+  {
+   bool result=true;
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      result&=control.Save(file_handle);
+     }
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
+//| Load                                                             |
+//+------------------------------------------------------------------+
+bool CWndContainer::Load(const int file_handle)
+  {
+   bool result=true;
+//--- loop by elements of group
+   int total=m_controls.Total();
+   for(int i=0;i<total;i++)
+     {
+      CWnd *control=Control(i);
+      //--- check of pointer
+      if(control==NULL)
+         continue;
+      result&=control.Load(file_handle);
+     }
+//--- result
+   return(result);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/WndObj.mqh b/Include/Controls/WndObj.mqh
new file mode 100644
index 0000000..4aa9d42
--- /dev/null
+++ b/Include/Controls/WndObj.mqh
@@ -0,0 +1,262 @@
+//+------------------------------------------------------------------+
+//|                                                       WndObj.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "Wnd.mqh"
+//+------------------------------------------------------------------+
+//| Class CWndObj                                                    |
+//| Usage: base class to work with chart objects                     |
+//+------------------------------------------------------------------+
+class CWndObj : public CWnd
+  {
+private:
+   //--- flags of object
+   bool              m_undeletable;         // "object is not deletable" flag
+   bool              m_unchangeable;        // "object is not changeable" flag
+   bool              m_unmoveable;          // "object is not movable" flag
+
+protected:
+   //--- parameters of the chart object
+   string            m_text;                // object text
+   color             m_color;               // object color
+   color             m_color_background;    // object background color
+   color             m_color_border;        // object border color
+   string            m_font;                // object font
+   int               m_font_size;           // object font size
+   long              m_zorder;              // Z order
+
+public:
+                     CWndObj(void);
+                    ~CWndObj(void);
+   //--- chart event handler
+   virtual bool      OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam);
+   //--- set up the object
+   string            Text(void) const { return(m_text); }
+   bool              Text(const string value);
+   color             Color(void) const { return(m_color); }
+   bool              Color(const color value);
+   color             ColorBackground(void) const { return(m_color_background); }
+   bool              ColorBackground(const color value);
+   color             ColorBorder(void) const { return(m_color_border); }
+   bool              ColorBorder(const color value);
+   string            Font(void) const { return(m_font); }
+   bool              Font(const string value);
+   int               FontSize(void) const { return(m_font_size); }
+   bool              FontSize(const int value);
+   long              ZOrder(void) const { return(m_zorder); }
+   bool              ZOrder(const long value);
+
+protected:
+   //--- handlers of object events
+   virtual bool      OnObjectCreate(void);
+   virtual bool      OnObjectChange(void);
+   virtual bool      OnObjectDelete(void);
+   virtual bool      OnObjectDrag(void);
+   //--- handlers of object settings
+   virtual bool      OnSetText(void)                  { return(true); }
+   virtual bool      OnSetColor(void)                 { return(true); }
+   virtual bool      OnSetColorBackground(void)       { return(true); }
+   virtual bool      OnSetColorBorder(void)           { return(true); }
+   virtual bool      OnSetFont(void)                  { return(true); }
+   virtual bool      OnSetFontSize(void)              { return(true); }
+   virtual bool      OnSetZOrder(void)                { return(true); }
+   //--- internal event handlers
+   virtual bool      OnDestroy(void) { return(ObjectDelete(m_chart_id,m_name)); }
+   virtual bool      OnChange(void);
+  };
+//+------------------------------------------------------------------+
+//| Common handler of chart events                                   |
+//+------------------------------------------------------------------+
+bool CWndObj::OnEvent(const int id,const long &lparam,const double &dparam,const string &sparam)
+  {
+   if(m_name==sparam)
+     {
+      //--- object name and string parameters are equal
+      //--- this means that event should be handled
+      switch(id)
+        {
+         case CHARTEVENT_OBJECT_CREATE: return(OnObjectCreate());
+         case CHARTEVENT_OBJECT_CHANGE: return(OnObjectChange());
+         case CHARTEVENT_OBJECT_DELETE: return(OnObjectDelete());
+         case CHARTEVENT_OBJECT_DRAG  : return(OnObjectDrag());
+        }
+     }
+//--- event was not handled
+   return(CWnd::OnEvent(id,lparam,dparam,sparam));
+  }
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CWndObj::CWndObj(void) : m_color(clrNONE),
+                         m_color_background(clrNONE),
+                         m_color_border(clrNONE),
+                         m_font(CONTROLS_FONT_NAME),
+                         m_font_size(CONTROLS_FONT_SIZE),
+                         m_zorder(0),
+                         m_undeletable(true),
+                         m_unchangeable(true),
+                         m_unmoveable(true)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CWndObj::~CWndObj(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Set the "Text" parameter                                         |
+//+------------------------------------------------------------------+
+bool CWndObj::Text(const string value)
+  {
+//--- save new value of parameter
+   m_text=value;
+//--- call virtual event handler
+   return(OnSetText());
+  }
+//+------------------------------------------------------------------+
+//| Set the "Color" parameter                                        |
+//+------------------------------------------------------------------+
+bool CWndObj::Color(const color value)
+  {
+//--- save new value of parameter
+   m_color=value;
+//--- call virtual event handler
+   return(OnSetColor());
+  }
+//+------------------------------------------------------------------+
+//| Setting the "Background color" parameter                         |
+//+------------------------------------------------------------------+
+bool CWndObj::ColorBackground(const color value)
+  {
+//--- save new value of parameter
+   m_color_background=value;
+//--- call virtual event handler
+   return(OnSetColorBackground());
+  }
+//+------------------------------------------------------------------+
+//| Set the "Border color" parameter                                 |
+//+------------------------------------------------------------------+
+bool CWndObj::ColorBorder(const color value)
+  {
+//--- save new value of parameter
+   m_color_border=value;
+//--- call virtual event handler
+   return(OnSetColorBorder());
+  }
+//+------------------------------------------------------------------+
+//| Set the "Font" parameter                                         |
+//+------------------------------------------------------------------+
+bool CWndObj::Font(const string value)
+  {
+//--- save new value of parameter
+   m_font=value;
+//--- call virtual event handler
+   return(OnSetFont());
+  }
+//+------------------------------------------------------------------+
+//| Set the "Font size" parameter                                    |
+//+------------------------------------------------------------------+
+bool CWndObj::FontSize(const int value)
+  {
+//--- save new value of parameter
+   m_font_size=value;
+//--- call virtual event handler
+   return(OnSetFontSize());
+  }
+//+------------------------------------------------------------------+
+//| Set the "Z order" parameter                                      |
+//+------------------------------------------------------------------+
+bool CWndObj::ZOrder(const long value)
+  {
+//--- save new value of parameter
+   m_zorder=value;
+//--- call virtual event handler
+   return(OnSetZOrder());
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Object creation" event                           |
+//+------------------------------------------------------------------+
+bool CWndObj::OnObjectCreate(void)
+  {
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Object modification" event                       |
+//+------------------------------------------------------------------+
+bool CWndObj::OnObjectChange(void)
+  {
+//--- if object is not changeable
+   if(m_unchangeable)
+     {
+      //--- restore position
+      if(!OnMove())
+         return(false);
+      //--- restore size
+      if(!OnResize())
+         return(false);
+      //--- restore settings
+      if(!OnChange())
+         return(false);
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Object deletion" event                           |
+//+------------------------------------------------------------------+
+bool CWndObj::OnObjectDelete(void)
+  {
+//--- if object is not deletable
+   if(m_undeletable)
+     {
+      //--- restore the object
+      if(!OnCreate())
+         return(false);
+      //--- restore settings
+      if(!OnChange())
+         return(false);
+      //--- restore visibility
+      return(IS_VISIBLE ? OnShow():OnHide());
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Handler of the "Object dragging" event                           |
+//+------------------------------------------------------------------+
+bool CWndObj::OnObjectDrag(void)
+  {
+//--- if object is not movable
+   if(m_unmoveable)
+     {
+      //--- restore position
+      return(OnMove());
+     }
+//--- event is handled
+   return(true);
+  }
+//+------------------------------------------------------------------+
+//| Set up the object                                                |
+//+------------------------------------------------------------------+
+bool CWndObj::OnChange(void)
+  {
+//--- set up the chart object according to previously set parameters
+   if(!OnSetText())
+      return(false);
+   if(!OnSetFont())
+      return(false);
+   if(!OnSetFontSize())
+      return(false);
+   if(!OnSetColor())
+      return(false);
+   if(!OnSetColorBackground())
+      return(false);
+   if(!OnSetColorBorder())
+      return(false);
+//--- succeed
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Controls/res/CheckBoxOff.bmp b/Include/Controls/res/CheckBoxOff.bmp
new file mode 100644
index 0000000..cdc09e6
Binary files /dev/null and b/Include/Controls/res/CheckBoxOff.bmp differ
diff --git a/Include/Controls/res/CheckBoxOn.bmp b/Include/Controls/res/CheckBoxOn.bmp
new file mode 100644
index 0000000..decb816
Binary files /dev/null and b/Include/Controls/res/CheckBoxOn.bmp differ
diff --git a/Include/Controls/res/Close.bmp b/Include/Controls/res/Close.bmp
new file mode 100644
index 0000000..9d1aab5
Binary files /dev/null and b/Include/Controls/res/Close.bmp differ
diff --git a/Include/Controls/res/DateDropOff.bmp b/Include/Controls/res/DateDropOff.bmp
new file mode 100644
index 0000000..8525047
Binary files /dev/null and b/Include/Controls/res/DateDropOff.bmp differ
diff --git a/Include/Controls/res/DateDropOn.bmp b/Include/Controls/res/DateDropOn.bmp
new file mode 100644
index 0000000..0e65c5d
Binary files /dev/null and b/Include/Controls/res/DateDropOn.bmp differ
diff --git a/Include/Controls/res/Down.bmp b/Include/Controls/res/Down.bmp
new file mode 100644
index 0000000..5dd180c
Binary files /dev/null and b/Include/Controls/res/Down.bmp differ
diff --git a/Include/Controls/res/DownTransp.bmp b/Include/Controls/res/DownTransp.bmp
new file mode 100644
index 0000000..ab50187
Binary files /dev/null and b/Include/Controls/res/DownTransp.bmp differ
diff --git a/Include/Controls/res/DropOff.bmp b/Include/Controls/res/DropOff.bmp
new file mode 100644
index 0000000..ab50187
Binary files /dev/null and b/Include/Controls/res/DropOff.bmp differ
diff --git a/Include/Controls/res/DropOn.bmp b/Include/Controls/res/DropOn.bmp
new file mode 100644
index 0000000..11b45f1
Binary files /dev/null and b/Include/Controls/res/DropOn.bmp differ
diff --git a/Include/Controls/res/Left.bmp b/Include/Controls/res/Left.bmp
new file mode 100644
index 0000000..1de38ac
Binary files /dev/null and b/Include/Controls/res/Left.bmp differ
diff --git a/Include/Controls/res/LeftTransp.bmp b/Include/Controls/res/LeftTransp.bmp
new file mode 100644
index 0000000..dc8ed84
Binary files /dev/null and b/Include/Controls/res/LeftTransp.bmp differ
diff --git a/Include/Controls/res/RadioButtonOff.bmp b/Include/Controls/res/RadioButtonOff.bmp
new file mode 100644
index 0000000..0c39bbc
Binary files /dev/null and b/Include/Controls/res/RadioButtonOff.bmp differ
diff --git a/Include/Controls/res/RadioButtonOn.bmp b/Include/Controls/res/RadioButtonOn.bmp
new file mode 100644
index 0000000..6eada00
Binary files /dev/null and b/Include/Controls/res/RadioButtonOn.bmp differ
diff --git a/Include/Controls/res/Restore.bmp b/Include/Controls/res/Restore.bmp
new file mode 100644
index 0000000..2e8312a
Binary files /dev/null and b/Include/Controls/res/Restore.bmp differ
diff --git a/Include/Controls/res/Right.bmp b/Include/Controls/res/Right.bmp
new file mode 100644
index 0000000..9930da2
Binary files /dev/null and b/Include/Controls/res/Right.bmp differ
diff --git a/Include/Controls/res/RightTransp.bmp b/Include/Controls/res/RightTransp.bmp
new file mode 100644
index 0000000..31227b5
Binary files /dev/null and b/Include/Controls/res/RightTransp.bmp differ
diff --git a/Include/Controls/res/SpinDec.bmp b/Include/Controls/res/SpinDec.bmp
new file mode 100644
index 0000000..ad4d3d0
Binary files /dev/null and b/Include/Controls/res/SpinDec.bmp differ
diff --git a/Include/Controls/res/SpinInc.bmp b/Include/Controls/res/SpinInc.bmp
new file mode 100644
index 0000000..ce0ae60
Binary files /dev/null and b/Include/Controls/res/SpinInc.bmp differ
diff --git a/Include/Controls/res/ThumbHor.bmp b/Include/Controls/res/ThumbHor.bmp
new file mode 100644
index 0000000..8c9bed3
Binary files /dev/null and b/Include/Controls/res/ThumbHor.bmp differ
diff --git a/Include/Controls/res/ThumbVert.bmp b/Include/Controls/res/ThumbVert.bmp
new file mode 100644
index 0000000..15b2609
Binary files /dev/null and b/Include/Controls/res/ThumbVert.bmp differ
diff --git a/Include/Controls/res/Turn.bmp b/Include/Controls/res/Turn.bmp
new file mode 100644
index 0000000..022c7f1
Binary files /dev/null and b/Include/Controls/res/Turn.bmp differ
diff --git a/Include/Controls/res/Up.bmp b/Include/Controls/res/Up.bmp
new file mode 100644
index 0000000..bfea4cd
Binary files /dev/null and b/Include/Controls/res/Up.bmp differ
diff --git a/Include/Controls/res/UpTransp.bmp b/Include/Controls/res/UpTransp.bmp
new file mode 100644
index 0000000..11b45f1
Binary files /dev/null and b/Include/Controls/res/UpTransp.bmp differ
diff --git a/Include/Files/File.mqh b/Include/Files/File.mqh
new file mode 100644
index 0000000..499722e
--- /dev/null
+++ b/Include/Files/File.mqh
@@ -0,0 +1,292 @@
+//+------------------------------------------------------------------+
+//|                                                         File.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include <Object.mqh>
+//+------------------------------------------------------------------+
+//| Class CFile.                                                     |
+//| Purpose: Base class of file operations.                          |
+//|          Derives from class CObject.                             |
+//+------------------------------------------------------------------+
+class CFile : public CObject
+  {
+protected:
+   int               m_handle;             // handle of file
+   string            m_name;               // name of opened file
+   int               m_flags;              // flags of opened file
+
+public:
+                     CFile(void);
+                    ~CFile(void);
+   //--- methods of access to protected data
+   int               Handle(void)              const { return(m_handle); };
+   string            FileName(void)            const { return(m_name);   };
+   int               Flags(void)               const { return(m_flags);  };
+   void              SetUnicode(const bool unicode);
+   void              SetCommon(const bool common);
+   //--- general methods for working with files
+   int               Open(const string file_name,int open_flags,const short delimiter='\t');
+   void              Close(void);
+   void              Delete(void);
+   ulong             Size(void);
+   ulong             Tell(void);
+   void              Seek(const long offset,const ENUM_FILE_POSITION origin);
+   void              Flush(void);
+   bool              IsEnding(void);
+   bool              IsLineEnding(void);
+   //--- general methods for working with files
+   void              Delete(const string file_name,const int common_flag=0);
+   bool              IsExist(const string file_name,const int common_flag=0);
+   bool              Copy(const string src_name,const int common_flag,const string dst_name,const int mode_flags);
+   bool              Move(const string src_name,const int common_flag,const string dst_name,const int mode_flags);
+   //--- general methods of working with folders
+   bool              FolderCreate(const string folder_name);
+   bool              FolderDelete(const string folder_name);
+   bool              FolderClean(const string folder_name);
+   //--- general methods of finding files
+   long              FileFindFirst(const string file_filter,string &returned_filename);
+   bool              FileFindNext(const long search_handle,string &returned_filename);
+   void              FileFindClose(const long search_handle);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CFile::CFile(void) : m_handle(INVALID_HANDLE),
+                     m_name(""),
+                     m_flags(FILE_ANSI)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CFile::~CFile(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      Close();
+  }
+//+------------------------------------------------------------------+
+//| Set the FILE_UNICODE flag                                        |
+//+------------------------------------------------------------------+
+void CFile::SetUnicode(const bool unicode)
+  {
+//--- check handle
+   if(m_handle==INVALID_HANDLE)
+     {
+      if(unicode)
+         m_flags|=FILE_UNICODE;
+      else
+         m_flags&=~FILE_UNICODE;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Set the "Common Folder" flag                                     |
+//+------------------------------------------------------------------+
+void CFile::SetCommon(const bool common)
+  {
+//--- check handle
+   if(m_handle==INVALID_HANDLE)
+     {
+      if(common)
+         m_flags|=FILE_COMMON;
+      else
+         m_flags&=~FILE_COMMON;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Open the file                                                    |
+//+------------------------------------------------------------------+
+int CFile::Open(const string file_name,int open_flags,const short delimiter)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      Close();
+//--- action
+   if((open_flags &(FILE_BIN|FILE_CSV))==0)
+      open_flags|=FILE_TXT;
+//--- open
+   m_handle=FileOpen(file_name,open_flags|m_flags,delimiter);
+   if(m_handle!=INVALID_HANDLE)
+     {
+      //--- store options of the opened file
+      m_flags|=open_flags;
+      m_name=file_name;
+     }
+//--- result
+   return(m_handle);
+  }
+//+------------------------------------------------------------------+
+//| Close the file                                                   |
+//+------------------------------------------------------------------+
+void CFile::Close(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      //--- closing the file and resetting all the variables to the initial state
+      FileClose(m_handle);
+      m_handle=INVALID_HANDLE;
+      m_name="";
+      //--- reset all flags except the text
+      m_flags&=FILE_ANSI|FILE_UNICODE;
+     }
+  }
+//+------------------------------------------------------------------+
+//| Deleting an open file                                            |
+//+------------------------------------------------------------------+
+void CFile::Delete(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      string file_name=m_name;
+      int    common_flag=m_flags&FILE_COMMON;
+      //--- close before deleting
+      Close();
+      //--- delete
+      FileDelete(file_name,common_flag);
+     }
+  }
+//+------------------------------------------------------------------+
+//| Get size of opened file                                          |
+//+------------------------------------------------------------------+
+ulong CFile::Size(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileSize(m_handle));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Get current position of pointer in file                          |
+//+------------------------------------------------------------------+
+ulong CFile::Tell(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileTell(m_handle));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Set position of pointer in file                                  |
+//+------------------------------------------------------------------+
+void CFile::Seek(const long offset,const ENUM_FILE_POSITION origin)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      FileSeek(m_handle,offset,origin);
+  }
+//+------------------------------------------------------------------+
+//| Flush data from the file buffer of input-output to disk          |
+//+------------------------------------------------------------------+
+void CFile::Flush(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      FileFlush(m_handle);
+  }
+//+------------------------------------------------------------------+
+//| Detect the end of file                                           |
+//+------------------------------------------------------------------+
+bool CFile::IsEnding(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileIsEnding(m_handle));
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Detect the end of string                                         |
+//+------------------------------------------------------------------+
+bool CFile::IsLineEnding(void)
+  {
+//--- checking
+   if(m_handle!=INVALID_HANDLE)
+      if((m_flags&FILE_BIN)==0)
+         return(FileIsLineEnding(m_handle));
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Deleting a file                                                  |
+//+------------------------------------------------------------------+
+void CFile::Delete(const string file_name,const int common_flag)
+  {
+//--- checking
+   if(file_name==m_name)
+     {
+      int flag=m_flags&FILE_COMMON;
+      if(flag==common_flag)
+         Close();
+     }
+//--- delete
+   FileDelete(file_name,common_flag);
+  }
+//+------------------------------------------------------------------+
+//| Check if file exists                                             |
+//+------------------------------------------------------------------+
+bool CFile::IsExist(const string file_name,const int common_flag)
+  {
+   return(FileIsExist(file_name,common_flag));
+  }
+//+------------------------------------------------------------------+
+//| Copying file                                                     |
+//+------------------------------------------------------------------+
+bool CFile::Copy(const string src_name,const int common_flag,const string dst_name,const int mode_flags)
+  {
+   return(FileCopy(src_name,common_flag,dst_name,mode_flags));
+  }
+//+------------------------------------------------------------------+
+//| Move/rename file                                                 |
+//+------------------------------------------------------------------+
+bool CFile::Move(const string src_name,const int common_flag,const string dst_name,const int mode_flags)
+  {
+   return(FileMove(src_name,common_flag,dst_name,mode_flags));
+  }
+//+------------------------------------------------------------------+
+//| Create folder                                                    |
+//+------------------------------------------------------------------+
+bool CFile::FolderCreate(const string folder_name)
+  {
+   return(::FolderCreate(folder_name,m_flags));
+  }
+//+------------------------------------------------------------------+
+//| Delete folder                                                    |
+//+------------------------------------------------------------------+
+bool CFile::FolderDelete(const string folder_name)
+  {
+   return(::FolderDelete(folder_name,m_flags));
+  }
+//+------------------------------------------------------------------+
+//| Clean folder                                                     |
+//+------------------------------------------------------------------+
+bool CFile::FolderClean(const string folder_name)
+  {
+   return(::FolderClean(folder_name,m_flags));
+  }
+//+------------------------------------------------------------------+
+//| Start search of files                                            |
+//+------------------------------------------------------------------+
+long CFile::FileFindFirst(const string file_filter,string &returned_filename)
+  {
+   return(::FileFindFirst(file_filter,returned_filename,m_flags));
+  }
+//+------------------------------------------------------------------+
+//| Continue search of files                                         |
+//+------------------------------------------------------------------+
+bool CFile::FileFindNext(const long search_handle,string &returned_filename)
+  {
+   return(::FileFindNext(search_handle,returned_filename));
+  }
+//+------------------------------------------------------------------+
+//| End search of files                                              |
+//+------------------------------------------------------------------+
+void CFile::FileFindClose(const long search_handle)
+  {
+   ::FileFindClose(search_handle);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Files/FileBin.mqh b/Include/Files/FileBin.mqh
new file mode 100644
index 0000000..f515603
--- /dev/null
+++ b/Include/Files/FileBin.mqh
@@ -0,0 +1,517 @@
+//+------------------------------------------------------------------+
+//|                                                      FileBin.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "File.mqh"
+//+------------------------------------------------------------------+
+//| Class CFileBin                                                   |
+//| Purpose: Class of operations with binary files                   |
+//|          Derives from class CFile                                |
+//+------------------------------------------------------------------+
+class CFileBin : public CFile
+  {
+public:
+                     CFileBin(void);
+                    ~CFileBin(void);
+   //--- methods for working with files
+   int               Open(const string file_name,const int open_flags);
+   //--- methods for writing data
+   uint              WriteChar(const char value);
+   uint              WriteShort(const short value);
+   uint              WriteInteger(const int value);
+   uint              WriteLong(const long value);
+   uint              WriteFloat(const float value);
+   uint              WriteDouble(const double value);
+   uint              WriteString(const string value);
+   uint              WriteString(const string value,const int size);
+   uint              WriteCharArray(const char &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              WriteShortArray(const short& array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              WriteIntegerArray(const int& array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              WriteLongArray(const long &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              WriteFloatArray(const float &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              WriteDoubleArray(const double &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   template<typename T>
+   uint              WriteArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   template<typename T>
+   uint              WriteStruct(T &data);
+   bool              WriteObject(CObject *object);
+   template<typename T>
+   uint              WriteEnum(const T value) { return(WriteInteger((int)value)); }
+   //--- methods for reading data
+   bool              ReadChar(char &value);
+   bool              ReadShort(short &value);
+   bool              ReadInteger(int &value);
+   bool              ReadLong(long &value);
+   bool              ReadFloat(float &value);
+   bool              ReadDouble(double &value);
+   bool              ReadString(string &value);
+   bool              ReadString(string &value,const int size);
+   uint              ReadCharArray(char &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              ReadShortArray(short& array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              ReadIntegerArray(int& array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              ReadLongArray(long &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              ReadFloatArray(float &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   uint              ReadDoubleArray(double &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   template<typename T>
+   uint              ReadArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   template<typename T>
+   uint              ReadStruct(T &data);
+   bool              ReadObject(CObject *object);
+   template<typename T>
+   bool              ReadEnum(T &value);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CFileBin::CFileBin(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CFileBin::~CFileBin(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Opening a binary file                                            |
+//+------------------------------------------------------------------+
+int CFileBin::Open(const string file_name,const int open_flags)
+  {
+   return(CFile::Open(file_name,open_flags|FILE_BIN));
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of char or uchar type                           |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteChar(const char value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteInteger(m_handle,value,sizeof(char)));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of short or ushort type                         |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteShort(const short value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteInteger(m_handle,value,sizeof(short)));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of int or uint type                             |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteInteger(const int value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteInteger(m_handle,value,sizeof(int)));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of long or ulong type                           |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteLong(const long value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteLong(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of float type                                   |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteFloat(const float value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteFloat(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of double type                                  |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteDouble(const double value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteDouble(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of string type                                  |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteString(const string value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      //--- size of string
+      int size=StringLen(value);
+      //--- write
+      if(FileWriteInteger(m_handle,size)==sizeof(int))
+         return(FileWriteString(m_handle,value,size));
+     }
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a part of string                                           |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteString(const string value,const int size)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteString(m_handle,value,size));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write array variables of type char or uchar                      |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteCharArray(const char &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of short or ushort type              |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteShortArray(const short &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of int or uint type                  |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteIntegerArray(const int &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of long or ulong type                |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteLongArray(const long &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of float type                        |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteFloatArray(const float &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of double type                       |
+//+------------------------------------------------------------------+
+uint CFileBin::WriteDoubleArray(const double &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of any type                          |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFileBin::WriteArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an structure                                               |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFileBin::WriteStruct(T &data)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteStruct(m_handle,data));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write data of an instance of the CObject class                   |
+//+------------------------------------------------------------------+
+bool CFileBin::WriteObject(CObject *object)
+  {
+//--- check handle & object
+   if(m_handle!=INVALID_HANDLE)
+      if(CheckPointer(object))
+         return(object.Save(m_handle));
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of char or uchar type                            |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadChar(char &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      value=(char)FileReadInteger(m_handle,sizeof(char));
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of short or ushort type                          |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadShort(short &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      value=(short)FileReadInteger(m_handle,sizeof(short));
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of int or uint type                              |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadInteger(int &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      value=FileReadInteger(m_handle,sizeof(int));
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of long or ulong type                            |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadLong(long &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      value=FileReadLong(m_handle);
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of float type                                    |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadFloat(float &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      value=FileReadFloat(m_handle);
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of double type                                   |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadDouble(double &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      value=FileReadDouble(m_handle);
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of string type                                   |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadString(string &value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      ResetLastError();
+      int size=FileReadInteger(m_handle);
+      if(GetLastError()==0)
+        {
+         value=FileReadString(m_handle,size);
+         return(size==StringLen(value));
+        }
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a part of string                                            |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadString(string &value,const int size)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      value=FileReadString(m_handle,size);
+      return(size==StringLen(value));
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of char or uchar type                 |
+//+------------------------------------------------------------------+
+uint CFileBin::ReadCharArray(char &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of short or ushort type               |
+//+------------------------------------------------------------------+
+uint CFileBin::ReadShortArray(short &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of int or uint type                   |
+//+------------------------------------------------------------------+
+uint CFileBin::ReadIntegerArray(int &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of long or ulong type                 |
+//+------------------------------------------------------------------+
+uint CFileBin::ReadLongArray(long &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of float type                         |
+//+------------------------------------------------------------------+
+uint CFileBin::ReadFloatArray(float &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of double type                        |
+//+------------------------------------------------------------------+
+uint CFileBin::ReadDoubleArray(double &array[],const int start_item,const int items_count)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of any type                           |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFileBin::ReadArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an structure                                                |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFileBin::ReadStruct(T &data)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadStruct(m_handle,data));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read data of an instance of the CObject class                    |
+//+------------------------------------------------------------------+
+bool CFileBin::ReadObject(CObject *object)
+  {
+//--- check handle & object
+   if(m_handle!=INVALID_HANDLE)
+      if(CheckPointer(object))
+         return(object.Load(m_handle));
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of an enumeration type                           |
+//+------------------------------------------------------------------+
+template<typename T>
+bool CFileBin::ReadEnum(T &value)
+  {
+   int val;
+   if(!ReadInteger(val))
+      return(false);
+//---
+   value=(T)val;
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Files/FilePipe.mqh b/Include/Files/FilePipe.mqh
new file mode 100644
index 0000000..23dffe4
--- /dev/null
+++ b/Include/Files/FilePipe.mqh
@@ -0,0 +1,347 @@
+//+------------------------------------------------------------------+
+//|                                                     FilePipe.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "File.mqh"
+//+------------------------------------------------------------------+
+//| Class CFilePipe                                                  |
+//| Purpose: Class of operations with binary files                   |
+//|          Derives from class CFile                                |
+//+------------------------------------------------------------------+
+class CFilePipe : public CFile
+  {
+public:
+                     CFilePipe(void);
+                    ~CFilePipe(void);
+   //--- methods for working with files
+   int               Open(const string file_name,const int open_flags);
+   //--- wait for incoming data
+   bool              WaitForRead(const ulong size);
+   //--- methods for writing data
+   template<typename T>
+   uint              WriteInteger(const T value);
+   uint              WriteLong(const long value);
+   uint              WriteFloat(const float value);
+   uint              WriteDouble(const double value);
+   uint              WriteString(const string value);
+   uint              WriteString(const string value,const int size);
+   template<typename T>
+   uint              WriteArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   template<typename T>
+   uint              WriteStruct(T &data);
+   bool              WriteObject(CObject *object);
+   template<typename T>
+   uint              WriteEnum(const T value) { return(WriteInteger((int)value)); }
+   //--- methods for reading data
+   template<typename T>
+   bool              ReadInteger(T &value);
+   bool              ReadLong(long &value);
+   bool              ReadFloat(float &value);
+   bool              ReadDouble(double &value);
+   bool              ReadString(string &value);
+   bool              ReadString(string &value,const int size);
+   template<typename T>
+   uint              ReadArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY);
+   template<typename T>
+   uint              ReadStruct(T &data);
+   bool              ReadObject(CObject *object);
+   template<typename T>
+   bool              ReadEnum(T &value);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CFilePipe::CFilePipe(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CFilePipe::~CFilePipe(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Opening a binary file                                            |
+//+------------------------------------------------------------------+
+int CFilePipe::Open(const string file_name,const int open_flags)
+  {
+   return(CFile::Open(file_name,open_flags|FILE_BIN));
+  }
+//+------------------------------------------------------------------+
+//| Wait for incoming data                                           |
+//+------------------------------------------------------------------+
+bool CFilePipe::WaitForRead(const ulong size)
+  {
+//--- check handle and stop flag
+   while(m_handle!=INVALID_HANDLE && !IsStopped())
+     {
+      //--- enought data?
+      if(FileSize(m_handle)>=size)
+         return(true);
+      //--- wait a little
+      Sleep(1);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of integer types                                |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFilePipe::WriteInteger(const T value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteInteger(m_handle,value,sizeof(T)));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of long or ulong type                           |
+//+------------------------------------------------------------------+
+uint CFilePipe::WriteLong(const long value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteLong(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of float type                                   |
+//+------------------------------------------------------------------+
+uint CFilePipe::WriteFloat(const float value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteFloat(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of double type                                  |
+//+------------------------------------------------------------------+
+uint CFilePipe::WriteDouble(const double value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteDouble(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a variable of string type                                  |
+//+------------------------------------------------------------------+
+uint CFilePipe::WriteString(const string value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+     {
+      //--- size of string
+      int size=StringLen(value);
+      //--- write
+      if(FileWriteInteger(m_handle,size)==sizeof(int))
+         return(FileWriteString(m_handle,value,size));
+     }
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write a part of string                                           |
+//+------------------------------------------------------------------+
+uint CFilePipe::WriteString(const string value,const int size)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteString(m_handle,value,size));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an array of variables of any type                          |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFilePipe::WriteArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write an structure                                               |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFilePipe::WriteStruct(T &data)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteStruct(m_handle,data));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Write data of an instance of the CObject class                   |
+//+------------------------------------------------------------------+
+bool CFilePipe::WriteObject(CObject *object)
+  {
+//--- check handle & object
+   if(m_handle!=INVALID_HANDLE)
+      if(CheckPointer(object))
+         return(object.Save(m_handle));
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of integer types                                 |
+//+------------------------------------------------------------------+
+template<typename T>
+bool CFilePipe::ReadInteger(T &value)
+  {
+//--- check for data
+   if(WaitForRead(sizeof(T)))
+     {
+      ResetLastError();
+      value=FileReadInteger(m_handle,sizeof(T));
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of long or ulong type                            |
+//+------------------------------------------------------------------+
+bool CFilePipe::ReadLong(long &value)
+  {
+//--- check handle
+   if(WaitForRead(sizeof(long)))
+     {
+      ResetLastError();
+      value=FileReadLong(m_handle);
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of float type                                    |
+//+------------------------------------------------------------------+
+bool CFilePipe::ReadFloat(float &value)
+  {
+//--- check for data
+   if(WaitForRead(sizeof(float)))
+     {
+      ResetLastError();
+      value=FileReadFloat(m_handle);
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of double type                                   |
+//+------------------------------------------------------------------+
+bool CFilePipe::ReadDouble(double &value)
+  {
+//--- check for data
+   if(WaitForRead(sizeof(double)))
+     {
+      ResetLastError();
+      value=FileReadDouble(m_handle);
+      return(GetLastError()==0);
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of string type                                   |
+//+------------------------------------------------------------------+
+bool CFilePipe::ReadString(string &value)
+  {
+//--- check for data
+   if(WaitForRead(sizeof(int)))
+     {
+      ResetLastError();
+      int size=FileReadInteger(m_handle);
+      if(GetLastError()==0)
+        {
+         //--- check for data
+         if(WaitForRead(size))
+           {
+            value=FileReadString(m_handle,size);
+            return(size==StringLen(value));
+           }
+        }
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a part of string                                            |
+//+------------------------------------------------------------------+
+bool CFilePipe::ReadString(string &value,const int size)
+  {
+//--- check for data
+   if(WaitForRead(size))
+     {
+      value=FileReadString(m_handle,size);
+      return(size==StringLen(value));
+     }
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read an array of variables of any type                           |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFilePipe::ReadArray(T &array[],const int start_item=0,const int items_count=WHOLE_ARRAY)
+  {
+//--- calculate size
+   uint size=ArraySize(array);
+   if(items_count!=WHOLE_ARRAY) size=items_count;
+//--- check for data
+   if(WaitForRead(size*sizeof(T)))
+      return(FileReadArray(m_handle,array,start_item,items_count));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read an structure                                                |
+//+------------------------------------------------------------------+
+template<typename T>
+uint CFilePipe::ReadStruct(T &data)
+  {
+//--- check for data
+   if(WaitForRead(sizeof(T)))
+      return(FileReadStruct(m_handle,data));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Read data of an instance of the CObject class                    |
+//+------------------------------------------------------------------+
+bool CFilePipe::ReadObject(CObject *object)
+  {
+//--- check for object & data
+   if(CheckPointer(object))
+      if(WaitForRead(sizeof(int))) // only 4 bytes!
+         return(object.Load(m_handle));
+//--- failure
+   return(false);
+  }
+//+------------------------------------------------------------------+
+//| Read a variable of an enumeration type                           |
+//+------------------------------------------------------------------+
+template<typename T>
+bool CFilePipe::ReadEnum(T &value)
+  {
+   int val;
+   if(!ReadInteger(val))
+      return(false);
+//---
+   value=(T)val;
+   return(true);
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Files/FileTxt.mqh b/Include/Files/FileTxt.mqh
new file mode 100644
index 0000000..a0dc1fa
--- /dev/null
+++ b/Include/Files/FileTxt.mqh
@@ -0,0 +1,64 @@
+//+------------------------------------------------------------------+
+//|                                                      FileTxt.mqh |
+//|                   Copyright 2009-2017, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+#include "File.mqh"
+//+------------------------------------------------------------------+
+//| Class CFileTxt                                                   |
+//| Purpose: Class of operations with text files.                    |
+//|          Derives from class CFile.                               |
+//+------------------------------------------------------------------+
+class CFileTxt : public CFile
+  {
+public:
+                     CFileTxt(void);
+                    ~CFileTxt(void);
+   //--- methods for working with files
+   int               Open(const string file_name,const int open_flags);
+   //--- methods to access data
+   uint              WriteString(const string value);
+   string            ReadString(void);
+  };
+//+------------------------------------------------------------------+
+//| Constructor                                                      |
+//+------------------------------------------------------------------+
+CFileTxt::CFileTxt(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Destructor                                                       |
+//+------------------------------------------------------------------+
+CFileTxt::~CFileTxt(void)
+  {
+  }
+//+------------------------------------------------------------------+
+//| Open the text file                                               |
+//+------------------------------------------------------------------+
+int CFileTxt::Open(const string file_name,const int open_flags)
+  {
+   return(CFile::Open(file_name,open_flags|FILE_TXT));
+  }
+//+------------------------------------------------------------------+
+//| Writing string to file                                           |
+//+------------------------------------------------------------------+
+uint CFileTxt::WriteString(const string value)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileWriteString(m_handle,value));
+//--- failure
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Reading string from file                                         |
+//+------------------------------------------------------------------+
+string CFileTxt::ReadString(void)
+  {
+//--- check handle
+   if(m_handle!=INVALID_HANDLE)
+      return(FileReadString(m_handle));
+//--- failure
+   return("");
+  }
+//+------------------------------------------------------------------+
diff --git a/Include/Tools/DateTime.mqh b/Include/Tools/DateTime.mqh
new file mode 100644
index 0000000..94d405b
--- /dev/null
+++ b/Include/Tools/DateTime.mqh
@@ -0,0 +1,581 @@
+//+------------------------------------------------------------------+
+//|                                                     DateTime.mqh |
+//|                   Copyright 2009-2015, MetaQuotes Software Corp. |
+//|                                              http://www.mql5.com |
+//+------------------------------------------------------------------+
+//+------------------------------------------------------------------+
+//| Structure CDateTime.                                             |
+//| Purpose: Working with dates and time.                            |
+//|         Extends the MqlDateTime structure.                       |
+//+------------------------------------------------------------------+
+struct CDateTime : public MqlDateTime
+  {
+   //--- additional information
+   string            MonthName(const int num) const;
+   string            ShortMonthName(const int num) const;
+   string            DayName(const int num) const;
+   string            ShortDayName(const int num) const;
+   string            MonthName(void)               const { return(MonthName(mon));            }
+   string            ShortMonthName(void)          const { return(ShortMonthName(mon));       }
+   string            DayName(void)                 const { return(DayName(day_of_week));      }
+   string            ShortDayName(void)            const { return(ShortDayName(day_of_week)); }
+   int               DaysInMonth(void) const;
+   //--- data access
+   datetime          DateTime(void)                      { return(StructToTime(this));        }
+   void              DateTime(const datetime value)      { TimeToStruct(value,this);          }
+   void              DateTime(const MqlDateTime& value)  { this=value;                        }
+   void              Date(const datetime value);
+   void              Date(const MqlDateTime &value);
+   void              Time(const datetime value);
+   void              Time(const MqlDateTime &value);
+   //--- settings
+   void              Sec(const int value);
+   void              Min(const int value);
+   void              Hour(const int value);
+   void              Day(const int value);
+   void              Mon(const int value);
+   void              Year(const int value);
+   //--- increments
+   void              SecDec(int delta=1);
+   void              SecInc(int delta=1);
+   void              MinDec(int delta=1);
+   void              MinInc(int delta=1);
+   void              HourDec(int delta=1);
+   void              HourInc(int delta=1);
+   void              DayDec(int delta=1);
+   void              DayInc(int delta=1);
+   void              MonDec(int delta=1);
+   void              MonInc(int delta=1);
+   void              YearDec(int delta=1);
+   void              YearInc(int delta=1);
+   //--- check
+   void              DayCheck(void);
+  };
+//+------------------------------------------------------------------+
+//| Gets month name                                                  |
+//+------------------------------------------------------------------+
+string CDateTime::MonthName(const int num) const
+  {
+   switch(num)
+     {
+      case  1: return("January");
+      case  2: return("February");
+      case  3: return("March");
+      case  4: return("April");
+      case  5: return("May");
+      case  6: return("June");
+      case  7: return("July");
+      case  8: return("August");
+      case  9: return("September");
+      case 10: return("October");
+      case 11: return("November");
+      case 12: return("December");
+     }
+//---
+   return("Bad month");
+  }
+//+------------------------------------------------------------------+
+//| Gets short name of month                                         |
+//+------------------------------------------------------------------+
+string CDateTime::ShortMonthName(const int num) const
+  {
+   switch(num)
+     {
+      case  1: return("jan");
+      case  2: return("feb");
+      case  3: return("mar");
+      case  4: return("apr");
+      case  5: return("may");
+      case  6: return("jun");
+      case  7: return("jul");
+      case  8: return("aug");
+      case  9: return("sep");
+      case 10: return("oct");
+      case 11: return("nov");
+      case 12: return("dec");
+     }
+//---
+   return("Bad month");
+  }
+//+------------------------------------------------------------------+
+//| Gets name of week day                                            |
+//+------------------------------------------------------------------+
+string CDateTime::DayName(const int num) const
+  {
+   switch(num)
+     {
+      case 0: return("Sunday");
+      case 1: return("Monday");
+      case 2: return("Tuesday");
+      case 3: return("Wednesday");
+      case 4: return("Thursday");
+      case 5: return("Friday");
+      case 6: return("Saturday");
+     }
+//---
+   return("Bad day of week");
+  }
+//+------------------------------------------------------------------+
+//| Gets short name of week day                                      |
+//+------------------------------------------------------------------+
+string CDateTime::ShortDayName(const int num) const
+  {
+   switch(num)
+     {
+      case 0: return("Su");
+      case 1: return("Mo");
+      case 2: return("Tu");
+      case 3: return("We");
+      case 4: return("Th");
+      case 5: return("Fr");
+      case 6: return("Sa");
+     }
+//---
+   return("Bad day of week");
+  }
+//+------------------------------------------------------------------+
+//| Gets number of days in month                                     |
+//+------------------------------------------------------------------+
+int CDateTime::DaysInMonth(void) const
+  {
+   int leap_year;
+//---
+   switch(mon)
+     {
+      case  1:
+      case  3:
+      case  5:
+      case  7:
+      case  8:
+      case 10:
+      case 12:
+         return(31);
+      case  2:
+         leap_year=year;
+         if(year%100==0)
+            leap_year/=100;
+         return((leap_year%4==0)? 29 : 28);
+      case  4:
+      case  6:
+      case  9:
+      case 11:
+         return(30);
+     }
+//---
+   return(0);
+  }
+//+------------------------------------------------------------------+
+//| Sets date                                                        |
+//+------------------------------------------------------------------+
+void CDateTime::Date(const datetime value)
+  {
+   MqlDateTime dt;
+//--- convert to structure
+   TimeToStruct(value,dt);
+//--- set
+   Date(dt);
+  }
+//+------------------------------------------------------------------+
+//| Sets date                                                        |
+//+------------------------------------------------------------------+
+void CDateTime::Date(const MqlDateTime &value)
+  {
+   day =value.day;
+   mon =value.mon;
+   year=value.year;
+//--- check if day is correct
+   DayCheck();
+  }
+//+------------------------------------------------------------------+
+//| Sets time                                                        |
+//+------------------------------------------------------------------+
+void CDateTime::Time(const datetime value)
+  {
+   MqlDateTime dt;
+//--- convert to structure
+   TimeToStruct(value,dt);
+//--- set
+   Time(dt);
+  }
+//+------------------------------------------------------------------+
+//| Sets time                                                        |
+//+------------------------------------------------------------------+
+void CDateTime::Time(const MqlDateTime &value)
+  {
+   hour=value.hour;
+   min =value.min;
+   sec =value.sec;
+  }
+//+------------------------------------------------------------------+
+//| Sets seconds                                                     |
+//+------------------------------------------------------------------+
+void CDateTime::Sec(const int value)
+  {
+//--- check and set
+   if(value>=0 && value<60)
+      sec=value;
+  }
+//+------------------------------------------------------------------+
+//| Sets minutes                                                     |
+//+------------------------------------------------------------------+
+void CDateTime::Min(const int value)
+  {
+//--- check and set
+   if(value>=0 && value<60)
+      min=value;
+  }
+//+------------------------------------------------------------------+
+//| Sets hours                                                       |
+//+------------------------------------------------------------------+
+void CDateTime::Hour(const int value)
+  {
+//--- check and set
+   if(value>=0 && value<24)
+      hour=value;
+  }
+//+------------------------------------------------------------------+
+//| Sets day of month                                                |
+//+------------------------------------------------------------------+
+void CDateTime::Day(const int value)
+  {
+//--- check and set
+   if(value>0 && value<=DaysInMonth())
+     {
+      day=value;
+      //--- check if day is correct
+      DayCheck();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets month                                                       |
+//+------------------------------------------------------------------+
+void CDateTime::Mon(const int value)
+  {
+//--- check and set
+   if(value>0 && value<=12)
+     {
+      mon=value;
+      //--- check if day is correct
+      DayCheck();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Sets year                                                        |
+//+------------------------------------------------------------------+
+void CDateTime::Year(const int value)
+  {
+//--- check and set
+   if(value>=1970)
+     {
+      year=value;
+      //--- check if day is correct
+      DayCheck();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Subtracts specified number of seconds                            |
+//+------------------------------------------------------------------+
+void CDateTime::SecDec(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      SecInc(-delta);
+      return;
+     }
+//--- check if subtract from upper number positions
+   if(delta>60)
+     {
+      MinDec(delta/60);
+      delta%=60;
+     }
+   sec-=delta;
+   if(sec<0)
+     {
+      sec+=60;
+      MinDec();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Adds specified number of seconds                                 |
+//+------------------------------------------------------------------+
+void CDateTime::SecInc(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      SecDec(-delta);
+      return;
+     }
+//--- check if add to upper number positions
+   if(delta>60)
+     {
+      MinInc(delta/60);
+      delta%=60;
+     }
+   sec+=delta;
+   if(sec>=60)
+     {
+      sec-=60;
+      MinInc();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Subtracts specified number of minutes                            |
+//+------------------------------------------------------------------+
+void CDateTime::MinDec(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      MinInc(-delta);
+      return;
+     }
+//--- check if subtract from upper number positions
+   if(delta>60)
+     {
+      HourDec(delta/60);
+      delta%=60;
+     }
+   min-=delta;
+   if(min<0)
+     {
+      min+=60;
+      HourDec();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Adds specified number of minutes                                 |
+//+------------------------------------------------------------------+
+void CDateTime::MinInc(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      MinDec(-delta);
+      return;
+     }
+//--- check if add to upper number positions
+   if(delta>60)
+     {
+      HourInc(delta/60);
+      delta%=60;
+     }
+   min+=delta;
+   if(min>=60)
+     {
+      min-=60;
+      HourInc();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Subtracts specified number of hours                              |
+//+------------------------------------------------------------------+
+void CDateTime::HourDec(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      HourInc(-delta);
+      return;
+     }
+//--- check if subtract from upper number positions
+   if(delta>24)
+     {
+      DayDec(delta/24);
+      delta%=24;
+     }
+   hour-=delta;
+   if(hour<0)
+     {
+      hour+=24;
+      DayDec();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Adds specified number of hours                                   |
+//+------------------------------------------------------------------+
+void CDateTime::HourInc(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      HourDec(-delta);
+      return;
+     }
+//--- check if add to upper number positions
+   if(delta>24)
+     {
+      DayInc(delta/24);
+      delta%=24;
+     }
+   hour+=delta;
+   if(hour>=24)
+     {
+      hour-=24;
+      DayInc();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Subtracts specified number of days                               |
+//+------------------------------------------------------------------+
+void CDateTime::DayDec(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      DayInc(-delta);
+      return;
+     }
+//--- uncertain condition, as the number of days in month can differ
+   while(day<=delta)
+     {
+      delta-=day;
+      MonDec();
+      day=DaysInMonth();
+     }
+   day-=delta;
+//--- check if day is correct
+   DayCheck();
+  }
+//+------------------------------------------------------------------+
+//| Adds specified number of days                                    |
+//+------------------------------------------------------------------+
+void CDateTime::DayInc(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      DayDec(-delta);
+      return;
+     }
+//--- uncertain condition, as the number of days in month can differ
+   while(DaysInMonth()-day<delta)
+     {
+      delta-=DaysInMonth()-day+1;
+      MonInc();
+      day=1;
+     }
+   day+=delta;
+//--- check if day is correct
+   DayCheck();
+  }
+//+------------------------------------------------------------------+
+//| Subtracts specified number of months                             |
+//+------------------------------------------------------------------+
+void CDateTime::MonDec(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      MonInc(-delta);
+      return;
+     }
+//--- check if subtract from upper number positions
+   if(delta>12)
+     {
+      YearDec(delta/12);
+      delta%=12;
+     }
+   mon-=delta;
+   if(mon<=0)
+     {
+      mon+=12;
+      YearDec();
+     }
+//--- check if day is correct
+   DayCheck();
+  }
+//+------------------------------------------------------------------+
+//| Adds specified number of months                                  |
+//+------------------------------------------------------------------+
+void CDateTime::MonInc(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta==0)
+      return;
+//--- if increment is negative - inverse the operation
+   if(delta<0)
+     {
+      MonDec(-delta);
+      return;
+     }
+//--- check if add to upper number positions
+   if(delta>12)
+     {
+      YearInc(delta/12);
+      delta%=12;
+     }
+   mon+=delta;
+   if(mon>12)
+     {
+      mon-=12;
+      YearInc();
+     }
+//--- check if day is correct
+   DayCheck();
+  }
+//+------------------------------------------------------------------+
+//| Subtracts specified number of years                              |
+//+------------------------------------------------------------------+
+void CDateTime::YearDec(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta!=0)
+     {
+      year-=delta;
+      //--- check if day is correct
+      DayCheck();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Adds specified number of years                                   |
+//+------------------------------------------------------------------+
+void CDateTime::YearInc(int delta)
+  {
+//--- if increment is 0 - exit
+   if(delta!=0)
+     {
+      year+=delta;
+      //--- check if day is correct
+      DayCheck();
+     }
+  }
+//+------------------------------------------------------------------+
+//| Checks if day number is correct                                  |
+//+------------------------------------------------------------------+
+void CDateTime::DayCheck(void)
+  {
+   if(day>DaysInMonth())
+      day=DaysInMonth();
+//--- this is required to get day of week and day of year
+   TimeToStruct(StructToTime(this),this);
+  }
+//+------------------------------------------------------------------+